diff --git a/25_03_11/estis_vizsgafeladat_2024.zip b/25_03_11/estis_vizsgafeladat_2024.zip new file mode 100644 index 00000000..8fbc5d04 Binary files /dev/null and b/25_03_11/estis_vizsgafeladat_2024.zip differ diff --git a/25_03_11/frontend_vizsgafeladat/backend/index.js b/25_03_11/frontend_vizsgafeladat/backend/index.js new file mode 100644 index 00000000..3fdc1661 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/index.js @@ -0,0 +1,222 @@ +const express=require('express'); +const cors=require('cors'); +const sqlite3=require('sqlite3'); + +const app=express(); +const db=new sqlite3.Database('./webshop.db'); +app.use(cors()); +app.use(express.json()); +app.use(express.urlencoded({extended:true})); + +app.listen(8000,()=>{console.log("Running")}); + +app.get('/',(req,res)=>{ + res.send("Webshop"); +}) + +app.get('/vevok',(req,res)=>{ + db.all("select * from vevok" + ,(error,rows)=>{ + if(error){ + res.status(400).json({message:error.message}); + } + res.status(200).json(rows); + + }); +}); + +app.get('/termekek',(req,res)=>{ + db.all("select * from termekek" + ,(error,rows)=>{ + if(error){ + res.status(400).json({message:error.message}); + } + res.status(200).json(rows); + + }); + +}); + +app.post('/vevok',(req,res)=>{ + const {nev,iranyitoszam,telepules,utcahazszam}=req.body; + db.run("insert into vevok (nev,iranyitoszam,telepules,utcahazszam) values(?,?,?,?)" + ,[nev,iranyitoszam,telepules,utcahazszam] + ,function (error){ + if(error){ + res.status(400).json({message:error.message}); + } + + res.status(201).json({message:"Beszúrás rendben "+this.lastID}); + + + }); +}); + +app.post('/termekek',(req,res)=>{ + const {megnevezes,ar}=req.body; + db.run("insert into termekek (megnevezes,ar) values(?,?)" + ,[megnevezes,ar] + ,function (error){ + if(error){ + res.status(400).json({message:error.message}); + } + + res.status(201).json({message:"Beszúrás rendben "+this.lastID}); + + + }); + +}) + +app.delete('/termekek/:id',(req,res)=>{ + const id=req.params.id; + db.run("delete from termekek where id=?" + ,[id] + ,function (error){ + + if(error){ + res.status(404).json({message:error.message}); + } + console.log(this.changes); + if(this.changes==1){ + res.status(200).json({message:"Törölve!"}); + } else { + res.status(200).json({message:"Nincs ilyen Id"}); + } + + }); + +}); + +app.delete('/vevok/:id',(req,res)=>{ + const id=req.params.id; + db.run("delete from vevok where id=?" + ,[id] + ,function (error){ + + if(error){ + res.status(404).json({message:error.message}); + } + console.log(this.changes); + if(this.changes==1){ + res.status(200).json({message:"Törölve!"}); + } else { + res.status(200).json({message:"Nincs ilyen Id"}); + } + + }); + +}); + +app.get('/vevoszamlai/:vevoid',(req,res)=>{ + const vevoid=req.params.vevoid; + + db.all("select szamlaszam,kelt,teljesites,vevoid,v.nev from szamlafej,vevok as v where vevoid=?" + ,[vevoid] + ,(error,rows)=>{ + if(error){ + res.status(400).json({message:error.message}); + } + if(rows.length>0){ + res.status(200).json(rows); + } else { + res.status(200).json({message:"A vevőhöz nem tartoznak számlák"}); + } + + + }); + +}); + +app.get('/szamla/',(req,res)=>{ + const szamlaszam=req.query.szamlaszam; + db.all(`select sf.szamlaszam,sf.kelt,sf.teljesites,vevok.nev as "vevo_neve" from szamlafej as sf,vevok where sf.vevoid=vevok.id and sf.szamlaszam=?`, + [szamlaszam] + + ,(error,rows)=>{ + if(error){ + res.status(400).json({message:error.message}); + } + if(rows.length>0){ + res.status(200).json(rows); + } else { + res.status(200).json({message:"Nincs ilyen!"}); + } + + + }); + + +}); + +app.get('/vevoszamlak_old/',(req,res)=>{ + const vevoid=req.query.vevoid; + db.all(`select st.szamlafejid,st.mennyiseg,st.mennyisegiegyseg,sf.szamlaszam,v.nev,t.megnevezes from szamlatetel as st, szamlafej as sf,vevok as v ,termekek as t where st.szamlafejid=sf.id and st.termekid=t.id and sf.vevoid=v.id and v.id=?` + ,[vevoid] + ,(error,rows)=>{ + if(error){ + res.status(400).json({message:error.message}); + } + if(rows.length>0){ + + res.status(200).json(rows); + } else { + res.status(200).json({message:"Nincs ilyen!"}); + } + + + }); + + + +}); + +app.get('/vevoszamlak/',(req,res)=>{ + const vevoid=req.query.vevoid; + + + db.serialize(()=>{ + db.all("select nev,iranyitoszam,telepules,utcahazszam from vevok where id=?",[vevoid],(err,rows1)=>{ + if(err){ + res.status(500).json({message:"Adatbázis hiba!"}); + return; + } + + db.all(`select st.szamlafejid,st.mennyiseg,st.mennyisegiegyseg,sf.szamlaszam,t.megnevezes from szamlatetel as st, szamlafej as sf,vevok as v ,termekek as t where st.szamlafejid=sf.id and st.termekid=t.id and sf.vevoid=v.id and v.id=?` + ,[vevoid] + ,(error,rows2)=>{ + if(error){ + res.status(400).json({message:error.message}); + return; + } + + if(rows1.length>0){ + + res.status(200).json(Object.assign({"vevo":rows1[0]},{"vevo_szamlai":rows2})); + //res.status(200).json({vevo:rows1[0],vevoszamlak:rows2}); + } else { + res.status(200).json({message:"Nincs ilyen felhasználó!"}); + } + + }); + + + + }); + + + + + + + + }); + + + + + + + + +}); diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/color-support b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/color-support new file mode 100644 index 00000000..8bf9de45 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/color-support @@ -0,0 +1,15 @@ +#!/bin/sh +basedir=$(dirname "$(echo "$0" | sed -e 's,\\,/,g')") + +case `uname` in + *CYGWIN*|*MINGW*|*MSYS*) basedir=`cygpath -w "$basedir"`;; +esac + +if [ -x "$basedir/node" ]; then + "$basedir/node" "$basedir/../color-support/bin.js" "$@" + ret=$? +else + node "$basedir/../color-support/bin.js" "$@" + ret=$? +fi +exit $ret diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/color-support.cmd b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/color-support.cmd new file mode 100644 index 00000000..4ad98314 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/color-support.cmd @@ -0,0 +1,17 @@ +@ECHO off +SETLOCAL +CALL :find_dp0 + +IF EXIST "%dp0%\node.exe" ( + SET "_prog=%dp0%\node.exe" +) ELSE ( + SET "_prog=node" + SET PATHEXT=%PATHEXT:;.JS;=;% +) + +"%_prog%" "%dp0%\..\color-support\bin.js" %* +ENDLOCAL +EXIT /b %errorlevel% +:find_dp0 +SET dp0=%~dp0 +EXIT /b diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/color-support.ps1 b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/color-support.ps1 new file mode 100644 index 00000000..bbca6c64 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/color-support.ps1 @@ -0,0 +1,18 @@ +#!/usr/bin/env pwsh +$basedir=Split-Path $MyInvocation.MyCommand.Definition -Parent + +$exe="" +if ($PSVersionTable.PSVersion -lt "6.0" -or $IsWindows) { + # Fix case when both the Windows and Linux builds of Node + # are installed in the same directory + $exe=".exe" +} +$ret=0 +if (Test-Path "$basedir/node$exe") { + & "$basedir/node$exe" "$basedir/../color-support/bin.js" $args + $ret=$LASTEXITCODE +} else { + & "node$exe" "$basedir/../color-support/bin.js" $args + $ret=$LASTEXITCODE +} +exit $ret diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/is-ci b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/is-ci new file mode 100644 index 00000000..e79342ff --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/is-ci @@ -0,0 +1,15 @@ +#!/bin/sh +basedir=$(dirname "$(echo "$0" | sed -e 's,\\,/,g')") + +case `uname` in + *CYGWIN*|*MINGW*|*MSYS*) basedir=`cygpath -w "$basedir"`;; +esac + +if [ -x "$basedir/node" ]; then + "$basedir/node" "$basedir/../is-ci/bin.js" "$@" + ret=$? +else + node "$basedir/../is-ci/bin.js" "$@" + ret=$? +fi +exit $ret diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/is-ci.cmd b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/is-ci.cmd new file mode 100644 index 00000000..e3276c08 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/is-ci.cmd @@ -0,0 +1,17 @@ +@ECHO off +SETLOCAL +CALL :find_dp0 + +IF EXIST "%dp0%\node.exe" ( + SET "_prog=%dp0%\node.exe" +) ELSE ( + SET "_prog=node" + SET PATHEXT=%PATHEXT:;.JS;=;% +) + +"%_prog%" "%dp0%\..\is-ci\bin.js" %* +ENDLOCAL +EXIT /b %errorlevel% +:find_dp0 +SET dp0=%~dp0 +EXIT /b diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/is-ci.ps1 b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/is-ci.ps1 new file mode 100644 index 00000000..3fe23403 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/is-ci.ps1 @@ -0,0 +1,18 @@ +#!/usr/bin/env pwsh +$basedir=Split-Path $MyInvocation.MyCommand.Definition -Parent + +$exe="" +if ($PSVersionTable.PSVersion -lt "6.0" -or $IsWindows) { + # Fix case when both the Windows and Linux builds of Node + # are installed in the same directory + $exe=".exe" +} +$ret=0 +if (Test-Path "$basedir/node$exe") { + & "$basedir/node$exe" "$basedir/../is-ci/bin.js" $args + $ret=$LASTEXITCODE +} else { + & "node$exe" "$basedir/../is-ci/bin.js" $args + $ret=$LASTEXITCODE +} +exit $ret diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/mime b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/mime new file mode 100644 index 00000000..91e5e16a --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/mime @@ -0,0 +1,15 @@ +#!/bin/sh +basedir=$(dirname "$(echo "$0" | sed -e 's,\\,/,g')") + +case `uname` in + *CYGWIN*|*MINGW*|*MSYS*) basedir=`cygpath -w "$basedir"`;; +esac + +if [ -x "$basedir/node" ]; then + "$basedir/node" "$basedir/../mime/cli.js" "$@" + ret=$? +else + node "$basedir/../mime/cli.js" "$@" + ret=$? +fi +exit $ret diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/mime.cmd b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/mime.cmd new file mode 100644 index 00000000..746a2798 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/mime.cmd @@ -0,0 +1,17 @@ +@ECHO off +SETLOCAL +CALL :find_dp0 + +IF EXIST "%dp0%\node.exe" ( + SET "_prog=%dp0%\node.exe" +) ELSE ( + SET "_prog=node" + SET PATHEXT=%PATHEXT:;.JS;=;% +) + +"%_prog%" "%dp0%\..\mime\cli.js" %* +ENDLOCAL +EXIT /b %errorlevel% +:find_dp0 +SET dp0=%~dp0 +EXIT /b diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/mime.ps1 b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/mime.ps1 new file mode 100644 index 00000000..a6f6f470 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/mime.ps1 @@ -0,0 +1,18 @@ +#!/usr/bin/env pwsh +$basedir=Split-Path $MyInvocation.MyCommand.Definition -Parent + +$exe="" +if ($PSVersionTable.PSVersion -lt "6.0" -or $IsWindows) { + # Fix case when both the Windows and Linux builds of Node + # are installed in the same directory + $exe=".exe" +} +$ret=0 +if (Test-Path "$basedir/node$exe") { + & "$basedir/node$exe" "$basedir/../mime/cli.js" $args + $ret=$LASTEXITCODE +} else { + & "node$exe" "$basedir/../mime/cli.js" $args + $ret=$LASTEXITCODE +} +exit $ret diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/mkdirp b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/mkdirp new file mode 100644 index 00000000..bcd333f4 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/mkdirp @@ -0,0 +1,15 @@ +#!/bin/sh +basedir=$(dirname "$(echo "$0" | sed -e 's,\\,/,g')") + +case `uname` in + *CYGWIN*|*MINGW*|*MSYS*) basedir=`cygpath -w "$basedir"`;; +esac + +if [ -x "$basedir/node" ]; then + "$basedir/node" "$basedir/../mkdirp/bin/cmd.js" "$@" + ret=$? +else + node "$basedir/../mkdirp/bin/cmd.js" "$@" + ret=$? +fi +exit $ret diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/mkdirp.cmd b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/mkdirp.cmd new file mode 100644 index 00000000..c2c9350b --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/mkdirp.cmd @@ -0,0 +1,17 @@ +@ECHO off +SETLOCAL +CALL :find_dp0 + +IF EXIST "%dp0%\node.exe" ( + SET "_prog=%dp0%\node.exe" +) ELSE ( + SET "_prog=node" + SET PATHEXT=%PATHEXT:;.JS;=;% +) + +"%_prog%" "%dp0%\..\mkdirp\bin\cmd.js" %* +ENDLOCAL +EXIT /b %errorlevel% +:find_dp0 +SET dp0=%~dp0 +EXIT /b diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/mkdirp.ps1 b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/mkdirp.ps1 new file mode 100644 index 00000000..35ce6907 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/mkdirp.ps1 @@ -0,0 +1,18 @@ +#!/usr/bin/env pwsh +$basedir=Split-Path $MyInvocation.MyCommand.Definition -Parent + +$exe="" +if ($PSVersionTable.PSVersion -lt "6.0" -or $IsWindows) { + # Fix case when both the Windows and Linux builds of Node + # are installed in the same directory + $exe=".exe" +} +$ret=0 +if (Test-Path "$basedir/node$exe") { + & "$basedir/node$exe" "$basedir/../mkdirp/bin/cmd.js" $args + $ret=$LASTEXITCODE +} else { + & "node$exe" "$basedir/../mkdirp/bin/cmd.js" $args + $ret=$LASTEXITCODE +} +exit $ret diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/node-gyp b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/node-gyp new file mode 100644 index 00000000..68303f94 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/node-gyp @@ -0,0 +1,15 @@ +#!/bin/sh +basedir=$(dirname "$(echo "$0" | sed -e 's,\\,/,g')") + +case `uname` in + *CYGWIN*|*MINGW*|*MSYS*) basedir=`cygpath -w "$basedir"`;; +esac + +if [ -x "$basedir/node" ]; then + "$basedir/node" "$basedir/../node-gyp/bin/node-gyp.js" "$@" + ret=$? +else + node "$basedir/../node-gyp/bin/node-gyp.js" "$@" + ret=$? +fi +exit $ret diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/node-gyp.cmd b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/node-gyp.cmd new file mode 100644 index 00000000..90254177 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/node-gyp.cmd @@ -0,0 +1,17 @@ +@ECHO off +SETLOCAL +CALL :find_dp0 + +IF EXIST "%dp0%\node.exe" ( + SET "_prog=%dp0%\node.exe" +) ELSE ( + SET "_prog=node" + SET PATHEXT=%PATHEXT:;.JS;=;% +) + +"%_prog%" "%dp0%\..\node-gyp\bin\node-gyp.js" %* +ENDLOCAL +EXIT /b %errorlevel% +:find_dp0 +SET dp0=%~dp0 +EXIT /b diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/node-gyp.ps1 b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/node-gyp.ps1 new file mode 100644 index 00000000..53678458 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/node-gyp.ps1 @@ -0,0 +1,18 @@ +#!/usr/bin/env pwsh +$basedir=Split-Path $MyInvocation.MyCommand.Definition -Parent + +$exe="" +if ($PSVersionTable.PSVersion -lt "6.0" -or $IsWindows) { + # Fix case when both the Windows and Linux builds of Node + # are installed in the same directory + $exe=".exe" +} +$ret=0 +if (Test-Path "$basedir/node$exe") { + & "$basedir/node$exe" "$basedir/../node-gyp/bin/node-gyp.js" $args + $ret=$LASTEXITCODE +} else { + & "node$exe" "$basedir/../node-gyp/bin/node-gyp.js" $args + $ret=$LASTEXITCODE +} +exit $ret diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/node-pre-gyp b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/node-pre-gyp new file mode 100644 index 00000000..b44cce22 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/node-pre-gyp @@ -0,0 +1,15 @@ +#!/bin/sh +basedir=$(dirname "$(echo "$0" | sed -e 's,\\,/,g')") + +case `uname` in + *CYGWIN*|*MINGW*|*MSYS*) basedir=`cygpath -w "$basedir"`;; +esac + +if [ -x "$basedir/node" ]; then + "$basedir/node" "$basedir/../@mapbox/node-pre-gyp/bin/node-pre-gyp" "$@" + ret=$? +else + node "$basedir/../@mapbox/node-pre-gyp/bin/node-pre-gyp" "$@" + ret=$? +fi +exit $ret diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/node-pre-gyp.cmd b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/node-pre-gyp.cmd new file mode 100644 index 00000000..38976362 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/node-pre-gyp.cmd @@ -0,0 +1,17 @@ +@ECHO off +SETLOCAL +CALL :find_dp0 + +IF EXIST "%dp0%\node.exe" ( + SET "_prog=%dp0%\node.exe" +) ELSE ( + SET "_prog=node" + SET PATHEXT=%PATHEXT:;.JS;=;% +) + +"%_prog%" "%dp0%\..\@mapbox\node-pre-gyp\bin\node-pre-gyp" %* +ENDLOCAL +EXIT /b %errorlevel% +:find_dp0 +SET dp0=%~dp0 +EXIT /b diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/node-pre-gyp.ps1 b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/node-pre-gyp.ps1 new file mode 100644 index 00000000..c8b51258 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/node-pre-gyp.ps1 @@ -0,0 +1,18 @@ +#!/usr/bin/env pwsh +$basedir=Split-Path $MyInvocation.MyCommand.Definition -Parent + +$exe="" +if ($PSVersionTable.PSVersion -lt "6.0" -or $IsWindows) { + # Fix case when both the Windows and Linux builds of Node + # are installed in the same directory + $exe=".exe" +} +$ret=0 +if (Test-Path "$basedir/node$exe") { + & "$basedir/node$exe" "$basedir/../@mapbox/node-pre-gyp/bin/node-pre-gyp" $args + $ret=$LASTEXITCODE +} else { + & "node$exe" "$basedir/../@mapbox/node-pre-gyp/bin/node-pre-gyp" $args + $ret=$LASTEXITCODE +} +exit $ret diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/node-which b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/node-which new file mode 100644 index 00000000..cd9503c8 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/node-which @@ -0,0 +1,15 @@ +#!/bin/sh +basedir=$(dirname "$(echo "$0" | sed -e 's,\\,/,g')") + +case `uname` in + *CYGWIN*|*MINGW*|*MSYS*) basedir=`cygpath -w "$basedir"`;; +esac + +if [ -x "$basedir/node" ]; then + "$basedir/node" "$basedir/../which/bin/node-which" "$@" + ret=$? +else + node "$basedir/../which/bin/node-which" "$@" + ret=$? +fi +exit $ret diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/node-which.cmd b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/node-which.cmd new file mode 100644 index 00000000..7060445d --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/node-which.cmd @@ -0,0 +1,17 @@ +@ECHO off +SETLOCAL +CALL :find_dp0 + +IF EXIST "%dp0%\node.exe" ( + SET "_prog=%dp0%\node.exe" +) ELSE ( + SET "_prog=node" + SET PATHEXT=%PATHEXT:;.JS;=;% +) + +"%_prog%" "%dp0%\..\which\bin\node-which" %* +ENDLOCAL +EXIT /b %errorlevel% +:find_dp0 +SET dp0=%~dp0 +EXIT /b diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/node-which.ps1 b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/node-which.ps1 new file mode 100644 index 00000000..60d6560f --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/node-which.ps1 @@ -0,0 +1,18 @@ +#!/usr/bin/env pwsh +$basedir=Split-Path $MyInvocation.MyCommand.Definition -Parent + +$exe="" +if ($PSVersionTable.PSVersion -lt "6.0" -or $IsWindows) { + # Fix case when both the Windows and Linux builds of Node + # are installed in the same directory + $exe=".exe" +} +$ret=0 +if (Test-Path "$basedir/node$exe") { + & "$basedir/node$exe" "$basedir/../which/bin/node-which" $args + $ret=$LASTEXITCODE +} else { + & "node$exe" "$basedir/../which/bin/node-which" $args + $ret=$LASTEXITCODE +} +exit $ret diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/nodemon b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/nodemon new file mode 100644 index 00000000..439386d9 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/nodemon @@ -0,0 +1,15 @@ +#!/bin/sh +basedir=$(dirname "$(echo "$0" | sed -e 's,\\,/,g')") + +case `uname` in + *CYGWIN*|*MINGW*|*MSYS*) basedir=`cygpath -w "$basedir"`;; +esac + +if [ -x "$basedir/node" ]; then + "$basedir/node" "$basedir/../nodemon/bin/nodemon.js" "$@" + ret=$? +else + node "$basedir/../nodemon/bin/nodemon.js" "$@" + ret=$? +fi +exit $ret diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/nodemon.cmd b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/nodemon.cmd new file mode 100644 index 00000000..2ef28880 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/nodemon.cmd @@ -0,0 +1,17 @@ +@ECHO off +SETLOCAL +CALL :find_dp0 + +IF EXIST "%dp0%\node.exe" ( + SET "_prog=%dp0%\node.exe" +) ELSE ( + SET "_prog=node" + SET PATHEXT=%PATHEXT:;.JS;=;% +) + +"%_prog%" "%dp0%\..\nodemon\bin\nodemon.js" %* +ENDLOCAL +EXIT /b %errorlevel% +:find_dp0 +SET dp0=%~dp0 +EXIT /b diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/nodemon.ps1 b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/nodemon.ps1 new file mode 100644 index 00000000..413e5cb8 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/nodemon.ps1 @@ -0,0 +1,18 @@ +#!/usr/bin/env pwsh +$basedir=Split-Path $MyInvocation.MyCommand.Definition -Parent + +$exe="" +if ($PSVersionTable.PSVersion -lt "6.0" -or $IsWindows) { + # Fix case when both the Windows and Linux builds of Node + # are installed in the same directory + $exe=".exe" +} +$ret=0 +if (Test-Path "$basedir/node$exe") { + & "$basedir/node$exe" "$basedir/../nodemon/bin/nodemon.js" $args + $ret=$LASTEXITCODE +} else { + & "node$exe" "$basedir/../nodemon/bin/nodemon.js" $args + $ret=$LASTEXITCODE +} +exit $ret diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/nodetouch b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/nodetouch new file mode 100644 index 00000000..1f7f0015 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/nodetouch @@ -0,0 +1,15 @@ +#!/bin/sh +basedir=$(dirname "$(echo "$0" | sed -e 's,\\,/,g')") + +case `uname` in + *CYGWIN*|*MINGW*|*MSYS*) basedir=`cygpath -w "$basedir"`;; +esac + +if [ -x "$basedir/node" ]; then + "$basedir/node" "$basedir/../touch/bin/nodetouch.js" "$@" + ret=$? +else + node "$basedir/../touch/bin/nodetouch.js" "$@" + ret=$? +fi +exit $ret diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/nodetouch.cmd b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/nodetouch.cmd new file mode 100644 index 00000000..1f78c68a --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/nodetouch.cmd @@ -0,0 +1,17 @@ +@ECHO off +SETLOCAL +CALL :find_dp0 + +IF EXIST "%dp0%\node.exe" ( + SET "_prog=%dp0%\node.exe" +) ELSE ( + SET "_prog=node" + SET PATHEXT=%PATHEXT:;.JS;=;% +) + +"%_prog%" "%dp0%\..\touch\bin\nodetouch.js" %* +ENDLOCAL +EXIT /b %errorlevel% +:find_dp0 +SET dp0=%~dp0 +EXIT /b diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/nodetouch.ps1 b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/nodetouch.ps1 new file mode 100644 index 00000000..236659ce --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/nodetouch.ps1 @@ -0,0 +1,18 @@ +#!/usr/bin/env pwsh +$basedir=Split-Path $MyInvocation.MyCommand.Definition -Parent + +$exe="" +if ($PSVersionTable.PSVersion -lt "6.0" -or $IsWindows) { + # Fix case when both the Windows and Linux builds of Node + # are installed in the same directory + $exe=".exe" +} +$ret=0 +if (Test-Path "$basedir/node$exe") { + & "$basedir/node$exe" "$basedir/../touch/bin/nodetouch.js" $args + $ret=$LASTEXITCODE +} else { + & "node$exe" "$basedir/../touch/bin/nodetouch.js" $args + $ret=$LASTEXITCODE +} +exit $ret diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/nopt b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/nopt new file mode 100644 index 00000000..e658aac4 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/nopt @@ -0,0 +1,15 @@ +#!/bin/sh +basedir=$(dirname "$(echo "$0" | sed -e 's,\\,/,g')") + +case `uname` in + *CYGWIN*|*MINGW*|*MSYS*) basedir=`cygpath -w "$basedir"`;; +esac + +if [ -x "$basedir/node" ]; then + "$basedir/node" "$basedir/../nopt/bin/nopt.js" "$@" + ret=$? +else + node "$basedir/../nopt/bin/nopt.js" "$@" + ret=$? +fi +exit $ret diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/nopt.cmd b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/nopt.cmd new file mode 100644 index 00000000..c92ec036 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/nopt.cmd @@ -0,0 +1,17 @@ +@ECHO off +SETLOCAL +CALL :find_dp0 + +IF EXIST "%dp0%\node.exe" ( + SET "_prog=%dp0%\node.exe" +) ELSE ( + SET "_prog=node" + SET PATHEXT=%PATHEXT:;.JS;=;% +) + +"%_prog%" "%dp0%\..\nopt\bin\nopt.js" %* +ENDLOCAL +EXIT /b %errorlevel% +:find_dp0 +SET dp0=%~dp0 +EXIT /b diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/nopt.ps1 b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/nopt.ps1 new file mode 100644 index 00000000..68c40bf9 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/nopt.ps1 @@ -0,0 +1,18 @@ +#!/usr/bin/env pwsh +$basedir=Split-Path $MyInvocation.MyCommand.Definition -Parent + +$exe="" +if ($PSVersionTable.PSVersion -lt "6.0" -or $IsWindows) { + # Fix case when both the Windows and Linux builds of Node + # are installed in the same directory + $exe=".exe" +} +$ret=0 +if (Test-Path "$basedir/node$exe") { + & "$basedir/node$exe" "$basedir/../nopt/bin/nopt.js" $args + $ret=$LASTEXITCODE +} else { + & "node$exe" "$basedir/../nopt/bin/nopt.js" $args + $ret=$LASTEXITCODE +} +exit $ret diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/rc b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/rc new file mode 100644 index 00000000..9e016267 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/rc @@ -0,0 +1,15 @@ +#!/bin/sh +basedir=$(dirname "$(echo "$0" | sed -e 's,\\,/,g')") + +case `uname` in + *CYGWIN*|*MINGW*|*MSYS*) basedir=`cygpath -w "$basedir"`;; +esac + +if [ -x "$basedir/node" ]; then + "$basedir/node" "$basedir/../rc/cli.js" "$@" + ret=$? +else + node "$basedir/../rc/cli.js" "$@" + ret=$? +fi +exit $ret diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/rc.cmd b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/rc.cmd new file mode 100644 index 00000000..aedece9d --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/rc.cmd @@ -0,0 +1,17 @@ +@ECHO off +SETLOCAL +CALL :find_dp0 + +IF EXIST "%dp0%\node.exe" ( + SET "_prog=%dp0%\node.exe" +) ELSE ( + SET "_prog=node" + SET PATHEXT=%PATHEXT:;.JS;=;% +) + +"%_prog%" "%dp0%\..\rc\cli.js" %* +ENDLOCAL +EXIT /b %errorlevel% +:find_dp0 +SET dp0=%~dp0 +EXIT /b diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/rc.ps1 b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/rc.ps1 new file mode 100644 index 00000000..ac2cd2a5 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/rc.ps1 @@ -0,0 +1,18 @@ +#!/usr/bin/env pwsh +$basedir=Split-Path $MyInvocation.MyCommand.Definition -Parent + +$exe="" +if ($PSVersionTable.PSVersion -lt "6.0" -or $IsWindows) { + # Fix case when both the Windows and Linux builds of Node + # are installed in the same directory + $exe=".exe" +} +$ret=0 +if (Test-Path "$basedir/node$exe") { + & "$basedir/node$exe" "$basedir/../rc/cli.js" $args + $ret=$LASTEXITCODE +} else { + & "node$exe" "$basedir/../rc/cli.js" $args + $ret=$LASTEXITCODE +} +exit $ret diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/rimraf b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/rimraf new file mode 100644 index 00000000..a3e9f718 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/rimraf @@ -0,0 +1,15 @@ +#!/bin/sh +basedir=$(dirname "$(echo "$0" | sed -e 's,\\,/,g')") + +case `uname` in + *CYGWIN*|*MINGW*|*MSYS*) basedir=`cygpath -w "$basedir"`;; +esac + +if [ -x "$basedir/node" ]; then + "$basedir/node" "$basedir/../rimraf/bin.js" "$@" + ret=$? +else + node "$basedir/../rimraf/bin.js" "$@" + ret=$? +fi +exit $ret diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/rimraf.cmd b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/rimraf.cmd new file mode 100644 index 00000000..698f4ba0 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/rimraf.cmd @@ -0,0 +1,17 @@ +@ECHO off +SETLOCAL +CALL :find_dp0 + +IF EXIST "%dp0%\node.exe" ( + SET "_prog=%dp0%\node.exe" +) ELSE ( + SET "_prog=node" + SET PATHEXT=%PATHEXT:;.JS;=;% +) + +"%_prog%" "%dp0%\..\rimraf\bin.js" %* +ENDLOCAL +EXIT /b %errorlevel% +:find_dp0 +SET dp0=%~dp0 +EXIT /b diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/rimraf.ps1 b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/rimraf.ps1 new file mode 100644 index 00000000..a244a805 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/rimraf.ps1 @@ -0,0 +1,18 @@ +#!/usr/bin/env pwsh +$basedir=Split-Path $MyInvocation.MyCommand.Definition -Parent + +$exe="" +if ($PSVersionTable.PSVersion -lt "6.0" -or $IsWindows) { + # Fix case when both the Windows and Linux builds of Node + # are installed in the same directory + $exe=".exe" +} +$ret=0 +if (Test-Path "$basedir/node$exe") { + & "$basedir/node$exe" "$basedir/../rimraf/bin.js" $args + $ret=$LASTEXITCODE +} else { + & "node$exe" "$basedir/../rimraf/bin.js" $args + $ret=$LASTEXITCODE +} +exit $ret diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/semver b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/semver new file mode 100644 index 00000000..7e365277 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/semver @@ -0,0 +1,15 @@ +#!/bin/sh +basedir=$(dirname "$(echo "$0" | sed -e 's,\\,/,g')") + +case `uname` in + *CYGWIN*|*MINGW*|*MSYS*) basedir=`cygpath -w "$basedir"`;; +esac + +if [ -x "$basedir/node" ]; then + "$basedir/node" "$basedir/../semver/bin/semver.js" "$@" + ret=$? +else + node "$basedir/../semver/bin/semver.js" "$@" + ret=$? +fi +exit $ret diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/semver.cmd b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/semver.cmd new file mode 100644 index 00000000..164cdeac --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/semver.cmd @@ -0,0 +1,17 @@ +@ECHO off +SETLOCAL +CALL :find_dp0 + +IF EXIST "%dp0%\node.exe" ( + SET "_prog=%dp0%\node.exe" +) ELSE ( + SET "_prog=node" + SET PATHEXT=%PATHEXT:;.JS;=;% +) + +"%_prog%" "%dp0%\..\semver\bin\semver.js" %* +ENDLOCAL +EXIT /b %errorlevel% +:find_dp0 +SET dp0=%~dp0 +EXIT /b diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/semver.ps1 b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/semver.ps1 new file mode 100644 index 00000000..6a85e340 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/.bin/semver.ps1 @@ -0,0 +1,18 @@ +#!/usr/bin/env pwsh +$basedir=Split-Path $MyInvocation.MyCommand.Definition -Parent + +$exe="" +if ($PSVersionTable.PSVersion -lt "6.0" -or $IsWindows) { + # Fix case when both the Windows and Linux builds of Node + # are installed in the same directory + $exe=".exe" +} +$ret=0 +if (Test-Path "$basedir/node$exe") { + & "$basedir/node$exe" "$basedir/../semver/bin/semver.js" $args + $ret=$LASTEXITCODE +} else { + & "node$exe" "$basedir/../semver/bin/semver.js" $args + $ret=$LASTEXITCODE +} +exit $ret diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@gar/promisify/LICENSE.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@gar/promisify/LICENSE.md new file mode 100644 index 00000000..64f77324 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@gar/promisify/LICENSE.md @@ -0,0 +1,10 @@ +The MIT License (MIT) + +Copyright © 2020-2022 Michael Garvin + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the “Software”), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED “AS IS”, WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@gar/promisify/README.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@gar/promisify/README.md new file mode 100644 index 00000000..465c546a --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@gar/promisify/README.md @@ -0,0 +1,65 @@ +# @gar/promisify + +### Promisify an entire object or class instance + +This module leverages es6 Proxy and Reflect to promisify every function in an +object or class instance. + +It assumes the callback that the function is expecting is the last +parameter, and that it is an error-first callback with only one value, +i.e. `(err, value) => ...`. This mirrors node's `util.promisify` method. + +In order that you can use it as a one-stop-shop for all your promisify +needs, you can also pass it a function. That function will be +promisified as normal using node's built-in `util.promisify` method. + +[node's custom promisified +functions](https://nodejs.org/api/util.html#util_custom_promisified_functions) +will also be mirrored, further allowing this to be a drop-in replacement +for the built-in `util.promisify`. + +### Examples + +Promisify an entire object + +```javascript + +const promisify = require('@gar/promisify') + +class Foo { + constructor (attr) { + this.attr = attr + } + + double (input, cb) { + cb(null, input * 2) + } + +const foo = new Foo('baz') +const promisified = promisify(foo) + +console.log(promisified.attr) +console.log(await promisified.double(1024)) +``` + +Promisify a function + +```javascript + +const promisify = require('@gar/promisify') + +function foo (a, cb) { + if (a !== 'bad') { + return cb(null, 'ok') + } + return cb('not ok') +} + +const promisified = promisify(foo) + +// This will resolve to 'ok' +promisified('good') + +// this will reject +promisified('bad') +``` diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@gar/promisify/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@gar/promisify/index.js new file mode 100644 index 00000000..d0be95f6 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@gar/promisify/index.js @@ -0,0 +1,36 @@ +'use strict' + +const { promisify } = require('util') + +const handler = { + get: function (target, prop, receiver) { + if (typeof target[prop] !== 'function') { + return target[prop] + } + if (target[prop][promisify.custom]) { + return function () { + return Reflect.get(target, prop, receiver)[promisify.custom].apply(target, arguments) + } + } + return function () { + return new Promise((resolve, reject) => { + Reflect.get(target, prop, receiver).apply(target, [...arguments, function (err, result) { + if (err) { + return reject(err) + } + resolve(result) + }]) + }) + } + } +} + +module.exports = function (thingToPromisify) { + if (typeof thingToPromisify === 'function') { + return promisify(thingToPromisify) + } + if (typeof thingToPromisify === 'object') { + return new Proxy(thingToPromisify, handler) + } + throw new TypeError('Can only promisify functions or objects') +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@gar/promisify/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@gar/promisify/package.json new file mode 100644 index 00000000..563db1fe --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@gar/promisify/package.json @@ -0,0 +1,65 @@ +{ + "_from": "@gar/promisify@^1.0.1", + "_id": "@gar/promisify@1.1.3", + "_inBundle": false, + "_integrity": "sha512-k2Ty1JcVojjJFwrg/ThKi2ujJ7XNLYaFGNB/bWT9wGR+oSMJHMa5w+CUq6p/pVrKeNNgA7pCqEcjSnHVoqJQFw==", + "_location": "/@gar/promisify", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "@gar/promisify@^1.0.1", + "name": "@gar/promisify", + "escapedName": "@gar%2fpromisify", + "scope": "@gar", + "rawSpec": "^1.0.1", + "saveSpec": null, + "fetchSpec": "^1.0.1" + }, + "_requiredBy": [ + "/@npmcli/fs" + ], + "_resolved": "https://registry.npmjs.org/@gar/promisify/-/promisify-1.1.3.tgz", + "_shasum": "555193ab2e3bb3b6adc3d551c9c030d9e860daf6", + "_spec": "@gar/promisify@^1.0.1", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\@npmcli\\fs", + "author": { + "name": "Gar", + "email": "gar+npm@danger.computer" + }, + "bugs": { + "url": "https://github.com/wraithgar/gar-promisify/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Promisify an entire class or object", + "devDependencies": { + "@hapi/code": "^8.0.1", + "@hapi/lab": "^24.1.0", + "standard": "^16.0.3" + }, + "files": [ + "index.js" + ], + "homepage": "https://github.com/wraithgar/gar-promisify#readme", + "keywords": [ + "promisify", + "all", + "class", + "object" + ], + "license": "MIT", + "main": "index.js", + "name": "@gar/promisify", + "repository": { + "type": "git", + "url": "git+https://github.com/wraithgar/gar-promisify.git" + }, + "scripts": { + "lint": "standard", + "lint:fix": "standard --fix", + "posttest": "npm run lint", + "test": "lab -a @hapi/code -t 100" + }, + "version": "1.1.3" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/CHANGELOG.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/CHANGELOG.md new file mode 100644 index 00000000..685b09d7 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/CHANGELOG.md @@ -0,0 +1,504 @@ +# node-pre-gyp changelog + +## 1.0.9 +- Upgraded node-fetch to 2.6.7 to address [CVE-2022-0235](https://www.cve.org/CVERecord?id=CVE-2022-0235) +- Upgraded detect-libc to 2.0.0 to use non-blocking NodeJS(>=12) Report API + +## 1.0.8 +- Downgraded npmlog to maintain node v10 and v8 support (https://github.com/mapbox/node-pre-gyp/pull/624) + +## 1.0.7 +- Upgraded nyc and npmlog to address https://github.com/advisories/GHSA-93q8-gq69-wqmw + +## 1.0.6 +- Added node v17 to the internal node releases listing +- Upgraded various dependencies declared in package.json to latest major versions (node-fetch from 2.6.1 to 2.6.5, npmlog from 4.1.2 to 5.01, semver from 7.3.4 to 7.3.5, and tar from 6.1.0 to 6.1.11) +- Fixed bug in `staging_host` parameter (https://github.com/mapbox/node-pre-gyp/pull/590) + + +## 1.0.5 +- Fix circular reference warning with node >= v14 + +## 1.0.4 +- Added node v16 to the internal node releases listing + +## 1.0.3 +- Improved support configuring s3 uploads (solves https://github.com/mapbox/node-pre-gyp/issues/571) + - New options added in https://github.com/mapbox/node-pre-gyp/pull/576: 'bucket', 'region', and `s3ForcePathStyle` + +## 1.0.2 +- Fixed regression in proxy support (https://github.com/mapbox/node-pre-gyp/issues/572) + +## 1.0.1 +- Switched from mkdirp@1.0.4 to make-dir@3.1.0 to avoid this bug: https://github.com/isaacs/node-mkdirp/issues/31 + +## 1.0.0 +- Module is now name-spaced at `@mapbox/node-pre-gyp` and the original `node-pre-gyp` is deprecated. +- New: support for staging and production s3 targets (see README.md) +- BREAKING: no longer supporting `node_pre_gyp_accessKeyId` & `node_pre_gyp_secretAccessKey`, use `AWS_ACCESS_KEY_ID` & `AWS_SECRET_ACCESS_KEY` instead to authenticate against s3 for `info`, `publish`, and `unpublish` commands. +- Dropped node v6 support, added node v14 support +- Switched tests to use mapbox-owned bucket for testing +- Added coverage tracking and linting with eslint +- Added back support for symlinks inside the tarball +- Upgraded all test apps to N-API/node-addon-api +- New: support for staging and production s3 targets (see README.md) +- Added `node_pre_gyp_s3_host` env var which has priority over the `--s3_host` option or default. +- Replaced needle with node-fetch +- Added proxy support for node-fetch +- Upgraded to mkdirp@1.x + +## 0.17.0 +- Got travis + appveyor green again +- Added support for more node versions + +## 0.16.0 + +- Added Node 15 support in the local database (https://github.com/mapbox/node-pre-gyp/pull/520) + +## 0.15.0 + +- Bump dependency on `mkdirp` from `^0.5.1` to `^0.5.3` (https://github.com/mapbox/node-pre-gyp/pull/492) +- Bump dependency on `needle` from `^2.2.1` to `^2.5.0` (https://github.com/mapbox/node-pre-gyp/pull/502) +- Added Node 14 support in the local database (https://github.com/mapbox/node-pre-gyp/pull/501) + +## 0.14.0 + +- Defer modules requires in napi.js (https://github.com/mapbox/node-pre-gyp/pull/434) +- Bump dependency on `tar` from `^4` to `^4.4.2` (https://github.com/mapbox/node-pre-gyp/pull/454) +- Support extracting compiled binary from local offline mirror (https://github.com/mapbox/node-pre-gyp/pull/459) +- Added Node 13 support in the local database (https://github.com/mapbox/node-pre-gyp/pull/483) + +## 0.13.0 + +- Added Node 12 support in the local database (https://github.com/mapbox/node-pre-gyp/pull/449) + +## 0.12.0 + +- Fixed double-build problem with node v10 (https://github.com/mapbox/node-pre-gyp/pull/428) +- Added node 11 support in the local database (https://github.com/mapbox/node-pre-gyp/pull/422) + +## 0.11.0 + +- Fixed double-install problem with node v10 +- Significant N-API improvements (https://github.com/mapbox/node-pre-gyp/pull/405) + +## 0.10.3 + +- Now will use `request` over `needle` if request is installed. By default `needle` is used for `https`. This should unbreak proxy support that regressed in v0.9.0 + +## 0.10.2 + +- Fixed rc/deep-extent security vulnerability +- Fixed broken reinstall script do to incorrectly named get_best_napi_version + +## 0.10.1 + +- Fix needle error event (@medns) + +## 0.10.0 + +- Allow for a single-level module path when packing @allenluce (https://github.com/mapbox/node-pre-gyp/pull/371) +- Log warnings instead of errors when falling back @xzyfer (https://github.com/mapbox/node-pre-gyp/pull/366) +- Add Node.js v10 support to tests (https://github.com/mapbox/node-pre-gyp/pull/372) +- Remove retire.js from CI (https://github.com/mapbox/node-pre-gyp/pull/372) +- Remove support for Node.js v4 due to [EOL on April 30th, 2018](https://github.com/nodejs/Release/blob/7dd52354049cae99eed0e9fe01345b0722a86fde/schedule.json#L14) +- Update appveyor tests to install default NPM version instead of NPM v2.x for all Windows builds (https://github.com/mapbox/node-pre-gyp/pull/375) + +## 0.9.1 + +- Fixed regression (in v0.9.0) with support for http redirects @allenluce (https://github.com/mapbox/node-pre-gyp/pull/361) + +## 0.9.0 + +- Switched from using `request` to `needle` to reduce size of module deps (https://github.com/mapbox/node-pre-gyp/pull/350) + +## 0.8.0 + +- N-API support (@inspiredware) + +## 0.7.1 + +- Upgraded to tar v4.x + +## 0.7.0 + + - Updated request and hawk (#347) + - Dropped node v0.10.x support + +## 0.6.40 + + - Improved error reporting if an install fails + +## 0.6.39 + + - Support for node v9 + - Support for versioning on `{libc}` to allow binaries to work on non-glic linux systems like alpine linux + + +## 0.6.38 + + - Maintaining compatibility (for v0.6.x series) with node v0.10.x + +## 0.6.37 + + - Solved one part of #276: now now deduce the node ABI from the major version for node >= 2 even when not stored in the abi_crosswalk.json + - Fixed docs to avoid mentioning the deprecated and dangerous `prepublish` in package.json (#291) + - Add new node versions to crosswalk + - Ported tests to use tape instead of mocha + - Got appveyor tests passing by downgrading npm and node-gyp + +## 0.6.36 + + - Removed the running of `testbinary` during install. Because this was regressed for so long, it is too dangerous to re-enable by default. Developers needing validation can call `node-pre-gyp testbinary` directory. + - Fixed regression in v0.6.35 for electron installs (now skipping binary validation which is not yet supported for electron) + +## 0.6.35 + + - No longer recommending `npm ls` in `prepublish` (#291) + - Fixed testbinary command (#283) @szdavid92 + +## 0.6.34 + + - Added new node versions to crosswalk, including v8 + - Upgraded deps to latest versions, started using `^` instead of `~` for all deps. + +## 0.6.33 + + - Improved support for yarn + +## 0.6.32 + + - Honor npm configuration for CA bundles (@heikkipora) + - Add node-pre-gyp and npm versions to user agent (@addaleax) + - Updated various deps + - Add known node version for v7.x + +## 0.6.31 + + - Updated various deps + +## 0.6.30 + + - Update to npmlog@4.x and semver@5.3.x + - Add known node version for v6.5.0 + +## 0.6.29 + + - Add known node versions for v0.10.45, v0.12.14, v4.4.4, v5.11.1, and v6.1.0 + +## 0.6.28 + + - Now more verbose when remote binaries are not available. This is needed since npm is increasingly more quiet by default + and users need to know why builds are falling back to source compiles that might then error out. + +## 0.6.27 + + - Add known node version for node v6 + - Stopped bundling dependencies + - Documented method for module authors to avoid bundling node-pre-gyp + - See https://github.com/mapbox/node-pre-gyp/tree/master#configuring for details + +## 0.6.26 + + - Skip validation for nw runtime (https://github.com/mapbox/node-pre-gyp/pull/181) via @fleg + +## 0.6.25 + + - Improved support for auto-detection of electron runtime in `node-pre-gyp.find()` + - Pull request from @enlight - https://github.com/mapbox/node-pre-gyp/pull/187 + - Add known node version for 4.4.1 and 5.9.1 + +## 0.6.24 + + - Add known node version for 5.8.0, 5.9.0, and 4.4.0. + +## 0.6.23 + + - Add known node version for 0.10.43, 0.12.11, 4.3.2, and 5.7.1. + +## 0.6.22 + + - Add known node version for 4.3.1, and 5.7.0. + +## 0.6.21 + + - Add known node version for 0.10.42, 0.12.10, 4.3.0, and 5.6.0. + +## 0.6.20 + + - Add known node version for 4.2.5, 4.2.6, 5.4.0, 5.4.1,and 5.5.0. + +## 0.6.19 + + - Add known node version for 4.2.4 + +## 0.6.18 + + - Add new known node versions for 0.10.x, 0.12.x, 4.x, and 5.x + +## 0.6.17 + + - Re-tagged to fix packaging problem of `Error: Cannot find module 'isarray'` + +## 0.6.16 + + - Added known version in crosswalk for 5.1.0. + +## 0.6.15 + + - Upgraded tar-pack (https://github.com/mapbox/node-pre-gyp/issues/182) + - Support custom binary hosting mirror (https://github.com/mapbox/node-pre-gyp/pull/170) + - Added known version in crosswalk for 4.2.2. + +## 0.6.14 + + - Added node 5.x version + +## 0.6.13 + + - Added more known node 4.x versions + +## 0.6.12 + + - Added support for [Electron](http://electron.atom.io/). Just pass the `--runtime=electron` flag when building/installing. Thanks @zcbenz + +## 0.6.11 + + - Added known node and io.js versions including more 3.x and 4.x versions + +## 0.6.10 + + - Added known node and io.js versions including 3.x and 4.x versions + - Upgraded `tar` dep + +## 0.6.9 + + - Upgraded `rc` dep + - Updated known io.js version: v2.4.0 + +## 0.6.8 + + - Upgraded `semver` and `rimraf` deps + - Updated known node and io.js versions + +## 0.6.7 + + - Fixed `node_abi` versions for io.js 1.1.x -> 1.8.x (should be 43, but was stored as 42) (refs https://github.com/iojs/build/issues/94) + +## 0.6.6 + + - Updated with known io.js 2.0.0 version + +## 0.6.5 + + - Now respecting `npm_config_node_gyp` (https://github.com/npm/npm/pull/4887) + - Updated to semver@4.3.2 + - Updated known node v0.12.x versions and io.js 1.x versions. + +## 0.6.4 + + - Improved support for `io.js` (@fengmk2) + - Test coverage improvements (@mikemorris) + - Fixed support for `--dist-url` that regressed in 0.6.3 + +## 0.6.3 + + - Added support for passing raw options to node-gyp using `--` separator. Flags passed after + the `--` to `node-pre-gyp configure` will be passed directly to gyp while flags passed + after the `--` will be passed directly to make/visual studio. + - Added `node-pre-gyp configure` command to be able to call `node-gyp configure` directly + - Fix issue with require validation not working on windows 7 (@edgarsilva) + +## 0.6.2 + + - Support for io.js >= v1.0.2 + - Deferred require of `request` and `tar` to help speed up command line usage of `node-pre-gyp`. + +## 0.6.1 + + - Fixed bundled `tar` version + +## 0.6.0 + + - BREAKING: node odd releases like v0.11.x now use `major.minor.patch` for `{node_abi}` instead of `NODE_MODULE_VERSION` (#124) + - Added support for `toolset` option in versioning. By default is an empty string but `--toolset` can be passed to publish or install to select alternative binaries that target a custom toolset like C++11. For example to target Visual Studio 2014 modules like node-sqlite3 use `--toolset=v140`. + - Added support for `--no-rollback` option to request that a failed binary test does not remove the binary module leaves it in place. + - Added support for `--update-binary` option to request an existing binary be re-installed and the check for a valid local module be skipped. + - Added support for passing build options from `npm` through `node-pre-gyp` to `node-gyp`: `--nodedir`, `--disturl`, `--python`, and `--msvs_version` + +## 0.5.31 + + - Added support for deducing node_abi for node.js runtime from previous release if the series is even + - Added support for --target=0.10.33 + +## 0.5.30 + + - Repackaged with latest bundled deps + +## 0.5.29 + + - Added support for semver `build`. + - Fixed support for downloading from urls that include `+`. + +## 0.5.28 + + - Now reporting unix style paths only in reveal command + +## 0.5.27 + + - Fixed support for auto-detecting s3 bucket name when it contains `.` - @taavo + - Fixed support for installing when path contains a `'` - @halfdan + - Ported tests to mocha + +## 0.5.26 + + - Fix node-webkit support when `--target` option is not provided + +## 0.5.25 + + - Fix bundling of deps + +## 0.5.24 + + - Updated ABI crosswalk to incldue node v0.10.30 and v0.10.31 + +## 0.5.23 + + - Added `reveal` command. Pass no options to get all versioning data as json. Pass a second arg to grab a single versioned property value + - Added support for `--silent` (shortcut for `--loglevel=silent`) + +## 0.5.22 + + - Fixed node-webkit versioning name (NOTE: node-webkit support still experimental) + +## 0.5.21 + + - New package to fix `shasum check failed` error with v0.5.20 + +## 0.5.20 + + - Now versioning node-webkit binaries based on major.minor.patch - assuming no compatible ABI across versions (#90) + +## 0.5.19 + + - Updated to know about more node-webkit releases + +## 0.5.18 + + - Updated to know about more node-webkit releases + +## 0.5.17 + + - Updated to know about node v0.10.29 release + +## 0.5.16 + + - Now supporting all aws-sdk configuration parameters (http://docs.aws.amazon.com/AWSJavaScriptSDK/guide/node-configuring.html) (#86) + +## 0.5.15 + + - Fixed installation of windows packages sub directories on unix systems (#84) + +## 0.5.14 + + - Finished support for cross building using `--target_platform` option (#82) + - Now skipping binary validation on install if target arch/platform do not match the host. + - Removed multi-arch validing for OS X since it required a FAT node.js binary + +## 0.5.13 + + - Fix problem in 0.5.12 whereby the wrong versions of mkdirp and semver where bundled. + +## 0.5.12 + + - Improved support for node-webkit (@Mithgol) + +## 0.5.11 + + - Updated target versions listing + +## 0.5.10 + + - Fixed handling of `-debug` flag passed directory to node-pre-gyp (#72) + - Added optional second arg to `node_pre_gyp.find` to customize the default versioning options used to locate the runtime binary + - Failed install due to `testbinary` check failure no longer leaves behind binary (#70) + +## 0.5.9 + + - Fixed regression in `testbinary` command causing installs to fail on windows with 0.5.7 (#60) + +## 0.5.8 + + - Started bundling deps + +## 0.5.7 + + - Fixed the `testbinary` check, which is used to determine whether to re-download or source compile, to work even in complex dependency situations (#63) + - Exposed the internal `testbinary` command in node-pre-gyp command line tool + - Fixed minor bug so that `fallback_to_build` option is always respected + +## 0.5.6 + + - Added support for versioning on the `name` value in `package.json` (#57). + - Moved to using streams for reading tarball when publishing (#52) + +## 0.5.5 + + - Improved binary validation that also now works with node-webkit (@Mithgol) + - Upgraded test apps to work with node v0.11.x + - Improved test coverage + +## 0.5.4 + + - No longer depends on external install of node-gyp for compiling builds. + +## 0.5.3 + + - Reverted fix for debian/nodejs since it broke windows (#45) + +## 0.5.2 + + - Support for debian systems where the node binary is named `nodejs` (#45) + - Added `bin/node-pre-gyp.cmd` to be able to run command on windows locally (npm creates an .npm automatically when globally installed) + - Updated abi-crosswalk with node v0.10.26 entry. + +## 0.5.1 + + - Various minor bug fixes, several improving windows support for publishing. + +## 0.5.0 + + - Changed property names in `binary` object: now required are `module_name`, `module_path`, and `host`. + - Now `module_path` supports versioning, which allows developers to opt-in to using a versioned install path (#18). + - Added `remote_path` which also supports versioning. + - Changed `remote_uri` to `host`. + +## 0.4.2 + + - Added support for `--target` flag to request cross-compile against a specific node/node-webkit version. + - Added preliminary support for node-webkit + - Fixed support for `--target_arch` option being respected in all cases. + +## 0.4.1 + + - Fixed exception when only stderr is available in binary test (@bendi / #31) + +## 0.4.0 + + - Enforce only `https:` based remote publishing access. + - Added `node-pre-gyp info` command to display listing of published binaries + - Added support for changing the directory node-pre-gyp should build in with the `-C/--directory` option. + - Added support for S3 prefixes. + +## 0.3.1 + + - Added `unpublish` command. + - Fixed module path construction in tests. + - Added ability to disable falling back to build behavior via `npm install --fallback-to-build=false` which overrides setting in a depedencies package.json `install` target. + +## 0.3.0 + + - Support for packaging all files in `module_path` directory - see `app4` for example + - Added `testpackage` command. + - Changed `clean` command to only delete `.node` not entire `build` directory since node-gyp will handle that. + - `.node` modules must be in a folder of there own since tar-pack will remove everything when it unpacks. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/LICENSE b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/LICENSE new file mode 100644 index 00000000..8f5fce91 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/LICENSE @@ -0,0 +1,27 @@ +Copyright (c), Mapbox + +All rights reserved. + +Redistribution and use in source and binary forms, with or without modification, +are permitted provided that the following conditions are met: + + * Redistributions of source code must retain the above copyright notice, + this list of conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above copyright notice, + this list of conditions and the following disclaimer in the documentation + and/or other materials provided with the distribution. + * Neither the name of node-pre-gyp nor the names of its contributors + may be used to endorse or promote products derived from this software + without specific prior written permission. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +"AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR +CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, +EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, +PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR +PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF +LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING +NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS +SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/README.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/README.md new file mode 100644 index 00000000..fcb78124 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/README.md @@ -0,0 +1,742 @@ +# @mapbox/node-pre-gyp + +#### @mapbox/node-pre-gyp makes it easy to publish and install Node.js C++ addons from binaries + +[![Build Status](https://travis-ci.com/mapbox/node-pre-gyp.svg?branch=master)](https://travis-ci.com/mapbox/node-pre-gyp) +[![Build status](https://ci.appveyor.com/api/projects/status/3nxewb425y83c0gv)](https://ci.appveyor.com/project/Mapbox/node-pre-gyp) + +`@mapbox/node-pre-gyp` stands between [npm](https://github.com/npm/npm) and [node-gyp](https://github.com/Tootallnate/node-gyp) and offers a cross-platform method of binary deployment. + +### Special note on previous package + +On Feb 9th, 2021 `@mapbox/node-pre-gyp@1.0.0` was [released](./CHANGELOG.md). Older, unscoped versions that are not part of the `@mapbox` org are deprecated and only `@mapbox/node-pre-gyp` will see updates going forward. To upgrade to the new package do: + +``` +npm uninstall node-pre-gyp --save +npm install @mapbox/node-pre-gyp --save +``` + +### Features + + - A command line tool called `node-pre-gyp` that can install your package's C++ module from a binary. + - A variety of developer targeted commands for packaging, testing, and publishing binaries. + - A JavaScript module that can dynamically require your installed binary: `require('@mapbox/node-pre-gyp').find` + +For a hello world example of a module packaged with `node-pre-gyp` see and [the wiki ](https://github.com/mapbox/node-pre-gyp/wiki/Modules-using-node-pre-gyp) for real world examples. + +## Credits + + - The module is modeled after [node-gyp](https://github.com/Tootallnate/node-gyp) by [@Tootallnate](https://github.com/Tootallnate) + - Motivation for initial development came from [@ErisDS](https://github.com/ErisDS) and the [Ghost Project](https://github.com/TryGhost/Ghost). + - Development is sponsored by [Mapbox](https://www.mapbox.com/) + +## FAQ + +See the [Frequently Ask Questions](https://github.com/mapbox/node-pre-gyp/wiki/FAQ). + +## Depends + + - Node.js >= node v8.x + +## Install + +`node-pre-gyp` is designed to be installed as a local dependency of your Node.js C++ addon and accessed like: + + ./node_modules/.bin/node-pre-gyp --help + +But you can also install it globally: + + npm install @mapbox/node-pre-gyp -g + +## Usage + +### Commands + +View all possible commands: + + node-pre-gyp --help + +- clean - Remove the entire folder containing the compiled .node module +- install - Install pre-built binary for module +- reinstall - Run "clean" and "install" at once +- build - Compile the module by dispatching to node-gyp or nw-gyp +- rebuild - Run "clean" and "build" at once +- package - Pack binary into tarball +- testpackage - Test that the staged package is valid +- publish - Publish pre-built binary +- unpublish - Unpublish pre-built binary +- info - Fetch info on published binaries + +You can also chain commands: + + node-pre-gyp clean build unpublish publish info + +### Options + +Options include: + + - `-C/--directory`: run the command in this directory + - `--build-from-source`: build from source instead of using pre-built binary + - `--update-binary`: reinstall by replacing previously installed local binary with remote binary + - `--runtime=node-webkit`: customize the runtime: `node`, `electron` and `node-webkit` are the valid options + - `--fallback-to-build`: fallback to building from source if pre-built binary is not available + - `--target=0.4.0`: Pass the target node or node-webkit version to compile against + - `--target_arch=ia32`: Pass the target arch and override the host `arch`. Valid values are 'ia32','x64', or `arm`. + - `--target_platform=win32`: Pass the target platform and override the host `platform`. Valid values are `linux`, `darwin`, `win32`, `sunos`, `freebsd`, `openbsd`, and `aix`. + +Both `--build-from-source` and `--fallback-to-build` can be passed alone or they can provide values. You can pass `--fallback-to-build=false` to override the option as declared in package.json. In addition to being able to pass `--build-from-source` you can also pass `--build-from-source=myapp` where `myapp` is the name of your module. + +For example: `npm install --build-from-source=myapp`. This is useful if: + + - `myapp` is referenced in the package.json of a larger app and therefore `myapp` is being installed as a dependency with `npm install`. + - The larger app also depends on other modules installed with `node-pre-gyp` + - You only want to trigger a source compile for `myapp` and the other modules. + +### Configuring + +This is a guide to configuring your module to use node-pre-gyp. + +#### 1) Add new entries to your `package.json` + + - Add `@mapbox/node-pre-gyp` to `dependencies` + - Add `aws-sdk` as a `devDependency` + - Add a custom `install` script + - Declare a `binary` object + +This looks like: + +```js + "dependencies" : { + "@mapbox/node-pre-gyp": "1.x" + }, + "devDependencies": { + "aws-sdk": "2.x" + } + "scripts": { + "install": "node-pre-gyp install --fallback-to-build" + }, + "binary": { + "module_name": "your_module", + "module_path": "./lib/binding/", + "host": "https://your_module.s3-us-west-1.amazonaws.com" + } +``` + +For a full example see [node-addon-examples's package.json](https://github.com/springmeyer/node-addon-example/blob/master/package.json). + +Let's break this down: + + - Dependencies need to list `node-pre-gyp` + - Your devDependencies should list `aws-sdk` so that you can run `node-pre-gyp publish` locally or a CI system. We recommend using `devDependencies` only since `aws-sdk` is large and not needed for `node-pre-gyp install` since it only uses http to fetch binaries + - Your `scripts` section should override the `install` target with `"install": "node-pre-gyp install --fallback-to-build"`. This allows node-pre-gyp to be used instead of the default npm behavior of always source compiling with `node-gyp` directly. + - Your package.json should contain a `binary` section describing key properties you provide to allow node-pre-gyp to package optimally. They are detailed below. + +Note: in the past we recommended putting `@mapbox/node-pre-gyp` in the `bundledDependencies`, but we no longer recommend this. In the past there were npm bugs (with node versions 0.10.x) that could lead to node-pre-gyp not being available at the right time during install (unless we bundled). This should no longer be the case. Also, for a time we recommended using `"preinstall": "npm install @mapbox/node-pre-gyp"` as an alternative method to avoid needing to bundle. But this did not behave predictably across all npm versions - see https://github.com/mapbox/node-pre-gyp/issues/260 for the details. So we do not recommend using `preinstall` to install `@mapbox/node-pre-gyp`. More history on this at https://github.com/strongloop/fsevents/issues/157#issuecomment-265545908. + +##### The `binary` object has three required properties + +###### module_name + +The name of your native node module. This value must: + + - Match the name passed to [the NODE_MODULE macro](http://nodejs.org/api/addons.html#addons_hello_world) + - Must be a valid C variable name (e.g. it cannot contain `-`) + - Should not include the `.node` extension. + +###### module_path + +The location your native module is placed after a build. This should be an empty directory without other Javascript files. This entire directory will be packaged in the binary tarball. When installing from a remote package this directory will be overwritten with the contents of the tarball. + +Note: This property supports variables based on [Versioning](#versioning). + +###### host + +A url to the remote location where you've published tarball binaries (must be `https` not `http`). + +It is highly recommended that you use Amazon S3. The reasons are: + + - Various node-pre-gyp commands like `publish` and `info` only work with an S3 host. + - S3 is a very solid hosting platform for distributing large files. + - We provide detail documentation for using [S3 hosting](#s3-hosting) with node-pre-gyp. + +Why then not require S3? Because while some applications using node-pre-gyp need to distribute binaries as large as 20-30 MB, others might have very small binaries and might wish to store them in a GitHub repo. This is not recommended, but if an author really wants to host in a non-S3 location then it should be possible. + +It should also be mentioned that there is an optional and entirely separate npm module called [node-pre-gyp-github](https://github.com/bchr02/node-pre-gyp-github) which is intended to complement node-pre-gyp and be installed along with it. It provides the ability to store and publish your binaries within your repositories GitHub Releases if you would rather not use S3 directly. Installation and usage instructions can be found [here](https://github.com/bchr02/node-pre-gyp-github), but the basic premise is that instead of using the ```node-pre-gyp publish``` command you would use ```node-pre-gyp-github publish```. + +##### The `binary` object other optional S3 properties + +If you are not using a standard s3 path like `bucket_name.s3(.-)region.amazonaws.com`, you might get an error on `publish` because node-pre-gyp extracts the region and bucket from the `host` url. For example, you may have an on-premises s3-compatible storage server, or may have configured a specific dns redirecting to an s3 endpoint. In these cases, you can explicitly set the `region` and `bucket` properties to tell node-pre-gyp to use these values instead of guessing from the `host` property. The following values can be used in the `binary` section: + +###### host + +The url to the remote server root location (must be `https` not `http`). + +###### bucket + +The bucket name where your tarball binaries should be located. + +###### region + +Your S3 server region. + +###### s3ForcePathStyle + +Set `s3ForcePathStyle` to true if the endpoint url should not be prefixed with the bucket name. If false (default), the server endpoint would be constructed as `bucket_name.your_server.com`. + +##### The `binary` object has optional properties + +###### remote_path + +It **is recommended** that you customize this property. This is an extra path to use for publishing and finding remote tarballs. The default value for `remote_path` is `""` meaning that if you do not provide it then all packages will be published at the base of the `host`. It is recommended to provide a value like `./{name}/v{version}` to help organize remote packages in the case that you choose to publish multiple node addons to the same `host`. + +Note: This property supports variables based on [Versioning](#versioning). + +###### package_name + +It is **not recommended** to override this property unless you are also overriding the `remote_path`. This is the versioned name of the remote tarball containing the binary `.node` module and any supporting files you've placed inside the `module_path` directory. Unless you specify `package_name` in your `package.json` then it defaults to `{module_name}-v{version}-{node_abi}-{platform}-{arch}.tar.gz` which allows your binary to work across node versions, platforms, and architectures. If you are using `remote_path` that is also versioned by `./{module_name}/v{version}` then you could remove these variables from the `package_name` and just use: `{node_abi}-{platform}-{arch}.tar.gz`. Then your remote tarball will be looked up at, for example, `https://example.com/your-module/v0.1.0/node-v11-linux-x64.tar.gz`. + +Avoiding the version of your module in the `package_name` and instead only embedding in a directory name can be useful when you want to make a quick tag of your module that does not change any C++ code. In this case you can just copy binaries to the new version behind the scenes like: + +```sh +aws s3 sync --acl public-read s3://mapbox-node-binary/sqlite3/v3.0.3/ s3://mapbox-node-binary/sqlite3/v3.0.4/ +``` + +Note: This property supports variables based on [Versioning](#versioning). + +#### 2) Add a new target to binding.gyp + +`node-pre-gyp` calls out to `node-gyp` to compile the module and passes variables along like [module_name](#module_name) and [module_path](#module_path). + +A new target must be added to `binding.gyp` that moves the compiled `.node` module from `./build/Release/module_name.node` into the directory specified by `module_path`. + +Add a target like this at the end of your `targets` list: + +```js + { + "target_name": "action_after_build", + "type": "none", + "dependencies": [ "<(module_name)" ], + "copies": [ + { + "files": [ "<(PRODUCT_DIR)/<(module_name).node" ], + "destination": "<(module_path)" + } + ] + } +``` + +For a full example see [node-addon-example's binding.gyp](https://github.com/springmeyer/node-addon-example/blob/2ff60a8ded7f042864ad21db00c3a5a06cf47075/binding.gyp). + +#### 3) Dynamically require your `.node` + +Inside the main js file that requires your addon module you are likely currently doing: + +```js +var binding = require('../build/Release/binding.node'); +``` + +or: + +```js +var bindings = require('./bindings') +``` + +Change those lines to: + +```js +var binary = require('@mapbox/node-pre-gyp'); +var path = require('path'); +var binding_path = binary.find(path.resolve(path.join(__dirname,'./package.json'))); +var binding = require(binding_path); +``` + +For a full example see [node-addon-example's index.js](https://github.com/springmeyer/node-addon-example/blob/2ff60a8ded7f042864ad21db00c3a5a06cf47075/index.js#L1-L4) + +#### 4) Build and package your app + +Now build your module from source: + + npm install --build-from-source + +The `--build-from-source` tells `node-pre-gyp` to not look for a remote package and instead dispatch to node-gyp to build. + +Now `node-pre-gyp` should now also be installed as a local dependency so the command line tool it offers can be found at `./node_modules/.bin/node-pre-gyp`. + +#### 5) Test + +Now `npm test` should work just as it did before. + +#### 6) Publish the tarball + +Then package your app: + + ./node_modules/.bin/node-pre-gyp package + +Once packaged, now you can publish: + + ./node_modules/.bin/node-pre-gyp publish + +Currently the `publish` command pushes your binary to S3. This requires: + + - You have installed `aws-sdk` with `npm install aws-sdk` + - You have created a bucket already. + - The `host` points to an S3 http or https endpoint. + - You have configured node-pre-gyp to read your S3 credentials (see [S3 hosting](#s3-hosting) for details). + +You can also host your binaries elsewhere. To do this requires: + + - You manually publish the binary created by the `package` command to an `https` endpoint + - Ensure that the `host` value points to your custom `https` endpoint. + +#### 7) Automate builds + +Now you need to publish builds for all the platforms and node versions you wish to support. This is best automated. + + - See [Appveyor Automation](#appveyor-automation) for how to auto-publish builds on Windows. + - See [Travis Automation](#travis-automation) for how to auto-publish builds on OS X and Linux. + +#### 8) You're done! + +Now publish your module to the npm registry. Users will now be able to install your module from a binary. + +What will happen is this: + +1. `npm install ` will pull from the npm registry +2. npm will run the `install` script which will call out to `node-pre-gyp` +3. `node-pre-gyp` will fetch the binary `.node` module and unpack in the right place +4. Assuming that all worked, you are done + +If a a binary was not available for a given platform and `--fallback-to-build` was used then `node-gyp rebuild` will be called to try to source compile the module. + +#### 9) One more option + +It may be that you want to work with two s3 buckets, one for staging and one for production; this +arrangement makes it less likely to accidentally overwrite a production binary. It also allows the production +environment to have more restrictive permissions than staging while still enabling publishing when +developing and testing. + +The binary.host property can be set at execution time. In order to do so all of the following conditions +must be true. + +- binary.host is falsey or not present +- binary.staging_host is not empty +- binary.production_host is not empty + +If any of these checks fail then the operation will not perform execution time determination of the s3 target. + +If the command being executed is either "publish" or "unpublish" then the default is set to `binary.staging_host`. In all other cases +the default is `binary.production_host`. + +The command-line options `--s3_host=staging` or `--s3_host=production` override the default. If `s3_host` +is present and not `staging` or `production` an exception is thrown. + +This allows installing from staging by specifying `--s3_host=staging`. And it requires specifying +`--s3_option=production` in order to publish to, or unpublish from, production, making accidental errors less likely. + +## Node-API Considerations + +[Node-API](https://nodejs.org/api/n-api.html#n_api_node_api), which was previously known as N-API, is an ABI-stable alternative to previous technologies such as [nan](https://github.com/nodejs/nan) which are tied to a specific Node runtime engine. Node-API is Node runtime engine agnostic and guarantees modules created today will continue to run, without changes, into the future. + +Using `node-pre-gyp` with Node-API projects requires a handful of additional configuration values and imposes some additional requirements. + +The most significant difference is that an Node-API module can be coded to target multiple Node-API versions. Therefore, an Node-API module must declare in its `package.json` file which Node-API versions the module is designed to run against. In addition, since multiple builds may be required for a single module, path and file names must be specified in way that avoids naming conflicts. + +### The `napi_versions` array property + +A Node-API module must declare in its `package.json` file, the Node-API versions the module is intended to support. This is accomplished by including an `napi-versions` array property in the `binary` object. For example: + +```js +"binary": { + "module_name": "your_module", + "module_path": "your_module_path", + "host": "https://your_bucket.s3-us-west-1.amazonaws.com", + "napi_versions": [1,3] + } +``` + +If the `napi_versions` array property is *not* present, `node-pre-gyp` operates as it always has. Including the `napi_versions` array property instructs `node-pre-gyp` that this is a Node-API module build. + +When the `napi_versions` array property is present, `node-pre-gyp` fires off multiple operations, one for each of the Node-API versions in the array. In the example above, two operations are initiated, one for Node-API version 1 and second for Node-API version 3. How this version number is communicated is described next. + +### The `napi_build_version` value + +For each of the Node-API module operations `node-pre-gyp` initiates, it ensures that the `napi_build_version` is set appropriately. + +This value is of importance in two areas: + +1. The C/C++ code which needs to know against which Node-API version it should compile. +2. `node-pre-gyp` itself which must assign appropriate path and file names to avoid collisions. + +### Defining `NAPI_VERSION` for the C/C++ code + +The `napi_build_version` value is communicated to the C/C++ code by adding this code to the `binding.gyp` file: + +``` +"defines": [ + "NAPI_VERSION=<(napi_build_version)", +] +``` + +This ensures that `NAPI_VERSION`, an integer value, is declared appropriately to the C/C++ code for each build. + +> Note that earlier versions of this document recommended defining the symbol `NAPI_BUILD_VERSION`. `NAPI_VERSION` is preferred because it used by the Node-API C/C++ headers to configure the specific Node-API versions being requested. + +### Path and file naming requirements in `package.json` + +Since `node-pre-gyp` fires off multiple operations for each request, it is essential that path and file names be created in such a way as to avoid collisions. This is accomplished by imposing additional path and file naming requirements. + +Specifically, when performing Node-API builds, the `{napi_build_version}` text configuration value *must* be present in the `module_path` property. In addition, the `{napi_build_version}` text configuration value *must* be present in either the `remote_path` or `package_name` property. (No problem if it's in both.) + +Here's an example: + +```js +"binary": { + "module_name": "your_module", + "module_path": "./lib/binding/napi-v{napi_build_version}", + "remote_path": "./{module_name}/v{version}/{configuration}/", + "package_name": "{platform}-{arch}-napi-v{napi_build_version}.tar.gz", + "host": "https://your_bucket.s3-us-west-1.amazonaws.com", + "napi_versions": [1,3] + } +``` + +## Supporting both Node-API and NAN builds + +You may have a legacy native add-on that you wish to continue supporting for those versions of Node that do not support Node-API, as you add Node-API support for later Node versions. This can be accomplished by specifying the `node_napi_label` configuration value in the package.json `binary.package_name` property. + +Placing the configuration value `node_napi_label` in the package.json `binary.package_name` property instructs `node-pre-gyp` to build all viable Node-API binaries supported by the current Node instance. If the current Node instance does not support Node-API, `node-pre-gyp` will request a traditional, non-Node-API build. + +The configuration value `node_napi_label` is set by `node-pre-gyp` to the type of build created, `napi` or `node`, and the version number. For Node-API builds, the string contains the Node-API version nad has values like `napi-v3`. For traditional, non-Node-API builds, the string contains the ABI version with values like `node-v46`. + +Here's how the `binary` configuration above might be changed to support both Node-API and NAN builds: + +```js +"binary": { + "module_name": "your_module", + "module_path": "./lib/binding/{node_napi_label}", + "remote_path": "./{module_name}/v{version}/{configuration}/", + "package_name": "{platform}-{arch}-{node_napi_label}.tar.gz", + "host": "https://your_bucket.s3-us-west-1.amazonaws.com", + "napi_versions": [1,3] + } +``` + +The C/C++ symbol `NAPI_VERSION` can be used to distinguish Node-API and non-Node-API builds. The value of `NAPI_VERSION` is set to the integer Node-API version for Node-API builds and is set to `0` for non-Node-API builds. + +For example: + +```C +#if NAPI_VERSION +// Node-API code goes here +#else +// NAN code goes here +#endif +``` + +### Two additional configuration values + +The following two configuration values, which were implemented in previous versions of `node-pre-gyp`, continue to exist, but have been replaced by the `node_napi_label` configuration value described above. + +1. `napi_version` If Node-API is supported by the currently executing Node instance, this value is the Node-API version number supported by Node. If Node-API is not supported, this value is an empty string. + +2. `node_abi_napi` If the value returned for `napi_version` is non empty, this value is `'napi'`. If the value returned for `napi_version` is empty, this value is the value returned for `node_abi`. + +These values are present for use in the `binding.gyp` file and may be used as `{napi_version}` and `{node_abi_napi}` for text substituion in the `binary` properties of the `package.json` file. + +## S3 Hosting + +You can host wherever you choose but S3 is cheap, `node-pre-gyp publish` expects it, and S3 can be integrated well with [Travis.ci](http://travis-ci.org) to automate builds for OS X and Ubuntu, and with [Appveyor](http://appveyor.com) to automate builds for Windows. Here is an approach to do this: + +First, get setup locally and test the workflow: + +#### 1) Create an S3 bucket + +And have your **key** and **secret key** ready for writing to the bucket. + +It is recommended to create a IAM user with a policy that only gives permissions to the specific bucket you plan to publish to. This can be done in the [IAM console](https://console.aws.amazon.com/iam/) by: 1) adding a new user, 2) choosing `Attach User Policy`, 3) Using the `Policy Generator`, 4) selecting `Amazon S3` for the service, 5) adding the actions: `DeleteObject`, `GetObject`, `GetObjectAcl`, `ListBucket`, `HeadBucket`, `PutObject`, `PutObjectAcl`, 6) adding an ARN of `arn:aws:s3:::bucket/*` (replacing `bucket` with your bucket name), and finally 7) clicking `Add Statement` and saving the policy. It should generate a policy like: + +```js +{ + "Version": "2012-10-17", + "Statement": [ + { + "Sid": "objects", + "Effect": "Allow", + "Action": [ + "s3:PutObject", + "s3:GetObjectAcl", + "s3:GetObject", + "s3:DeleteObject", + "s3:PutObjectAcl" + ], + "Resource": "arn:aws:s3:::your-bucket-name/*" + }, + { + "Sid": "bucket", + "Effect": "Allow", + "Action": "s3:ListBucket", + "Resource": "arn:aws:s3:::your-bucket-name" + }, + { + "Sid": "buckets", + "Effect": "Allow", + "Action": "s3:HeadBucket", + "Resource": "*" + } + ] +} +``` + +#### 2) Install node-pre-gyp + +Either install it globally: + + npm install node-pre-gyp -g + +Or put the local version on your PATH + + export PATH=`pwd`/node_modules/.bin/:$PATH + +#### 3) Configure AWS credentials + +It is recommended to configure the AWS JS SDK v2 used internally by `node-pre-gyp` by setting these environment variables: + +- AWS_ACCESS_KEY_ID +- AWS_SECRET_ACCESS_KEY + +But also you can also use the `Shared Config File` mentioned [in the AWS JS SDK v2 docs](https://docs.aws.amazon.com/sdk-for-javascript/v2/developer-guide/configuring-the-jssdk.html) + +#### 4) Package and publish your build + +Install the `aws-sdk`: + + npm install aws-sdk + +Then publish: + + node-pre-gyp package publish + +Note: if you hit an error like `Hostname/IP doesn't match certificate's altnames` it may mean that you need to provide the `region` option in your config. + +## Appveyor Automation + +[Appveyor](http://www.appveyor.com/) can build binaries and publish the results per commit and supports: + + - Windows Visual Studio 2013 and related compilers + - Both 64 bit (x64) and 32 bit (x86) build configurations + - Multiple Node.js versions + +For an example of doing this see [node-sqlite3's appveyor.yml](https://github.com/mapbox/node-sqlite3/blob/master/appveyor.yml). + +Below is a guide to getting set up: + +#### 1) Create a free Appveyor account + +Go to https://ci.appveyor.com/signup/free and sign in with your GitHub account. + +#### 2) Create a new project + +Go to https://ci.appveyor.com/projects/new and select the GitHub repo for your module + +#### 3) Add appveyor.yml and push it + +Once you have committed an `appveyor.yml` ([appveyor.yml reference](http://www.appveyor.com/docs/appveyor-yml)) to your GitHub repo and pushed it AppVeyor should automatically start building your project. + +#### 4) Create secure variables + +Encrypt your S3 AWS keys by going to and hitting the `encrypt` button. + +Then paste the result into your `appveyor.yml` + +```yml +environment: + AWS_ACCESS_KEY_ID: + secure: Dn9HKdLNYvDgPdQOzRq/DqZ/MPhjknRHB1o+/lVU8MA= + AWS_SECRET_ACCESS_KEY: + secure: W1rwNoSnOku1r+28gnoufO8UA8iWADmL1LiiwH9IOkIVhDTNGdGPJqAlLjNqwLnL +``` + +NOTE: keys are per account but not per repo (this is difference than Travis where keys are per repo but not related to the account used to encrypt them). + +#### 5) Hook up publishing + +Just put `node-pre-gyp package publish` in your `appveyor.yml` after `npm install`. + +#### 6) Publish when you want + +You might wish to publish binaries only on a specific commit. To do this you could borrow from the [Travis CI idea of commit keywords](http://about.travis-ci.org/docs/user/how-to-skip-a-build/) and add special handling for commit messages with `[publish binary]`: + + SET CM=%APPVEYOR_REPO_COMMIT_MESSAGE% + if not "%CM%" == "%CM:[publish binary]=%" node-pre-gyp --msvs_version=2013 publish + +If your commit message contains special characters (e.g. `&`) this method might fail. An alternative is to use PowerShell, which gives you additional possibilities, like ignoring case by using `ToLower()`: + + ps: if($env:APPVEYOR_REPO_COMMIT_MESSAGE.ToLower().Contains('[publish binary]')) { node-pre-gyp --msvs_version=2013 publish } + +Remember this publishing is not the same as `npm publish`. We're just talking about the binary module here and not your entire npm package. + +## Travis Automation + +[Travis](https://travis-ci.org/) can push to S3 after a successful build and supports both: + + - Ubuntu Precise and OS X (64 bit) + - Multiple Node.js versions + +For an example of doing this see [node-add-example's .travis.yml](https://github.com/springmeyer/node-addon-example/blob/2ff60a8ded7f042864ad21db00c3a5a06cf47075/.travis.yml). + +Note: if you need 32 bit binaries, this can be done from a 64 bit Travis machine. See [the node-sqlite3 scripts for an example of doing this](https://github.com/mapbox/node-sqlite3/blob/bae122aa6a2b8a45f6b717fab24e207740e32b5d/scripts/build_against_node.sh#L54-L74). + +Below is a guide to getting set up: + +#### 1) Install the Travis gem + + gem install travis + +#### 2) Create secure variables + +Make sure you run this command from within the directory of your module. + +Use `travis-encrypt` like: + + travis encrypt AWS_ACCESS_KEY_ID=${node_pre_gyp_accessKeyId} + travis encrypt AWS_SECRET_ACCESS_KEY=${node_pre_gyp_secretAccessKey} + +Then put those values in your `.travis.yml` like: + +```yaml +env: + global: + - secure: F+sEL/v56CzHqmCSSES4pEyC9NeQlkoR0Gs/ZuZxX1ytrj8SKtp3MKqBj7zhIclSdXBz4Ev966Da5ctmcTd410p0b240MV6BVOkLUtkjZJyErMBOkeb8n8yVfSoeMx8RiIhBmIvEn+rlQq+bSFis61/JkE9rxsjkGRZi14hHr4M= + - secure: o2nkUQIiABD139XS6L8pxq3XO5gch27hvm/gOdV+dzNKc/s2KomVPWcOyXNxtJGhtecAkABzaW8KHDDi5QL1kNEFx6BxFVMLO8rjFPsMVaBG9Ks6JiDQkkmrGNcnVdxI/6EKTLHTH5WLsz8+J7caDBzvKbEfTux5EamEhxIWgrI= +``` + +More details on Travis encryption at http://about.travis-ci.org/docs/user/encryption-keys/. + +#### 3) Hook up publishing + +Just put `node-pre-gyp package publish` in your `.travis.yml` after `npm install`. + +##### OS X publishing + +If you want binaries for OS X in addition to linux you can enable [multi-os for Travis](http://docs.travis-ci.com/user/multi-os/#Setting-.travis.yml) + +Use a configuration like: + +```yml + +language: cpp + +os: +- linux +- osx + +env: + matrix: + - NODE_VERSION="4" + - NODE_VERSION="6" + +before_install: +- rm -rf ~/.nvm/ && git clone --depth 1 https://github.com/creationix/nvm.git ~/.nvm +- source ~/.nvm/nvm.sh +- nvm install $NODE_VERSION +- nvm use $NODE_VERSION +``` + +See [Travis OS X Gotchas](#travis-os-x-gotchas) for why we replace `language: node_js` and `node_js:` sections with `language: cpp` and a custom matrix. + +Also create platform specific sections for any deps that need install. For example if you need libpng: + +```yml +- if [ $(uname -s) == 'Linux' ]; then apt-get install libpng-dev; fi; +- if [ $(uname -s) == 'Darwin' ]; then brew install libpng; fi; +``` + +For detailed multi-OS examples see [node-mapnik](https://github.com/mapnik/node-mapnik/blob/master/.travis.yml) and [node-sqlite3](https://github.com/mapbox/node-sqlite3/blob/master/.travis.yml). + +##### Travis OS X Gotchas + +First, unlike the Travis Linux machines, the OS X machines do not put `node-pre-gyp` on PATH by default. To do so you will need to: + +```sh +export PATH=$(pwd)/node_modules/.bin:${PATH} +``` + +Second, the OS X machines do not support using a matrix for installing different Node.js versions. So you need to bootstrap the installation of Node.js in a cross platform way. + +By doing: + +```yml +env: + matrix: + - NODE_VERSION="4" + - NODE_VERSION="6" + +before_install: + - rm -rf ~/.nvm/ && git clone --depth 1 https://github.com/creationix/nvm.git ~/.nvm + - source ~/.nvm/nvm.sh + - nvm install $NODE_VERSION + - nvm use $NODE_VERSION +``` + +You can easily recreate the previous behavior of this matrix: + +```yml +node_js: + - "4" + - "6" +``` + +#### 4) Publish when you want + +You might wish to publish binaries only on a specific commit. To do this you could borrow from the [Travis CI idea of commit keywords](http://about.travis-ci.org/docs/user/how-to-skip-a-build/) and add special handling for commit messages with `[publish binary]`: + + COMMIT_MESSAGE=$(git log --format=%B --no-merges -n 1 | tr -d '\n') + if [[ ${COMMIT_MESSAGE} =~ "[publish binary]" ]]; then node-pre-gyp publish; fi; + +Then you can trigger new binaries to be built like: + + git commit -a -m "[publish binary]" + +Or, if you don't have any changes to make simply run: + + git commit --allow-empty -m "[publish binary]" + +WARNING: if you are working in a pull request and publishing binaries from there then you will want to avoid double publishing when Travis CI builds both the `push` and `pr`. You only want to run the publish on the `push` commit. See https://github.com/Project-OSRM/node-osrm/blob/8eb837abe2e2e30e595093d16e5354bc5c573575/scripts/is_pr_merge.sh which is called from https://github.com/Project-OSRM/node-osrm/blob/8eb837abe2e2e30e595093d16e5354bc5c573575/scripts/publish.sh for an example of how to do this. + +Remember this publishing is not the same as `npm publish`. We're just talking about the binary module here and not your entire npm package. To automate the publishing of your entire package to npm on Travis see http://about.travis-ci.org/docs/user/deployment/npm/ + +# Versioning + +The `binary` properties of `module_path`, `remote_path`, and `package_name` support variable substitution. The strings are evaluated by `node-pre-gyp` depending on your system and any custom build flags you passed. + + - `node_abi`: The node C++ `ABI` number. This value is available in Javascript as `process.versions.modules` as of [`>= v0.10.4 >= v0.11.7`](https://github.com/joyent/node/commit/ccabd4a6fa8a6eb79d29bc3bbe9fe2b6531c2d8e) and in C++ as the `NODE_MODULE_VERSION` define much earlier. For versions of Node before this was available we fallback to the V8 major and minor version. + - `platform` matches node's `process.platform` like `linux`, `darwin`, and `win32` unless the user passed the `--target_platform` option to override. + - `arch` matches node's `process.arch` like `x64` or `ia32` unless the user passes the `--target_arch` option to override. + - `libc` matches `require('detect-libc').family` like `glibc` or `musl` unless the user passes the `--target_libc` option to override. + - `configuration` - Either 'Release' or 'Debug' depending on if `--debug` is passed during the build. + - `module_name` - the `binary.module_name` attribute from `package.json`. + - `version` - the semver `version` value for your module from `package.json` (NOTE: ignores the `semver.build` property). + - `major`, `minor`, `patch`, and `prelease` match the individual semver values for your module's `version` + - `build` - the sevmer `build` value. For example it would be `this.that` if your package.json `version` was `v1.0.0+this.that` + - `prerelease` - the semver `prerelease` value. For example it would be `alpha.beta` if your package.json `version` was `v1.0.0-alpha.beta` + + +The options are visible in the code at + +# Download binary files from a mirror + +S3 is broken in China for the well known reason. + +Using the `npm` config argument: `--{module_name}_binary_host_mirror` can download binary files through a mirror, `-` in `module_name` will be replaced with `_`. + +e.g.: Install [v8-profiler](https://www.npmjs.com/package/v8-profiler) from `npm`. + +```bash +$ npm install v8-profiler --profiler_binary_host_mirror=https://npm.taobao.org/mirrors/node-inspector/ +``` + +e.g.: Install [canvas-prebuilt](https://www.npmjs.com/package/canvas-prebuilt) from `npm`. + +```bash +$ npm install canvas-prebuilt --canvas_prebuilt_binary_host_mirror=https://npm.taobao.org/mirrors/canvas-prebuilt/ +``` diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/bin/node-pre-gyp b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/bin/node-pre-gyp new file mode 100644 index 00000000..c38d34d1 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/bin/node-pre-gyp @@ -0,0 +1,4 @@ +#!/usr/bin/env node +'use strict'; + +require('../lib/main'); diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/bin/node-pre-gyp.cmd b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/bin/node-pre-gyp.cmd new file mode 100644 index 00000000..46e14b54 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/bin/node-pre-gyp.cmd @@ -0,0 +1,2 @@ +@echo off +node "%~dp0\node-pre-gyp" %* diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/contributing.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/contributing.md new file mode 100644 index 00000000..4038fa6a --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/contributing.md @@ -0,0 +1,10 @@ +# Contributing + + +### Releasing a new version: + +- Ensure tests are passing on travis and appveyor +- Run `node scripts/abi_crosswalk.js` and commit any changes +- Update the changelog +- Tag a new release like: `git tag -a v0.6.34 -m "tagging v0.6.34" && git push --tags` +- Run `npm publish` diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/build.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/build.js new file mode 100644 index 00000000..e8a1459d --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/build.js @@ -0,0 +1,51 @@ +'use strict'; + +module.exports = exports = build; + +exports.usage = 'Attempts to compile the module by dispatching to node-gyp or nw-gyp'; + +const napi = require('./util/napi.js'); +const compile = require('./util/compile.js'); +const handle_gyp_opts = require('./util/handle_gyp_opts.js'); +const configure = require('./configure.js'); + +function do_build(gyp, argv, callback) { + handle_gyp_opts(gyp, argv, (err, result) => { + let final_args = ['build'].concat(result.gyp).concat(result.pre); + if (result.unparsed.length > 0) { + final_args = final_args. + concat(['--']). + concat(result.unparsed); + } + if (!err && result.opts.napi_build_version) { + napi.swap_build_dir_in(result.opts.napi_build_version); + } + compile.run_gyp(final_args, result.opts, (err2) => { + if (result.opts.napi_build_version) { + napi.swap_build_dir_out(result.opts.napi_build_version); + } + return callback(err2); + }); + }); +} + +function build(gyp, argv, callback) { + + // Form up commands to pass to node-gyp: + // We map `node-pre-gyp build` to `node-gyp configure build` so that we do not + // trigger a clean and therefore do not pay the penalty of a full recompile + if (argv.length && (argv.indexOf('rebuild') > -1)) { + argv.shift(); // remove `rebuild` + // here we map `node-pre-gyp rebuild` to `node-gyp rebuild` which internally means + // "clean + configure + build" and triggers a full recompile + compile.run_gyp(['clean'], {}, (err3) => { + if (err3) return callback(err3); + configure(gyp, argv, (err4) => { + if (err4) return callback(err4); + return do_build(gyp, argv, callback); + }); + }); + } else { + return do_build(gyp, argv, callback); + } +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/clean.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/clean.js new file mode 100644 index 00000000..e6933923 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/clean.js @@ -0,0 +1,31 @@ +'use strict'; + +module.exports = exports = clean; + +exports.usage = 'Removes the entire folder containing the compiled .node module'; + +const rm = require('rimraf'); +const exists = require('fs').exists || require('path').exists; +const versioning = require('./util/versioning.js'); +const napi = require('./util/napi.js'); +const path = require('path'); + +function clean(gyp, argv, callback) { + const package_json = gyp.package_json; + const napi_build_version = napi.get_napi_build_version_from_command_args(argv); + const opts = versioning.evaluate(package_json, gyp.opts, napi_build_version); + const to_delete = opts.module_path; + if (!to_delete) { + return callback(new Error('module_path is empty, refusing to delete')); + } else if (path.normalize(to_delete) === path.normalize(process.cwd())) { + return callback(new Error('module_path is not set, refusing to delete')); + } else { + exists(to_delete, (found) => { + if (found) { + if (!gyp.opts.silent_clean) console.log('[' + package_json.name + '] Removing "%s"', to_delete); + return rm(to_delete, callback); + } + return callback(); + }); + } +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/configure.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/configure.js new file mode 100644 index 00000000..1337c0cb --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/configure.js @@ -0,0 +1,52 @@ +'use strict'; + +module.exports = exports = configure; + +exports.usage = 'Attempts to configure node-gyp or nw-gyp build'; + +const napi = require('./util/napi.js'); +const compile = require('./util/compile.js'); +const handle_gyp_opts = require('./util/handle_gyp_opts.js'); + +function configure(gyp, argv, callback) { + handle_gyp_opts(gyp, argv, (err, result) => { + let final_args = result.gyp.concat(result.pre); + // pull select node-gyp configure options out of the npm environ + const known_gyp_args = ['dist-url', 'python', 'nodedir', 'msvs_version']; + known_gyp_args.forEach((key) => { + const val = gyp.opts[key] || gyp.opts[key.replace('-', '_')]; + if (val) { + final_args.push('--' + key + '=' + val); + } + }); + // --ensure=false tell node-gyp to re-install node development headers + // but it is only respected by node-gyp install, so we have to call install + // as a separate step if the user passes it + if (gyp.opts.ensure === false) { + const install_args = final_args.concat(['install', '--ensure=false']); + compile.run_gyp(install_args, result.opts, (err2) => { + if (err2) return callback(err2); + if (result.unparsed.length > 0) { + final_args = final_args. + concat(['--']). + concat(result.unparsed); + } + compile.run_gyp(['configure'].concat(final_args), result.opts, (err3) => { + return callback(err3); + }); + }); + } else { + if (result.unparsed.length > 0) { + final_args = final_args. + concat(['--']). + concat(result.unparsed); + } + compile.run_gyp(['configure'].concat(final_args), result.opts, (err4) => { + if (!err4 && result.opts.napi_build_version) { + napi.swap_build_dir_out(result.opts.napi_build_version); + } + return callback(err4); + }); + } + }); +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/info.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/info.js new file mode 100644 index 00000000..ba22f327 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/info.js @@ -0,0 +1,38 @@ +'use strict'; + +module.exports = exports = info; + +exports.usage = 'Lists all published binaries (requires aws-sdk)'; + +const log = require('npmlog'); +const versioning = require('./util/versioning.js'); +const s3_setup = require('./util/s3_setup.js'); + +function info(gyp, argv, callback) { + const package_json = gyp.package_json; + const opts = versioning.evaluate(package_json, gyp.opts); + const config = {}; + s3_setup.detect(opts, config); + const s3 = s3_setup.get_s3(config); + const s3_opts = { + Bucket: config.bucket, + Prefix: config.prefix + }; + s3.listObjects(s3_opts, (err, meta) => { + if (err && err.code === 'NotFound') { + return callback(new Error('[' + package_json.name + '] Not found: https://' + s3_opts.Bucket + '.s3.amazonaws.com/' + config.prefix)); + } else if (err) { + return callback(err); + } else { + log.verbose(JSON.stringify(meta, null, 1)); + if (meta && meta.Contents) { + meta.Contents.forEach((obj) => { + console.log(obj.Key); + }); + } else { + console.error('[' + package_json.name + '] No objects found at https://' + s3_opts.Bucket + '.s3.amazonaws.com/' + config.prefix); + } + return callback(); + } + }); +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/install.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/install.js new file mode 100644 index 00000000..617dd866 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/install.js @@ -0,0 +1,235 @@ +'use strict'; + +module.exports = exports = install; + +exports.usage = 'Attempts to install pre-built binary for module'; + +const fs = require('fs'); +const path = require('path'); +const log = require('npmlog'); +const existsAsync = fs.exists || path.exists; +const versioning = require('./util/versioning.js'); +const napi = require('./util/napi.js'); +const makeDir = require('make-dir'); +// for fetching binaries +const fetch = require('node-fetch'); +const tar = require('tar'); + +let npgVersion = 'unknown'; +try { + // Read own package.json to get the current node-pre-pyp version. + const ownPackageJSON = fs.readFileSync(path.join(__dirname, '..', 'package.json'), 'utf8'); + npgVersion = JSON.parse(ownPackageJSON).version; +} catch (e) { + // do nothing +} + +function place_binary(uri, targetDir, opts, callback) { + log.http('GET', uri); + + // Try getting version info from the currently running npm. + const envVersionInfo = process.env.npm_config_user_agent || + 'node ' + process.version; + + const sanitized = uri.replace('+', '%2B'); + const requestOpts = { + uri: sanitized, + headers: { + 'User-Agent': 'node-pre-gyp (v' + npgVersion + ', ' + envVersionInfo + ')' + }, + follow_max: 10 + }; + + if (opts.cafile) { + try { + requestOpts.ca = fs.readFileSync(opts.cafile); + } catch (e) { + return callback(e); + } + } else if (opts.ca) { + requestOpts.ca = opts.ca; + } + + const proxyUrl = opts.proxy || + process.env.http_proxy || + process.env.HTTP_PROXY || + process.env.npm_config_proxy; + let agent; + if (proxyUrl) { + const ProxyAgent = require('https-proxy-agent'); + agent = new ProxyAgent(proxyUrl); + log.http('download', 'proxy agent configured using: "%s"', proxyUrl); + } + + fetch(sanitized, { agent }) + .then((res) => { + if (!res.ok) { + throw new Error(`response status ${res.status} ${res.statusText} on ${sanitized}`); + } + const dataStream = res.body; + + return new Promise((resolve, reject) => { + let extractions = 0; + const countExtractions = (entry) => { + extractions += 1; + log.info('install', 'unpacking %s', entry.path); + }; + + dataStream.pipe(extract(targetDir, countExtractions)) + .on('error', (e) => { + reject(e); + }); + dataStream.on('end', () => { + resolve(`extracted file count: ${extractions}`); + }); + dataStream.on('error', (e) => { + reject(e); + }); + }); + }) + .then((text) => { + log.info(text); + callback(); + }) + .catch((e) => { + log.error(`install ${e.message}`); + callback(e); + }); +} + +function extract(to, onentry) { + return tar.extract({ + cwd: to, + strip: 1, + onentry + }); +} + +function extract_from_local(from, targetDir, callback) { + if (!fs.existsSync(from)) { + return callback(new Error('Cannot find file ' + from)); + } + log.info('Found local file to extract from ' + from); + + // extract helpers + let extractCount = 0; + function countExtractions(entry) { + extractCount += 1; + log.info('install', 'unpacking ' + entry.path); + } + function afterExtract(err) { + if (err) return callback(err); + if (extractCount === 0) { + return callback(new Error('There was a fatal problem while extracting the tarball')); + } + log.info('tarball', 'done parsing tarball'); + callback(); + } + + fs.createReadStream(from).pipe(extract(targetDir, countExtractions)) + .on('close', afterExtract) + .on('error', afterExtract); +} + +function do_build(gyp, argv, callback) { + const args = ['rebuild'].concat(argv); + gyp.todo.push({ name: 'build', args: args }); + process.nextTick(callback); +} + +function print_fallback_error(err, opts, package_json) { + const fallback_message = ' (falling back to source compile with node-gyp)'; + let full_message = ''; + if (err.statusCode !== undefined) { + // If we got a network response it but failed to download + // it means remote binaries are not available, so let's try to help + // the user/developer with the info to debug why + full_message = 'Pre-built binaries not found for ' + package_json.name + '@' + package_json.version; + full_message += ' and ' + opts.runtime + '@' + (opts.target || process.versions.node) + ' (' + opts.node_abi + ' ABI, ' + opts.libc + ')'; + full_message += fallback_message; + log.warn('Tried to download(' + err.statusCode + '): ' + opts.hosted_tarball); + log.warn(full_message); + log.http(err.message); + } else { + // If we do not have a statusCode that means an unexpected error + // happened and prevented an http response, so we output the exact error + full_message = 'Pre-built binaries not installable for ' + package_json.name + '@' + package_json.version; + full_message += ' and ' + opts.runtime + '@' + (opts.target || process.versions.node) + ' (' + opts.node_abi + ' ABI, ' + opts.libc + ')'; + full_message += fallback_message; + log.warn(full_message); + log.warn('Hit error ' + err.message); + } +} + +// +// install +// +function install(gyp, argv, callback) { + const package_json = gyp.package_json; + const napi_build_version = napi.get_napi_build_version_from_command_args(argv); + const source_build = gyp.opts['build-from-source'] || gyp.opts.build_from_source; + const update_binary = gyp.opts['update-binary'] || gyp.opts.update_binary; + const should_do_source_build = source_build === package_json.name || (source_build === true || source_build === 'true'); + if (should_do_source_build) { + log.info('build', 'requesting source compile'); + return do_build(gyp, argv, callback); + } else { + const fallback_to_build = gyp.opts['fallback-to-build'] || gyp.opts.fallback_to_build; + let should_do_fallback_build = fallback_to_build === package_json.name || (fallback_to_build === true || fallback_to_build === 'true'); + // but allow override from npm + if (process.env.npm_config_argv) { + const cooked = JSON.parse(process.env.npm_config_argv).cooked; + const match = cooked.indexOf('--fallback-to-build'); + if (match > -1 && cooked.length > match && cooked[match + 1] === 'false') { + should_do_fallback_build = false; + log.info('install', 'Build fallback disabled via npm flag: --fallback-to-build=false'); + } + } + let opts; + try { + opts = versioning.evaluate(package_json, gyp.opts, napi_build_version); + } catch (err) { + return callback(err); + } + + opts.ca = gyp.opts.ca; + opts.cafile = gyp.opts.cafile; + + const from = opts.hosted_tarball; + const to = opts.module_path; + const binary_module = path.join(to, opts.module_name + '.node'); + existsAsync(binary_module, (found) => { + if (!update_binary) { + if (found) { + console.log('[' + package_json.name + '] Success: "' + binary_module + '" already installed'); + console.log('Pass --update-binary to reinstall or --build-from-source to recompile'); + return callback(); + } + log.info('check', 'checked for "' + binary_module + '" (not found)'); + } + + makeDir(to).then(() => { + const fileName = from.startsWith('file://') && from.slice('file://'.length); + if (fileName) { + extract_from_local(fileName, to, after_place); + } else { + place_binary(from, to, opts, after_place); + } + }).catch((err) => { + after_place(err); + }); + + function after_place(err) { + if (err && should_do_fallback_build) { + print_fallback_error(err, opts, package_json); + return do_build(gyp, argv, callback); + } else if (err) { + return callback(err); + } else { + console.log('[' + package_json.name + '] Success: "' + binary_module + '" is installed via remote'); + return callback(); + } + } + }); + } +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/main.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/main.js new file mode 100644 index 00000000..bae32acb --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/main.js @@ -0,0 +1,125 @@ +'use strict'; + +/** + * Set the title. + */ + +process.title = 'node-pre-gyp'; + +const node_pre_gyp = require('../'); +const log = require('npmlog'); + +/** + * Process and execute the selected commands. + */ + +const prog = new node_pre_gyp.Run({ argv: process.argv }); +let completed = false; + +if (prog.todo.length === 0) { + if (~process.argv.indexOf('-v') || ~process.argv.indexOf('--version')) { + console.log('v%s', prog.version); + process.exit(0); + } else if (~process.argv.indexOf('-h') || ~process.argv.indexOf('--help')) { + console.log('%s', prog.usage()); + process.exit(0); + } + console.log('%s', prog.usage()); + process.exit(1); +} + +// if --no-color is passed +if (prog.opts && Object.hasOwnProperty.call(prog, 'color') && !prog.opts.color) { + log.disableColor(); +} + +log.info('it worked if it ends with', 'ok'); +log.verbose('cli', process.argv); +log.info('using', process.title + '@%s', prog.version); +log.info('using', 'node@%s | %s | %s', process.versions.node, process.platform, process.arch); + + +/** + * Change dir if -C/--directory was passed. + */ + +const dir = prog.opts.directory; +if (dir) { + const fs = require('fs'); + try { + const stat = fs.statSync(dir); + if (stat.isDirectory()) { + log.info('chdir', dir); + process.chdir(dir); + } else { + log.warn('chdir', dir + ' is not a directory'); + } + } catch (e) { + if (e.code === 'ENOENT') { + log.warn('chdir', dir + ' is not a directory'); + } else { + log.warn('chdir', 'error during chdir() "%s"', e.message); + } + } +} + +function run() { + const command = prog.todo.shift(); + if (!command) { + // done! + completed = true; + log.info('ok'); + return; + } + + // set binary.host when appropriate. host determines the s3 target bucket. + const target = prog.setBinaryHostProperty(command.name); + if (target && ['install', 'publish', 'unpublish', 'info'].indexOf(command.name) >= 0) { + log.info('using binary.host: ' + prog.package_json.binary.host); + } + + prog.commands[command.name](command.args, function(err) { + if (err) { + log.error(command.name + ' error'); + log.error('stack', err.stack); + errorMessage(); + log.error('not ok'); + console.log(err.message); + return process.exit(1); + } + const args_array = [].slice.call(arguments, 1); + if (args_array.length) { + console.log.apply(console, args_array); + } + // now run the next command in the queue + process.nextTick(run); + }); +} + +process.on('exit', (code) => { + if (!completed && !code) { + log.error('Completion callback never invoked!'); + errorMessage(); + process.exit(6); + } +}); + +process.on('uncaughtException', (err) => { + log.error('UNCAUGHT EXCEPTION'); + log.error('stack', err.stack); + errorMessage(); + process.exit(7); +}); + +function errorMessage() { + // copied from npm's lib/util/error-handler.js + const os = require('os'); + log.error('System', os.type() + ' ' + os.release()); + log.error('command', process.argv.map(JSON.stringify).join(' ')); + log.error('cwd', process.cwd()); + log.error('node -v', process.version); + log.error(process.title + ' -v', 'v' + prog.package.version); +} + +// start running the given commands! +run(); diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/node-pre-gyp.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/node-pre-gyp.js new file mode 100644 index 00000000..dc18e749 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/node-pre-gyp.js @@ -0,0 +1,309 @@ +'use strict'; + +/** + * Module exports. + */ + +module.exports = exports; + +/** + * Module dependencies. + */ + +// load mocking control function for accessing s3 via https. the function is a noop always returning +// false if not mocking. +exports.mockS3Http = require('./util/s3_setup').get_mockS3Http(); +exports.mockS3Http('on'); +const mocking = exports.mockS3Http('get'); + + +const fs = require('fs'); +const path = require('path'); +const nopt = require('nopt'); +const log = require('npmlog'); +log.disableProgress(); +const napi = require('./util/napi.js'); + +const EE = require('events').EventEmitter; +const inherits = require('util').inherits; +const cli_commands = [ + 'clean', + 'install', + 'reinstall', + 'build', + 'rebuild', + 'package', + 'testpackage', + 'publish', + 'unpublish', + 'info', + 'testbinary', + 'reveal', + 'configure' +]; +const aliases = {}; + +// differentiate node-pre-gyp's logs from npm's +log.heading = 'node-pre-gyp'; + +if (mocking) { + log.warn(`mocking s3 to ${process.env.node_pre_gyp_mock_s3}`); +} + +// this is a getter to avoid circular reference warnings with node v14. +Object.defineProperty(exports, 'find', { + get: function() { + return require('./pre-binding').find; + }, + enumerable: true +}); + +// in the following, "my_module" is using node-pre-gyp to +// prebuild and install pre-built binaries. "main_module" +// is using "my_module". +// +// "bin/node-pre-gyp" invokes Run() without a path. the +// expectation is that the working directory is the package +// root "my_module". this is true because in all cases npm is +// executing a script in the context of "my_module". +// +// "pre-binding.find()" is executed by "my_module" but in the +// context of "main_module". this is because "main_module" is +// executing and requires "my_module" which is then executing +// "pre-binding.find()" via "node-pre-gyp.find()", so the working +// directory is that of "main_module". +// +// that's why "find()" must pass the path to package.json. +// +function Run({ package_json_path = './package.json', argv }) { + this.package_json_path = package_json_path; + this.commands = {}; + + const self = this; + cli_commands.forEach((command) => { + self.commands[command] = function(argvx, callback) { + log.verbose('command', command, argvx); + return require('./' + command)(self, argvx, callback); + }; + }); + + this.parseArgv(argv); + + // this is set to true after the binary.host property was set to + // either staging_host or production_host. + this.binaryHostSet = false; +} +inherits(Run, EE); +exports.Run = Run; +const proto = Run.prototype; + +/** + * Export the contents of the package.json. + */ + +proto.package = require('../package.json'); + +/** + * nopt configuration definitions + */ + +proto.configDefs = { + help: Boolean, // everywhere + arch: String, // 'configure' + debug: Boolean, // 'build' + directory: String, // bin + proxy: String, // 'install' + loglevel: String // everywhere +}; + +/** + * nopt shorthands + */ + +proto.shorthands = { + release: '--no-debug', + C: '--directory', + debug: '--debug', + j: '--jobs', + silent: '--loglevel=silent', + silly: '--loglevel=silly', + verbose: '--loglevel=verbose' +}; + +/** + * expose the command aliases for the bin file to use. + */ + +proto.aliases = aliases; + +/** + * Parses the given argv array and sets the 'opts', 'argv', + * 'command', and 'package_json' properties. + */ + +proto.parseArgv = function parseOpts(argv) { + this.opts = nopt(this.configDefs, this.shorthands, argv); + this.argv = this.opts.argv.remain.slice(); + const commands = this.todo = []; + + // create a copy of the argv array with aliases mapped + argv = this.argv.map((arg) => { + // is this an alias? + if (arg in this.aliases) { + arg = this.aliases[arg]; + } + return arg; + }); + + // process the mapped args into "command" objects ("name" and "args" props) + argv.slice().forEach((arg) => { + if (arg in this.commands) { + const args = argv.splice(0, argv.indexOf(arg)); + argv.shift(); + if (commands.length > 0) { + commands[commands.length - 1].args = args; + } + commands.push({ name: arg, args: [] }); + } + }); + if (commands.length > 0) { + commands[commands.length - 1].args = argv.splice(0); + } + + + // if a directory was specified package.json is assumed to be relative + // to it. + let package_json_path = this.package_json_path; + if (this.opts.directory) { + package_json_path = path.join(this.opts.directory, package_json_path); + } + + this.package_json = JSON.parse(fs.readFileSync(package_json_path)); + + // expand commands entries for multiple napi builds + this.todo = napi.expand_commands(this.package_json, this.opts, commands); + + // support for inheriting config env variables from npm + const npm_config_prefix = 'npm_config_'; + Object.keys(process.env).forEach((name) => { + if (name.indexOf(npm_config_prefix) !== 0) return; + const val = process.env[name]; + if (name === npm_config_prefix + 'loglevel') { + log.level = val; + } else { + // add the user-defined options to the config + name = name.substring(npm_config_prefix.length); + // avoid npm argv clobber already present args + // which avoids problem of 'npm test' calling + // script that runs unique npm install commands + if (name === 'argv') { + if (this.opts.argv && + this.opts.argv.remain && + this.opts.argv.remain.length) { + // do nothing + } else { + this.opts[name] = val; + } + } else { + this.opts[name] = val; + } + } + }); + + if (this.opts.loglevel) { + log.level = this.opts.loglevel; + } + log.resume(); +}; + +/** + * allow the binary.host property to be set at execution time. + * + * for this to take effect requires all the following to be true. + * - binary is a property in package.json + * - binary.host is falsey + * - binary.staging_host is not empty + * - binary.production_host is not empty + * + * if any of the previous checks fail then the function returns an empty string + * and makes no changes to package.json's binary property. + * + * + * if command is "publish" then the default is set to "binary.staging_host" + * if command is not "publish" the the default is set to "binary.production_host" + * + * if the command-line option '--s3_host' is set to "staging" or "production" then + * "binary.host" is set to the specified "staging_host" or "production_host". if + * '--s3_host' is any other value an exception is thrown. + * + * if '--s3_host' is not present then "binary.host" is set to the default as above. + * + * this strategy was chosen so that any command other than "publish" or "unpublish" uses "production" + * as the default without requiring any command-line options but that "publish" and "unpublish" require + * '--s3_host production_host' to be specified in order to *really* publish (or unpublish). publishing + * to staging can be done freely without worrying about disturbing any production releases. + */ +proto.setBinaryHostProperty = function(command) { + if (this.binaryHostSet) { + return this.package_json.binary.host; + } + const p = this.package_json; + // don't set anything if host is present. it must be left blank to trigger this. + if (!p || !p.binary || p.binary.host) { + return ''; + } + // and both staging and production must be present. errors will be reported later. + if (!p.binary.staging_host || !p.binary.production_host) { + return ''; + } + let target = 'production_host'; + if (command === 'publish' || command === 'unpublish') { + target = 'staging_host'; + } + // the environment variable has priority over the default or the command line. if + // either the env var or the command line option are invalid throw an error. + const npg_s3_host = process.env.node_pre_gyp_s3_host; + if (npg_s3_host === 'staging' || npg_s3_host === 'production') { + target = `${npg_s3_host}_host`; + } else if (this.opts['s3_host'] === 'staging' || this.opts['s3_host'] === 'production') { + target = `${this.opts['s3_host']}_host`; + } else if (this.opts['s3_host'] || npg_s3_host) { + throw new Error(`invalid s3_host ${this.opts['s3_host'] || npg_s3_host}`); + } + + p.binary.host = p.binary[target]; + this.binaryHostSet = true; + + return p.binary.host; +}; + +/** + * Returns the usage instructions for node-pre-gyp. + */ + +proto.usage = function usage() { + const str = [ + '', + ' Usage: node-pre-gyp [options]', + '', + ' where is one of:', + cli_commands.map((c) => { + return ' - ' + c + ' - ' + require('./' + c).usage; + }).join('\n'), + '', + 'node-pre-gyp@' + this.version + ' ' + path.resolve(__dirname, '..'), + 'node@' + process.versions.node + ].join('\n'); + return str; +}; + +/** + * Version number getter. + */ + +Object.defineProperty(proto, 'version', { + get: function() { + return this.package.version; + }, + enumerable: true +}); diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/package.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/package.js new file mode 100644 index 00000000..07349846 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/package.js @@ -0,0 +1,73 @@ +'use strict'; + +module.exports = exports = _package; + +exports.usage = 'Packs binary (and enclosing directory) into locally staged tarball'; + +const fs = require('fs'); +const path = require('path'); +const log = require('npmlog'); +const versioning = require('./util/versioning.js'); +const napi = require('./util/napi.js'); +const existsAsync = fs.exists || path.exists; +const makeDir = require('make-dir'); +const tar = require('tar'); + +function readdirSync(dir) { + let list = []; + const files = fs.readdirSync(dir); + + files.forEach((file) => { + const stats = fs.lstatSync(path.join(dir, file)); + if (stats.isDirectory()) { + list = list.concat(readdirSync(path.join(dir, file))); + } else { + list.push(path.join(dir, file)); + } + }); + return list; +} + +function _package(gyp, argv, callback) { + const package_json = gyp.package_json; + const napi_build_version = napi.get_napi_build_version_from_command_args(argv); + const opts = versioning.evaluate(package_json, gyp.opts, napi_build_version); + const from = opts.module_path; + const binary_module = path.join(from, opts.module_name + '.node'); + existsAsync(binary_module, (found) => { + if (!found) { + return callback(new Error('Cannot package because ' + binary_module + ' missing: run `node-pre-gyp rebuild` first')); + } + const tarball = opts.staged_tarball; + const filter_func = function(entry) { + const basename = path.basename(entry); + if (basename.length && basename[0] !== '.') { + console.log('packing ' + entry); + return true; + } else { + console.log('skipping ' + entry); + } + return false; + }; + makeDir(path.dirname(tarball)).then(() => { + let files = readdirSync(from); + const base = path.basename(from); + files = files.map((file) => { + return path.join(base, path.relative(from, file)); + }); + tar.create({ + portable: false, + gzip: true, + filter: filter_func, + file: tarball, + cwd: path.dirname(from) + }, files, (err2) => { + if (err2) console.error('[' + package_json.name + '] ' + err2.message); + else log.info('package', 'Binary staged at "' + tarball + '"'); + return callback(err2); + }); + }).catch((err) => { + return callback(err); + }); + }); +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/pre-binding.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/pre-binding.js new file mode 100644 index 00000000..e110fe38 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/pre-binding.js @@ -0,0 +1,34 @@ +'use strict'; + +const npg = require('..'); +const versioning = require('../lib/util/versioning.js'); +const napi = require('../lib/util/napi.js'); +const existsSync = require('fs').existsSync || require('path').existsSync; +const path = require('path'); + +module.exports = exports; + +exports.usage = 'Finds the require path for the node-pre-gyp installed module'; + +exports.validate = function(package_json, opts) { + versioning.validate_config(package_json, opts); +}; + +exports.find = function(package_json_path, opts) { + if (!existsSync(package_json_path)) { + throw new Error(package_json_path + 'does not exist'); + } + const prog = new npg.Run({ package_json_path, argv: process.argv }); + prog.setBinaryHostProperty(); + const package_json = prog.package_json; + + versioning.validate_config(package_json, opts); + let napi_build_version; + if (napi.get_napi_build_versions(package_json, opts)) { + napi_build_version = napi.get_best_napi_build_version(package_json, opts); + } + opts = opts || {}; + if (!opts.module_root) opts.module_root = path.dirname(package_json_path); + const meta = versioning.evaluate(package_json, opts, napi_build_version); + return meta.module; +}; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/publish.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/publish.js new file mode 100644 index 00000000..8367b150 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/publish.js @@ -0,0 +1,81 @@ +'use strict'; + +module.exports = exports = publish; + +exports.usage = 'Publishes pre-built binary (requires aws-sdk)'; + +const fs = require('fs'); +const path = require('path'); +const log = require('npmlog'); +const versioning = require('./util/versioning.js'); +const napi = require('./util/napi.js'); +const s3_setup = require('./util/s3_setup.js'); +const existsAsync = fs.exists || path.exists; +const url = require('url'); + +function publish(gyp, argv, callback) { + const package_json = gyp.package_json; + const napi_build_version = napi.get_napi_build_version_from_command_args(argv); + const opts = versioning.evaluate(package_json, gyp.opts, napi_build_version); + const tarball = opts.staged_tarball; + existsAsync(tarball, (found) => { + if (!found) { + return callback(new Error('Cannot publish because ' + tarball + ' missing: run `node-pre-gyp package` first')); + } + + log.info('publish', 'Detecting s3 credentials'); + const config = {}; + s3_setup.detect(opts, config); + const s3 = s3_setup.get_s3(config); + + const key_name = url.resolve(config.prefix, opts.package_name); + const s3_opts = { + Bucket: config.bucket, + Key: key_name + }; + log.info('publish', 'Authenticating with s3'); + log.info('publish', config); + + log.info('publish', 'Checking for existing binary at ' + opts.hosted_path); + s3.headObject(s3_opts, (err, meta) => { + if (meta) log.info('publish', JSON.stringify(meta)); + if (err && err.code === 'NotFound') { + // we are safe to publish because + // the object does not already exist + log.info('publish', 'Preparing to put object'); + const s3_put_opts = { + ACL: 'public-read', + Body: fs.createReadStream(tarball), + Key: key_name, + Bucket: config.bucket + }; + log.info('publish', 'Putting object', s3_put_opts.ACL, s3_put_opts.Bucket, s3_put_opts.Key); + try { + s3.putObject(s3_put_opts, (err2, resp) => { + log.info('publish', 'returned from putting object'); + if (err2) { + log.info('publish', 's3 putObject error: "' + err2 + '"'); + return callback(err2); + } + if (resp) log.info('publish', 's3 putObject response: "' + JSON.stringify(resp) + '"'); + log.info('publish', 'successfully put object'); + console.log('[' + package_json.name + '] published to ' + opts.hosted_path); + return callback(); + }); + } catch (err3) { + log.info('publish', 's3 putObject error: "' + err3 + '"'); + return callback(err3); + } + } else if (err) { + log.info('publish', 's3 headObject error: "' + err + '"'); + return callback(err); + } else { + log.error('publish', 'Cannot publish over existing version'); + log.error('publish', "Update the 'version' field in package.json and try again"); + log.error('publish', 'If the previous version was published in error see:'); + log.error('publish', '\t node-pre-gyp unpublish'); + return callback(new Error('Failed publishing to ' + opts.hosted_path)); + } + }); + }); +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/rebuild.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/rebuild.js new file mode 100644 index 00000000..31510fbd --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/rebuild.js @@ -0,0 +1,20 @@ +'use strict'; + +module.exports = exports = rebuild; + +exports.usage = 'Runs "clean" and "build" at once'; + +const napi = require('./util/napi.js'); + +function rebuild(gyp, argv, callback) { + const package_json = gyp.package_json; + let commands = [ + { name: 'clean', args: [] }, + { name: 'build', args: ['rebuild'] } + ]; + commands = napi.expand_commands(package_json, gyp.opts, commands); + for (let i = commands.length; i !== 0; i--) { + gyp.todo.unshift(commands[i - 1]); + } + process.nextTick(callback); +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/reinstall.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/reinstall.js new file mode 100644 index 00000000..a29b5c9b --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/reinstall.js @@ -0,0 +1,19 @@ +'use strict'; + +module.exports = exports = rebuild; + +exports.usage = 'Runs "clean" and "install" at once'; + +const napi = require('./util/napi.js'); + +function rebuild(gyp, argv, callback) { + const package_json = gyp.package_json; + let installArgs = []; + const napi_build_version = napi.get_best_napi_build_version(package_json, gyp.opts); + if (napi_build_version != null) installArgs = [napi.get_command_arg(napi_build_version)]; + gyp.todo.unshift( + { name: 'clean', args: [] }, + { name: 'install', args: installArgs } + ); + process.nextTick(callback); +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/reveal.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/reveal.js new file mode 100644 index 00000000..7255e5f0 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/reveal.js @@ -0,0 +1,32 @@ +'use strict'; + +module.exports = exports = reveal; + +exports.usage = 'Reveals data on the versioned binary'; + +const versioning = require('./util/versioning.js'); +const napi = require('./util/napi.js'); + +function unix_paths(key, val) { + return val && val.replace ? val.replace(/\\/g, '/') : val; +} + +function reveal(gyp, argv, callback) { + const package_json = gyp.package_json; + const napi_build_version = napi.get_napi_build_version_from_command_args(argv); + const opts = versioning.evaluate(package_json, gyp.opts, napi_build_version); + let hit = false; + // if a second arg is passed look to see + // if it is a known option + // console.log(JSON.stringify(gyp.opts,null,1)) + const remain = gyp.opts.argv.remain[gyp.opts.argv.remain.length - 1]; + if (remain && Object.hasOwnProperty.call(opts, remain)) { + console.log(opts[remain].replace(/\\/g, '/')); + hit = true; + } + // otherwise return all options as json + if (!hit) { + console.log(JSON.stringify(opts, unix_paths, 2)); + } + return callback(); +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/testbinary.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/testbinary.js new file mode 100644 index 00000000..429cb130 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/testbinary.js @@ -0,0 +1,79 @@ +'use strict'; + +module.exports = exports = testbinary; + +exports.usage = 'Tests that the binary.node can be required'; + +const path = require('path'); +const log = require('npmlog'); +const cp = require('child_process'); +const versioning = require('./util/versioning.js'); +const napi = require('./util/napi.js'); + +function testbinary(gyp, argv, callback) { + const args = []; + const options = {}; + let shell_cmd = process.execPath; + const package_json = gyp.package_json; + const napi_build_version = napi.get_napi_build_version_from_command_args(argv); + const opts = versioning.evaluate(package_json, gyp.opts, napi_build_version); + // skip validation for runtimes we don't explicitly support (like electron) + if (opts.runtime && + opts.runtime !== 'node-webkit' && + opts.runtime !== 'node') { + return callback(); + } + const nw = (opts.runtime && opts.runtime === 'node-webkit'); + // ensure on windows that / are used for require path + const binary_module = opts.module.replace(/\\/g, '/'); + if ((process.arch !== opts.target_arch) || + (process.platform !== opts.target_platform)) { + let msg = 'skipping validation since host platform/arch ('; + msg += process.platform + '/' + process.arch + ')'; + msg += ' does not match target ('; + msg += opts.target_platform + '/' + opts.target_arch + ')'; + log.info('validate', msg); + return callback(); + } + if (nw) { + options.timeout = 5000; + if (process.platform === 'darwin') { + shell_cmd = 'node-webkit'; + } else if (process.platform === 'win32') { + shell_cmd = 'nw.exe'; + } else { + shell_cmd = 'nw'; + } + const modulePath = path.resolve(binary_module); + const appDir = path.join(__dirname, 'util', 'nw-pre-gyp'); + args.push(appDir); + args.push(modulePath); + log.info('validate', "Running test command: '" + shell_cmd + ' ' + args.join(' ') + "'"); + cp.execFile(shell_cmd, args, options, (err, stdout, stderr) => { + // check for normal timeout for node-webkit + if (err) { + if (err.killed === true && err.signal && err.signal.indexOf('SIG') > -1) { + return callback(); + } + const stderrLog = stderr.toString(); + log.info('stderr', stderrLog); + if (/^\s*Xlib:\s*extension\s*"RANDR"\s*missing\s*on\s*display\s*":\d+\.\d+"\.\s*$/.test(stderrLog)) { + log.info('RANDR', 'stderr contains only RANDR error, ignored'); + return callback(); + } + return callback(err); + } + return callback(); + }); + return; + } + args.push('--eval'); + args.push("require('" + binary_module.replace(/'/g, '\'') + "')"); + log.info('validate', "Running test command: '" + shell_cmd + ' ' + args.join(' ') + "'"); + cp.execFile(shell_cmd, args, options, (err, stdout, stderr) => { + if (err) { + return callback(err, { stdout: stdout, stderr: stderr }); + } + return callback(); + }); +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/testpackage.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/testpackage.js new file mode 100644 index 00000000..fab1911b --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/testpackage.js @@ -0,0 +1,53 @@ +'use strict'; + +module.exports = exports = testpackage; + +exports.usage = 'Tests that the staged package is valid'; + +const fs = require('fs'); +const path = require('path'); +const log = require('npmlog'); +const existsAsync = fs.exists || path.exists; +const versioning = require('./util/versioning.js'); +const napi = require('./util/napi.js'); +const testbinary = require('./testbinary.js'); +const tar = require('tar'); +const makeDir = require('make-dir'); + +function testpackage(gyp, argv, callback) { + const package_json = gyp.package_json; + const napi_build_version = napi.get_napi_build_version_from_command_args(argv); + const opts = versioning.evaluate(package_json, gyp.opts, napi_build_version); + const tarball = opts.staged_tarball; + existsAsync(tarball, (found) => { + if (!found) { + return callback(new Error('Cannot test package because ' + tarball + ' missing: run `node-pre-gyp package` first')); + } + const to = opts.module_path; + function filter_func(entry) { + log.info('install', 'unpacking [' + entry.path + ']'); + } + + makeDir(to).then(() => { + tar.extract({ + file: tarball, + cwd: to, + strip: 1, + onentry: filter_func + }).then(after_extract, callback); + }).catch((err) => { + return callback(err); + }); + + function after_extract() { + testbinary(gyp, argv, (err) => { + if (err) { + return callback(err); + } else { + console.log('[' + package_json.name + '] Package appears valid'); + return callback(); + } + }); + } + }); +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/unpublish.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/unpublish.js new file mode 100644 index 00000000..12c9f561 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/unpublish.js @@ -0,0 +1,41 @@ +'use strict'; + +module.exports = exports = unpublish; + +exports.usage = 'Unpublishes pre-built binary (requires aws-sdk)'; + +const log = require('npmlog'); +const versioning = require('./util/versioning.js'); +const napi = require('./util/napi.js'); +const s3_setup = require('./util/s3_setup.js'); +const url = require('url'); + +function unpublish(gyp, argv, callback) { + const package_json = gyp.package_json; + const napi_build_version = napi.get_napi_build_version_from_command_args(argv); + const opts = versioning.evaluate(package_json, gyp.opts, napi_build_version); + const config = {}; + s3_setup.detect(opts, config); + const s3 = s3_setup.get_s3(config); + const key_name = url.resolve(config.prefix, opts.package_name); + const s3_opts = { + Bucket: config.bucket, + Key: key_name + }; + s3.headObject(s3_opts, (err, meta) => { + if (err && err.code === 'NotFound') { + console.log('[' + package_json.name + '] Not found: https://' + s3_opts.Bucket + '.s3.amazonaws.com/' + s3_opts.Key); + return callback(); + } else if (err) { + return callback(err); + } else { + log.info('unpublish', JSON.stringify(meta)); + s3.deleteObject(s3_opts, (err2, resp) => { + if (err2) return callback(err2); + log.info(JSON.stringify(resp)); + console.log('[' + package_json.name + '] Success: removed https://' + s3_opts.Bucket + '.s3.amazonaws.com/' + s3_opts.Key); + return callback(); + }); + } + }); +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/util/abi_crosswalk.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/util/abi_crosswalk.json new file mode 100644 index 00000000..7f529727 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/util/abi_crosswalk.json @@ -0,0 +1,2602 @@ +{ + "0.1.14": { + "node_abi": null, + "v8": "1.3" + }, + "0.1.15": { + "node_abi": null, + "v8": "1.3" + }, + "0.1.16": { + "node_abi": null, + "v8": "1.3" + }, + "0.1.17": { + "node_abi": null, + "v8": "1.3" + }, + "0.1.18": { + "node_abi": null, + "v8": "1.3" + }, + "0.1.19": { + "node_abi": null, + "v8": "2.0" + }, + "0.1.20": { + "node_abi": null, + "v8": "2.0" + }, + "0.1.21": { + "node_abi": null, + "v8": "2.0" + }, + "0.1.22": { + "node_abi": null, + "v8": "2.0" + }, + "0.1.23": { + "node_abi": null, + "v8": "2.0" + }, + "0.1.24": { + "node_abi": null, + "v8": "2.0" + }, + "0.1.25": { + "node_abi": null, + "v8": "2.0" + }, + "0.1.26": { + "node_abi": null, + "v8": "2.0" + }, + "0.1.27": { + "node_abi": null, + "v8": "2.1" + }, + "0.1.28": { + "node_abi": null, + "v8": "2.1" + }, + "0.1.29": { + "node_abi": null, + "v8": "2.1" + }, + "0.1.30": { + "node_abi": null, + "v8": "2.1" + }, + "0.1.31": { + "node_abi": null, + "v8": "2.1" + }, + "0.1.32": { + "node_abi": null, + "v8": "2.1" + }, + "0.1.33": { + "node_abi": null, + "v8": "2.1" + }, + "0.1.90": { + "node_abi": null, + "v8": "2.2" + }, + "0.1.91": { + "node_abi": null, + "v8": "2.2" + }, + "0.1.92": { + "node_abi": null, + "v8": "2.2" + }, + "0.1.93": { + "node_abi": null, + "v8": "2.2" + }, + "0.1.94": { + "node_abi": null, + "v8": "2.2" + }, + "0.1.95": { + "node_abi": null, + "v8": "2.2" + }, + "0.1.96": { + "node_abi": null, + "v8": "2.2" + }, + "0.1.97": { + "node_abi": null, + "v8": "2.2" + }, + "0.1.98": { + "node_abi": null, + "v8": "2.2" + }, + "0.1.99": { + "node_abi": null, + "v8": "2.2" + }, + "0.1.100": { + "node_abi": null, + "v8": "2.2" + }, + "0.1.101": { + "node_abi": null, + "v8": "2.3" + }, + "0.1.102": { + "node_abi": null, + "v8": "2.3" + }, + "0.1.103": { + "node_abi": null, + "v8": "2.3" + }, + "0.1.104": { + "node_abi": null, + "v8": "2.3" + }, + "0.2.0": { + "node_abi": 1, + "v8": "2.3" + }, + "0.2.1": { + "node_abi": 1, + "v8": "2.3" + }, + "0.2.2": { + "node_abi": 1, + "v8": "2.3" + }, + "0.2.3": { + "node_abi": 1, + "v8": "2.3" + }, + "0.2.4": { + "node_abi": 1, + "v8": "2.3" + }, + "0.2.5": { + "node_abi": 1, + "v8": "2.3" + }, + "0.2.6": { + "node_abi": 1, + "v8": "2.3" + }, + "0.3.0": { + "node_abi": 1, + "v8": "2.5" + }, + "0.3.1": { + "node_abi": 1, + "v8": "2.5" + }, + "0.3.2": { + "node_abi": 1, + "v8": "3.0" + }, + "0.3.3": { + "node_abi": 1, + "v8": "3.0" + }, + "0.3.4": { + "node_abi": 1, + "v8": "3.0" + }, + "0.3.5": { + "node_abi": 1, + "v8": "3.0" + }, + "0.3.6": { + "node_abi": 1, + "v8": "3.0" + }, + "0.3.7": { + "node_abi": 1, + "v8": "3.0" + }, + "0.3.8": { + "node_abi": 1, + "v8": "3.1" + }, + "0.4.0": { + "node_abi": 1, + "v8": "3.1" + }, + "0.4.1": { + "node_abi": 1, + "v8": "3.1" + }, + "0.4.2": { + "node_abi": 1, + "v8": "3.1" + }, + "0.4.3": { + "node_abi": 1, + "v8": "3.1" + }, + "0.4.4": { + "node_abi": 1, + "v8": "3.1" + }, + "0.4.5": { + "node_abi": 1, + "v8": "3.1" + }, + "0.4.6": { + "node_abi": 1, + "v8": "3.1" + }, + "0.4.7": { + "node_abi": 1, + "v8": "3.1" + }, + "0.4.8": { + "node_abi": 1, + "v8": "3.1" + }, + "0.4.9": { + "node_abi": 1, + "v8": "3.1" + }, + "0.4.10": { + "node_abi": 1, + "v8": "3.1" + }, + "0.4.11": { + "node_abi": 1, + "v8": "3.1" + }, + "0.4.12": { + "node_abi": 1, + "v8": "3.1" + }, + "0.5.0": { + "node_abi": 1, + "v8": "3.1" + }, + "0.5.1": { + "node_abi": 1, + "v8": "3.4" + }, + "0.5.2": { + "node_abi": 1, + "v8": "3.4" + }, + "0.5.3": { + "node_abi": 1, + "v8": "3.4" + }, + "0.5.4": { + "node_abi": 1, + "v8": "3.5" + }, + "0.5.5": { + "node_abi": 1, + "v8": "3.5" + }, + "0.5.6": { + "node_abi": 1, + "v8": "3.6" + }, + "0.5.7": { + "node_abi": 1, + "v8": "3.6" + }, + "0.5.8": { + "node_abi": 1, + "v8": "3.6" + }, + "0.5.9": { + "node_abi": 1, + "v8": "3.6" + }, + "0.5.10": { + "node_abi": 1, + "v8": "3.7" + }, + "0.6.0": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.1": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.2": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.3": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.4": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.5": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.6": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.7": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.8": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.9": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.10": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.11": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.12": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.13": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.14": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.15": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.16": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.17": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.18": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.19": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.20": { + "node_abi": 1, + "v8": "3.6" + }, + "0.6.21": { + "node_abi": 1, + "v8": "3.6" + }, + "0.7.0": { + "node_abi": 1, + "v8": "3.8" + }, + "0.7.1": { + "node_abi": 1, + "v8": "3.8" + }, + "0.7.2": { + "node_abi": 1, + "v8": "3.8" + }, + "0.7.3": { + "node_abi": 1, + "v8": "3.9" + }, + "0.7.4": { + "node_abi": 1, + "v8": "3.9" + }, + "0.7.5": { + "node_abi": 1, + "v8": "3.9" + }, + "0.7.6": { + "node_abi": 1, + "v8": "3.9" + }, + "0.7.7": { + "node_abi": 1, + "v8": "3.9" + }, + "0.7.8": { + "node_abi": 1, + "v8": "3.9" + }, + "0.7.9": { + "node_abi": 1, + "v8": "3.11" + }, + "0.7.10": { + "node_abi": 1, + "v8": "3.9" + }, + "0.7.11": { + "node_abi": 1, + "v8": "3.11" + }, + "0.7.12": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.0": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.1": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.2": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.3": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.4": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.5": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.6": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.7": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.8": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.9": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.10": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.11": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.12": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.13": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.14": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.15": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.16": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.17": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.18": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.19": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.20": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.21": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.22": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.23": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.24": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.25": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.26": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.27": { + "node_abi": 1, + "v8": "3.11" + }, + "0.8.28": { + "node_abi": 1, + "v8": "3.11" + }, + "0.9.0": { + "node_abi": 1, + "v8": "3.11" + }, + "0.9.1": { + "node_abi": 10, + "v8": "3.11" + }, + "0.9.2": { + "node_abi": 10, + "v8": "3.11" + }, + "0.9.3": { + "node_abi": 10, + "v8": "3.13" + }, + "0.9.4": { + "node_abi": 10, + "v8": "3.13" + }, + "0.9.5": { + "node_abi": 10, + "v8": "3.13" + }, + "0.9.6": { + "node_abi": 10, + "v8": "3.15" + }, + "0.9.7": { + "node_abi": 10, + "v8": "3.15" + }, + "0.9.8": { + "node_abi": 10, + "v8": "3.15" + }, + "0.9.9": { + "node_abi": 11, + "v8": "3.15" + }, + "0.9.10": { + "node_abi": 11, + "v8": "3.15" + }, + "0.9.11": { + "node_abi": 11, + "v8": "3.14" + }, + "0.9.12": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.0": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.1": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.2": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.3": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.4": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.5": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.6": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.7": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.8": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.9": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.10": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.11": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.12": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.13": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.14": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.15": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.16": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.17": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.18": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.19": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.20": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.21": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.22": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.23": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.24": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.25": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.26": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.27": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.28": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.29": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.30": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.31": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.32": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.33": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.34": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.35": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.36": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.37": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.38": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.39": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.40": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.41": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.42": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.43": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.44": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.45": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.46": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.47": { + "node_abi": 11, + "v8": "3.14" + }, + "0.10.48": { + "node_abi": 11, + "v8": "3.14" + }, + "0.11.0": { + "node_abi": 12, + "v8": "3.17" + }, + "0.11.1": { + "node_abi": 12, + "v8": "3.18" + }, + "0.11.2": { + "node_abi": 12, + "v8": "3.19" + }, + "0.11.3": { + "node_abi": 12, + "v8": "3.19" + }, + "0.11.4": { + "node_abi": 12, + "v8": "3.20" + }, + "0.11.5": { + "node_abi": 12, + "v8": "3.20" + }, + "0.11.6": { + "node_abi": 12, + "v8": "3.20" + }, + "0.11.7": { + "node_abi": 12, + "v8": "3.20" + }, + "0.11.8": { + "node_abi": 13, + "v8": "3.21" + }, + "0.11.9": { + "node_abi": 13, + "v8": "3.22" + }, + "0.11.10": { + "node_abi": 13, + "v8": "3.22" + }, + "0.11.11": { + "node_abi": 14, + "v8": "3.22" + }, + "0.11.12": { + "node_abi": 14, + "v8": "3.22" + }, + "0.11.13": { + "node_abi": 14, + "v8": "3.25" + }, + "0.11.14": { + "node_abi": 14, + "v8": "3.26" + }, + "0.11.15": { + "node_abi": 14, + "v8": "3.28" + }, + "0.11.16": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.0": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.1": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.2": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.3": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.4": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.5": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.6": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.7": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.8": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.9": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.10": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.11": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.12": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.13": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.14": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.15": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.16": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.17": { + "node_abi": 14, + "v8": "3.28" + }, + "0.12.18": { + "node_abi": 14, + "v8": "3.28" + }, + "1.0.0": { + "node_abi": 42, + "v8": "3.31" + }, + "1.0.1": { + "node_abi": 42, + "v8": "3.31" + }, + "1.0.2": { + "node_abi": 42, + "v8": "3.31" + }, + "1.0.3": { + "node_abi": 42, + "v8": "4.1" + }, + "1.0.4": { + "node_abi": 42, + "v8": "4.1" + }, + "1.1.0": { + "node_abi": 43, + "v8": "4.1" + }, + "1.2.0": { + "node_abi": 43, + "v8": "4.1" + }, + "1.3.0": { + "node_abi": 43, + "v8": "4.1" + }, + "1.4.1": { + "node_abi": 43, + "v8": "4.1" + }, + "1.4.2": { + "node_abi": 43, + "v8": "4.1" + }, + "1.4.3": { + "node_abi": 43, + "v8": "4.1" + }, + "1.5.0": { + "node_abi": 43, + "v8": "4.1" + }, + "1.5.1": { + "node_abi": 43, + "v8": "4.1" + }, + "1.6.0": { + "node_abi": 43, + "v8": "4.1" + }, + "1.6.1": { + "node_abi": 43, + "v8": "4.1" + }, + "1.6.2": { + "node_abi": 43, + "v8": "4.1" + }, + "1.6.3": { + "node_abi": 43, + "v8": "4.1" + }, + "1.6.4": { + "node_abi": 43, + "v8": "4.1" + }, + "1.7.1": { + "node_abi": 43, + "v8": "4.1" + }, + "1.8.1": { + "node_abi": 43, + "v8": "4.1" + }, + "1.8.2": { + "node_abi": 43, + "v8": "4.1" + }, + "1.8.3": { + "node_abi": 43, + "v8": "4.1" + }, + "1.8.4": { + "node_abi": 43, + "v8": "4.1" + }, + "2.0.0": { + "node_abi": 44, + "v8": "4.2" + }, + "2.0.1": { + "node_abi": 44, + "v8": "4.2" + }, + "2.0.2": { + "node_abi": 44, + "v8": "4.2" + }, + "2.1.0": { + "node_abi": 44, + "v8": "4.2" + }, + "2.2.0": { + "node_abi": 44, + "v8": "4.2" + }, + "2.2.1": { + "node_abi": 44, + "v8": "4.2" + }, + "2.3.0": { + "node_abi": 44, + "v8": "4.2" + }, + "2.3.1": { + "node_abi": 44, + "v8": "4.2" + }, + "2.3.2": { + "node_abi": 44, + "v8": "4.2" + }, + "2.3.3": { + "node_abi": 44, + "v8": "4.2" + }, + "2.3.4": { + "node_abi": 44, + "v8": "4.2" + }, + "2.4.0": { + "node_abi": 44, + "v8": "4.2" + }, + "2.5.0": { + "node_abi": 44, + "v8": "4.2" + }, + "3.0.0": { + "node_abi": 45, + "v8": "4.4" + }, + "3.1.0": { + "node_abi": 45, + "v8": "4.4" + }, + "3.2.0": { + "node_abi": 45, + "v8": "4.4" + }, + "3.3.0": { + "node_abi": 45, + "v8": "4.4" + }, + "3.3.1": { + "node_abi": 45, + "v8": "4.4" + }, + "4.0.0": { + "node_abi": 46, + "v8": "4.5" + }, + "4.1.0": { + "node_abi": 46, + "v8": "4.5" + }, + "4.1.1": { + "node_abi": 46, + "v8": "4.5" + }, + "4.1.2": { + "node_abi": 46, + "v8": "4.5" + }, + "4.2.0": { + "node_abi": 46, + "v8": "4.5" + }, + "4.2.1": { + "node_abi": 46, + "v8": "4.5" + }, + "4.2.2": { + "node_abi": 46, + "v8": "4.5" + }, + "4.2.3": { + "node_abi": 46, + "v8": "4.5" + }, + "4.2.4": { + "node_abi": 46, + "v8": "4.5" + }, + "4.2.5": { + "node_abi": 46, + "v8": "4.5" + }, + "4.2.6": { + "node_abi": 46, + "v8": "4.5" + }, + "4.3.0": { + "node_abi": 46, + "v8": "4.5" + }, + "4.3.1": { + "node_abi": 46, + "v8": "4.5" + }, + "4.3.2": { + "node_abi": 46, + "v8": "4.5" + }, + "4.4.0": { + "node_abi": 46, + "v8": "4.5" + }, + "4.4.1": { + "node_abi": 46, + "v8": "4.5" + }, + "4.4.2": { + "node_abi": 46, + "v8": "4.5" + }, + "4.4.3": { + "node_abi": 46, + "v8": "4.5" + }, + "4.4.4": { + "node_abi": 46, + "v8": "4.5" + }, + "4.4.5": { + "node_abi": 46, + "v8": "4.5" + }, + "4.4.6": { + "node_abi": 46, + "v8": "4.5" + }, + "4.4.7": { + "node_abi": 46, + "v8": "4.5" + }, + "4.5.0": { + "node_abi": 46, + "v8": "4.5" + }, + "4.6.0": { + "node_abi": 46, + "v8": "4.5" + }, + "4.6.1": { + "node_abi": 46, + "v8": "4.5" + }, + "4.6.2": { + "node_abi": 46, + "v8": "4.5" + }, + "4.7.0": { + "node_abi": 46, + "v8": "4.5" + }, + "4.7.1": { + "node_abi": 46, + "v8": "4.5" + }, + "4.7.2": { + "node_abi": 46, + "v8": "4.5" + }, + "4.7.3": { + "node_abi": 46, + "v8": "4.5" + }, + "4.8.0": { + "node_abi": 46, + "v8": "4.5" + }, + "4.8.1": { + "node_abi": 46, + "v8": "4.5" + }, + "4.8.2": { + "node_abi": 46, + "v8": "4.5" + }, + "4.8.3": { + "node_abi": 46, + "v8": "4.5" + }, + "4.8.4": { + "node_abi": 46, + "v8": "4.5" + }, + "4.8.5": { + "node_abi": 46, + "v8": "4.5" + }, + "4.8.6": { + "node_abi": 46, + "v8": "4.5" + }, + "4.8.7": { + "node_abi": 46, + "v8": "4.5" + }, + "4.9.0": { + "node_abi": 46, + "v8": "4.5" + }, + "4.9.1": { + "node_abi": 46, + "v8": "4.5" + }, + "5.0.0": { + "node_abi": 47, + "v8": "4.6" + }, + "5.1.0": { + "node_abi": 47, + "v8": "4.6" + }, + "5.1.1": { + "node_abi": 47, + "v8": "4.6" + }, + "5.2.0": { + "node_abi": 47, + "v8": "4.6" + }, + "5.3.0": { + "node_abi": 47, + "v8": "4.6" + }, + "5.4.0": { + "node_abi": 47, + "v8": "4.6" + }, + "5.4.1": { + "node_abi": 47, + "v8": "4.6" + }, + "5.5.0": { + "node_abi": 47, + "v8": "4.6" + }, + "5.6.0": { + "node_abi": 47, + "v8": "4.6" + }, + "5.7.0": { + "node_abi": 47, + "v8": "4.6" + }, + "5.7.1": { + "node_abi": 47, + "v8": "4.6" + }, + "5.8.0": { + "node_abi": 47, + "v8": "4.6" + }, + "5.9.0": { + "node_abi": 47, + "v8": "4.6" + }, + "5.9.1": { + "node_abi": 47, + "v8": "4.6" + }, + "5.10.0": { + "node_abi": 47, + "v8": "4.6" + }, + "5.10.1": { + "node_abi": 47, + "v8": "4.6" + }, + "5.11.0": { + "node_abi": 47, + "v8": "4.6" + }, + "5.11.1": { + "node_abi": 47, + "v8": "4.6" + }, + "5.12.0": { + "node_abi": 47, + "v8": "4.6" + }, + "6.0.0": { + "node_abi": 48, + "v8": "5.0" + }, + "6.1.0": { + "node_abi": 48, + "v8": "5.0" + }, + "6.2.0": { + "node_abi": 48, + "v8": "5.0" + }, + "6.2.1": { + "node_abi": 48, + "v8": "5.0" + }, + "6.2.2": { + "node_abi": 48, + "v8": "5.0" + }, + "6.3.0": { + "node_abi": 48, + "v8": "5.0" + }, + "6.3.1": { + "node_abi": 48, + "v8": "5.0" + }, + "6.4.0": { + "node_abi": 48, + "v8": "5.0" + }, + "6.5.0": { + "node_abi": 48, + "v8": "5.1" + }, + "6.6.0": { + "node_abi": 48, + "v8": "5.1" + }, + "6.7.0": { + "node_abi": 48, + "v8": "5.1" + }, + "6.8.0": { + "node_abi": 48, + "v8": "5.1" + }, + "6.8.1": { + "node_abi": 48, + "v8": "5.1" + }, + "6.9.0": { + "node_abi": 48, + "v8": "5.1" + }, + "6.9.1": { + "node_abi": 48, + "v8": "5.1" + }, + "6.9.2": { + "node_abi": 48, + "v8": "5.1" + }, + "6.9.3": { + "node_abi": 48, + "v8": "5.1" + }, + "6.9.4": { + "node_abi": 48, + "v8": "5.1" + }, + "6.9.5": { + "node_abi": 48, + "v8": "5.1" + }, + "6.10.0": { + "node_abi": 48, + "v8": "5.1" + }, + "6.10.1": { + "node_abi": 48, + "v8": "5.1" + }, + "6.10.2": { + "node_abi": 48, + "v8": "5.1" + }, + "6.10.3": { + "node_abi": 48, + "v8": "5.1" + }, + "6.11.0": { + "node_abi": 48, + "v8": "5.1" + }, + "6.11.1": { + "node_abi": 48, + "v8": "5.1" + }, + "6.11.2": { + "node_abi": 48, + "v8": "5.1" + }, + "6.11.3": { + "node_abi": 48, + "v8": "5.1" + }, + "6.11.4": { + "node_abi": 48, + "v8": "5.1" + }, + "6.11.5": { + "node_abi": 48, + "v8": "5.1" + }, + "6.12.0": { + "node_abi": 48, + "v8": "5.1" + }, + "6.12.1": { + "node_abi": 48, + "v8": "5.1" + }, + "6.12.2": { + "node_abi": 48, + "v8": "5.1" + }, + "6.12.3": { + "node_abi": 48, + "v8": "5.1" + }, + "6.13.0": { + "node_abi": 48, + "v8": "5.1" + }, + "6.13.1": { + "node_abi": 48, + "v8": "5.1" + }, + "6.14.0": { + "node_abi": 48, + "v8": "5.1" + }, + "6.14.1": { + "node_abi": 48, + "v8": "5.1" + }, + "6.14.2": { + "node_abi": 48, + "v8": "5.1" + }, + "6.14.3": { + "node_abi": 48, + "v8": "5.1" + }, + "6.14.4": { + "node_abi": 48, + "v8": "5.1" + }, + "6.15.0": { + "node_abi": 48, + "v8": "5.1" + }, + "6.15.1": { + "node_abi": 48, + "v8": "5.1" + }, + "6.16.0": { + "node_abi": 48, + "v8": "5.1" + }, + "6.17.0": { + "node_abi": 48, + "v8": "5.1" + }, + "6.17.1": { + "node_abi": 48, + "v8": "5.1" + }, + "7.0.0": { + "node_abi": 51, + "v8": "5.4" + }, + "7.1.0": { + "node_abi": 51, + "v8": "5.4" + }, + "7.2.0": { + "node_abi": 51, + "v8": "5.4" + }, + "7.2.1": { + "node_abi": 51, + "v8": "5.4" + }, + "7.3.0": { + "node_abi": 51, + "v8": "5.4" + }, + "7.4.0": { + "node_abi": 51, + "v8": "5.4" + }, + "7.5.0": { + "node_abi": 51, + "v8": "5.4" + }, + "7.6.0": { + "node_abi": 51, + "v8": "5.5" + }, + "7.7.0": { + "node_abi": 51, + "v8": "5.5" + }, + "7.7.1": { + "node_abi": 51, + "v8": "5.5" + }, + "7.7.2": { + "node_abi": 51, + "v8": "5.5" + }, + "7.7.3": { + "node_abi": 51, + "v8": "5.5" + }, + "7.7.4": { + "node_abi": 51, + "v8": "5.5" + }, + "7.8.0": { + "node_abi": 51, + "v8": "5.5" + }, + "7.9.0": { + "node_abi": 51, + "v8": "5.5" + }, + "7.10.0": { + "node_abi": 51, + "v8": "5.5" + }, + "7.10.1": { + "node_abi": 51, + "v8": "5.5" + }, + "8.0.0": { + "node_abi": 57, + "v8": "5.8" + }, + "8.1.0": { + "node_abi": 57, + "v8": "5.8" + }, + "8.1.1": { + "node_abi": 57, + "v8": "5.8" + }, + "8.1.2": { + "node_abi": 57, + "v8": "5.8" + }, + "8.1.3": { + "node_abi": 57, + "v8": "5.8" + }, + "8.1.4": { + "node_abi": 57, + "v8": "5.8" + }, + "8.2.0": { + "node_abi": 57, + "v8": "5.8" + }, + "8.2.1": { + "node_abi": 57, + "v8": "5.8" + }, + "8.3.0": { + "node_abi": 57, + "v8": "6.0" + }, + "8.4.0": { + "node_abi": 57, + "v8": "6.0" + }, + "8.5.0": { + "node_abi": 57, + "v8": "6.0" + }, + "8.6.0": { + "node_abi": 57, + "v8": "6.0" + }, + "8.7.0": { + "node_abi": 57, + "v8": "6.1" + }, + "8.8.0": { + "node_abi": 57, + "v8": "6.1" + }, + "8.8.1": { + "node_abi": 57, + "v8": "6.1" + }, + "8.9.0": { + "node_abi": 57, + "v8": "6.1" + }, + "8.9.1": { + "node_abi": 57, + "v8": "6.1" + }, + "8.9.2": { + "node_abi": 57, + "v8": "6.1" + }, + "8.9.3": { + "node_abi": 57, + "v8": "6.1" + }, + "8.9.4": { + "node_abi": 57, + "v8": "6.1" + }, + "8.10.0": { + "node_abi": 57, + "v8": "6.2" + }, + "8.11.0": { + "node_abi": 57, + "v8": "6.2" + }, + "8.11.1": { + "node_abi": 57, + "v8": "6.2" + }, + "8.11.2": { + "node_abi": 57, + "v8": "6.2" + }, + "8.11.3": { + "node_abi": 57, + "v8": "6.2" + }, + "8.11.4": { + "node_abi": 57, + "v8": "6.2" + }, + "8.12.0": { + "node_abi": 57, + "v8": "6.2" + }, + "8.13.0": { + "node_abi": 57, + "v8": "6.2" + }, + "8.14.0": { + "node_abi": 57, + "v8": "6.2" + }, + "8.14.1": { + "node_abi": 57, + "v8": "6.2" + }, + "8.15.0": { + "node_abi": 57, + "v8": "6.2" + }, + "8.15.1": { + "node_abi": 57, + "v8": "6.2" + }, + "8.16.0": { + "node_abi": 57, + "v8": "6.2" + }, + "8.16.1": { + "node_abi": 57, + "v8": "6.2" + }, + "8.16.2": { + "node_abi": 57, + "v8": "6.2" + }, + "8.17.0": { + "node_abi": 57, + "v8": "6.2" + }, + "9.0.0": { + "node_abi": 59, + "v8": "6.2" + }, + "9.1.0": { + "node_abi": 59, + "v8": "6.2" + }, + "9.2.0": { + "node_abi": 59, + "v8": "6.2" + }, + "9.2.1": { + "node_abi": 59, + "v8": "6.2" + }, + "9.3.0": { + "node_abi": 59, + "v8": "6.2" + }, + "9.4.0": { + "node_abi": 59, + "v8": "6.2" + }, + "9.5.0": { + "node_abi": 59, + "v8": "6.2" + }, + "9.6.0": { + "node_abi": 59, + "v8": "6.2" + }, + "9.6.1": { + "node_abi": 59, + "v8": "6.2" + }, + "9.7.0": { + "node_abi": 59, + "v8": "6.2" + }, + "9.7.1": { + "node_abi": 59, + "v8": "6.2" + }, + "9.8.0": { + "node_abi": 59, + "v8": "6.2" + }, + "9.9.0": { + "node_abi": 59, + "v8": "6.2" + }, + "9.10.0": { + "node_abi": 59, + "v8": "6.2" + }, + "9.10.1": { + "node_abi": 59, + "v8": "6.2" + }, + "9.11.0": { + "node_abi": 59, + "v8": "6.2" + }, + "9.11.1": { + "node_abi": 59, + "v8": "6.2" + }, + "9.11.2": { + "node_abi": 59, + "v8": "6.2" + }, + "10.0.0": { + "node_abi": 64, + "v8": "6.6" + }, + "10.1.0": { + "node_abi": 64, + "v8": "6.6" + }, + "10.2.0": { + "node_abi": 64, + "v8": "6.6" + }, + "10.2.1": { + "node_abi": 64, + "v8": "6.6" + }, + "10.3.0": { + "node_abi": 64, + "v8": "6.6" + }, + "10.4.0": { + "node_abi": 64, + "v8": "6.7" + }, + "10.4.1": { + "node_abi": 64, + "v8": "6.7" + }, + "10.5.0": { + "node_abi": 64, + "v8": "6.7" + }, + "10.6.0": { + "node_abi": 64, + "v8": "6.7" + }, + "10.7.0": { + "node_abi": 64, + "v8": "6.7" + }, + "10.8.0": { + "node_abi": 64, + "v8": "6.7" + }, + "10.9.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.10.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.11.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.12.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.13.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.14.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.14.1": { + "node_abi": 64, + "v8": "6.8" + }, + "10.14.2": { + "node_abi": 64, + "v8": "6.8" + }, + "10.15.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.15.1": { + "node_abi": 64, + "v8": "6.8" + }, + "10.15.2": { + "node_abi": 64, + "v8": "6.8" + }, + "10.15.3": { + "node_abi": 64, + "v8": "6.8" + }, + "10.16.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.16.1": { + "node_abi": 64, + "v8": "6.8" + }, + "10.16.2": { + "node_abi": 64, + "v8": "6.8" + }, + "10.16.3": { + "node_abi": 64, + "v8": "6.8" + }, + "10.17.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.18.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.18.1": { + "node_abi": 64, + "v8": "6.8" + }, + "10.19.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.20.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.20.1": { + "node_abi": 64, + "v8": "6.8" + }, + "10.21.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.22.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.22.1": { + "node_abi": 64, + "v8": "6.8" + }, + "10.23.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.23.1": { + "node_abi": 64, + "v8": "6.8" + }, + "10.23.2": { + "node_abi": 64, + "v8": "6.8" + }, + "10.23.3": { + "node_abi": 64, + "v8": "6.8" + }, + "10.24.0": { + "node_abi": 64, + "v8": "6.8" + }, + "10.24.1": { + "node_abi": 64, + "v8": "6.8" + }, + "11.0.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.1.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.2.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.3.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.4.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.5.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.6.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.7.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.8.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.9.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.10.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.10.1": { + "node_abi": 67, + "v8": "7.0" + }, + "11.11.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.12.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.13.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.14.0": { + "node_abi": 67, + "v8": "7.0" + }, + "11.15.0": { + "node_abi": 67, + "v8": "7.0" + }, + "12.0.0": { + "node_abi": 72, + "v8": "7.4" + }, + "12.1.0": { + "node_abi": 72, + "v8": "7.4" + }, + "12.2.0": { + "node_abi": 72, + "v8": "7.4" + }, + "12.3.0": { + "node_abi": 72, + "v8": "7.4" + }, + "12.3.1": { + "node_abi": 72, + "v8": "7.4" + }, + "12.4.0": { + "node_abi": 72, + "v8": "7.4" + }, + "12.5.0": { + "node_abi": 72, + "v8": "7.5" + }, + "12.6.0": { + "node_abi": 72, + "v8": "7.5" + }, + "12.7.0": { + "node_abi": 72, + "v8": "7.5" + }, + "12.8.0": { + "node_abi": 72, + "v8": "7.5" + }, + "12.8.1": { + "node_abi": 72, + "v8": "7.5" + }, + "12.9.0": { + "node_abi": 72, + "v8": "7.6" + }, + "12.9.1": { + "node_abi": 72, + "v8": "7.6" + }, + "12.10.0": { + "node_abi": 72, + "v8": "7.6" + }, + "12.11.0": { + "node_abi": 72, + "v8": "7.7" + }, + "12.11.1": { + "node_abi": 72, + "v8": "7.7" + }, + "12.12.0": { + "node_abi": 72, + "v8": "7.7" + }, + "12.13.0": { + "node_abi": 72, + "v8": "7.7" + }, + "12.13.1": { + "node_abi": 72, + "v8": "7.7" + }, + "12.14.0": { + "node_abi": 72, + "v8": "7.7" + }, + "12.14.1": { + "node_abi": 72, + "v8": "7.7" + }, + "12.15.0": { + "node_abi": 72, + "v8": "7.7" + }, + "12.16.0": { + "node_abi": 72, + "v8": "7.8" + }, + "12.16.1": { + "node_abi": 72, + "v8": "7.8" + }, + "12.16.2": { + "node_abi": 72, + "v8": "7.8" + }, + "12.16.3": { + "node_abi": 72, + "v8": "7.8" + }, + "12.17.0": { + "node_abi": 72, + "v8": "7.8" + }, + "12.18.0": { + "node_abi": 72, + "v8": "7.8" + }, + "12.18.1": { + "node_abi": 72, + "v8": "7.8" + }, + "12.18.2": { + "node_abi": 72, + "v8": "7.8" + }, + "12.18.3": { + "node_abi": 72, + "v8": "7.8" + }, + "12.18.4": { + "node_abi": 72, + "v8": "7.8" + }, + "12.19.0": { + "node_abi": 72, + "v8": "7.8" + }, + "12.19.1": { + "node_abi": 72, + "v8": "7.8" + }, + "12.20.0": { + "node_abi": 72, + "v8": "7.8" + }, + "12.20.1": { + "node_abi": 72, + "v8": "7.8" + }, + "12.20.2": { + "node_abi": 72, + "v8": "7.8" + }, + "12.21.0": { + "node_abi": 72, + "v8": "7.8" + }, + "12.22.0": { + "node_abi": 72, + "v8": "7.8" + }, + "12.22.1": { + "node_abi": 72, + "v8": "7.8" + }, + "12.22.2": { + "node_abi": 72, + "v8": "7.8" + }, + "12.22.3": { + "node_abi": 72, + "v8": "7.8" + }, + "12.22.4": { + "node_abi": 72, + "v8": "7.8" + }, + "12.22.5": { + "node_abi": 72, + "v8": "7.8" + }, + "12.22.6": { + "node_abi": 72, + "v8": "7.8" + }, + "12.22.7": { + "node_abi": 72, + "v8": "7.8" + }, + "13.0.0": { + "node_abi": 79, + "v8": "7.8" + }, + "13.0.1": { + "node_abi": 79, + "v8": "7.8" + }, + "13.1.0": { + "node_abi": 79, + "v8": "7.8" + }, + "13.2.0": { + "node_abi": 79, + "v8": "7.9" + }, + "13.3.0": { + "node_abi": 79, + "v8": "7.9" + }, + "13.4.0": { + "node_abi": 79, + "v8": "7.9" + }, + "13.5.0": { + "node_abi": 79, + "v8": "7.9" + }, + "13.6.0": { + "node_abi": 79, + "v8": "7.9" + }, + "13.7.0": { + "node_abi": 79, + "v8": "7.9" + }, + "13.8.0": { + "node_abi": 79, + "v8": "7.9" + }, + "13.9.0": { + "node_abi": 79, + "v8": "7.9" + }, + "13.10.0": { + "node_abi": 79, + "v8": "7.9" + }, + "13.10.1": { + "node_abi": 79, + "v8": "7.9" + }, + "13.11.0": { + "node_abi": 79, + "v8": "7.9" + }, + "13.12.0": { + "node_abi": 79, + "v8": "7.9" + }, + "13.13.0": { + "node_abi": 79, + "v8": "7.9" + }, + "13.14.0": { + "node_abi": 79, + "v8": "7.9" + }, + "14.0.0": { + "node_abi": 83, + "v8": "8.1" + }, + "14.1.0": { + "node_abi": 83, + "v8": "8.1" + }, + "14.2.0": { + "node_abi": 83, + "v8": "8.1" + }, + "14.3.0": { + "node_abi": 83, + "v8": "8.1" + }, + "14.4.0": { + "node_abi": 83, + "v8": "8.1" + }, + "14.5.0": { + "node_abi": 83, + "v8": "8.3" + }, + "14.6.0": { + "node_abi": 83, + "v8": "8.4" + }, + "14.7.0": { + "node_abi": 83, + "v8": "8.4" + }, + "14.8.0": { + "node_abi": 83, + "v8": "8.4" + }, + "14.9.0": { + "node_abi": 83, + "v8": "8.4" + }, + "14.10.0": { + "node_abi": 83, + "v8": "8.4" + }, + "14.10.1": { + "node_abi": 83, + "v8": "8.4" + }, + "14.11.0": { + "node_abi": 83, + "v8": "8.4" + }, + "14.12.0": { + "node_abi": 83, + "v8": "8.4" + }, + "14.13.0": { + "node_abi": 83, + "v8": "8.4" + }, + "14.13.1": { + "node_abi": 83, + "v8": "8.4" + }, + "14.14.0": { + "node_abi": 83, + "v8": "8.4" + }, + "14.15.0": { + "node_abi": 83, + "v8": "8.4" + }, + "14.15.1": { + "node_abi": 83, + "v8": "8.4" + }, + "14.15.2": { + "node_abi": 83, + "v8": "8.4" + }, + "14.15.3": { + "node_abi": 83, + "v8": "8.4" + }, + "14.15.4": { + "node_abi": 83, + "v8": "8.4" + }, + "14.15.5": { + "node_abi": 83, + "v8": "8.4" + }, + "14.16.0": { + "node_abi": 83, + "v8": "8.4" + }, + "14.16.1": { + "node_abi": 83, + "v8": "8.4" + }, + "14.17.0": { + "node_abi": 83, + "v8": "8.4" + }, + "14.17.1": { + "node_abi": 83, + "v8": "8.4" + }, + "14.17.2": { + "node_abi": 83, + "v8": "8.4" + }, + "14.17.3": { + "node_abi": 83, + "v8": "8.4" + }, + "14.17.4": { + "node_abi": 83, + "v8": "8.4" + }, + "14.17.5": { + "node_abi": 83, + "v8": "8.4" + }, + "14.17.6": { + "node_abi": 83, + "v8": "8.4" + }, + "14.18.0": { + "node_abi": 83, + "v8": "8.4" + }, + "14.18.1": { + "node_abi": 83, + "v8": "8.4" + }, + "15.0.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.0.1": { + "node_abi": 88, + "v8": "8.6" + }, + "15.1.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.2.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.2.1": { + "node_abi": 88, + "v8": "8.6" + }, + "15.3.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.4.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.5.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.5.1": { + "node_abi": 88, + "v8": "8.6" + }, + "15.6.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.7.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.8.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.9.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.10.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.11.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.12.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.13.0": { + "node_abi": 88, + "v8": "8.6" + }, + "15.14.0": { + "node_abi": 88, + "v8": "8.6" + }, + "16.0.0": { + "node_abi": 93, + "v8": "9.0" + }, + "16.1.0": { + "node_abi": 93, + "v8": "9.0" + }, + "16.2.0": { + "node_abi": 93, + "v8": "9.0" + }, + "16.3.0": { + "node_abi": 93, + "v8": "9.0" + }, + "16.4.0": { + "node_abi": 93, + "v8": "9.1" + }, + "16.4.1": { + "node_abi": 93, + "v8": "9.1" + }, + "16.4.2": { + "node_abi": 93, + "v8": "9.1" + }, + "16.5.0": { + "node_abi": 93, + "v8": "9.1" + }, + "16.6.0": { + "node_abi": 93, + "v8": "9.2" + }, + "16.6.1": { + "node_abi": 93, + "v8": "9.2" + }, + "16.6.2": { + "node_abi": 93, + "v8": "9.2" + }, + "16.7.0": { + "node_abi": 93, + "v8": "9.2" + }, + "16.8.0": { + "node_abi": 93, + "v8": "9.2" + }, + "16.9.0": { + "node_abi": 93, + "v8": "9.3" + }, + "16.9.1": { + "node_abi": 93, + "v8": "9.3" + }, + "16.10.0": { + "node_abi": 93, + "v8": "9.3" + }, + "16.11.0": { + "node_abi": 93, + "v8": "9.4" + }, + "16.11.1": { + "node_abi": 93, + "v8": "9.4" + }, + "16.12.0": { + "node_abi": 93, + "v8": "9.4" + }, + "16.13.0": { + "node_abi": 93, + "v8": "9.4" + }, + "17.0.0": { + "node_abi": 102, + "v8": "9.5" + }, + "17.0.1": { + "node_abi": 102, + "v8": "9.5" + }, + "17.1.0": { + "node_abi": 102, + "v8": "9.5" + } +} \ No newline at end of file diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/util/compile.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/util/compile.js new file mode 100644 index 00000000..956e5aa6 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/util/compile.js @@ -0,0 +1,93 @@ +'use strict'; + +module.exports = exports; + +const fs = require('fs'); +const path = require('path'); +const win = process.platform === 'win32'; +const existsSync = fs.existsSync || path.existsSync; +const cp = require('child_process'); + +// try to build up the complete path to node-gyp +/* priority: + - node-gyp on ENV:npm_config_node_gyp (https://github.com/npm/npm/pull/4887) + - node-gyp on NODE_PATH + - node-gyp inside npm on NODE_PATH (ignore on iojs) + - node-gyp inside npm beside node exe +*/ +function which_node_gyp() { + let node_gyp_bin; + if (process.env.npm_config_node_gyp) { + try { + node_gyp_bin = process.env.npm_config_node_gyp; + if (existsSync(node_gyp_bin)) { + return node_gyp_bin; + } + } catch (err) { + // do nothing + } + } + try { + const node_gyp_main = require.resolve('node-gyp'); // eslint-disable-line node/no-missing-require + node_gyp_bin = path.join(path.dirname( + path.dirname(node_gyp_main)), + 'bin/node-gyp.js'); + if (existsSync(node_gyp_bin)) { + return node_gyp_bin; + } + } catch (err) { + // do nothing + } + if (process.execPath.indexOf('iojs') === -1) { + try { + const npm_main = require.resolve('npm'); // eslint-disable-line node/no-missing-require + node_gyp_bin = path.join(path.dirname( + path.dirname(npm_main)), + 'node_modules/node-gyp/bin/node-gyp.js'); + if (existsSync(node_gyp_bin)) { + return node_gyp_bin; + } + } catch (err) { + // do nothing + } + } + const npm_base = path.join(path.dirname( + path.dirname(process.execPath)), + 'lib/node_modules/npm/'); + node_gyp_bin = path.join(npm_base, 'node_modules/node-gyp/bin/node-gyp.js'); + if (existsSync(node_gyp_bin)) { + return node_gyp_bin; + } +} + +module.exports.run_gyp = function(args, opts, callback) { + let shell_cmd = ''; + const cmd_args = []; + if (opts.runtime && opts.runtime === 'node-webkit') { + shell_cmd = 'nw-gyp'; + if (win) shell_cmd += '.cmd'; + } else { + const node_gyp_path = which_node_gyp(); + if (node_gyp_path) { + shell_cmd = process.execPath; + cmd_args.push(node_gyp_path); + } else { + shell_cmd = 'node-gyp'; + if (win) shell_cmd += '.cmd'; + } + } + const final_args = cmd_args.concat(args); + const cmd = cp.spawn(shell_cmd, final_args, { cwd: undefined, env: process.env, stdio: [0, 1, 2] }); + cmd.on('error', (err) => { + if (err) { + return callback(new Error("Failed to execute '" + shell_cmd + ' ' + final_args.join(' ') + "' (" + err + ')')); + } + callback(null, opts); + }); + cmd.on('close', (code) => { + if (code && code !== 0) { + return callback(new Error("Failed to execute '" + shell_cmd + ' ' + final_args.join(' ') + "' (" + code + ')')); + } + callback(null, opts); + }); +}; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/util/handle_gyp_opts.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/util/handle_gyp_opts.js new file mode 100644 index 00000000..d702f785 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/util/handle_gyp_opts.js @@ -0,0 +1,102 @@ +'use strict'; + +module.exports = exports = handle_gyp_opts; + +const versioning = require('./versioning.js'); +const napi = require('./napi.js'); + +/* + +Here we gather node-pre-gyp generated options (from versioning) and pass them along to node-gyp. + +We massage the args and options slightly to account for differences in what commands mean between +node-pre-gyp and node-gyp (e.g. see the difference between "build" and "rebuild" below) + +Keep in mind: the values inside `argv` and `gyp.opts` below are different depending on whether +node-pre-gyp is called directory, or if it is called in a `run-script` phase of npm. + +We also try to preserve any command line options that might have been passed to npm or node-pre-gyp. +But this is fairly difficult without passing way to much through. For example `gyp.opts` contains all +the process.env and npm pushes a lot of variables into process.env which node-pre-gyp inherits. So we have +to be very selective about what we pass through. + +For example: + +`npm install --build-from-source` will give: + +argv == [ 'rebuild' ] +gyp.opts.argv == { remain: [ 'install' ], + cooked: [ 'install', '--fallback-to-build' ], + original: [ 'install', '--fallback-to-build' ] } + +`./bin/node-pre-gyp build` will give: + +argv == [] +gyp.opts.argv == { remain: [ 'build' ], + cooked: [ 'build' ], + original: [ '-C', 'test/app1', 'build' ] } + +*/ + +// select set of node-pre-gyp versioning info +// to share with node-gyp +const share_with_node_gyp = [ + 'module', + 'module_name', + 'module_path', + 'napi_version', + 'node_abi_napi', + 'napi_build_version', + 'node_napi_label' +]; + +function handle_gyp_opts(gyp, argv, callback) { + + // Collect node-pre-gyp specific variables to pass to node-gyp + const node_pre_gyp_options = []; + // generate custom node-pre-gyp versioning info + const napi_build_version = napi.get_napi_build_version_from_command_args(argv); + const opts = versioning.evaluate(gyp.package_json, gyp.opts, napi_build_version); + share_with_node_gyp.forEach((key) => { + const val = opts[key]; + if (val) { + node_pre_gyp_options.push('--' + key + '=' + val); + } else if (key === 'napi_build_version') { + node_pre_gyp_options.push('--' + key + '=0'); + } else { + if (key !== 'napi_version' && key !== 'node_abi_napi') + return callback(new Error('Option ' + key + ' required but not found by node-pre-gyp')); + } + }); + + // Collect options that follow the special -- which disables nopt parsing + const unparsed_options = []; + let double_hyphen_found = false; + gyp.opts.argv.original.forEach((opt) => { + if (double_hyphen_found) { + unparsed_options.push(opt); + } + if (opt === '--') { + double_hyphen_found = true; + } + }); + + // We try respect and pass through remaining command + // line options (like --foo=bar) to node-gyp + const cooked = gyp.opts.argv.cooked; + const node_gyp_options = []; + cooked.forEach((value) => { + if (value.length > 2 && value.slice(0, 2) === '--') { + const key = value.slice(2); + const val = cooked[cooked.indexOf(value) + 1]; + if (val && val.indexOf('--') === -1) { // handle '--foo=bar' or ['--foo','bar'] + node_gyp_options.push('--' + key + '=' + val); + } else { // pass through --foo + node_gyp_options.push(value); + } + } + }); + + const result = { 'opts': opts, 'gyp': node_gyp_options, 'pre': node_pre_gyp_options, 'unparsed': unparsed_options }; + return callback(null, result); +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/util/napi.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/util/napi.js new file mode 100644 index 00000000..5d14ad6d --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/util/napi.js @@ -0,0 +1,205 @@ +'use strict'; + +const fs = require('fs'); + +module.exports = exports; + +const versionArray = process.version + .substr(1) + .replace(/-.*$/, '') + .split('.') + .map((item) => { + return +item; + }); + +const napi_multiple_commands = [ + 'build', + 'clean', + 'configure', + 'package', + 'publish', + 'reveal', + 'testbinary', + 'testpackage', + 'unpublish' +]; + +const napi_build_version_tag = 'napi_build_version='; + +module.exports.get_napi_version = function() { + // returns the non-zero numeric napi version or undefined if napi is not supported. + // correctly supporting target requires an updated cross-walk + let version = process.versions.napi; // can be undefined + if (!version) { // this code should never need to be updated + if (versionArray[0] === 9 && versionArray[1] >= 3) version = 2; // 9.3.0+ + else if (versionArray[0] === 8) version = 1; // 8.0.0+ + } + return version; +}; + +module.exports.get_napi_version_as_string = function(target) { + // returns the napi version as a string or an empty string if napi is not supported. + const version = module.exports.get_napi_version(target); + return version ? '' + version : ''; +}; + +module.exports.validate_package_json = function(package_json, opts) { // throws Error + + const binary = package_json.binary; + const module_path_ok = pathOK(binary.module_path); + const remote_path_ok = pathOK(binary.remote_path); + const package_name_ok = pathOK(binary.package_name); + const napi_build_versions = module.exports.get_napi_build_versions(package_json, opts, true); + const napi_build_versions_raw = module.exports.get_napi_build_versions_raw(package_json); + + if (napi_build_versions) { + napi_build_versions.forEach((napi_build_version)=> { + if (!(parseInt(napi_build_version, 10) === napi_build_version && napi_build_version > 0)) { + throw new Error('All values specified in napi_versions must be positive integers.'); + } + }); + } + + if (napi_build_versions && (!module_path_ok || (!remote_path_ok && !package_name_ok))) { + throw new Error('When napi_versions is specified; module_path and either remote_path or ' + + "package_name must contain the substitution string '{napi_build_version}`."); + } + + if ((module_path_ok || remote_path_ok || package_name_ok) && !napi_build_versions_raw) { + throw new Error("When the substitution string '{napi_build_version}` is specified in " + + 'module_path, remote_path, or package_name; napi_versions must also be specified.'); + } + + if (napi_build_versions && !module.exports.get_best_napi_build_version(package_json, opts) && + module.exports.build_napi_only(package_json)) { + throw new Error( + 'The Node-API version of this Node instance is ' + module.exports.get_napi_version(opts ? opts.target : undefined) + '. ' + + 'This module supports Node-API version(s) ' + module.exports.get_napi_build_versions_raw(package_json) + '. ' + + 'This Node instance cannot run this module.'); + } + + if (napi_build_versions_raw && !napi_build_versions && module.exports.build_napi_only(package_json)) { + throw new Error( + 'The Node-API version of this Node instance is ' + module.exports.get_napi_version(opts ? opts.target : undefined) + '. ' + + 'This module supports Node-API version(s) ' + module.exports.get_napi_build_versions_raw(package_json) + '. ' + + 'This Node instance cannot run this module.'); + } + +}; + +function pathOK(path) { + return path && (path.indexOf('{napi_build_version}') !== -1 || path.indexOf('{node_napi_label}') !== -1); +} + +module.exports.expand_commands = function(package_json, opts, commands) { + const expanded_commands = []; + const napi_build_versions = module.exports.get_napi_build_versions(package_json, opts); + commands.forEach((command)=> { + if (napi_build_versions && command.name === 'install') { + const napi_build_version = module.exports.get_best_napi_build_version(package_json, opts); + const args = napi_build_version ? [napi_build_version_tag + napi_build_version] : []; + expanded_commands.push({ name: command.name, args: args }); + } else if (napi_build_versions && napi_multiple_commands.indexOf(command.name) !== -1) { + napi_build_versions.forEach((napi_build_version)=> { + const args = command.args.slice(); + args.push(napi_build_version_tag + napi_build_version); + expanded_commands.push({ name: command.name, args: args }); + }); + } else { + expanded_commands.push(command); + } + }); + return expanded_commands; +}; + +module.exports.get_napi_build_versions = function(package_json, opts, warnings) { // opts may be undefined + const log = require('npmlog'); + let napi_build_versions = []; + const supported_napi_version = module.exports.get_napi_version(opts ? opts.target : undefined); + // remove duplicates, verify each napi version can actaully be built + if (package_json.binary && package_json.binary.napi_versions) { + package_json.binary.napi_versions.forEach((napi_version) => { + const duplicated = napi_build_versions.indexOf(napi_version) !== -1; + if (!duplicated && supported_napi_version && napi_version <= supported_napi_version) { + napi_build_versions.push(napi_version); + } else if (warnings && !duplicated && supported_napi_version) { + log.info('This Node instance does not support builds for Node-API version', napi_version); + } + }); + } + if (opts && opts['build-latest-napi-version-only']) { + let latest_version = 0; + napi_build_versions.forEach((napi_version) => { + if (napi_version > latest_version) latest_version = napi_version; + }); + napi_build_versions = latest_version ? [latest_version] : []; + } + return napi_build_versions.length ? napi_build_versions : undefined; +}; + +module.exports.get_napi_build_versions_raw = function(package_json) { + const napi_build_versions = []; + // remove duplicates + if (package_json.binary && package_json.binary.napi_versions) { + package_json.binary.napi_versions.forEach((napi_version) => { + if (napi_build_versions.indexOf(napi_version) === -1) { + napi_build_versions.push(napi_version); + } + }); + } + return napi_build_versions.length ? napi_build_versions : undefined; +}; + +module.exports.get_command_arg = function(napi_build_version) { + return napi_build_version_tag + napi_build_version; +}; + +module.exports.get_napi_build_version_from_command_args = function(command_args) { + for (let i = 0; i < command_args.length; i++) { + const arg = command_args[i]; + if (arg.indexOf(napi_build_version_tag) === 0) { + return parseInt(arg.substr(napi_build_version_tag.length), 10); + } + } + return undefined; +}; + +module.exports.swap_build_dir_out = function(napi_build_version) { + if (napi_build_version) { + const rm = require('rimraf'); + rm.sync(module.exports.get_build_dir(napi_build_version)); + fs.renameSync('build', module.exports.get_build_dir(napi_build_version)); + } +}; + +module.exports.swap_build_dir_in = function(napi_build_version) { + if (napi_build_version) { + const rm = require('rimraf'); + rm.sync('build'); + fs.renameSync(module.exports.get_build_dir(napi_build_version), 'build'); + } +}; + +module.exports.get_build_dir = function(napi_build_version) { + return 'build-tmp-napi-v' + napi_build_version; +}; + +module.exports.get_best_napi_build_version = function(package_json, opts) { + let best_napi_build_version = 0; + const napi_build_versions = module.exports.get_napi_build_versions(package_json, opts); + if (napi_build_versions) { + const our_napi_version = module.exports.get_napi_version(opts ? opts.target : undefined); + napi_build_versions.forEach((napi_build_version)=> { + if (napi_build_version > best_napi_build_version && + napi_build_version <= our_napi_version) { + best_napi_build_version = napi_build_version; + } + }); + } + return best_napi_build_version === 0 ? undefined : best_napi_build_version; +}; + +module.exports.build_napi_only = function(package_json) { + return package_json.binary && package_json.binary.package_name && + package_json.binary.package_name.indexOf('{node_napi_label}') === -1; +}; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/util/nw-pre-gyp/index.html b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/util/nw-pre-gyp/index.html new file mode 100644 index 00000000..244466c4 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/util/nw-pre-gyp/index.html @@ -0,0 +1,26 @@ + + + + +Node-webkit-based module test + + + +

Node-webkit-based module test

+ + diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/util/nw-pre-gyp/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/util/nw-pre-gyp/package.json new file mode 100644 index 00000000..71d03f82 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/util/nw-pre-gyp/package.json @@ -0,0 +1,9 @@ +{ +"main": "index.html", +"name": "nw-pre-gyp-module-test", +"description": "Node-webkit-based module test.", +"version": "0.0.1", +"window": { + "show": false +} +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/util/s3_setup.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/util/s3_setup.js new file mode 100644 index 00000000..6b1b1a6c --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/util/s3_setup.js @@ -0,0 +1,163 @@ +'use strict'; + +module.exports = exports; + +const url = require('url'); +const fs = require('fs'); +const path = require('path'); + +module.exports.detect = function(opts, config) { + const to = opts.hosted_path; + const uri = url.parse(to); + config.prefix = (!uri.pathname || uri.pathname === '/') ? '' : uri.pathname.replace('/', ''); + if (opts.bucket && opts.region) { + config.bucket = opts.bucket; + config.region = opts.region; + config.endpoint = opts.host; + config.s3ForcePathStyle = opts.s3ForcePathStyle; + } else { + const parts = uri.hostname.split('.s3'); + const bucket = parts[0]; + if (!bucket) { + return; + } + if (!config.bucket) { + config.bucket = bucket; + } + if (!config.region) { + const region = parts[1].slice(1).split('.')[0]; + if (region === 'amazonaws') { + config.region = 'us-east-1'; + } else { + config.region = region; + } + } + } +}; + +module.exports.get_s3 = function(config) { + + if (process.env.node_pre_gyp_mock_s3) { + // here we're mocking. node_pre_gyp_mock_s3 is the scratch directory + // for the mock code. + const AWSMock = require('mock-aws-s3'); + const os = require('os'); + + AWSMock.config.basePath = `${os.tmpdir()}/mock`; + + const s3 = AWSMock.S3(); + + // wrapped callback maker. fs calls return code of ENOENT but AWS.S3 returns + // NotFound. + const wcb = (fn) => (err, ...args) => { + if (err && err.code === 'ENOENT') { + err.code = 'NotFound'; + } + return fn(err, ...args); + }; + + return { + listObjects(params, callback) { + return s3.listObjects(params, wcb(callback)); + }, + headObject(params, callback) { + return s3.headObject(params, wcb(callback)); + }, + deleteObject(params, callback) { + return s3.deleteObject(params, wcb(callback)); + }, + putObject(params, callback) { + return s3.putObject(params, wcb(callback)); + } + }; + } + + // if not mocking then setup real s3. + const AWS = require('aws-sdk'); + + AWS.config.update(config); + const s3 = new AWS.S3(); + + // need to change if additional options need to be specified. + return { + listObjects(params, callback) { + return s3.listObjects(params, callback); + }, + headObject(params, callback) { + return s3.headObject(params, callback); + }, + deleteObject(params, callback) { + return s3.deleteObject(params, callback); + }, + putObject(params, callback) { + return s3.putObject(params, callback); + } + }; + + + +}; + +// +// function to get the mocking control function. if not mocking it returns a no-op. +// +// if mocking it sets up the mock http interceptors that use the mocked s3 file system +// to fulfill reponses. +module.exports.get_mockS3Http = function() { + let mock_s3 = false; + if (!process.env.node_pre_gyp_mock_s3) { + return () => mock_s3; + } + + const nock = require('nock'); + // the bucket used for testing, as addressed by https. + const host = 'https://mapbox-node-pre-gyp-public-testing-bucket.s3.us-east-1.amazonaws.com'; + const mockDir = process.env.node_pre_gyp_mock_s3 + '/mapbox-node-pre-gyp-public-testing-bucket'; + + // function to setup interceptors. they are "turned off" by setting mock_s3 to false. + const mock_http = () => { + // eslint-disable-next-line no-unused-vars + function get(uri, requestBody) { + const filepath = path.join(mockDir, uri.replace('%2B', '+')); + + try { + fs.accessSync(filepath, fs.constants.R_OK); + } catch (e) { + return [404, 'not found\n']; + } + + // the mock s3 functions just write to disk, so just read from it. + return [200, fs.createReadStream(filepath)]; + } + + // eslint-disable-next-line no-unused-vars + return nock(host) + .persist() + .get(() => mock_s3) // mock any uri for s3 when true + .reply(get); + }; + + // setup interceptors. they check the mock_s3 flag to determine whether to intercept. + mock_http(nock, host, mockDir); + // function to turn matching all requests to s3 on/off. + const mockS3Http = (action) => { + const previous = mock_s3; + if (action === 'off') { + mock_s3 = false; + } else if (action === 'on') { + mock_s3 = true; + } else if (action !== 'get') { + throw new Error(`illegal action for setMockHttp ${action}`); + } + return previous; + }; + + // call mockS3Http with the argument + // - 'on' - turn it on + // - 'off' - turn it off (used by fetch.test.js so it doesn't interfere with redirects) + // - 'get' - return true or false for 'on' or 'off' + return mockS3Http; +}; + + + diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/util/versioning.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/util/versioning.js new file mode 100644 index 00000000..825cfa1d --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/lib/util/versioning.js @@ -0,0 +1,335 @@ +'use strict'; + +module.exports = exports; + +const path = require('path'); +const semver = require('semver'); +const url = require('url'); +const detect_libc = require('detect-libc'); +const napi = require('./napi.js'); + +let abi_crosswalk; + +// This is used for unit testing to provide a fake +// ABI crosswalk that emulates one that is not updated +// for the current version +if (process.env.NODE_PRE_GYP_ABI_CROSSWALK) { + abi_crosswalk = require(process.env.NODE_PRE_GYP_ABI_CROSSWALK); +} else { + abi_crosswalk = require('./abi_crosswalk.json'); +} + +const major_versions = {}; +Object.keys(abi_crosswalk).forEach((v) => { + const major = v.split('.')[0]; + if (!major_versions[major]) { + major_versions[major] = v; + } +}); + +function get_electron_abi(runtime, target_version) { + if (!runtime) { + throw new Error('get_electron_abi requires valid runtime arg'); + } + if (typeof target_version === 'undefined') { + // erroneous CLI call + throw new Error('Empty target version is not supported if electron is the target.'); + } + // Electron guarantees that patch version update won't break native modules. + const sem_ver = semver.parse(target_version); + return runtime + '-v' + sem_ver.major + '.' + sem_ver.minor; +} +module.exports.get_electron_abi = get_electron_abi; + +function get_node_webkit_abi(runtime, target_version) { + if (!runtime) { + throw new Error('get_node_webkit_abi requires valid runtime arg'); + } + if (typeof target_version === 'undefined') { + // erroneous CLI call + throw new Error('Empty target version is not supported if node-webkit is the target.'); + } + return runtime + '-v' + target_version; +} +module.exports.get_node_webkit_abi = get_node_webkit_abi; + +function get_node_abi(runtime, versions) { + if (!runtime) { + throw new Error('get_node_abi requires valid runtime arg'); + } + if (!versions) { + throw new Error('get_node_abi requires valid process.versions object'); + } + const sem_ver = semver.parse(versions.node); + if (sem_ver.major === 0 && sem_ver.minor % 2) { // odd series + // https://github.com/mapbox/node-pre-gyp/issues/124 + return runtime + '-v' + versions.node; + } else { + // process.versions.modules added in >= v0.10.4 and v0.11.7 + // https://github.com/joyent/node/commit/ccabd4a6fa8a6eb79d29bc3bbe9fe2b6531c2d8e + return versions.modules ? runtime + '-v' + (+versions.modules) : + 'v8-' + versions.v8.split('.').slice(0, 2).join('.'); + } +} +module.exports.get_node_abi = get_node_abi; + +function get_runtime_abi(runtime, target_version) { + if (!runtime) { + throw new Error('get_runtime_abi requires valid runtime arg'); + } + if (runtime === 'node-webkit') { + return get_node_webkit_abi(runtime, target_version || process.versions['node-webkit']); + } else if (runtime === 'electron') { + return get_electron_abi(runtime, target_version || process.versions.electron); + } else { + if (runtime !== 'node') { + throw new Error("Unknown Runtime: '" + runtime + "'"); + } + if (!target_version) { + return get_node_abi(runtime, process.versions); + } else { + let cross_obj; + // abi_crosswalk generated with ./scripts/abi_crosswalk.js + if (abi_crosswalk[target_version]) { + cross_obj = abi_crosswalk[target_version]; + } else { + const target_parts = target_version.split('.').map((i) => { return +i; }); + if (target_parts.length !== 3) { // parse failed + throw new Error('Unknown target version: ' + target_version); + } + /* + The below code tries to infer the last known ABI compatible version + that we have recorded in the abi_crosswalk.json when an exact match + is not possible. The reasons for this to exist are complicated: + + - We support passing --target to be able to allow developers to package binaries for versions of node + that are not the same one as they are running. This might also be used in combination with the + --target_arch or --target_platform flags to also package binaries for alternative platforms + - When --target is passed we can't therefore determine the ABI (process.versions.modules) from the node + version that is running in memory + - So, therefore node-pre-gyp keeps an "ABI crosswalk" (lib/util/abi_crosswalk.json) to be able to look + this info up for all versions + - But we cannot easily predict what the future ABI will be for released versions + - And node-pre-gyp needs to be a `bundledDependency` in apps that depend on it in order to work correctly + by being fully available at install time. + - So, the speed of node releases and the bundled nature of node-pre-gyp mean that a new node-pre-gyp release + need to happen for every node.js/io.js/node-webkit/nw.js/atom-shell/etc release that might come online if + you want the `--target` flag to keep working for the latest version + - Which is impractical ^^ + - Hence the below code guesses about future ABI to make the need to update node-pre-gyp less demanding. + + In practice then you can have a dependency of your app like `node-sqlite3` that bundles a `node-pre-gyp` that + only knows about node v0.10.33 in the `abi_crosswalk.json` but target node v0.10.34 (which is assumed to be + ABI compatible with v0.10.33). + + TODO: use semver module instead of custom version parsing + */ + const major = target_parts[0]; + let minor = target_parts[1]; + let patch = target_parts[2]; + // io.js: yeah if node.js ever releases 1.x this will break + // but that is unlikely to happen: https://github.com/iojs/io.js/pull/253#issuecomment-69432616 + if (major === 1) { + // look for last release that is the same major version + // e.g. we assume io.js 1.x is ABI compatible with >= 1.0.0 + while (true) { + if (minor > 0) --minor; + if (patch > 0) --patch; + const new_iojs_target = '' + major + '.' + minor + '.' + patch; + if (abi_crosswalk[new_iojs_target]) { + cross_obj = abi_crosswalk[new_iojs_target]; + console.log('Warning: node-pre-gyp could not find exact match for ' + target_version); + console.log('Warning: but node-pre-gyp successfully choose ' + new_iojs_target + ' as ABI compatible target'); + break; + } + if (minor === 0 && patch === 0) { + break; + } + } + } else if (major >= 2) { + // look for last release that is the same major version + if (major_versions[major]) { + cross_obj = abi_crosswalk[major_versions[major]]; + console.log('Warning: node-pre-gyp could not find exact match for ' + target_version); + console.log('Warning: but node-pre-gyp successfully choose ' + major_versions[major] + ' as ABI compatible target'); + } + } else if (major === 0) { // node.js + if (target_parts[1] % 2 === 0) { // for stable/even node.js series + // look for the last release that is the same minor release + // e.g. we assume node 0.10.x is ABI compatible with >= 0.10.0 + while (--patch > 0) { + const new_node_target = '' + major + '.' + minor + '.' + patch; + if (abi_crosswalk[new_node_target]) { + cross_obj = abi_crosswalk[new_node_target]; + console.log('Warning: node-pre-gyp could not find exact match for ' + target_version); + console.log('Warning: but node-pre-gyp successfully choose ' + new_node_target + ' as ABI compatible target'); + break; + } + } + } + } + } + if (!cross_obj) { + throw new Error('Unsupported target version: ' + target_version); + } + // emulate process.versions + const versions_obj = { + node: target_version, + v8: cross_obj.v8 + '.0', + // abi_crosswalk uses 1 for node versions lacking process.versions.modules + // process.versions.modules added in >= v0.10.4 and v0.11.7 + modules: cross_obj.node_abi > 1 ? cross_obj.node_abi : undefined + }; + return get_node_abi(runtime, versions_obj); + } + } +} +module.exports.get_runtime_abi = get_runtime_abi; + +const required_parameters = [ + 'module_name', + 'module_path', + 'host' +]; + +function validate_config(package_json, opts) { + const msg = package_json.name + ' package.json is not node-pre-gyp ready:\n'; + const missing = []; + if (!package_json.main) { + missing.push('main'); + } + if (!package_json.version) { + missing.push('version'); + } + if (!package_json.name) { + missing.push('name'); + } + if (!package_json.binary) { + missing.push('binary'); + } + const o = package_json.binary; + if (o) { + required_parameters.forEach((p) => { + if (!o[p] || typeof o[p] !== 'string') { + missing.push('binary.' + p); + } + }); + } + + if (missing.length >= 1) { + throw new Error(msg + 'package.json must declare these properties: \n' + missing.join('\n')); + } + if (o) { + // enforce https over http + const protocol = url.parse(o.host).protocol; + if (protocol === 'http:') { + throw new Error("'host' protocol (" + protocol + ") is invalid - only 'https:' is accepted"); + } + } + napi.validate_package_json(package_json, opts); +} + +module.exports.validate_config = validate_config; + +function eval_template(template, opts) { + Object.keys(opts).forEach((key) => { + const pattern = '{' + key + '}'; + while (template.indexOf(pattern) > -1) { + template = template.replace(pattern, opts[key]); + } + }); + return template; +} + +// url.resolve needs single trailing slash +// to behave correctly, otherwise a double slash +// may end up in the url which breaks requests +// and a lacking slash may not lead to proper joining +function fix_slashes(pathname) { + if (pathname.slice(-1) !== '/') { + return pathname + '/'; + } + return pathname; +} + +// remove double slashes +// note: path.normalize will not work because +// it will convert forward to back slashes +function drop_double_slashes(pathname) { + return pathname.replace(/\/\//g, '/'); +} + +function get_process_runtime(versions) { + let runtime = 'node'; + if (versions['node-webkit']) { + runtime = 'node-webkit'; + } else if (versions.electron) { + runtime = 'electron'; + } + return runtime; +} + +module.exports.get_process_runtime = get_process_runtime; + +const default_package_name = '{module_name}-v{version}-{node_abi}-{platform}-{arch}.tar.gz'; +const default_remote_path = ''; + +module.exports.evaluate = function(package_json, options, napi_build_version) { + options = options || {}; + validate_config(package_json, options); // options is a suitable substitute for opts in this case + const v = package_json.version; + const module_version = semver.parse(v); + const runtime = options.runtime || get_process_runtime(process.versions); + const opts = { + name: package_json.name, + configuration: options.debug ? 'Debug' : 'Release', + debug: options.debug, + module_name: package_json.binary.module_name, + version: module_version.version, + prerelease: module_version.prerelease.length ? module_version.prerelease.join('.') : '', + build: module_version.build.length ? module_version.build.join('.') : '', + major: module_version.major, + minor: module_version.minor, + patch: module_version.patch, + runtime: runtime, + node_abi: get_runtime_abi(runtime, options.target), + node_abi_napi: napi.get_napi_version(options.target) ? 'napi' : get_runtime_abi(runtime, options.target), + napi_version: napi.get_napi_version(options.target), // non-zero numeric, undefined if unsupported + napi_build_version: napi_build_version || '', + node_napi_label: napi_build_version ? 'napi-v' + napi_build_version : get_runtime_abi(runtime, options.target), + target: options.target || '', + platform: options.target_platform || process.platform, + target_platform: options.target_platform || process.platform, + arch: options.target_arch || process.arch, + target_arch: options.target_arch || process.arch, + libc: options.target_libc || detect_libc.familySync() || 'unknown', + module_main: package_json.main, + toolset: options.toolset || '', // address https://github.com/mapbox/node-pre-gyp/issues/119 + bucket: package_json.binary.bucket, + region: package_json.binary.region, + s3ForcePathStyle: package_json.binary.s3ForcePathStyle || false + }; + // support host mirror with npm config `--{module_name}_binary_host_mirror` + // e.g.: https://github.com/node-inspector/v8-profiler/blob/master/package.json#L25 + // > npm install v8-profiler --profiler_binary_host_mirror=https://npm.taobao.org/mirrors/node-inspector/ + const validModuleName = opts.module_name.replace('-', '_'); + const host = process.env['npm_config_' + validModuleName + '_binary_host_mirror'] || package_json.binary.host; + opts.host = fix_slashes(eval_template(host, opts)); + opts.module_path = eval_template(package_json.binary.module_path, opts); + // now we resolve the module_path to ensure it is absolute so that binding.gyp variables work predictably + if (options.module_root) { + // resolve relative to known module root: works for pre-binding require + opts.module_path = path.join(options.module_root, opts.module_path); + } else { + // resolve relative to current working directory: works for node-pre-gyp commands + opts.module_path = path.resolve(opts.module_path); + } + opts.module = path.join(opts.module_path, opts.module_name + '.node'); + opts.remote_path = package_json.binary.remote_path ? drop_double_slashes(fix_slashes(eval_template(package_json.binary.remote_path, opts))) : default_remote_path; + const package_name = package_json.binary.package_name ? package_json.binary.package_name : default_package_name; + opts.package_name = eval_template(package_name, opts); + opts.staged_tarball = path.join('build/stage', opts.remote_path, opts.package_name); + opts.hosted_path = url.resolve(opts.host, opts.remote_path); + opts.hosted_tarball = url.resolve(opts.hosted_path, opts.package_name); + return opts; +}; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/package.json new file mode 100644 index 00000000..1b51bbbe --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@mapbox/node-pre-gyp/package.json @@ -0,0 +1,97 @@ +{ + "_from": "@mapbox/node-pre-gyp@^1.0.0", + "_id": "@mapbox/node-pre-gyp@1.0.9", + "_inBundle": false, + "_integrity": "sha512-aDF3S3rK9Q2gey/WAttUlISduDItz5BU3306M9Eyv6/oS40aMprnopshtlKTykxRNIBEZuRMaZAnbrQ4QtKGyw==", + "_location": "/@mapbox/node-pre-gyp", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "@mapbox/node-pre-gyp@^1.0.0", + "name": "@mapbox/node-pre-gyp", + "escapedName": "@mapbox%2fnode-pre-gyp", + "scope": "@mapbox", + "rawSpec": "^1.0.0", + "saveSpec": null, + "fetchSpec": "^1.0.0" + }, + "_requiredBy": [ + "/sqlite3" + ], + "_resolved": "https://registry.npmjs.org/@mapbox/node-pre-gyp/-/node-pre-gyp-1.0.9.tgz", + "_shasum": "09a8781a3a036151cdebbe8719d6f8b25d4058bc", + "_spec": "@mapbox/node-pre-gyp@^1.0.0", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\sqlite3", + "author": { + "name": "Dane Springmeyer", + "email": "dane@mapbox.com" + }, + "bin": { + "node-pre-gyp": "bin/node-pre-gyp" + }, + "bugs": { + "url": "https://github.com/mapbox/node-pre-gyp/issues" + }, + "bundleDependencies": false, + "dependencies": { + "detect-libc": "^2.0.0", + "https-proxy-agent": "^5.0.0", + "make-dir": "^3.1.0", + "node-fetch": "^2.6.7", + "nopt": "^5.0.0", + "npmlog": "^5.0.1", + "rimraf": "^3.0.2", + "semver": "^7.3.5", + "tar": "^6.1.11" + }, + "deprecated": false, + "description": "Node.js native addon binary install tool", + "devDependencies": { + "@mapbox/cloudfriend": "^5.1.0", + "@mapbox/eslint-config-mapbox": "^3.0.0", + "aws-sdk": "^2.1087.0", + "codecov": "^3.8.3", + "eslint": "^7.32.0", + "eslint-plugin-node": "^11.1.0", + "mock-aws-s3": "^4.0.2", + "nock": "^12.0.3", + "node-addon-api": "^4.3.0", + "nyc": "^15.1.0", + "tape": "^5.5.2", + "tar-fs": "^2.1.1" + }, + "homepage": "https://github.com/mapbox/node-pre-gyp#readme", + "keywords": [ + "native", + "addon", + "module", + "c", + "c++", + "bindings", + "binary" + ], + "license": "BSD-3-Clause", + "main": "./lib/node-pre-gyp.js", + "name": "@mapbox/node-pre-gyp", + "nyc": { + "all": true, + "skip-full": false, + "exclude": [ + "test/**" + ] + }, + "repository": { + "type": "git", + "url": "git://github.com/mapbox/node-pre-gyp.git" + }, + "scripts": { + "coverage": "nyc --all --include index.js --include lib/ npm test", + "fix": "npm run lint -- --fix", + "lint": "eslint bin/node-pre-gyp lib/*js lib/util/*js test/*js scripts/*js", + "test": "tape test/*test.js", + "update-crosswalk": "node scripts/abi_crosswalk.js", + "upload-coverage": "nyc report --reporter json && codecov --clear --flags=unit --file=./coverage/coverage-final.json" + }, + "version": "1.0.9" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/LICENSE.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/LICENSE.md new file mode 100644 index 00000000..5fc208ff --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/LICENSE.md @@ -0,0 +1,20 @@ + + +ISC License + +Copyright npm, Inc. + +Permission to use, copy, modify, and/or distribute this +software for any purpose with or without fee is hereby +granted, provided that the above copyright notice and this +permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND NPM DISCLAIMS ALL +WARRANTIES WITH REGARD TO THIS SOFTWARE INCLUDING ALL +IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS. IN NO +EVENT SHALL NPM BE LIABLE FOR ANY SPECIAL, DIRECT, +INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER +TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE +USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/README.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/README.md new file mode 100644 index 00000000..bc71a119 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/README.md @@ -0,0 +1,60 @@ +# @npmcli/fs + +polyfills, and extensions, of the core `fs` module. + +## Features + +- all exposed functions return promises +- `fs.rm` polyfill for node versions < 14.14.0 +- `fs.mkdir` polyfill adding support for the `recursive` and `force` options in node versions < 10.12.0 +- `fs.copyFile` extended to accept an `owner` option +- `fs.mkdir` extended to accept an `owner` option +- `fs.mkdtemp` extended to accept an `owner` option +- `fs.writeFile` extended to accept an `owner` option +- `fs.withTempDir` added +- `fs.cp` polyfill for node < 16.7.0 + +## The `owner` option + +The `copyFile`, `mkdir`, `mkdtemp`, `writeFile`, and `withTempDir` functions +all accept a new `owner` property in their options. It can be used in two ways: + +- `{ owner: { uid: 100, gid: 100 } }` - set the `uid` and `gid` explicitly +- `{ owner: 100 }` - use one value, will set both `uid` and `gid` the same + +The special string `'inherit'` may be passed instead of a number, which will +cause this module to automatically determine the correct `uid` and/or `gid` +from the nearest existing parent directory of the target. + +## `fs.withTempDir(root, fn, options) -> Promise` + +### Parameters + +- `root`: the directory in which to create the temporary directory +- `fn`: a function that will be called with the path to the temporary directory +- `options` + - `tmpPrefix`: a prefix to be used in the generated directory name + +### Usage + +The `withTempDir` function creates a temporary directory, runs the provided +function (`fn`), then removes the temporary directory and resolves or rejects +based on the result of `fn`. + +```js +const fs = require('@npmcli/fs') +const os = require('os') + +// this function will be called with the full path to the temporary directory +// it is called with `await` behind the scenes, so can be async if desired. +const myFunction = async (tempPath) => { + return 'done!' +} + +const main = async () => { + const result = await fs.withTempDir(os.tmpdir(), myFunction) + // result === 'done!' +} + +main() +``` diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/common/file-url-to-path/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/common/file-url-to-path/index.js new file mode 100644 index 00000000..7755d1c1 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/common/file-url-to-path/index.js @@ -0,0 +1,17 @@ +const url = require('url') + +const node = require('../node.js') +const polyfill = require('./polyfill.js') + +const useNative = node.satisfies('>=10.12.0') + +const fileURLToPath = (path) => { + // the polyfill is tested separately from this module, no need to hack + // process.version to try to trigger it just for coverage + // istanbul ignore next + return useNative + ? url.fileURLToPath(path) + : polyfill(path) +} + +module.exports = fileURLToPath diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/common/file-url-to-path/polyfill.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/common/file-url-to-path/polyfill.js new file mode 100644 index 00000000..6cc90f0b --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/common/file-url-to-path/polyfill.js @@ -0,0 +1,121 @@ +const { URL, domainToUnicode } = require('url') + +const CHAR_LOWERCASE_A = 97 +const CHAR_LOWERCASE_Z = 122 + +const isWindows = process.platform === 'win32' + +class ERR_INVALID_FILE_URL_HOST extends TypeError { + constructor (platform) { + super(`File URL host must be "localhost" or empty on ${platform}`) + this.code = 'ERR_INVALID_FILE_URL_HOST' + } + + toString () { + return `${this.name} [${this.code}]: ${this.message}` + } +} + +class ERR_INVALID_FILE_URL_PATH extends TypeError { + constructor (msg) { + super(`File URL path ${msg}`) + this.code = 'ERR_INVALID_FILE_URL_PATH' + } + + toString () { + return `${this.name} [${this.code}]: ${this.message}` + } +} + +class ERR_INVALID_ARG_TYPE extends TypeError { + constructor (name, actual) { + super(`The "${name}" argument must be one of type string or an instance ` + + `of URL. Received type ${typeof actual} ${actual}`) + this.code = 'ERR_INVALID_ARG_TYPE' + } + + toString () { + return `${this.name} [${this.code}]: ${this.message}` + } +} + +class ERR_INVALID_URL_SCHEME extends TypeError { + constructor (expected) { + super(`The URL must be of scheme ${expected}`) + this.code = 'ERR_INVALID_URL_SCHEME' + } + + toString () { + return `${this.name} [${this.code}]: ${this.message}` + } +} + +const isURLInstance = (input) => { + return input != null && input.href && input.origin +} + +const getPathFromURLWin32 = (url) => { + const hostname = url.hostname + let pathname = url.pathname + for (let n = 0; n < pathname.length; n++) { + if (pathname[n] === '%') { + const third = pathname.codePointAt(n + 2) | 0x20 + if ((pathname[n + 1] === '2' && third === 102) || + (pathname[n + 1] === '5' && third === 99)) { + throw new ERR_INVALID_FILE_URL_PATH('must not include encoded \\ or / characters') + } + } + } + + pathname = pathname.replace(/\//g, '\\') + pathname = decodeURIComponent(pathname) + if (hostname !== '') { + return `\\\\${domainToUnicode(hostname)}${pathname}` + } + + const letter = pathname.codePointAt(1) | 0x20 + const sep = pathname[2] + if (letter < CHAR_LOWERCASE_A || letter > CHAR_LOWERCASE_Z || + (sep !== ':')) { + throw new ERR_INVALID_FILE_URL_PATH('must be absolute') + } + + return pathname.slice(1) +} + +const getPathFromURLPosix = (url) => { + if (url.hostname !== '') { + throw new ERR_INVALID_FILE_URL_HOST(process.platform) + } + + const pathname = url.pathname + + for (let n = 0; n < pathname.length; n++) { + if (pathname[n] === '%') { + const third = pathname.codePointAt(n + 2) | 0x20 + if (pathname[n + 1] === '2' && third === 102) { + throw new ERR_INVALID_FILE_URL_PATH('must not include encoded / characters') + } + } + } + + return decodeURIComponent(pathname) +} + +const fileURLToPath = (path) => { + if (typeof path === 'string') { + path = new URL(path) + } else if (!isURLInstance(path)) { + throw new ERR_INVALID_ARG_TYPE('path', ['string', 'URL'], path) + } + + if (path.protocol !== 'file:') { + throw new ERR_INVALID_URL_SCHEME('file') + } + + return isWindows + ? getPathFromURLWin32(path) + : getPathFromURLPosix(path) +} + +module.exports = fileURLToPath diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/common/get-options.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/common/get-options.js new file mode 100644 index 00000000..cb5982f7 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/common/get-options.js @@ -0,0 +1,20 @@ +// given an input that may or may not be an object, return an object that has +// a copy of every defined property listed in 'copy'. if the input is not an +// object, assign it to the property named by 'wrap' +const getOptions = (input, { copy, wrap }) => { + const result = {} + + if (input && typeof input === 'object') { + for (const prop of copy) { + if (input[prop] !== undefined) { + result[prop] = input[prop] + } + } + } else { + result[wrap] = input + } + + return result +} + +module.exports = getOptions diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/common/node.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/common/node.js new file mode 100644 index 00000000..4d13bc03 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/common/node.js @@ -0,0 +1,9 @@ +const semver = require('semver') + +const satisfies = (range) => { + return semver.satisfies(process.version, range, { includePrerelease: true }) +} + +module.exports = { + satisfies, +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/common/owner.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/common/owner.js new file mode 100644 index 00000000..e3468b07 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/common/owner.js @@ -0,0 +1,92 @@ +const { dirname, resolve } = require('path') + +const fileURLToPath = require('./file-url-to-path/index.js') +const fs = require('../fs.js') + +// given a path, find the owner of the nearest parent +const find = async (path) => { + // if we have no getuid, permissions are irrelevant on this platform + if (!process.getuid) { + return {} + } + + // fs methods accept URL objects with a scheme of file: so we need to unwrap + // those into an actual path string before we can resolve it + const resolved = path != null && path.href && path.origin + ? resolve(fileURLToPath(path)) + : resolve(path) + + let stat + + try { + stat = await fs.lstat(resolved) + } finally { + // if we got a stat, return its contents + if (stat) { + return { uid: stat.uid, gid: stat.gid } + } + + // try the parent directory + if (resolved !== dirname(resolved)) { + return find(dirname(resolved)) + } + + // no more parents, never got a stat, just return an empty object + return {} + } +} + +// given a path, uid, and gid update the ownership of the path if necessary +const update = async (path, uid, gid) => { + // nothing to update, just exit + if (uid === undefined && gid === undefined) { + return + } + + try { + // see if the permissions are already the same, if they are we don't + // need to do anything, so return early + const stat = await fs.stat(path) + if (uid === stat.uid && gid === stat.gid) { + return + } + } catch (err) {} + + try { + await fs.chown(path, uid, gid) + } catch (err) {} +} + +// accepts a `path` and the `owner` property of an options object and normalizes +// it into an object with numerical `uid` and `gid` +const validate = async (path, input) => { + let uid + let gid + + if (typeof input === 'string' || typeof input === 'number') { + uid = input + gid = input + } else if (input && typeof input === 'object') { + uid = input.uid + gid = input.gid + } + + if (uid === 'inherit' || gid === 'inherit') { + const owner = await find(path) + if (uid === 'inherit') { + uid = owner.uid + } + + if (gid === 'inherit') { + gid = owner.gid + } + } + + return { uid, gid } +} + +module.exports = { + find, + update, + validate, +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/copy-file.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/copy-file.js new file mode 100644 index 00000000..d9875aba --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/copy-file.js @@ -0,0 +1,22 @@ +const fs = require('./fs.js') +const getOptions = require('./common/get-options.js') +const owner = require('./common/owner.js') + +const copyFile = async (src, dest, opts) => { + const options = getOptions(opts, { + copy: ['mode', 'owner'], + wrap: 'mode', + }) + + const { uid, gid } = await owner.validate(dest, options.owner) + + // the node core method as of 16.5.0 does not support the mode being in an + // object, so we have to pass the mode value directly + const result = await fs.copyFile(src, dest, options.mode) + + await owner.update(dest, uid, gid) + + return result +} + +module.exports = copyFile diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/cp/LICENSE b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/cp/LICENSE new file mode 100644 index 00000000..93546dfb --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/cp/LICENSE @@ -0,0 +1,15 @@ +(The MIT License) + +Copyright (c) 2011-2017 JP Richardson + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files +(the 'Software'), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, + merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is + furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE +WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS +OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, + ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/cp/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/cp/index.js new file mode 100644 index 00000000..5da4739b --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/cp/index.js @@ -0,0 +1,22 @@ +const fs = require('../fs.js') +const getOptions = require('../common/get-options.js') +const node = require('../common/node.js') +const polyfill = require('./polyfill.js') + +// node 16.7.0 added fs.cp +const useNative = node.satisfies('>=16.7.0') + +const cp = async (src, dest, opts) => { + const options = getOptions(opts, { + copy: ['dereference', 'errorOnExist', 'filter', 'force', 'preserveTimestamps', 'recursive'], + }) + + // the polyfill is tested separately from this module, no need to hack + // process.version to try to trigger it just for coverage + // istanbul ignore next + return useNative + ? fs.cp(src, dest, options) + : polyfill(src, dest, options) +} + +module.exports = cp diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/cp/polyfill.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/cp/polyfill.js new file mode 100644 index 00000000..f83ccbf5 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/cp/polyfill.js @@ -0,0 +1,428 @@ +// this file is a modified version of the code in node 17.2.0 +// which is, in turn, a modified version of the fs-extra module on npm +// node core changes: +// - Use of the assert module has been replaced with core's error system. +// - All code related to the glob dependency has been removed. +// - Bring your own custom fs module is not currently supported. +// - Some basic code cleanup. +// changes here: +// - remove all callback related code +// - drop sync support +// - change assertions back to non-internal methods (see options.js) +// - throws ENOTDIR when rmdir gets an ENOENT for a path that exists in Windows +'use strict' + +const { + ERR_FS_CP_DIR_TO_NON_DIR, + ERR_FS_CP_EEXIST, + ERR_FS_CP_EINVAL, + ERR_FS_CP_FIFO_PIPE, + ERR_FS_CP_NON_DIR_TO_DIR, + ERR_FS_CP_SOCKET, + ERR_FS_CP_SYMLINK_TO_SUBDIRECTORY, + ERR_FS_CP_UNKNOWN, + ERR_FS_EISDIR, + ERR_INVALID_ARG_TYPE, +} = require('../errors.js') +const { + constants: { + errno: { + EEXIST, + EISDIR, + EINVAL, + ENOTDIR, + }, + }, +} = require('os') +const { + chmod, + copyFile, + lstat, + mkdir, + readdir, + readlink, + stat, + symlink, + unlink, + utimes, +} = require('../fs.js') +const { + dirname, + isAbsolute, + join, + parse, + resolve, + sep, + toNamespacedPath, +} = require('path') +const { fileURLToPath } = require('url') + +const defaultOptions = { + dereference: false, + errorOnExist: false, + filter: undefined, + force: true, + preserveTimestamps: false, + recursive: false, +} + +async function cp (src, dest, opts) { + if (opts != null && typeof opts !== 'object') { + throw new ERR_INVALID_ARG_TYPE('options', ['Object'], opts) + } + return cpFn( + toNamespacedPath(getValidatedPath(src)), + toNamespacedPath(getValidatedPath(dest)), + { ...defaultOptions, ...opts }) +} + +function getValidatedPath (fileURLOrPath) { + const path = fileURLOrPath != null && fileURLOrPath.href + && fileURLOrPath.origin + ? fileURLToPath(fileURLOrPath) + : fileURLOrPath + return path +} + +async function cpFn (src, dest, opts) { + // Warn about using preserveTimestamps on 32-bit node + // istanbul ignore next + if (opts.preserveTimestamps && process.arch === 'ia32') { + const warning = 'Using the preserveTimestamps option in 32-bit ' + + 'node is not recommended' + process.emitWarning(warning, 'TimestampPrecisionWarning') + } + const stats = await checkPaths(src, dest, opts) + const { srcStat, destStat } = stats + await checkParentPaths(src, srcStat, dest) + if (opts.filter) { + return handleFilter(checkParentDir, destStat, src, dest, opts) + } + return checkParentDir(destStat, src, dest, opts) +} + +async function checkPaths (src, dest, opts) { + const { 0: srcStat, 1: destStat } = await getStats(src, dest, opts) + if (destStat) { + if (areIdentical(srcStat, destStat)) { + throw new ERR_FS_CP_EINVAL({ + message: 'src and dest cannot be the same', + path: dest, + syscall: 'cp', + errno: EINVAL, + }) + } + if (srcStat.isDirectory() && !destStat.isDirectory()) { + throw new ERR_FS_CP_DIR_TO_NON_DIR({ + message: `cannot overwrite directory ${src} ` + + `with non-directory ${dest}`, + path: dest, + syscall: 'cp', + errno: EISDIR, + }) + } + if (!srcStat.isDirectory() && destStat.isDirectory()) { + throw new ERR_FS_CP_NON_DIR_TO_DIR({ + message: `cannot overwrite non-directory ${src} ` + + `with directory ${dest}`, + path: dest, + syscall: 'cp', + errno: ENOTDIR, + }) + } + } + + if (srcStat.isDirectory() && isSrcSubdir(src, dest)) { + throw new ERR_FS_CP_EINVAL({ + message: `cannot copy ${src} to a subdirectory of self ${dest}`, + path: dest, + syscall: 'cp', + errno: EINVAL, + }) + } + return { srcStat, destStat } +} + +function areIdentical (srcStat, destStat) { + return destStat.ino && destStat.dev && destStat.ino === srcStat.ino && + destStat.dev === srcStat.dev +} + +function getStats (src, dest, opts) { + const statFunc = opts.dereference ? + (file) => stat(file, { bigint: true }) : + (file) => lstat(file, { bigint: true }) + return Promise.all([ + statFunc(src), + statFunc(dest).catch((err) => { + // istanbul ignore next: unsure how to cover. + if (err.code === 'ENOENT') { + return null + } + // istanbul ignore next: unsure how to cover. + throw err + }), + ]) +} + +async function checkParentDir (destStat, src, dest, opts) { + const destParent = dirname(dest) + const dirExists = await pathExists(destParent) + if (dirExists) { + return getStatsForCopy(destStat, src, dest, opts) + } + await mkdir(destParent, { recursive: true }) + return getStatsForCopy(destStat, src, dest, opts) +} + +function pathExists (dest) { + return stat(dest).then( + () => true, + // istanbul ignore next: not sure when this would occur + (err) => (err.code === 'ENOENT' ? false : Promise.reject(err))) +} + +// Recursively check if dest parent is a subdirectory of src. +// It works for all file types including symlinks since it +// checks the src and dest inodes. It starts from the deepest +// parent and stops once it reaches the src parent or the root path. +async function checkParentPaths (src, srcStat, dest) { + const srcParent = resolve(dirname(src)) + const destParent = resolve(dirname(dest)) + if (destParent === srcParent || destParent === parse(destParent).root) { + return + } + let destStat + try { + destStat = await stat(destParent, { bigint: true }) + } catch (err) { + // istanbul ignore else: not sure when this would occur + if (err.code === 'ENOENT') { + return + } + // istanbul ignore next: not sure when this would occur + throw err + } + if (areIdentical(srcStat, destStat)) { + throw new ERR_FS_CP_EINVAL({ + message: `cannot copy ${src} to a subdirectory of self ${dest}`, + path: dest, + syscall: 'cp', + errno: EINVAL, + }) + } + return checkParentPaths(src, srcStat, destParent) +} + +const normalizePathToArray = (path) => + resolve(path).split(sep).filter(Boolean) + +// Return true if dest is a subdir of src, otherwise false. +// It only checks the path strings. +function isSrcSubdir (src, dest) { + const srcArr = normalizePathToArray(src) + const destArr = normalizePathToArray(dest) + return srcArr.every((cur, i) => destArr[i] === cur) +} + +async function handleFilter (onInclude, destStat, src, dest, opts, cb) { + const include = await opts.filter(src, dest) + if (include) { + return onInclude(destStat, src, dest, opts, cb) + } +} + +function startCopy (destStat, src, dest, opts) { + if (opts.filter) { + return handleFilter(getStatsForCopy, destStat, src, dest, opts) + } + return getStatsForCopy(destStat, src, dest, opts) +} + +async function getStatsForCopy (destStat, src, dest, opts) { + const statFn = opts.dereference ? stat : lstat + const srcStat = await statFn(src) + // istanbul ignore else: can't portably test FIFO + if (srcStat.isDirectory() && opts.recursive) { + return onDir(srcStat, destStat, src, dest, opts) + } else if (srcStat.isDirectory()) { + throw new ERR_FS_EISDIR({ + message: `${src} is a directory (not copied)`, + path: src, + syscall: 'cp', + errno: EINVAL, + }) + } else if (srcStat.isFile() || + srcStat.isCharacterDevice() || + srcStat.isBlockDevice()) { + return onFile(srcStat, destStat, src, dest, opts) + } else if (srcStat.isSymbolicLink()) { + return onLink(destStat, src, dest) + } else if (srcStat.isSocket()) { + throw new ERR_FS_CP_SOCKET({ + message: `cannot copy a socket file: ${dest}`, + path: dest, + syscall: 'cp', + errno: EINVAL, + }) + } else if (srcStat.isFIFO()) { + throw new ERR_FS_CP_FIFO_PIPE({ + message: `cannot copy a FIFO pipe: ${dest}`, + path: dest, + syscall: 'cp', + errno: EINVAL, + }) + } + // istanbul ignore next: should be unreachable + throw new ERR_FS_CP_UNKNOWN({ + message: `cannot copy an unknown file type: ${dest}`, + path: dest, + syscall: 'cp', + errno: EINVAL, + }) +} + +function onFile (srcStat, destStat, src, dest, opts) { + if (!destStat) { + return _copyFile(srcStat, src, dest, opts) + } + return mayCopyFile(srcStat, src, dest, opts) +} + +async function mayCopyFile (srcStat, src, dest, opts) { + if (opts.force) { + await unlink(dest) + return _copyFile(srcStat, src, dest, opts) + } else if (opts.errorOnExist) { + throw new ERR_FS_CP_EEXIST({ + message: `${dest} already exists`, + path: dest, + syscall: 'cp', + errno: EEXIST, + }) + } +} + +async function _copyFile (srcStat, src, dest, opts) { + await copyFile(src, dest) + if (opts.preserveTimestamps) { + return handleTimestampsAndMode(srcStat.mode, src, dest) + } + return setDestMode(dest, srcStat.mode) +} + +async function handleTimestampsAndMode (srcMode, src, dest) { + // Make sure the file is writable before setting the timestamp + // otherwise open fails with EPERM when invoked with 'r+' + // (through utimes call) + if (fileIsNotWritable(srcMode)) { + await makeFileWritable(dest, srcMode) + return setDestTimestampsAndMode(srcMode, src, dest) + } + return setDestTimestampsAndMode(srcMode, src, dest) +} + +function fileIsNotWritable (srcMode) { + return (srcMode & 0o200) === 0 +} + +function makeFileWritable (dest, srcMode) { + return setDestMode(dest, srcMode | 0o200) +} + +async function setDestTimestampsAndMode (srcMode, src, dest) { + await setDestTimestamps(src, dest) + return setDestMode(dest, srcMode) +} + +function setDestMode (dest, srcMode) { + return chmod(dest, srcMode) +} + +async function setDestTimestamps (src, dest) { + // The initial srcStat.atime cannot be trusted + // because it is modified by the read(2) system call + // (See https://nodejs.org/api/fs.html#fs_stat_time_values) + const updatedSrcStat = await stat(src) + return utimes(dest, updatedSrcStat.atime, updatedSrcStat.mtime) +} + +function onDir (srcStat, destStat, src, dest, opts) { + if (!destStat) { + return mkDirAndCopy(srcStat.mode, src, dest, opts) + } + return copyDir(src, dest, opts) +} + +async function mkDirAndCopy (srcMode, src, dest, opts) { + await mkdir(dest) + await copyDir(src, dest, opts) + return setDestMode(dest, srcMode) +} + +async function copyDir (src, dest, opts) { + const dir = await readdir(src) + for (let i = 0; i < dir.length; i++) { + const item = dir[i] + const srcItem = join(src, item) + const destItem = join(dest, item) + const { destStat } = await checkPaths(srcItem, destItem, opts) + await startCopy(destStat, srcItem, destItem, opts) + } +} + +async function onLink (destStat, src, dest) { + let resolvedSrc = await readlink(src) + if (!isAbsolute(resolvedSrc)) { + resolvedSrc = resolve(dirname(src), resolvedSrc) + } + if (!destStat) { + return symlink(resolvedSrc, dest) + } + let resolvedDest + try { + resolvedDest = await readlink(dest) + } catch (err) { + // Dest exists and is a regular file or directory, + // Windows may throw UNKNOWN error. If dest already exists, + // fs throws error anyway, so no need to guard against it here. + // istanbul ignore next: can only test on windows + if (err.code === 'EINVAL' || err.code === 'UNKNOWN') { + return symlink(resolvedSrc, dest) + } + // istanbul ignore next: should not be possible + throw err + } + if (!isAbsolute(resolvedDest)) { + resolvedDest = resolve(dirname(dest), resolvedDest) + } + if (isSrcSubdir(resolvedSrc, resolvedDest)) { + throw new ERR_FS_CP_EINVAL({ + message: `cannot copy ${resolvedSrc} to a subdirectory of self ` + + `${resolvedDest}`, + path: dest, + syscall: 'cp', + errno: EINVAL, + }) + } + // Do not copy if src is a subdir of dest since unlinking + // dest in this case would result in removing src contents + // and therefore a broken symlink would be created. + const srcStat = await stat(src) + if (srcStat.isDirectory() && isSrcSubdir(resolvedDest, resolvedSrc)) { + throw new ERR_FS_CP_SYMLINK_TO_SUBDIRECTORY({ + message: `cannot overwrite ${resolvedDest} with ${resolvedSrc}`, + path: dest, + syscall: 'cp', + errno: EINVAL, + }) + } + return copyLink(resolvedSrc, dest) +} + +async function copyLink (resolvedSrc, dest) { + await unlink(dest) + return symlink(resolvedSrc, dest) +} + +module.exports = cp diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/errors.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/errors.js new file mode 100644 index 00000000..1cd1e05d --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/errors.js @@ -0,0 +1,129 @@ +'use strict' +const { inspect } = require('util') + +// adapted from node's internal/errors +// https://github.com/nodejs/node/blob/c8a04049/lib/internal/errors.js + +// close copy of node's internal SystemError class. +class SystemError { + constructor (code, prefix, context) { + // XXX context.code is undefined in all constructors used in cp/polyfill + // that may be a bug copied from node, maybe the constructor should use + // `code` not `errno`? nodejs/node#41104 + let message = `${prefix}: ${context.syscall} returned ` + + `${context.code} (${context.message})` + + if (context.path !== undefined) { + message += ` ${context.path}` + } + if (context.dest !== undefined) { + message += ` => ${context.dest}` + } + + this.code = code + Object.defineProperties(this, { + name: { + value: 'SystemError', + enumerable: false, + writable: true, + configurable: true, + }, + message: { + value: message, + enumerable: false, + writable: true, + configurable: true, + }, + info: { + value: context, + enumerable: true, + configurable: true, + writable: false, + }, + errno: { + get () { + return context.errno + }, + set (value) { + context.errno = value + }, + enumerable: true, + configurable: true, + }, + syscall: { + get () { + return context.syscall + }, + set (value) { + context.syscall = value + }, + enumerable: true, + configurable: true, + }, + }) + + if (context.path !== undefined) { + Object.defineProperty(this, 'path', { + get () { + return context.path + }, + set (value) { + context.path = value + }, + enumerable: true, + configurable: true, + }) + } + + if (context.dest !== undefined) { + Object.defineProperty(this, 'dest', { + get () { + return context.dest + }, + set (value) { + context.dest = value + }, + enumerable: true, + configurable: true, + }) + } + } + + toString () { + return `${this.name} [${this.code}]: ${this.message}` + } + + [Symbol.for('nodejs.util.inspect.custom')] (_recurseTimes, ctx) { + return inspect(this, { + ...ctx, + getters: true, + customInspect: false, + }) + } +} + +function E (code, message) { + module.exports[code] = class NodeError extends SystemError { + constructor (ctx) { + super(code, message, ctx) + } + } +} + +E('ERR_FS_CP_DIR_TO_NON_DIR', 'Cannot overwrite directory with non-directory') +E('ERR_FS_CP_EEXIST', 'Target already exists') +E('ERR_FS_CP_EINVAL', 'Invalid src or dest') +E('ERR_FS_CP_FIFO_PIPE', 'Cannot copy a FIFO pipe') +E('ERR_FS_CP_NON_DIR_TO_DIR', 'Cannot overwrite non-directory with directory') +E('ERR_FS_CP_SOCKET', 'Cannot copy a socket file') +E('ERR_FS_CP_SYMLINK_TO_SUBDIRECTORY', 'Cannot overwrite symlink in subdirectory of self') +E('ERR_FS_CP_UNKNOWN', 'Cannot copy an unknown file type') +E('ERR_FS_EISDIR', 'Path is a directory') + +module.exports.ERR_INVALID_ARG_TYPE = class ERR_INVALID_ARG_TYPE extends Error { + constructor (name, expected, actual) { + super() + this.code = 'ERR_INVALID_ARG_TYPE' + this.message = `The ${name} argument must be ${expected}. Received ${typeof actual}` + } +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/fs.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/fs.js new file mode 100644 index 00000000..29e5fb57 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/fs.js @@ -0,0 +1,8 @@ +const fs = require('fs') +const promisify = require('@gar/promisify') + +// this module returns the core fs module wrapped in a proxy that promisifies +// method calls within the getter. we keep it in a separate module so that the +// overridden methods have a consistent way to get to promisified fs methods +// without creating a circular dependency +module.exports = promisify(fs) diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/index.js new file mode 100644 index 00000000..e40d748a --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/index.js @@ -0,0 +1,10 @@ +module.exports = { + ...require('./fs.js'), + copyFile: require('./copy-file.js'), + cp: require('./cp/index.js'), + mkdir: require('./mkdir/index.js'), + mkdtemp: require('./mkdtemp.js'), + rm: require('./rm/index.js'), + withTempDir: require('./with-temp-dir.js'), + writeFile: require('./write-file.js'), +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/mkdir/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/mkdir/index.js new file mode 100644 index 00000000..04ff4479 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/mkdir/index.js @@ -0,0 +1,32 @@ +const fs = require('../fs.js') +const getOptions = require('../common/get-options.js') +const node = require('../common/node.js') +const owner = require('../common/owner.js') + +const polyfill = require('./polyfill.js') + +// node 10.12.0 added the options parameter, which allows recursive and mode +// properties to be passed +const useNative = node.satisfies('>=10.12.0') + +// extends mkdir with the ability to specify an owner of the new dir +const mkdir = async (path, opts) => { + const options = getOptions(opts, { + copy: ['mode', 'recursive', 'owner'], + wrap: 'mode', + }) + const { uid, gid } = await owner.validate(path, options.owner) + + // the polyfill is tested separately from this module, no need to hack + // process.version to try to trigger it just for coverage + // istanbul ignore next + const result = useNative + ? await fs.mkdir(path, options) + : await polyfill(path, options) + + await owner.update(path, uid, gid) + + return result +} + +module.exports = mkdir diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/mkdir/polyfill.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/mkdir/polyfill.js new file mode 100644 index 00000000..4f8e6f00 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/mkdir/polyfill.js @@ -0,0 +1,81 @@ +const { dirname } = require('path') + +const fileURLToPath = require('../common/file-url-to-path/index.js') +const fs = require('../fs.js') + +const defaultOptions = { + mode: 0o777, + recursive: false, +} + +const mkdir = async (path, opts) => { + const options = { ...defaultOptions, ...opts } + + // if we're not in recursive mode, just call the real mkdir with the path and + // the mode option only + if (!options.recursive) { + return fs.mkdir(path, options.mode) + } + + const makeDirectory = async (dir, mode) => { + // we can't use dirname directly since these functions support URL + // objects with the file: protocol as the path input, so first we get a + // string path, then we can call dirname on that + const parent = dir != null && dir.href && dir.origin + ? dirname(fileURLToPath(dir)) + : dirname(dir) + + // if the parent is the dir itself, try to create it. anything but EISDIR + // should be rethrown + if (parent === dir) { + try { + await fs.mkdir(dir, opts) + } catch (err) { + if (err.code !== 'EISDIR') { + throw err + } + } + return undefined + } + + try { + await fs.mkdir(dir, mode) + return dir + } catch (err) { + // ENOENT means the parent wasn't there, so create that + if (err.code === 'ENOENT') { + const made = await makeDirectory(parent, mode) + await makeDirectory(dir, mode) + // return the shallowest path we created, i.e. the result of creating + // the parent + return made + } + + // an EEXIST means there's already something there + // an EROFS means we have a read-only filesystem and can't create a dir + // any other error is fatal and we should give up now + if (err.code !== 'EEXIST' && err.code !== 'EROFS') { + throw err + } + + // stat the directory, if the result is a directory, then we successfully + // created this one so return its path. otherwise, we reject with the + // original error by ignoring the error in the catch + try { + const stat = await fs.stat(dir) + if (stat.isDirectory()) { + // if it already existed, we didn't create anything so return + // undefined + return undefined + } + } catch (_) {} + + // if the thing that's there isn't a directory, then just re-throw + throw err + } + } + + return makeDirectory(path, options.mode) +} + +module.exports = mkdir diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/mkdtemp.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/mkdtemp.js new file mode 100644 index 00000000..b7f07802 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/mkdtemp.js @@ -0,0 +1,28 @@ +const { dirname, sep } = require('path') + +const fs = require('./fs.js') +const getOptions = require('./common/get-options.js') +const owner = require('./common/owner.js') + +const mkdtemp = async (prefix, opts) => { + const options = getOptions(opts, { + copy: ['encoding', 'owner'], + wrap: 'encoding', + }) + + // mkdtemp relies on the trailing path separator to indicate if it should + // create a directory inside of the prefix. if that's the case then the root + // we infer ownership from is the prefix itself, otherwise it's the dirname + // /tmp -> /tmpABCDEF, infers from / + // /tmp/ -> /tmp/ABCDEF, infers from /tmp + const root = prefix.endsWith(sep) ? prefix : dirname(prefix) + const { uid, gid } = await owner.validate(root, options.owner) + + const result = await fs.mkdtemp(prefix, options) + + await owner.update(result, uid, gid) + + return result +} + +module.exports = mkdtemp diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/rm/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/rm/index.js new file mode 100644 index 00000000..cb81fbdf --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/rm/index.js @@ -0,0 +1,22 @@ +const fs = require('../fs.js') +const getOptions = require('../common/get-options.js') +const node = require('../common/node.js') +const polyfill = require('./polyfill.js') + +// node 14.14.0 added fs.rm, which allows both the force and recursive options +const useNative = node.satisfies('>=14.14.0') + +const rm = async (path, opts) => { + const options = getOptions(opts, { + copy: ['retryDelay', 'maxRetries', 'recursive', 'force'], + }) + + // the polyfill is tested separately from this module, no need to hack + // process.version to try to trigger it just for coverage + // istanbul ignore next + return useNative + ? fs.rm(path, options) + : polyfill(path, options) +} + +module.exports = rm diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/rm/polyfill.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/rm/polyfill.js new file mode 100644 index 00000000..a25c1748 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/rm/polyfill.js @@ -0,0 +1,239 @@ +// this file is a modified version of the code in node core >=14.14.0 +// which is, in turn, a modified version of the rimraf module on npm +// node core changes: +// - Use of the assert module has been replaced with core's error system. +// - All code related to the glob dependency has been removed. +// - Bring your own custom fs module is not currently supported. +// - Some basic code cleanup. +// changes here: +// - remove all callback related code +// - drop sync support +// - change assertions back to non-internal methods (see options.js) +// - throws ENOTDIR when rmdir gets an ENOENT for a path that exists in Windows +const errnos = require('os').constants.errno +const { join } = require('path') +const fs = require('../fs.js') + +// error codes that mean we need to remove contents +const notEmptyCodes = new Set([ + 'ENOTEMPTY', + 'EEXIST', + 'EPERM', +]) + +// error codes we can retry later +const retryCodes = new Set([ + 'EBUSY', + 'EMFILE', + 'ENFILE', + 'ENOTEMPTY', + 'EPERM', +]) + +const isWindows = process.platform === 'win32' + +const defaultOptions = { + retryDelay: 100, + maxRetries: 0, + recursive: false, + force: false, +} + +// this is drastically simplified, but should be roughly equivalent to what +// node core throws +class ERR_FS_EISDIR extends Error { + constructor (path) { + super() + this.info = { + code: 'EISDIR', + message: 'is a directory', + path, + syscall: 'rm', + errno: errnos.EISDIR, + } + this.name = 'SystemError' + this.code = 'ERR_FS_EISDIR' + this.errno = errnos.EISDIR + this.syscall = 'rm' + this.path = path + this.message = `Path is a directory: ${this.syscall} returned ` + + `${this.info.code} (is a directory) ${path}` + } + + toString () { + return `${this.name} [${this.code}]: ${this.message}` + } +} + +class ENOTDIR extends Error { + constructor (path) { + super() + this.name = 'Error' + this.code = 'ENOTDIR' + this.errno = errnos.ENOTDIR + this.syscall = 'rmdir' + this.path = path + this.message = `not a directory, ${this.syscall} '${this.path}'` + } + + toString () { + return `${this.name}: ${this.code}: ${this.message}` + } +} + +// force is passed separately here because we respect it for the first entry +// into rimraf only, any further calls that are spawned as a result (i.e. to +// delete content within the target) will ignore ENOENT errors +const rimraf = async (path, options, isTop = false) => { + const force = isTop ? options.force : true + const stat = await fs.lstat(path) + .catch((err) => { + // we only ignore ENOENT if we're forcing this call + if (err.code === 'ENOENT' && force) { + return + } + + if (isWindows && err.code === 'EPERM') { + return fixEPERM(path, options, err, isTop) + } + + throw err + }) + + // no stat object here means either lstat threw an ENOENT, or lstat threw + // an EPERM and the fixPERM function took care of things. either way, we're + // already done, so return early + if (!stat) { + return + } + + if (stat.isDirectory()) { + return rmdir(path, options, null, isTop) + } + + return fs.unlink(path) + .catch((err) => { + if (err.code === 'ENOENT' && force) { + return + } + + if (err.code === 'EISDIR') { + return rmdir(path, options, err, isTop) + } + + if (err.code === 'EPERM') { + // in windows, we handle this through fixEPERM which will also try to + // delete things again. everywhere else since deleting the target as a + // file didn't work we go ahead and try to delete it as a directory + return isWindows + ? fixEPERM(path, options, err, isTop) + : rmdir(path, options, err, isTop) + } + + throw err + }) +} + +const fixEPERM = async (path, options, originalErr, isTop) => { + const force = isTop ? options.force : true + const targetMissing = await fs.chmod(path, 0o666) + .catch((err) => { + if (err.code === 'ENOENT' && force) { + return true + } + + throw originalErr + }) + + // got an ENOENT above, return now. no file = no problem + if (targetMissing) { + return + } + + // this function does its own lstat rather than calling rimraf again to avoid + // infinite recursion for a repeating EPERM + const stat = await fs.lstat(path) + .catch((err) => { + if (err.code === 'ENOENT' && force) { + return + } + + throw originalErr + }) + + if (!stat) { + return + } + + if (stat.isDirectory()) { + return rmdir(path, options, originalErr, isTop) + } + + return fs.unlink(path) +} + +const rmdir = async (path, options, originalErr, isTop) => { + if (!options.recursive && isTop) { + throw originalErr || new ERR_FS_EISDIR(path) + } + const force = isTop ? options.force : true + + return fs.rmdir(path) + .catch(async (err) => { + // in Windows, calling rmdir on a file path will fail with ENOENT rather + // than ENOTDIR. to determine if that's what happened, we have to do + // another lstat on the path. if the path isn't actually gone, we throw + // away the ENOENT and replace it with our own ENOTDIR + if (isWindows && err.code === 'ENOENT') { + const stillExists = await fs.lstat(path).then(() => true, () => false) + if (stillExists) { + err = new ENOTDIR(path) + } + } + + // not there, not a problem + if (err.code === 'ENOENT' && force) { + return + } + + // we may not have originalErr if lstat tells us our target is a + // directory but that changes before we actually remove it, so + // only throw it here if it's set + if (originalErr && err.code === 'ENOTDIR') { + throw originalErr + } + + // the directory isn't empty, remove the contents and try again + if (notEmptyCodes.has(err.code)) { + const files = await fs.readdir(path) + await Promise.all(files.map((file) => { + const target = join(path, file) + return rimraf(target, options) + })) + return fs.rmdir(path) + } + + throw err + }) +} + +const rm = async (path, opts) => { + const options = { ...defaultOptions, ...opts } + let retries = 0 + + const errHandler = async (err) => { + if (retryCodes.has(err.code) && ++retries < options.maxRetries) { + const delay = retries * options.retryDelay + await promiseTimeout(delay) + return rimraf(path, options, true).catch(errHandler) + } + + throw err + } + + return rimraf(path, options, true).catch(errHandler) +} + +const promiseTimeout = (ms) => new Promise((r) => setTimeout(r, ms)) + +module.exports = rm diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/with-temp-dir.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/with-temp-dir.js new file mode 100644 index 00000000..353d5555 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/with-temp-dir.js @@ -0,0 +1,39 @@ +const { join, sep } = require('path') + +const getOptions = require('./common/get-options.js') +const mkdir = require('./mkdir/index.js') +const mkdtemp = require('./mkdtemp.js') +const rm = require('./rm/index.js') + +// create a temp directory, ensure its permissions match its parent, then call +// the supplied function passing it the path to the directory. clean up after +// the function finishes, whether it throws or not +const withTempDir = async (root, fn, opts) => { + const options = getOptions(opts, { + copy: ['tmpPrefix'], + }) + // create the directory, and fix its ownership + await mkdir(root, { recursive: true, owner: 'inherit' }) + + const target = await mkdtemp(join(`${root}${sep}`, options.tmpPrefix || ''), { owner: 'inherit' }) + let err + let result + + try { + result = await fn(target) + } catch (_err) { + err = _err + } + + try { + await rm(target, { force: true, recursive: true }) + } catch (err) {} + + if (err) { + throw err + } + + return result +} + +module.exports = withTempDir diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/write-file.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/write-file.js new file mode 100644 index 00000000..01de531d --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/lib/write-file.js @@ -0,0 +1,19 @@ +const fs = require('./fs.js') +const getOptions = require('./common/get-options.js') +const owner = require('./common/owner.js') + +const writeFile = async (file, data, opts) => { + const options = getOptions(opts, { + copy: ['encoding', 'mode', 'flag', 'signal', 'owner'], + wrap: 'encoding', + }) + const { uid, gid } = await owner.validate(file, options.owner) + + const result = await fs.writeFile(file, data, options) + + await owner.update(file, uid, gid) + + return result +} + +module.exports = writeFile diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/package.json new file mode 100644 index 00000000..43476829 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/fs/package.json @@ -0,0 +1,66 @@ +{ + "_from": "@npmcli/fs@^1.0.0", + "_id": "@npmcli/fs@1.1.1", + "_inBundle": false, + "_integrity": "sha512-8KG5RD0GVP4ydEzRn/I4BNDuxDtqVbOdm8675T49OIG/NGhaK0pjPX7ZcDlvKYbA+ulvVK3ztfcF4uBdOxuJbQ==", + "_location": "/@npmcli/fs", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "@npmcli/fs@^1.0.0", + "name": "@npmcli/fs", + "escapedName": "@npmcli%2ffs", + "scope": "@npmcli", + "rawSpec": "^1.0.0", + "saveSpec": null, + "fetchSpec": "^1.0.0" + }, + "_requiredBy": [ + "/cacache" + ], + "_resolved": "https://registry.npmjs.org/@npmcli/fs/-/fs-1.1.1.tgz", + "_shasum": "72f719fe935e687c56a4faecf3c03d06ba593257", + "_spec": "@npmcli/fs@^1.0.0", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\cacache", + "author": { + "name": "GitHub Inc." + }, + "bundleDependencies": false, + "dependencies": { + "@gar/promisify": "^1.0.1", + "semver": "^7.3.5" + }, + "deprecated": false, + "description": "filesystem utilities for the npm cli", + "devDependencies": { + "@npmcli/template-oss": "^2.3.1", + "tap": "^15.0.9" + }, + "files": [ + "bin", + "lib" + ], + "keywords": [ + "npm", + "oss" + ], + "license": "ISC", + "main": "lib/index.js", + "name": "@npmcli/fs", + "scripts": { + "lint": "eslint '**/*.js'", + "lintfix": "npm run lint -- --fix", + "npmclilint": "npmcli-lint", + "postlint": "npm-template-check", + "postsnap": "npm run lintfix --", + "posttest": "npm run lint", + "postversion": "npm publish", + "prepublishOnly": "git push origin --follow-tags", + "preversion": "npm test", + "snap": "tap", + "test": "tap" + }, + "templateVersion": "2.3.1", + "version": "1.1.1" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/move-file/LICENSE.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/move-file/LICENSE.md new file mode 100644 index 00000000..072bf208 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/move-file/LICENSE.md @@ -0,0 +1,22 @@ +MIT License + +Copyright (c) Sindre Sorhus (https://sindresorhus.com) +Copyright (c) npm, Inc. + +Permission is hereby granted, free of charge, to any person obtaining a +copy of this software and associated documentation files (the "Software"), +to deal in the Software without restriction, including without limitation +the rights to use, copy, modify, merge, publish, distribute, sublicense, +and/or sell copies of the Software, and to permit persons to whom the +Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER +DEALINGS IN THE SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/move-file/README.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/move-file/README.md new file mode 100644 index 00000000..8a5a57f0 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/move-file/README.md @@ -0,0 +1,69 @@ +# @npmcli/move-file + +A fork of [move-file](https://github.com/sindresorhus/move-file) with +compatibility with all node 10.x versions. + +> Move a file (or directory) + +The built-in +[`fs.rename()`](https://nodejs.org/api/fs.html#fs_fs_rename_oldpath_newpath_callback) +is just a JavaScript wrapper for the C `rename(2)` function, which doesn't +support moving files across partitions or devices. This module is what you +would have expected `fs.rename()` to be. + +## Highlights + +- Promise API. +- Supports moving a file across partitions and devices. +- Optionally prevent overwriting an existing file. +- Creates non-existent destination directories for you. +- Support for Node versions that lack built-in recursive `fs.mkdir()` +- Automatically recurses when source is a directory. + +## Install + +``` +$ npm install @npmcli/move-file +``` + +## Usage + +```js +const moveFile = require('@npmcli/move-file'); + +(async () => { + await moveFile('source/unicorn.png', 'destination/unicorn.png'); + console.log('The file has been moved'); +})(); +``` + +## API + +### moveFile(source, destination, options?) + +Returns a `Promise` that resolves when the file has been moved. + +### moveFile.sync(source, destination, options?) + +#### source + +Type: `string` + +File, or directory, you want to move. + +#### destination + +Type: `string` + +Where you want the file or directory moved. + +#### options + +Type: `object` + +##### overwrite + +Type: `boolean`\ +Default: `true` + +Overwrite existing destination file(s). diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/move-file/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/move-file/index.js new file mode 100644 index 00000000..95d1888c --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/move-file/index.js @@ -0,0 +1,162 @@ +const { dirname, join, resolve, relative, isAbsolute } = require('path') +const rimraf_ = require('rimraf') +const { promisify } = require('util') +const { + access: access_, + accessSync, + copyFile: copyFile_, + copyFileSync, + unlink: unlink_, + unlinkSync, + readdir: readdir_, + readdirSync, + rename: rename_, + renameSync, + stat: stat_, + statSync, + lstat: lstat_, + lstatSync, + symlink: symlink_, + symlinkSync, + readlink: readlink_, + readlinkSync +} = require('fs') + +const access = promisify(access_) +const copyFile = promisify(copyFile_) +const unlink = promisify(unlink_) +const readdir = promisify(readdir_) +const rename = promisify(rename_) +const stat = promisify(stat_) +const lstat = promisify(lstat_) +const symlink = promisify(symlink_) +const readlink = promisify(readlink_) +const rimraf = promisify(rimraf_) +const rimrafSync = rimraf_.sync + +const mkdirp = require('mkdirp') + +const pathExists = async path => { + try { + await access(path) + return true + } catch (er) { + return er.code !== 'ENOENT' + } +} + +const pathExistsSync = path => { + try { + accessSync(path) + return true + } catch (er) { + return er.code !== 'ENOENT' + } +} + +const moveFile = async (source, destination, options = {}, root = true, symlinks = []) => { + if (!source || !destination) { + throw new TypeError('`source` and `destination` file required') + } + + options = { + overwrite: true, + ...options + } + + if (!options.overwrite && await pathExists(destination)) { + throw new Error(`The destination file exists: ${destination}`) + } + + await mkdirp(dirname(destination)) + + try { + await rename(source, destination) + } catch (error) { + if (error.code === 'EXDEV' || error.code === 'EPERM') { + const sourceStat = await lstat(source) + if (sourceStat.isDirectory()) { + const files = await readdir(source) + await Promise.all(files.map((file) => moveFile(join(source, file), join(destination, file), options, false, symlinks))) + } else if (sourceStat.isSymbolicLink()) { + symlinks.push({ source, destination }) + } else { + await copyFile(source, destination) + } + } else { + throw error + } + } + + if (root) { + await Promise.all(symlinks.map(async ({ source, destination }) => { + let target = await readlink(source) + // junction symlinks in windows will be absolute paths, so we need to make sure they point to the destination + if (isAbsolute(target)) + target = resolve(destination, relative(source, target)) + // try to determine what the actual file is so we can create the correct type of symlink in windows + let targetStat + try { + targetStat = await stat(resolve(dirname(source), target)) + } catch (err) {} + await symlink(target, destination, targetStat && targetStat.isDirectory() ? 'junction' : 'file') + })) + await rimraf(source) + } +} + +const moveFileSync = (source, destination, options = {}, root = true, symlinks = []) => { + if (!source || !destination) { + throw new TypeError('`source` and `destination` file required') + } + + options = { + overwrite: true, + ...options + } + + if (!options.overwrite && pathExistsSync(destination)) { + throw new Error(`The destination file exists: ${destination}`) + } + + mkdirp.sync(dirname(destination)) + + try { + renameSync(source, destination) + } catch (error) { + if (error.code === 'EXDEV' || error.code === 'EPERM') { + const sourceStat = lstatSync(source) + if (sourceStat.isDirectory()) { + const files = readdirSync(source) + for (const file of files) { + moveFileSync(join(source, file), join(destination, file), options, false, symlinks) + } + } else if (sourceStat.isSymbolicLink()) { + symlinks.push({ source, destination }) + } else { + copyFileSync(source, destination) + } + } else { + throw error + } + } + + if (root) { + for (const { source, destination } of symlinks) { + let target = readlinkSync(source) + // junction symlinks in windows will be absolute paths, so we need to make sure they point to the destination + if (isAbsolute(target)) + target = resolve(destination, relative(source, target)) + // try to determine what the actual file is so we can create the correct type of symlink in windows + let targetStat + try { + targetStat = statSync(resolve(dirname(source), target)) + } catch (err) {} + symlinkSync(target, destination, targetStat && targetStat.isDirectory() ? 'junction' : 'file') + } + rimrafSync(source) + } +} + +module.exports = moveFile +module.exports.sync = moveFileSync diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/move-file/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/move-file/package.json new file mode 100644 index 00000000..e0b87eca --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@npmcli/move-file/package.json @@ -0,0 +1,64 @@ +{ + "_from": "@npmcli/move-file@^1.0.1", + "_id": "@npmcli/move-file@1.1.2", + "_inBundle": false, + "_integrity": "sha512-1SUf/Cg2GzGDyaf15aR9St9TWlb+XvbZXWpDx8YKs7MLzMH/BCeopv+y9vzrzgkfykCGuWOlSu3mZhj2+FQcrg==", + "_location": "/@npmcli/move-file", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "@npmcli/move-file@^1.0.1", + "name": "@npmcli/move-file", + "escapedName": "@npmcli%2fmove-file", + "scope": "@npmcli", + "rawSpec": "^1.0.1", + "saveSpec": null, + "fetchSpec": "^1.0.1" + }, + "_requiredBy": [ + "/cacache" + ], + "_resolved": "https://registry.npmjs.org/@npmcli/move-file/-/move-file-1.1.2.tgz", + "_shasum": "1a82c3e372f7cae9253eb66d72543d6b8685c674", + "_spec": "@npmcli/move-file@^1.0.1", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\cacache", + "bugs": { + "url": "https://github.com/npm/move-file/issues" + }, + "bundleDependencies": false, + "dependencies": { + "mkdirp": "^1.0.4", + "rimraf": "^3.0.2" + }, + "deprecated": false, + "description": "move a file (fork of move-file)", + "devDependencies": { + "require-inject": "^1.4.4", + "tap": "^14.10.7" + }, + "engines": { + "node": ">=10" + }, + "files": [ + "index.js" + ], + "homepage": "https://github.com/npm/move-file#readme", + "license": "MIT", + "name": "@npmcli/move-file", + "repository": { + "type": "git", + "url": "git+https://github.com/npm/move-file.git" + }, + "scripts": { + "postversion": "npm publish", + "prepublishOnly": "git push origin --follow-tags", + "preversion": "npm test", + "snap": "tap", + "test": "tap" + }, + "tap": { + "check-coverage": true + }, + "version": "1.1.2" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@sindresorhus/is/dist/index.d.ts b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@sindresorhus/is/dist/index.d.ts new file mode 100644 index 00000000..e94d30b7 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@sindresorhus/is/dist/index.d.ts @@ -0,0 +1,132 @@ +/// +/// +/// +/// +/// +declare type TypedArray = Int8Array | Uint8Array | Uint8ClampedArray | Int16Array | Uint16Array | Int32Array | Uint32Array | Float32Array | Float64Array; +declare type Primitive = null | undefined | string | number | boolean | Symbol; +export interface ArrayLike { + length: number; +} +export interface Class { + new (...args: any[]): T; +} +declare type DomElement = object & { + nodeType: 1; + nodeName: string; +}; +declare type NodeStream = object & { + pipe: Function; +}; +export declare const enum TypeName { + null = "null", + boolean = "boolean", + undefined = "undefined", + string = "string", + number = "number", + symbol = "symbol", + Function = "Function", + GeneratorFunction = "GeneratorFunction", + AsyncFunction = "AsyncFunction", + Observable = "Observable", + Array = "Array", + Buffer = "Buffer", + Object = "Object", + RegExp = "RegExp", + Date = "Date", + Error = "Error", + Map = "Map", + Set = "Set", + WeakMap = "WeakMap", + WeakSet = "WeakSet", + Int8Array = "Int8Array", + Uint8Array = "Uint8Array", + Uint8ClampedArray = "Uint8ClampedArray", + Int16Array = "Int16Array", + Uint16Array = "Uint16Array", + Int32Array = "Int32Array", + Uint32Array = "Uint32Array", + Float32Array = "Float32Array", + Float64Array = "Float64Array", + ArrayBuffer = "ArrayBuffer", + SharedArrayBuffer = "SharedArrayBuffer", + DataView = "DataView", + Promise = "Promise", + URL = "URL" +} +declare function is(value: unknown): TypeName; +declare namespace is { + const undefined: (value: unknown) => value is undefined; + const string: (value: unknown) => value is string; + const number: (value: unknown) => value is number; + const function_: (value: unknown) => value is Function; + const null_: (value: unknown) => value is null; + const class_: (value: unknown) => value is Class; + const boolean: (value: unknown) => value is boolean; + const symbol: (value: unknown) => value is Symbol; + const numericString: (value: unknown) => boolean; + const array: (arg: any) => arg is any[]; + const buffer: (input: unknown) => input is Buffer; + const nullOrUndefined: (value: unknown) => value is null | undefined; + const object: (value: unknown) => value is object; + const iterable: (value: unknown) => value is IterableIterator; + const asyncIterable: (value: unknown) => value is AsyncIterableIterator; + const generator: (value: unknown) => value is Generator; + const nativePromise: (value: unknown) => value is Promise; + const promise: (value: unknown) => value is Promise; + const generatorFunction: (value: unknown) => value is GeneratorFunction; + const asyncFunction: (value: unknown) => value is Function; + const boundFunction: (value: unknown) => value is Function; + const regExp: (value: unknown) => value is RegExp; + const date: (value: unknown) => value is Date; + const error: (value: unknown) => value is Error; + const map: (value: unknown) => value is Map; + const set: (value: unknown) => value is Set; + const weakMap: (value: unknown) => value is WeakMap; + const weakSet: (value: unknown) => value is WeakSet; + const int8Array: (value: unknown) => value is Int8Array; + const uint8Array: (value: unknown) => value is Uint8Array; + const uint8ClampedArray: (value: unknown) => value is Uint8ClampedArray; + const int16Array: (value: unknown) => value is Int16Array; + const uint16Array: (value: unknown) => value is Uint16Array; + const int32Array: (value: unknown) => value is Int32Array; + const uint32Array: (value: unknown) => value is Uint32Array; + const float32Array: (value: unknown) => value is Float32Array; + const float64Array: (value: unknown) => value is Float64Array; + const arrayBuffer: (value: unknown) => value is ArrayBuffer; + const sharedArrayBuffer: (value: unknown) => value is SharedArrayBuffer; + const dataView: (value: unknown) => value is DataView; + const directInstanceOf: (instance: unknown, klass: Class) => instance is T; + const urlInstance: (value: unknown) => value is URL; + const urlString: (value: unknown) => boolean; + const truthy: (value: unknown) => boolean; + const falsy: (value: unknown) => boolean; + const nan: (value: unknown) => boolean; + const primitive: (value: unknown) => value is Primitive; + const integer: (value: unknown) => value is number; + const safeInteger: (value: unknown) => value is number; + const plainObject: (value: unknown) => boolean; + const typedArray: (value: unknown) => value is TypedArray; + const arrayLike: (value: unknown) => value is ArrayLike; + const inRange: (value: number, range: number | number[]) => boolean; + const domElement: (value: unknown) => value is DomElement; + const observable: (value: unknown) => boolean; + const nodeStream: (value: unknown) => value is NodeStream; + const infinite: (value: unknown) => boolean; + const even: (value: number) => boolean; + const odd: (value: number) => boolean; + const emptyArray: (value: unknown) => boolean; + const nonEmptyArray: (value: unknown) => boolean; + const emptyString: (value: unknown) => boolean; + const nonEmptyString: (value: unknown) => boolean; + const emptyStringOrWhitespace: (value: unknown) => boolean; + const emptyObject: (value: unknown) => boolean; + const nonEmptyObject: (value: unknown) => boolean; + const emptySet: (value: unknown) => boolean; + const nonEmptySet: (value: unknown) => boolean; + const emptyMap: (value: unknown) => boolean; + const nonEmptyMap: (value: unknown) => boolean; + const any: (predicate: unknown, ...values: unknown[]) => boolean; + const all: (predicate: unknown, ...values: unknown[]) => boolean; +} +export default is; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@sindresorhus/is/dist/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@sindresorhus/is/dist/index.js new file mode 100644 index 00000000..3cbafae1 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@sindresorhus/is/dist/index.js @@ -0,0 +1,245 @@ +"use strict"; +/// +/// +/// +/// +Object.defineProperty(exports, "__esModule", { value: true }); +// TODO: Use the `URL` global when targeting Node.js 10 +// tslint:disable-next-line +const URLGlobal = typeof URL === 'undefined' ? require('url').URL : URL; +const toString = Object.prototype.toString; +const isOfType = (type) => (value) => typeof value === type; +const isBuffer = (input) => !is.nullOrUndefined(input) && !is.nullOrUndefined(input.constructor) && is.function_(input.constructor.isBuffer) && input.constructor.isBuffer(input); +const getObjectType = (value) => { + const objectName = toString.call(value).slice(8, -1); + if (objectName) { + return objectName; + } + return null; +}; +const isObjectOfType = (type) => (value) => getObjectType(value) === type; +function is(value) { + switch (value) { + case null: + return "null" /* null */; + case true: + case false: + return "boolean" /* boolean */; + default: + } + switch (typeof value) { + case 'undefined': + return "undefined" /* undefined */; + case 'string': + return "string" /* string */; + case 'number': + return "number" /* number */; + case 'symbol': + return "symbol" /* symbol */; + default: + } + if (is.function_(value)) { + return "Function" /* Function */; + } + if (is.observable(value)) { + return "Observable" /* Observable */; + } + if (Array.isArray(value)) { + return "Array" /* Array */; + } + if (isBuffer(value)) { + return "Buffer" /* Buffer */; + } + const tagType = getObjectType(value); + if (tagType) { + return tagType; + } + if (value instanceof String || value instanceof Boolean || value instanceof Number) { + throw new TypeError('Please don\'t use object wrappers for primitive types'); + } + return "Object" /* Object */; +} +(function (is) { + // tslint:disable-next-line:strict-type-predicates + const isObject = (value) => typeof value === 'object'; + // tslint:disable:variable-name + is.undefined = isOfType('undefined'); + is.string = isOfType('string'); + is.number = isOfType('number'); + is.function_ = isOfType('function'); + // tslint:disable-next-line:strict-type-predicates + is.null_ = (value) => value === null; + is.class_ = (value) => is.function_(value) && value.toString().startsWith('class '); + is.boolean = (value) => value === true || value === false; + is.symbol = isOfType('symbol'); + // tslint:enable:variable-name + is.numericString = (value) => is.string(value) && value.length > 0 && !Number.isNaN(Number(value)); + is.array = Array.isArray; + is.buffer = isBuffer; + is.nullOrUndefined = (value) => is.null_(value) || is.undefined(value); + is.object = (value) => !is.nullOrUndefined(value) && (is.function_(value) || isObject(value)); + is.iterable = (value) => !is.nullOrUndefined(value) && is.function_(value[Symbol.iterator]); + is.asyncIterable = (value) => !is.nullOrUndefined(value) && is.function_(value[Symbol.asyncIterator]); + is.generator = (value) => is.iterable(value) && is.function_(value.next) && is.function_(value.throw); + is.nativePromise = (value) => isObjectOfType("Promise" /* Promise */)(value); + const hasPromiseAPI = (value) => !is.null_(value) && + isObject(value) && + is.function_(value.then) && + is.function_(value.catch); + is.promise = (value) => is.nativePromise(value) || hasPromiseAPI(value); + is.generatorFunction = isObjectOfType("GeneratorFunction" /* GeneratorFunction */); + is.asyncFunction = isObjectOfType("AsyncFunction" /* AsyncFunction */); + is.boundFunction = (value) => is.function_(value) && !value.hasOwnProperty('prototype'); + is.regExp = isObjectOfType("RegExp" /* RegExp */); + is.date = isObjectOfType("Date" /* Date */); + is.error = isObjectOfType("Error" /* Error */); + is.map = (value) => isObjectOfType("Map" /* Map */)(value); + is.set = (value) => isObjectOfType("Set" /* Set */)(value); + is.weakMap = (value) => isObjectOfType("WeakMap" /* WeakMap */)(value); + is.weakSet = (value) => isObjectOfType("WeakSet" /* WeakSet */)(value); + is.int8Array = isObjectOfType("Int8Array" /* Int8Array */); + is.uint8Array = isObjectOfType("Uint8Array" /* Uint8Array */); + is.uint8ClampedArray = isObjectOfType("Uint8ClampedArray" /* Uint8ClampedArray */); + is.int16Array = isObjectOfType("Int16Array" /* Int16Array */); + is.uint16Array = isObjectOfType("Uint16Array" /* Uint16Array */); + is.int32Array = isObjectOfType("Int32Array" /* Int32Array */); + is.uint32Array = isObjectOfType("Uint32Array" /* Uint32Array */); + is.float32Array = isObjectOfType("Float32Array" /* Float32Array */); + is.float64Array = isObjectOfType("Float64Array" /* Float64Array */); + is.arrayBuffer = isObjectOfType("ArrayBuffer" /* ArrayBuffer */); + is.sharedArrayBuffer = isObjectOfType("SharedArrayBuffer" /* SharedArrayBuffer */); + is.dataView = isObjectOfType("DataView" /* DataView */); + is.directInstanceOf = (instance, klass) => Object.getPrototypeOf(instance) === klass.prototype; + is.urlInstance = (value) => isObjectOfType("URL" /* URL */)(value); + is.urlString = (value) => { + if (!is.string(value)) { + return false; + } + try { + new URLGlobal(value); // tslint:disable-line no-unused-expression + return true; + } + catch (_a) { + return false; + } + }; + is.truthy = (value) => Boolean(value); + is.falsy = (value) => !value; + is.nan = (value) => Number.isNaN(value); + const primitiveTypes = new Set([ + 'undefined', + 'string', + 'number', + 'boolean', + 'symbol' + ]); + is.primitive = (value) => is.null_(value) || primitiveTypes.has(typeof value); + is.integer = (value) => Number.isInteger(value); + is.safeInteger = (value) => Number.isSafeInteger(value); + is.plainObject = (value) => { + // From: https://github.com/sindresorhus/is-plain-obj/blob/master/index.js + let prototype; + return getObjectType(value) === "Object" /* Object */ && + (prototype = Object.getPrototypeOf(value), prototype === null || // tslint:disable-line:ban-comma-operator + prototype === Object.getPrototypeOf({})); + }; + const typedArrayTypes = new Set([ + "Int8Array" /* Int8Array */, + "Uint8Array" /* Uint8Array */, + "Uint8ClampedArray" /* Uint8ClampedArray */, + "Int16Array" /* Int16Array */, + "Uint16Array" /* Uint16Array */, + "Int32Array" /* Int32Array */, + "Uint32Array" /* Uint32Array */, + "Float32Array" /* Float32Array */, + "Float64Array" /* Float64Array */ + ]); + is.typedArray = (value) => { + const objectType = getObjectType(value); + if (objectType === null) { + return false; + } + return typedArrayTypes.has(objectType); + }; + const isValidLength = (value) => is.safeInteger(value) && value > -1; + is.arrayLike = (value) => !is.nullOrUndefined(value) && !is.function_(value) && isValidLength(value.length); + is.inRange = (value, range) => { + if (is.number(range)) { + return value >= Math.min(0, range) && value <= Math.max(range, 0); + } + if (is.array(range) && range.length === 2) { + return value >= Math.min(...range) && value <= Math.max(...range); + } + throw new TypeError(`Invalid range: ${JSON.stringify(range)}`); + }; + const NODE_TYPE_ELEMENT = 1; + const DOM_PROPERTIES_TO_CHECK = [ + 'innerHTML', + 'ownerDocument', + 'style', + 'attributes', + 'nodeValue' + ]; + is.domElement = (value) => is.object(value) && value.nodeType === NODE_TYPE_ELEMENT && is.string(value.nodeName) && + !is.plainObject(value) && DOM_PROPERTIES_TO_CHECK.every(property => property in value); + is.observable = (value) => { + if (!value) { + return false; + } + if (value[Symbol.observable] && value === value[Symbol.observable]()) { + return true; + } + if (value['@@observable'] && value === value['@@observable']()) { + return true; + } + return false; + }; + is.nodeStream = (value) => !is.nullOrUndefined(value) && isObject(value) && is.function_(value.pipe) && !is.observable(value); + is.infinite = (value) => value === Infinity || value === -Infinity; + const isAbsoluteMod2 = (rem) => (value) => is.integer(value) && Math.abs(value % 2) === rem; + is.even = isAbsoluteMod2(0); + is.odd = isAbsoluteMod2(1); + const isWhiteSpaceString = (value) => is.string(value) && /\S/.test(value) === false; + is.emptyArray = (value) => is.array(value) && value.length === 0; + is.nonEmptyArray = (value) => is.array(value) && value.length > 0; + is.emptyString = (value) => is.string(value) && value.length === 0; + is.nonEmptyString = (value) => is.string(value) && value.length > 0; + is.emptyStringOrWhitespace = (value) => is.emptyString(value) || isWhiteSpaceString(value); + is.emptyObject = (value) => is.object(value) && !is.map(value) && !is.set(value) && Object.keys(value).length === 0; + is.nonEmptyObject = (value) => is.object(value) && !is.map(value) && !is.set(value) && Object.keys(value).length > 0; + is.emptySet = (value) => is.set(value) && value.size === 0; + is.nonEmptySet = (value) => is.set(value) && value.size > 0; + is.emptyMap = (value) => is.map(value) && value.size === 0; + is.nonEmptyMap = (value) => is.map(value) && value.size > 0; + const predicateOnArray = (method, predicate, values) => { + if (is.function_(predicate) === false) { + throw new TypeError(`Invalid predicate: ${JSON.stringify(predicate)}`); + } + if (values.length === 0) { + throw new TypeError('Invalid number of values'); + } + return method.call(values, predicate); + }; + // tslint:disable variable-name + is.any = (predicate, ...values) => predicateOnArray(Array.prototype.some, predicate, values); + is.all = (predicate, ...values) => predicateOnArray(Array.prototype.every, predicate, values); + // tslint:enable variable-name +})(is || (is = {})); +// Some few keywords are reserved, but we'll populate them for Node.js users +// See https://github.com/Microsoft/TypeScript/issues/2536 +Object.defineProperties(is, { + class: { + value: is.class_ + }, + function: { + value: is.function_ + }, + null: { + value: is.null_ + } +}); +exports.default = is; +// For CommonJS default export support +module.exports = is; +module.exports.default = is; +//# sourceMappingURL=index.js.map \ No newline at end of file diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@sindresorhus/is/dist/index.js.map b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@sindresorhus/is/dist/index.js.map new file mode 100644 index 00000000..cd827fc2 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@sindresorhus/is/dist/index.js.map @@ -0,0 +1 @@ +{"version":3,"file":"index.js","sourceRoot":"","sources":["../source/index.ts"],"names":[],"mappings":";AAAA,6BAA6B;AAC7B,0CAA0C;AAC1C,2CAA2C;AAC3C,0BAA0B;;AAE1B,uDAAuD;AACvD,2BAA2B;AAC3B,MAAM,SAAS,GAAG,OAAO,GAAG,KAAK,WAAW,CAAC,CAAC,CAAC,OAAO,CAAC,KAAK,CAAC,CAAC,GAAG,CAAC,CAAC,CAAC,GAAG,CAAC;AAqDxE,MAAM,QAAQ,GAAG,MAAM,CAAC,SAAS,CAAC,QAAQ,CAAC;AAC3C,MAAM,QAAQ,GAAG,CAAI,IAAY,EAAE,EAAE,CAAC,CAAC,KAAc,EAAc,EAAE,CAAC,OAAO,KAAK,KAAK,IAAI,CAAC;AAC5F,MAAM,QAAQ,GAAG,CAAC,KAAc,EAAmB,EAAE,CAAC,CAAC,EAAE,CAAC,eAAe,CAAC,KAAK,CAAC,IAAI,CAAC,EAAE,CAAC,eAAe,CAAE,KAAgB,CAAC,WAAW,CAAC,IAAI,EAAE,CAAC,SAAS,CAAE,KAAgB,CAAC,WAAW,CAAC,QAAQ,CAAC,IAAK,KAAgB,CAAC,WAAW,CAAC,QAAQ,CAAC,KAAK,CAAC,CAAC;AAEhP,MAAM,aAAa,GAAG,CAAC,KAAc,EAAmB,EAAE;IACzD,MAAM,UAAU,GAAG,QAAQ,CAAC,IAAI,CAAC,KAAK,CAAC,CAAC,KAAK,CAAC,CAAC,EAAE,CAAC,CAAC,CAAC,CAAC;IAErD,IAAI,UAAU,EAAE;QACf,OAAO,UAAsB,CAAC;KAC9B;IAED,OAAO,IAAI,CAAC;AACb,CAAC,CAAC;AAEF,MAAM,cAAc,GAAG,CAAI,IAAc,EAAE,EAAE,CAAC,CAAC,KAAc,EAAc,EAAE,CAAC,aAAa,CAAC,KAAK,CAAC,KAAK,IAAI,CAAC;AAE5G,SAAS,EAAE,CAAC,KAAc;IACzB,QAAQ,KAAK,EAAE;QACd,KAAK,IAAI;YACR,yBAAqB;QACtB,KAAK,IAAI,CAAC;QACV,KAAK,KAAK;YACT,+BAAwB;QACzB,QAAQ;KACR;IAED,QAAQ,OAAO,KAAK,EAAE;QACrB,KAAK,WAAW;YACf,mCAA0B;QAC3B,KAAK,QAAQ;YACZ,6BAAuB;QACxB,KAAK,QAAQ;YACZ,6BAAuB;QACxB,KAAK,QAAQ;YACZ,6BAAuB;QACxB,QAAQ;KACR;IAED,IAAI,EAAE,CAAC,SAAS,CAAC,KAAK,CAAC,EAAE;QACxB,iCAAyB;KACzB;IAED,IAAI,EAAE,CAAC,UAAU,CAAC,KAAK,CAAC,EAAE;QACzB,qCAA2B;KAC3B;IAED,IAAI,KAAK,CAAC,OAAO,CAAC,KAAK,CAAC,EAAE;QACzB,2BAAsB;KACtB;IAED,IAAI,QAAQ,CAAC,KAAK,CAAC,EAAE;QACpB,6BAAuB;KACvB;IAED,MAAM,OAAO,GAAG,aAAa,CAAC,KAAK,CAAC,CAAC;IACrC,IAAI,OAAO,EAAE;QACZ,OAAO,OAAO,CAAC;KACf;IAED,IAAI,KAAK,YAAY,MAAM,IAAI,KAAK,YAAY,OAAO,IAAI,KAAK,YAAY,MAAM,EAAE;QACnF,MAAM,IAAI,SAAS,CAAC,uDAAuD,CAAC,CAAC;KAC7E;IAED,6BAAuB;AACxB,CAAC;AAED,WAAU,EAAE;IACX,kDAAkD;IAClD,MAAM,QAAQ,GAAG,CAAC,KAAc,EAAmB,EAAE,CAAC,OAAO,KAAK,KAAK,QAAQ,CAAC;IAEhF,+BAA+B;IAClB,YAAS,GAAG,QAAQ,CAAY,WAAW,CAAC,CAAC;IAC7C,SAAM,GAAG,QAAQ,CAAS,QAAQ,CAAC,CAAC;IACpC,SAAM,GAAG,QAAQ,CAAS,QAAQ,CAAC,CAAC;IACpC,YAAS,GAAG,QAAQ,CAAW,UAAU,CAAC,CAAC;IACxD,kDAAkD;IACrC,QAAK,GAAG,CAAC,KAAc,EAAiB,EAAE,CAAC,KAAK,KAAK,IAAI,CAAC;IAC1D,SAAM,GAAG,CAAC,KAAc,EAAkB,EAAE,CAAC,GAAA,SAAS,CAAC,KAAK,CAAC,IAAI,KAAK,CAAC,QAAQ,EAAE,CAAC,UAAU,CAAC,QAAQ,CAAC,CAAC;IACvG,UAAO,GAAG,CAAC,KAAc,EAAoB,EAAE,CAAC,KAAK,KAAK,IAAI,IAAI,KAAK,KAAK,KAAK,CAAC;IAClF,SAAM,GAAG,QAAQ,CAAS,QAAQ,CAAC,CAAC;IACjD,8BAA8B;IAEjB,gBAAa,GAAG,CAAC,KAAc,EAAW,EAAE,CACxD,GAAA,MAAM,CAAC,KAAK,CAAC,IAAI,KAAK,CAAC,MAAM,GAAG,CAAC,IAAI,CAAC,MAAM,CAAC,KAAK,CAAC,MAAM,CAAC,KAAK,CAAC,CAAC,CAAC;IAEtD,QAAK,GAAG,KAAK,CAAC,OAAO,CAAC;IACtB,SAAM,GAAG,QAAQ,CAAC;IAElB,kBAAe,GAAG,CAAC,KAAc,EAA6B,EAAE,CAAC,GAAA,KAAK,CAAC,KAAK,CAAC,IAAI,GAAA,SAAS,CAAC,KAAK,CAAC,CAAC;IAClG,SAAM,GAAG,CAAC,KAAc,EAAmB,EAAE,CAAC,CAAC,GAAA,eAAe,CAAC,KAAK,CAAC,IAAI,CAAC,GAAA,SAAS,CAAC,KAAK,CAAC,IAAI,QAAQ,CAAC,KAAK,CAAC,CAAC,CAAC;IAC/G,WAAQ,GAAG,CAAC,KAAc,EAAsC,EAAE,CAAC,CAAC,GAAA,eAAe,CAAC,KAAK,CAAC,IAAI,GAAA,SAAS,CAAE,KAAmC,CAAC,MAAM,CAAC,QAAQ,CAAC,CAAC,CAAC;IAC/J,gBAAa,GAAG,CAAC,KAAc,EAA2C,EAAE,CAAC,CAAC,GAAA,eAAe,CAAC,KAAK,CAAC,IAAI,GAAA,SAAS,CAAE,KAAwC,CAAC,MAAM,CAAC,aAAa,CAAC,CAAC,CAAC;IACnL,YAAS,GAAG,CAAC,KAAc,EAAsB,EAAE,CAAC,GAAA,QAAQ,CAAC,KAAK,CAAC,IAAI,GAAA,SAAS,CAAC,KAAK,CAAC,IAAI,CAAC,IAAI,GAAA,SAAS,CAAC,KAAK,CAAC,KAAK,CAAC,CAAC;IAEvH,gBAAa,GAAG,CAAC,KAAc,EAA6B,EAAE,CAC1E,cAAc,yBAAoC,CAAC,KAAK,CAAC,CAAC;IAE3D,MAAM,aAAa,GAAG,CAAC,KAAc,EAA6B,EAAE,CACnE,CAAC,GAAA,KAAK,CAAC,KAAK,CAAC;QACb,QAAQ,CAAC,KAAK,CAAY;QAC1B,GAAA,SAAS,CAAE,KAA0B,CAAC,IAAI,CAAC;QAC3C,GAAA,SAAS,CAAE,KAA0B,CAAC,KAAK,CAAC,CAAC;IAEjC,UAAO,GAAG,CAAC,KAAc,EAA6B,EAAE,CAAC,GAAA,aAAa,CAAC,KAAK,CAAC,IAAI,aAAa,CAAC,KAAK,CAAC,CAAC;IAEtG,oBAAiB,GAAG,cAAc,6CAA+C,CAAC;IAClF,gBAAa,GAAG,cAAc,qCAAkC,CAAC;IACjE,gBAAa,GAAG,CAAC,KAAc,EAAqB,EAAE,CAAC,GAAA,SAAS,CAAC,KAAK,CAAC,IAAI,CAAC,KAAK,CAAC,cAAc,CAAC,WAAW,CAAC,CAAC;IAE9G,SAAM,GAAG,cAAc,uBAAyB,CAAC;IACjD,OAAI,GAAG,cAAc,mBAAqB,CAAC;IAC3C,QAAK,GAAG,cAAc,qBAAuB,CAAC;IAC9C,MAAG,GAAG,CAAC,KAAc,EAAkC,EAAE,CAAC,cAAc,iBAAqC,CAAC,KAAK,CAAC,CAAC;IACrH,MAAG,GAAG,CAAC,KAAc,EAAyB,EAAE,CAAC,cAAc,iBAA4B,CAAC,KAAK,CAAC,CAAC;IACnG,UAAO,GAAG,CAAC,KAAc,EAAqC,EAAE,CAAC,cAAc,yBAA4C,CAAC,KAAK,CAAC,CAAC;IACnI,UAAO,GAAG,CAAC,KAAc,EAA4B,EAAE,CAAC,cAAc,yBAAmC,CAAC,KAAK,CAAC,CAAC;IAEjH,YAAS,GAAG,cAAc,6BAA+B,CAAC;IAC1D,aAAU,GAAG,cAAc,+BAAiC,CAAC;IAC7D,oBAAiB,GAAG,cAAc,6CAA+C,CAAC;IAClF,aAAU,GAAG,cAAc,+BAAiC,CAAC;IAC7D,cAAW,GAAG,cAAc,iCAAmC,CAAC;IAChE,aAAU,GAAG,cAAc,+BAAiC,CAAC;IAC7D,cAAW,GAAG,cAAc,iCAAmC,CAAC;IAChE,eAAY,GAAG,cAAc,mCAAqC,CAAC;IACnE,eAAY,GAAG,cAAc,mCAAqC,CAAC;IAEnE,cAAW,GAAG,cAAc,iCAAmC,CAAC;IAChE,oBAAiB,GAAG,cAAc,6CAA+C,CAAC;IAClF,WAAQ,GAAG,cAAc,2BAA6B,CAAC;IAEvD,mBAAgB,GAAG,CAAI,QAAiB,EAAE,KAAe,EAAiB,EAAE,CAAC,MAAM,CAAC,cAAc,CAAC,QAAQ,CAAC,KAAK,KAAK,CAAC,SAAS,CAAC;IACjI,cAAW,GAAG,CAAC,KAAc,EAAgB,EAAE,CAAC,cAAc,iBAAmB,CAAC,KAAK,CAAC,CAAC;IAEzF,YAAS,GAAG,CAAC,KAAc,EAAE,EAAE;QAC3C,IAAI,CAAC,GAAA,MAAM,CAAC,KAAK,CAAC,EAAE;YACnB,OAAO,KAAK,CAAC;SACb;QAED,IAAI;YACH,IAAI,SAAS,CAAC,KAAK,CAAC,CAAC,CAAC,2CAA2C;YACjE,OAAO,IAAI,CAAC;SACZ;QAAC,WAAM;YACP,OAAO,KAAK,CAAC;SACb;IACF,CAAC,CAAC;IAEW,SAAM,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,OAAO,CAAC,KAAK,CAAC,CAAC;IAC5C,QAAK,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,CAAC,KAAK,CAAC;IAEnC,MAAG,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,MAAM,CAAC,KAAK,CAAC,KAAe,CAAC,CAAC;IAErE,MAAM,cAAc,GAAG,IAAI,GAAG,CAAC;QAC9B,WAAW;QACX,QAAQ;QACR,QAAQ;QACR,SAAS;QACT,QAAQ;KACR,CAAC,CAAC;IAEU,YAAS,GAAG,CAAC,KAAc,EAAsB,EAAE,CAAC,GAAA,KAAK,CAAC,KAAK,CAAC,IAAI,cAAc,CAAC,GAAG,CAAC,OAAO,KAAK,CAAC,CAAC;IAErG,UAAO,GAAG,CAAC,KAAc,EAAmB,EAAE,CAAC,MAAM,CAAC,SAAS,CAAC,KAAe,CAAC,CAAC;IACjF,cAAW,GAAG,CAAC,KAAc,EAAmB,EAAE,CAAC,MAAM,CAAC,aAAa,CAAC,KAAe,CAAC,CAAC;IAEzF,cAAW,GAAG,CAAC,KAAc,EAAE,EAAE;QAC7C,0EAA0E;QAC1E,IAAI,SAAS,CAAC;QAEd,OAAO,aAAa,CAAC,KAAK,CAAC,0BAAoB;YAC9C,CAAC,SAAS,GAAG,MAAM,CAAC,cAAc,CAAC,KAAK,CAAC,EAAE,SAAS,KAAK,IAAI,IAAI,yCAAyC;gBACzG,SAAS,KAAK,MAAM,CAAC,cAAc,CAAC,EAAE,CAAC,CAAC,CAAC;IAC5C,CAAC,CAAC;IAEF,MAAM,eAAe,GAAG,IAAI,GAAG,CAAC;;;;;;;;;;KAU/B,CAAC,CAAC;IACU,aAAU,GAAG,CAAC,KAAc,EAAuB,EAAE;QACjE,MAAM,UAAU,GAAG,aAAa,CAAC,KAAK,CAAC,CAAC;QAExC,IAAI,UAAU,KAAK,IAAI,EAAE;YACxB,OAAO,KAAK,CAAC;SACb;QAED,OAAO,eAAe,CAAC,GAAG,CAAC,UAAU,CAAC,CAAC;IACxC,CAAC,CAAC;IAEF,MAAM,aAAa,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,GAAA,WAAW,CAAC,KAAK,CAAC,IAAI,KAAK,GAAG,CAAC,CAAC,CAAC;IAC9D,YAAS,GAAG,CAAC,KAAc,EAAsB,EAAE,CAAC,CAAC,GAAA,eAAe,CAAC,KAAK,CAAC,IAAI,CAAC,GAAA,SAAS,CAAC,KAAK,CAAC,IAAI,aAAa,CAAE,KAAmB,CAAC,MAAM,CAAC,CAAC;IAE/I,UAAO,GAAG,CAAC,KAAa,EAAE,KAAwB,EAAE,EAAE;QAClE,IAAI,GAAA,MAAM,CAAC,KAAK,CAAC,EAAE;YAClB,OAAO,KAAK,IAAI,IAAI,CAAC,GAAG,CAAC,CAAC,EAAE,KAAK,CAAC,IAAI,KAAK,IAAI,IAAI,CAAC,GAAG,CAAC,KAAK,EAAE,CAAC,CAAC,CAAC;SAClE;QAED,IAAI,GAAA,KAAK,CAAC,KAAK,CAAC,IAAI,KAAK,CAAC,MAAM,KAAK,CAAC,EAAE;YACvC,OAAO,KAAK,IAAI,IAAI,CAAC,GAAG,CAAC,GAAG,KAAK,CAAC,IAAI,KAAK,IAAI,IAAI,CAAC,GAAG,CAAC,GAAG,KAAK,CAAC,CAAC;SAClE;QAED,MAAM,IAAI,SAAS,CAAC,kBAAkB,IAAI,CAAC,SAAS,CAAC,KAAK,CAAC,EAAE,CAAC,CAAC;IAChE,CAAC,CAAC;IAEF,MAAM,iBAAiB,GAAG,CAAC,CAAC;IAC5B,MAAM,uBAAuB,GAAG;QAC/B,WAAW;QACX,eAAe;QACf,OAAO;QACP,YAAY;QACZ,WAAW;KACX,CAAC;IAEW,aAAU,GAAG,CAAC,KAAc,EAAuB,EAAE,CAAC,GAAA,MAAM,CAAC,KAAK,CAAC,IAAK,KAAoB,CAAC,QAAQ,KAAK,iBAAiB,IAAI,GAAA,MAAM,CAAE,KAAoB,CAAC,QAAQ,CAAC;QACjL,CAAC,GAAA,WAAW,CAAC,KAAK,CAAC,IAAI,uBAAuB,CAAC,KAAK,CAAC,QAAQ,CAAC,EAAE,CAAC,QAAQ,IAAK,KAAoB,CAAC,CAAC;IAExF,aAAU,GAAG,CAAC,KAAc,EAAE,EAAE;QAC5C,IAAI,CAAC,KAAK,EAAE;YACX,OAAO,KAAK,CAAC;SACb;QAED,IAAK,KAAa,CAAC,MAAM,CAAC,UAAU,CAAC,IAAI,KAAK,KAAM,KAAa,CAAC,MAAM,CAAC,UAAU,CAAC,EAAE,EAAE;YACvF,OAAO,IAAI,CAAC;SACZ;QAED,IAAK,KAAa,CAAC,cAAc,CAAC,IAAI,KAAK,KAAM,KAAa,CAAC,cAAc,CAAC,EAAE,EAAE;YACjF,OAAO,IAAI,CAAC;SACZ;QAED,OAAO,KAAK,CAAC;IACd,CAAC,CAAC;IAEW,aAAU,GAAG,CAAC,KAAc,EAAuB,EAAE,CAAC,CAAC,GAAA,eAAe,CAAC,KAAK,CAAC,IAAI,QAAQ,CAAC,KAAK,CAAY,IAAI,GAAA,SAAS,CAAE,KAAoB,CAAC,IAAI,CAAC,IAAI,CAAC,GAAA,UAAU,CAAC,KAAK,CAAC,CAAC;IAE3K,WAAQ,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,KAAK,KAAK,QAAQ,IAAI,KAAK,KAAK,CAAC,QAAQ,CAAC;IAEtF,MAAM,cAAc,GAAG,CAAC,GAAW,EAAE,EAAE,CAAC,CAAC,KAAa,EAAE,EAAE,CAAC,GAAA,OAAO,CAAC,KAAK,CAAC,IAAI,IAAI,CAAC,GAAG,CAAC,KAAK,GAAG,CAAC,CAAC,KAAK,GAAG,CAAC;IAC5F,OAAI,GAAG,cAAc,CAAC,CAAC,CAAC,CAAC;IACzB,MAAG,GAAG,cAAc,CAAC,CAAC,CAAC,CAAC;IAErC,MAAM,kBAAkB,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,GAAA,MAAM,CAAC,KAAK,CAAC,IAAI,IAAI,CAAC,IAAI,CAAC,KAAK,CAAC,KAAK,KAAK,CAAC;IAE9E,aAAU,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,GAAA,KAAK,CAAC,KAAK,CAAC,IAAI,KAAK,CAAC,MAAM,KAAK,CAAC,CAAC;IACpE,gBAAa,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,GAAA,KAAK,CAAC,KAAK,CAAC,IAAI,KAAK,CAAC,MAAM,GAAG,CAAC,CAAC;IAErE,cAAW,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,GAAA,MAAM,CAAC,KAAK,CAAC,IAAI,KAAK,CAAC,MAAM,KAAK,CAAC,CAAC;IACtE,iBAAc,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,GAAA,MAAM,CAAC,KAAK,CAAC,IAAI,KAAK,CAAC,MAAM,GAAG,CAAC,CAAC;IACvE,0BAAuB,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,GAAA,WAAW,CAAC,KAAK,CAAC,IAAI,kBAAkB,CAAC,KAAK,CAAC,CAAC;IAE9F,cAAW,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,GAAA,MAAM,CAAC,KAAK,CAAC,IAAI,CAAC,GAAA,GAAG,CAAC,KAAK,CAAC,IAAI,CAAC,GAAA,GAAG,CAAC,KAAK,CAAC,IAAI,MAAM,CAAC,IAAI,CAAC,KAAK,CAAC,CAAC,MAAM,KAAK,CAAC,CAAC;IACjH,iBAAc,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,GAAA,MAAM,CAAC,KAAK,CAAC,IAAI,CAAC,GAAA,GAAG,CAAC,KAAK,CAAC,IAAI,CAAC,GAAA,GAAG,CAAC,KAAK,CAAC,IAAI,MAAM,CAAC,IAAI,CAAC,KAAK,CAAC,CAAC,MAAM,GAAG,CAAC,CAAC;IAElH,WAAQ,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,GAAA,GAAG,CAAC,KAAK,CAAC,IAAI,KAAK,CAAC,IAAI,KAAK,CAAC,CAAC;IAC9D,cAAW,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,GAAA,GAAG,CAAC,KAAK,CAAC,IAAI,KAAK,CAAC,IAAI,GAAG,CAAC,CAAC;IAE/D,WAAQ,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,GAAA,GAAG,CAAC,KAAK,CAAC,IAAI,KAAK,CAAC,IAAI,KAAK,CAAC,CAAC;IAC9D,cAAW,GAAG,CAAC,KAAc,EAAE,EAAE,CAAC,GAAA,GAAG,CAAC,KAAK,CAAC,IAAI,KAAK,CAAC,IAAI,GAAG,CAAC,CAAC;IAG5E,MAAM,gBAAgB,GAAG,CAAC,MAAmB,EAAE,SAAkB,EAAE,MAAiB,EAAE,EAAE;QACvF,IAAI,GAAA,SAAS,CAAC,SAAS,CAAC,KAAK,KAAK,EAAE;YACnC,MAAM,IAAI,SAAS,CAAC,sBAAsB,IAAI,CAAC,SAAS,CAAC,SAAS,CAAC,EAAE,CAAC,CAAC;SACvE;QAED,IAAI,MAAM,CAAC,MAAM,KAAK,CAAC,EAAE;YACxB,MAAM,IAAI,SAAS,CAAC,0BAA0B,CAAC,CAAC;SAChD;QAED,OAAO,MAAM,CAAC,IAAI,CAAC,MAAM,EAAE,SAAgB,CAAC,CAAC;IAC9C,CAAC,CAAC;IAEF,+BAA+B;IAClB,MAAG,GAAG,CAAC,SAAkB,EAAE,GAAG,MAAiB,EAAE,EAAE,CAAC,gBAAgB,CAAC,KAAK,CAAC,SAAS,CAAC,IAAI,EAAE,SAAS,EAAE,MAAM,CAAC,CAAC;IAC9G,MAAG,GAAG,CAAC,SAAkB,EAAE,GAAG,MAAiB,EAAE,EAAE,CAAC,gBAAgB,CAAC,KAAK,CAAC,SAAS,CAAC,KAAK,EAAE,SAAS,EAAE,MAAM,CAAC,CAAC;IAC5H,8BAA8B;AAC/B,CAAC,EAvNS,EAAE,KAAF,EAAE,QAuNX;AAED,4EAA4E;AAC5E,0DAA0D;AAC1D,MAAM,CAAC,gBAAgB,CAAC,EAAE,EAAE;IAC3B,KAAK,EAAE;QACN,KAAK,EAAE,EAAE,CAAC,MAAM;KAChB;IACD,QAAQ,EAAE;QACT,KAAK,EAAE,EAAE,CAAC,SAAS;KACnB;IACD,IAAI,EAAE;QACL,KAAK,EAAE,EAAE,CAAC,KAAK;KACf;CACD,CAAC,CAAC;AAEH,kBAAe,EAAE,CAAC;AAElB,sCAAsC;AACtC,MAAM,CAAC,OAAO,GAAG,EAAE,CAAC;AACpB,MAAM,CAAC,OAAO,CAAC,OAAO,GAAG,EAAE,CAAC"} \ No newline at end of file diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@sindresorhus/is/license b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@sindresorhus/is/license new file mode 100644 index 00000000..e7af2f77 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@sindresorhus/is/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@sindresorhus/is/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@sindresorhus/is/package.json new file mode 100644 index 00000000..260be0eb --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@sindresorhus/is/package.json @@ -0,0 +1,96 @@ +{ + "_from": "@sindresorhus/is@^0.14.0", + "_id": "@sindresorhus/is@0.14.0", + "_inBundle": false, + "_integrity": "sha512-9NET910DNaIPngYnLLPeg+Ogzqsi9uM4mSboU5y6p8S5DzMTVEsJZrawi+BoDNUVBa2DhJqQYUFvMDfgU062LQ==", + "_location": "/@sindresorhus/is", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "@sindresorhus/is@^0.14.0", + "name": "@sindresorhus/is", + "escapedName": "@sindresorhus%2fis", + "scope": "@sindresorhus", + "rawSpec": "^0.14.0", + "saveSpec": null, + "fetchSpec": "^0.14.0" + }, + "_requiredBy": [ + "/got" + ], + "_resolved": "https://registry.npmjs.org/@sindresorhus/is/-/is-0.14.0.tgz", + "_shasum": "9fb3a3cf3132328151f353de4632e01e52102bea", + "_spec": "@sindresorhus/is@^0.14.0", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\got", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "sindresorhus.com" + }, + "bugs": { + "url": "https://github.com/sindresorhus/is/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Type check values: `is.string('🦄') //=> true`", + "devDependencies": { + "@sindresorhus/tsconfig": "^0.1.0", + "@types/jsdom": "^11.12.0", + "@types/node": "^10.12.10", + "@types/tempy": "^0.2.0", + "@types/zen-observable": "^0.8.0", + "ava": "^0.25.0", + "del-cli": "^1.1.0", + "jsdom": "^11.6.2", + "rxjs": "^6.3.3", + "tempy": "^0.2.1", + "tslint": "^5.9.1", + "tslint-xo": "^0.10.0", + "typescript": "^3.2.1", + "zen-observable": "^0.8.8" + }, + "engines": { + "node": ">=6" + }, + "files": [ + "dist" + ], + "homepage": "https://github.com/sindresorhus/is#readme", + "keywords": [ + "type", + "types", + "is", + "check", + "checking", + "validate", + "validation", + "utility", + "util", + "typeof", + "instanceof", + "object", + "assert", + "assertion", + "test", + "kind", + "primitive", + "verify", + "compare" + ], + "license": "MIT", + "main": "dist/index.js", + "name": "@sindresorhus/is", + "repository": { + "type": "git", + "url": "git+https://github.com/sindresorhus/is.git" + }, + "scripts": { + "build": "del dist && tsc", + "lint": "tslint --format stylish --project .", + "prepublish": "npm run build && del dist/tests", + "test": "npm run lint && npm run build && ava dist/tests" + }, + "types": "dist/index.d.ts", + "version": "0.14.0" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@sindresorhus/is/readme.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@sindresorhus/is/readme.md new file mode 100644 index 00000000..97c023b5 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@sindresorhus/is/readme.md @@ -0,0 +1,451 @@ +# is [![Build Status](https://travis-ci.org/sindresorhus/is.svg?branch=master)](https://travis-ci.org/sindresorhus/is) + +> Type check values: `is.string('🦄') //=> true` + + + + +## Install + +``` +$ npm install @sindresorhus/is +``` + + +## Usage + +```js +const is = require('@sindresorhus/is'); + +is('🦄'); +//=> 'string' + +is(new Map()); +//=> 'Map' + +is.number(6); +//=> true +``` + +When using `is` together with TypeScript, [type guards](http://www.typescriptlang.org/docs/handbook/advanced-types.html#type-guards-and-differentiating-types) are being used to infer the correct type inside if-else statements. + +```ts +import is from '@sindresorhus/is'; + +const padLeft = (value: string, padding: string | number) => { + if (is.number(padding)) { + // `padding` is typed as `number` + return Array(padding + 1).join(' ') + value; + } + + if (is.string(padding)) { + // `padding` is typed as `string` + return padding + value; + } + + throw new TypeError(`Expected 'padding' to be of type 'string' or 'number', got '${is(padding)}'.`); +} + +padLeft('🦄', 3); +//=> ' 🦄' + +padLeft('🦄', '🌈'); +//=> '🌈🦄' +``` + + +## API + +### is(value) + +Returns the type of `value`. + +Primitives are lowercase and object types are camelcase. + +Example: + +- `'undefined'` +- `'null'` +- `'string'` +- `'symbol'` +- `'Array'` +- `'Function'` +- `'Object'` + +Note: It will throw an error if you try to feed it object-wrapped primitives, as that's a bad practice. For example `new String('foo')`. + +### is.{method} + +All the below methods accept a value and returns a boolean for whether the value is of the desired type. + +#### Primitives + +##### .undefined(value) +##### .null(value) +##### .string(value) +##### .number(value) +##### .boolean(value) +##### .symbol(value) + +#### Built-in types + +##### .array(value) +##### .function(value) +##### .buffer(value) +##### .object(value) + +Keep in mind that [functions are objects too](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Functions). + +##### .numericString(value) + +Returns `true` for a string that represents a number. For example, `'42'` and `'-8'`. + +Note: `'NaN'` returns `false`, but `'Infinity'` and `'-Infinity'` return `true`. + +##### .regExp(value) +##### .date(value) +##### .error(value) +##### .nativePromise(value) +##### .promise(value) + +Returns `true` for any object with a `.then()` and `.catch()` method. Prefer this one over `.nativePromise()` as you usually want to allow userland promise implementations too. + +##### .generator(value) + +Returns `true` for any object that implements its own `.next()` and `.throw()` methods and has a function definition for `Symbol.iterator`. + +##### .generatorFunction(value) + +##### .asyncFunction(value) + +Returns `true` for any `async` function that can be called with the `await` operator. + +```js +is.asyncFunction(async () => {}); +// => true + +is.asyncFunction(() => {}); +// => false +``` + +##### .boundFunction(value) + +Returns `true` for any `bound` function. + +```js +is.boundFunction(() => {}); +// => true + +is.boundFunction(function () {}.bind(null)); +// => true + +is.boundFunction(function () {}); +// => false +``` + +##### .map(value) +##### .set(value) +##### .weakMap(value) +##### .weakSet(value) + +#### Typed arrays + +##### .int8Array(value) +##### .uint8Array(value) +##### .uint8ClampedArray(value) +##### .int16Array(value) +##### .uint16Array(value) +##### .int32Array(value) +##### .uint32Array(value) +##### .float32Array(value) +##### .float64Array(value) + +#### Structured data + +##### .arrayBuffer(value) +##### .sharedArrayBuffer(value) +##### .dataView(value) + +#### Emptiness + +##### .emptyString(value) + +Returns `true` if the value is a `string` and the `.length` is 0. + +##### .nonEmptyString(value) + +Returns `true` if the value is a `string` and the `.length` is more than 0. + +##### .emptyStringOrWhitespace(value) + +Returns `true` if `is.emptyString(value)` or if it's a `string` that is all whitespace. + +##### .emptyArray(value) + +Returns `true` if the value is an `Array` and the `.length` is 0. + +##### .nonEmptyArray(value) + +Returns `true` if the value is an `Array` and the `.length` is more than 0. + +##### .emptyObject(value) + +Returns `true` if the value is an `Object` and `Object.keys(value).length` is 0. + +Please note that `Object.keys` returns only own enumerable properties. Hence something like this can happen: + +```js +const object1 = {}; + +Object.defineProperty(object1, 'property1', { + value: 42, + writable: true, + enumerable: false, + configurable: true +}); + +is.emptyObject(object1); +// => true +``` + +##### .nonEmptyObject(value) + +Returns `true` if the value is an `Object` and `Object.keys(value).length` is more than 0. + +##### .emptySet(value) + +Returns `true` if the value is a `Set` and the `.size` is 0. + +##### .nonEmptySet(Value) + +Returns `true` if the value is a `Set` and the `.size` is more than 0. + +##### .emptyMap(value) + +Returns `true` if the value is a `Map` and the `.size` is 0. + +##### .nonEmptyMap(value) + +Returns `true` if the value is a `Map` and the `.size` is more than 0. + +#### Miscellaneous + +##### .directInstanceOf(value, class) + +Returns `true` if `value` is a direct instance of `class`. + +```js +is.directInstanceOf(new Error(), Error); +//=> true + +class UnicornError extends Error {} + +is.directInstanceOf(new UnicornError(), Error); +//=> false +``` + +##### .urlInstance(value) + +Returns `true` if `value` is an instance of the [`URL` class](https://developer.mozilla.org/en-US/docs/Web/API/URL). + +```js +const url = new URL('https://example.com'); + +is.urlInstance(url); +//=> true +``` + +### .url(value) + +Returns `true` if `value` is a URL string. + +Note: this only does basic checking using the [`URL` class](https://developer.mozilla.org/en-US/docs/Web/API/URL) constructor. + +```js +const url = 'https://example.com'; + +is.url(url); +//=> true + +is.url(new URL(url)); +//=> false +``` + +##### .truthy(value) + +Returns `true` for all values that evaluate to true in a boolean context: + +```js +is.truthy('🦄'); +//=> true + +is.truthy(undefined); +//=> false +``` + +##### .falsy(value) + +Returns `true` if `value` is one of: `false`, `0`, `''`, `null`, `undefined`, `NaN`. + +##### .nan(value) +##### .nullOrUndefined(value) +##### .primitive(value) + +JavaScript primitives are as follows: `null`, `undefined`, `string`, `number`, `boolean`, `symbol`. + +##### .integer(value) + +##### .safeInteger(value) + +Returns `true` if `value` is a [safe integer](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Number/isSafeInteger). + +##### .plainObject(value) + +An object is plain if it's created by either `{}`, `new Object()`, or `Object.create(null)`. + +##### .iterable(value) +##### .asyncIterable(value) +##### .class(value) + +Returns `true` for instances created by a class. + +##### .typedArray(value) + +##### .arrayLike(value) + +A `value` is array-like if it is not a function and has a `value.length` that is a safe integer greater than or equal to 0. + +```js +is.arrayLike(document.forms); +//=> true + +function foo() { + is.arrayLike(arguments); + //=> true +} +foo(); +``` + +##### .inRange(value, range) + +Check if `value` (number) is in the given `range`. The range is an array of two values, lower bound and upper bound, in no specific order. + +```js +is.inRange(3, [0, 5]); +is.inRange(3, [5, 0]); +is.inRange(0, [-2, 2]); +``` + +##### .inRange(value, upperBound) + +Check if `value` (number) is in the range of `0` to `upperBound`. + +```js +is.inRange(3, 10); +``` + +##### .domElement(value) + +Returns `true` if `value` is a DOM Element. + +##### .nodeStream(value) + +Returns `true` if `value` is a Node.js [stream](https://nodejs.org/api/stream.html). + +```js +const fs = require('fs'); + +is.nodeStream(fs.createReadStream('unicorn.png')); +//=> true +``` + +##### .observable(value) + +Returns `true` if `value` is an `Observable`. + +```js +const {Observable} = require('rxjs'); + +is.observable(new Observable()); +//=> true +``` + +##### .infinite(value) + +Check if `value` is `Infinity` or `-Infinity`. + +##### .even(value) + +Returns `true` if `value` is an even integer. + +##### .odd(value) + +Returns `true` if `value` is an odd integer. + +##### .any(predicate, ...values) + +Returns `true` if **any** of the input `values` returns true in the `predicate`: + +```js +is.any(is.string, {}, true, '🦄'); +//=> true + +is.any(is.boolean, 'unicorns', [], new Map()); +//=> false +``` + +##### .all(predicate, ...values) + +Returns `true` if **all** of the input `values` returns true in the `predicate`: + +```js +is.all(is.object, {}, new Map(), new Set()); +//=> true + +is.all(is.string, '🦄', [], 'unicorns'); +//=> false +``` + + +## FAQ + +### Why yet another type checking module? + +There are hundreds of type checking modules on npm, unfortunately, I couldn't find any that fit my needs: + +- Includes both type methods and ability to get the type +- Types of primitives returned as lowercase and object types as camelcase +- Covers all built-ins +- Unsurprising behavior +- Well-maintained +- Comprehensive test suite + +For the ones I found, pick 3 of these. + +The most common mistakes I noticed in these modules was using `instanceof` for type checking, forgetting that functions are objects, and omitting `symbol` as a primitive. + + +## Related + +- [ow](https://github.com/sindresorhus/ow) - Function argument validation for humans +- [is-stream](https://github.com/sindresorhus/is-stream) - Check if something is a Node.js stream +- [is-observable](https://github.com/sindresorhus/is-observable) - Check if a value is an Observable +- [file-type](https://github.com/sindresorhus/file-type) - Detect the file type of a Buffer/Uint8Array +- [is-ip](https://github.com/sindresorhus/is-ip) - Check if a string is an IP address +- [is-array-sorted](https://github.com/sindresorhus/is-array-sorted) - Check if an Array is sorted +- [is-error-constructor](https://github.com/sindresorhus/is-error-constructor) - Check if a value is an error constructor +- [is-empty-iterable](https://github.com/sindresorhus/is-empty-iterable) - Check if an Iterable is empty +- [is-blob](https://github.com/sindresorhus/is-blob) - Check if a value is a Blob - File-like object of immutable, raw data +- [has-emoji](https://github.com/sindresorhus/has-emoji) - Check whether a string has any emoji + + +## Created by + +- [Sindre Sorhus](https://github.com/sindresorhus) +- [Giora Guttsait](https://github.com/gioragutt) +- [Brandon Smith](https://github.com/brandon93s) + + +## License + +MIT diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@szmarczak/http-timer/LICENSE b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@szmarczak/http-timer/LICENSE new file mode 100644 index 00000000..15ad2e8d --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@szmarczak/http-timer/LICENSE @@ -0,0 +1,21 @@ +MIT License + +Copyright (c) 2018 Szymon Marczak + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@szmarczak/http-timer/README.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@szmarczak/http-timer/README.md new file mode 100644 index 00000000..13279ed8 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@szmarczak/http-timer/README.md @@ -0,0 +1,70 @@ +# http-timer +> Timings for HTTP requests + +[![Build Status](https://travis-ci.org/szmarczak/http-timer.svg?branch=master)](https://travis-ci.org/szmarczak/http-timer) +[![Coverage Status](https://coveralls.io/repos/github/szmarczak/http-timer/badge.svg?branch=master)](https://coveralls.io/github/szmarczak/http-timer?branch=master) +[![install size](https://packagephobia.now.sh/badge?p=@szmarczak/http-timer)](https://packagephobia.now.sh/result?p=@szmarczak/http-timer) + +Inspired by the [`request` package](https://github.com/request/request). + +## Usage +```js +'use strict'; +const https = require('https'); +const timer = require('@szmarczak/http-timer'); + +const request = https.get('https://httpbin.org/anything'); +const timings = timer(request); + +request.on('response', response => { + response.on('data', () => {}); // Consume the data somehow + response.on('end', () => { + console.log(timings); + }); +}); + +// { start: 1535708511443, +// socket: 1535708511444, +// lookup: 1535708511444, +// connect: 1535708511582, +// upload: 1535708511887, +// response: 1535708512037, +// end: 1535708512040, +// phases: +// { wait: 1, +// dns: 0, +// tcp: 138, +// request: 305, +// firstByte: 150, +// download: 3, +// total: 597 } } +``` + +## API + +### timer(request) + +Returns: `Object` + +- `start` - Time when the request started. +- `socket` - Time when a socket was assigned to the request. +- `lookup` - Time when the DNS lookup finished. +- `connect` - Time when the socket successfully connected. +- `upload` - Time when the request finished uploading. +- `response` - Time when the request fired the `response` event. +- `end` - Time when the response fired the `end` event. +- `error` - Time when the request fired the `error` event. +- `phases` + - `wait` - `timings.socket - timings.start` + - `dns` - `timings.lookup - timings.socket` + - `tcp` - `timings.connect - timings.lookup` + - `request` - `timings.upload - timings.connect` + - `firstByte` - `timings.response - timings.upload` + - `download` - `timings.end - timings.response` + - `total` - `timings.end - timings.start` or `timings.error - timings.start` + +**Note**: The time is a `number` representing the milliseconds elapsed since the UNIX epoch. + +## License + +MIT diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@szmarczak/http-timer/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@szmarczak/http-timer/package.json new file mode 100644 index 00000000..c3c9ca40 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@szmarczak/http-timer/package.json @@ -0,0 +1,75 @@ +{ + "_from": "@szmarczak/http-timer@^1.1.2", + "_id": "@szmarczak/http-timer@1.1.2", + "_inBundle": false, + "_integrity": "sha512-XIB2XbzHTN6ieIjfIMV9hlVcfPU26s2vafYWQcZHWXHOxiaRZYEDKEwdl129Zyg50+foYV2jCgtrqSA6qNuNSA==", + "_location": "/@szmarczak/http-timer", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "@szmarczak/http-timer@^1.1.2", + "name": "@szmarczak/http-timer", + "escapedName": "@szmarczak%2fhttp-timer", + "scope": "@szmarczak", + "rawSpec": "^1.1.2", + "saveSpec": null, + "fetchSpec": "^1.1.2" + }, + "_requiredBy": [ + "/got" + ], + "_resolved": "https://registry.npmjs.org/@szmarczak/http-timer/-/http-timer-1.1.2.tgz", + "_shasum": "b1665e2c461a2cd92f4c1bbf50d5454de0d4b421", + "_spec": "@szmarczak/http-timer@^1.1.2", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\got", + "author": { + "name": "Szymon Marczak" + }, + "bugs": { + "url": "https://github.com/szmarczak/http-timer/issues" + }, + "bundleDependencies": false, + "dependencies": { + "defer-to-connect": "^1.0.1" + }, + "deprecated": false, + "description": "Timings for HTTP requests", + "devDependencies": { + "ava": "^0.25.0", + "coveralls": "^3.0.2", + "nyc": "^12.0.2", + "p-event": "^2.1.0", + "xo": "^0.22.0" + }, + "engines": { + "node": ">=6" + }, + "files": [ + "source" + ], + "homepage": "https://github.com/szmarczak/http-timer#readme", + "keywords": [ + "http", + "https", + "timer", + "timings" + ], + "license": "MIT", + "main": "source", + "name": "@szmarczak/http-timer", + "repository": { + "type": "git", + "url": "git+https://github.com/szmarczak/http-timer.git" + }, + "scripts": { + "coveralls": "nyc report --reporter=text-lcov | coveralls", + "test": "xo && nyc ava" + }, + "version": "1.1.2", + "xo": { + "rules": { + "unicorn/filename-case": "camelCase" + } + } +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@szmarczak/http-timer/source/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@szmarczak/http-timer/source/index.js new file mode 100644 index 00000000..e2945804 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@szmarczak/http-timer/source/index.js @@ -0,0 +1,99 @@ +'use strict'; +const deferToConnect = require('defer-to-connect'); + +module.exports = request => { + const timings = { + start: Date.now(), + socket: null, + lookup: null, + connect: null, + upload: null, + response: null, + end: null, + error: null, + phases: { + wait: null, + dns: null, + tcp: null, + request: null, + firstByte: null, + download: null, + total: null + } + }; + + const handleError = origin => { + const emit = origin.emit.bind(origin); + origin.emit = (event, ...args) => { + // Catches the `error` event + if (event === 'error') { + timings.error = Date.now(); + timings.phases.total = timings.error - timings.start; + + origin.emit = emit; + } + + // Saves the original behavior + return emit(event, ...args); + }; + }; + + let uploadFinished = false; + const onUpload = () => { + timings.upload = Date.now(); + timings.phases.request = timings.upload - timings.connect; + }; + + handleError(request); + + request.once('socket', socket => { + timings.socket = Date.now(); + timings.phases.wait = timings.socket - timings.start; + + const lookupListener = () => { + timings.lookup = Date.now(); + timings.phases.dns = timings.lookup - timings.socket; + }; + + socket.once('lookup', lookupListener); + + deferToConnect(socket, () => { + timings.connect = Date.now(); + + if (timings.lookup === null) { + socket.removeListener('lookup', lookupListener); + timings.lookup = timings.connect; + timings.phases.dns = timings.lookup - timings.socket; + } + + timings.phases.tcp = timings.connect - timings.lookup; + + if (uploadFinished && !timings.upload) { + onUpload(); + } + }); + }); + + request.once('finish', () => { + uploadFinished = true; + + if (timings.connect) { + onUpload(); + } + }); + + request.once('response', response => { + timings.response = Date.now(); + timings.phases.firstByte = timings.response - timings.upload; + + handleError(response); + + response.once('end', () => { + timings.end = Date.now(); + timings.phases.download = timings.end - timings.response; + timings.phases.total = timings.end - timings.start; + }); + }); + + return timings; +}; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@tootallnate/once/dist/index.d.ts b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@tootallnate/once/dist/index.d.ts new file mode 100644 index 00000000..a7efe943 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@tootallnate/once/dist/index.d.ts @@ -0,0 +1,14 @@ +/// +import { EventEmitter } from 'events'; +declare function once(emitter: EventEmitter, name: string): once.CancelablePromise; +declare namespace once { + interface CancelFunction { + (): void; + } + interface CancelablePromise extends Promise { + cancel: CancelFunction; + } + type CancellablePromise = CancelablePromise; + function spread(emitter: EventEmitter, name: string): once.CancelablePromise; +} +export = once; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@tootallnate/once/dist/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@tootallnate/once/dist/index.js new file mode 100644 index 00000000..bfd0dc88 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@tootallnate/once/dist/index.js @@ -0,0 +1,39 @@ +"use strict"; +function noop() { } +function once(emitter, name) { + const o = once.spread(emitter, name); + const r = o.then((args) => args[0]); + r.cancel = o.cancel; + return r; +} +(function (once) { + function spread(emitter, name) { + let c = null; + const p = new Promise((resolve, reject) => { + function cancel() { + emitter.removeListener(name, onEvent); + emitter.removeListener('error', onError); + p.cancel = noop; + } + function onEvent(...args) { + cancel(); + resolve(args); + } + function onError(err) { + cancel(); + reject(err); + } + c = cancel; + emitter.on(name, onEvent); + emitter.on('error', onError); + }); + if (!c) { + throw new TypeError('Could not get `cancel()` function'); + } + p.cancel = c; + return p; + } + once.spread = spread; +})(once || (once = {})); +module.exports = once; +//# sourceMappingURL=index.js.map \ No newline at end of file diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@tootallnate/once/dist/index.js.map b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@tootallnate/once/dist/index.js.map new file mode 100644 index 00000000..30d20491 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@tootallnate/once/dist/index.js.map @@ -0,0 +1 @@ +{"version":3,"file":"index.js","sourceRoot":"","sources":["../src/index.ts"],"names":[],"mappings":";AAEA,SAAS,IAAI,KAAI,CAAC;AAElB,SAAS,IAAI,CACZ,OAAqB,EACrB,IAAY;IAEZ,MAAM,CAAC,GAAG,IAAI,CAAC,MAAM,CAAM,OAAO,EAAE,IAAI,CAAC,CAAC;IAC1C,MAAM,CAAC,GAAG,CAAC,CAAC,IAAI,CAAC,CAAC,IAAS,EAAE,EAAE,CAAC,IAAI,CAAC,CAAC,CAAC,CAA8B,CAAC;IACtE,CAAC,CAAC,MAAM,GAAG,CAAC,CAAC,MAAM,CAAC;IACpB,OAAO,CAAC,CAAC;AACV,CAAC;AAED,WAAU,IAAI;IAWb,SAAgB,MAAM,CACrB,OAAqB,EACrB,IAAY;QAEZ,IAAI,CAAC,GAA+B,IAAI,CAAC;QACzC,MAAM,CAAC,GAAG,IAAI,OAAO,CAAI,CAAC,OAAO,EAAE,MAAM,EAAE,EAAE;YAC5C,SAAS,MAAM;gBACd,OAAO,CAAC,cAAc,CAAC,IAAI,EAAE,OAAO,CAAC,CAAC;gBACtC,OAAO,CAAC,cAAc,CAAC,OAAO,EAAE,OAAO,CAAC,CAAC;gBACzC,CAAC,CAAC,MAAM,GAAG,IAAI,CAAC;YACjB,CAAC;YACD,SAAS,OAAO,CAAC,GAAG,IAAW;gBAC9B,MAAM,EAAE,CAAC;gBACT,OAAO,CAAC,IAAS,CAAC,CAAC;YACpB,CAAC;YACD,SAAS,OAAO,CAAC,GAAU;gBAC1B,MAAM,EAAE,CAAC;gBACT,MAAM,CAAC,GAAG,CAAC,CAAC;YACb,CAAC;YACD,CAAC,GAAG,MAAM,CAAC;YACX,OAAO,CAAC,EAAE,CAAC,IAAI,EAAE,OAAO,CAAC,CAAC;YAC1B,OAAO,CAAC,EAAE,CAAC,OAAO,EAAE,OAAO,CAAC,CAAC;QAC9B,CAAC,CAA8B,CAAC;QAChC,IAAI,CAAC,CAAC,EAAE;YACP,MAAM,IAAI,SAAS,CAAC,mCAAmC,CAAC,CAAC;SACzD;QACD,CAAC,CAAC,MAAM,GAAG,CAAC,CAAC;QACb,OAAO,CAAC,CAAC;IACV,CAAC;IA5Be,WAAM,SA4BrB,CAAA;AACF,CAAC,EAxCS,IAAI,KAAJ,IAAI,QAwCb;AAED,iBAAS,IAAI,CAAC"} \ No newline at end of file diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/@tootallnate/once/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@tootallnate/once/package.json new file mode 100644 index 00000000..fcedf6f2 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/@tootallnate/once/package.json @@ -0,0 +1,76 @@ +{ + "_from": "@tootallnate/once@1", + "_id": "@tootallnate/once@1.1.2", + "_inBundle": false, + "_integrity": "sha512-RbzJvlNzmRq5c3O09UipeuXno4tA1FE6ikOjxZK0tuxVv3412l64l5t1W5pj4+rJq9vpkm/kwiR07aZXnsKPxw==", + "_location": "/@tootallnate/once", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "@tootallnate/once@1", + "name": "@tootallnate/once", + "escapedName": "@tootallnate%2fonce", + "scope": "@tootallnate", + "rawSpec": "1", + "saveSpec": null, + "fetchSpec": "1" + }, + "_requiredBy": [ + "/http-proxy-agent" + ], + "_resolved": "https://registry.npmjs.org/@tootallnate/once/-/once-1.1.2.tgz", + "_shasum": "ccb91445360179a04e7fe6aff78c00ffc1eeaf82", + "_spec": "@tootallnate/once@1", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\http-proxy-agent", + "author": { + "name": "Nathan Rajlich", + "email": "nathan@tootallnate.net", + "url": "http://n8.io/" + }, + "bugs": { + "url": "https://github.com/TooTallNate/once/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Creates a Promise that waits for a single event", + "devDependencies": { + "@types/node": "^12.12.11", + "@typescript-eslint/eslint-plugin": "1.6.0", + "@typescript-eslint/parser": "1.1.0", + "eslint": "5.16.0", + "eslint-config-airbnb": "17.1.0", + "eslint-config-prettier": "4.1.0", + "eslint-import-resolver-typescript": "1.1.1", + "eslint-plugin-import": "2.16.0", + "eslint-plugin-jsx-a11y": "6.2.1", + "eslint-plugin-react": "7.12.4", + "mocha": "^6.2.2", + "rimraf": "^3.0.0", + "typescript": "^3.7.3" + }, + "engines": { + "node": ">= 6" + }, + "files": [ + "dist" + ], + "homepage": "https://github.com/TooTallNate/once#readme", + "keywords": [], + "license": "MIT", + "main": "./dist/index.js", + "name": "@tootallnate/once", + "repository": { + "type": "git", + "url": "git://github.com/TooTallNate/once.git" + }, + "scripts": { + "build": "tsc", + "prebuild": "rimraf dist", + "prepublishOnly": "npm run build", + "test": "mocha --reporter spec", + "test-lint": "eslint src --ext .js,.ts" + }, + "types": "./dist/index.d.ts", + "version": "1.1.2" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/abbrev/LICENSE b/25_03_11/frontend_vizsgafeladat/backend/node_modules/abbrev/LICENSE new file mode 100644 index 00000000..9bcfa9d7 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/abbrev/LICENSE @@ -0,0 +1,46 @@ +This software is dual-licensed under the ISC and MIT licenses. +You may use this software under EITHER of the following licenses. + +---------- + +The ISC License + +Copyright (c) Isaac Z. Schlueter and Contributors + +Permission to use, copy, modify, and/or distribute this software for any +purpose with or without fee is hereby granted, provided that the above +copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF +MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR +ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR +IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + +---------- + +Copyright Isaac Z. Schlueter and Contributors +All rights reserved. + +Permission is hereby granted, free of charge, to any person +obtaining a copy of this software and associated documentation +files (the "Software"), to deal in the Software without +restriction, including without limitation the rights to use, +copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the +Software is furnished to do so, subject to the following +conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES +OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT +HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +OTHER DEALINGS IN THE SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/abbrev/README.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/abbrev/README.md new file mode 100644 index 00000000..99746fe6 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/abbrev/README.md @@ -0,0 +1,23 @@ +# abbrev-js + +Just like [ruby's Abbrev](http://apidock.com/ruby/Abbrev). + +Usage: + + var abbrev = require("abbrev"); + abbrev("foo", "fool", "folding", "flop"); + + // returns: + { fl: 'flop' + , flo: 'flop' + , flop: 'flop' + , fol: 'folding' + , fold: 'folding' + , foldi: 'folding' + , foldin: 'folding' + , folding: 'folding' + , foo: 'foo' + , fool: 'fool' + } + +This is handy for command-line scripts, or other cases where you want to be able to accept shorthands. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/abbrev/abbrev.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/abbrev/abbrev.js new file mode 100644 index 00000000..7b1dc5d6 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/abbrev/abbrev.js @@ -0,0 +1,61 @@ +module.exports = exports = abbrev.abbrev = abbrev + +abbrev.monkeyPatch = monkeyPatch + +function monkeyPatch () { + Object.defineProperty(Array.prototype, 'abbrev', { + value: function () { return abbrev(this) }, + enumerable: false, configurable: true, writable: true + }) + + Object.defineProperty(Object.prototype, 'abbrev', { + value: function () { return abbrev(Object.keys(this)) }, + enumerable: false, configurable: true, writable: true + }) +} + +function abbrev (list) { + if (arguments.length !== 1 || !Array.isArray(list)) { + list = Array.prototype.slice.call(arguments, 0) + } + for (var i = 0, l = list.length, args = [] ; i < l ; i ++) { + args[i] = typeof list[i] === "string" ? list[i] : String(list[i]) + } + + // sort them lexicographically, so that they're next to their nearest kin + args = args.sort(lexSort) + + // walk through each, seeing how much it has in common with the next and previous + var abbrevs = {} + , prev = "" + for (var i = 0, l = args.length ; i < l ; i ++) { + var current = args[i] + , next = args[i + 1] || "" + , nextMatches = true + , prevMatches = true + if (current === next) continue + for (var j = 0, cl = current.length ; j < cl ; j ++) { + var curChar = current.charAt(j) + nextMatches = nextMatches && curChar === next.charAt(j) + prevMatches = prevMatches && curChar === prev.charAt(j) + if (!nextMatches && !prevMatches) { + j ++ + break + } + } + prev = current + if (j === cl) { + abbrevs[current] = current + continue + } + for (var a = current.substr(0, j) ; j <= cl ; j ++) { + abbrevs[a] = current + a += current.charAt(j) + } + } + return abbrevs +} + +function lexSort (a, b) { + return a === b ? 0 : a > b ? 1 : -1 +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/abbrev/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/abbrev/package.json new file mode 100644 index 00000000..1ab5431e --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/abbrev/package.json @@ -0,0 +1,56 @@ +{ + "_from": "abbrev@1", + "_id": "abbrev@1.1.1", + "_inBundle": false, + "_integrity": "sha512-nne9/IiQ/hzIhY6pdDnbBtz7DjPTKrY00P/zvPSm5pOFkl6xuGrGnXn/VtTNNfNtAfZ9/1RtehkszU9qcTii0Q==", + "_location": "/abbrev", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "abbrev@1", + "name": "abbrev", + "escapedName": "abbrev", + "rawSpec": "1", + "saveSpec": null, + "fetchSpec": "1" + }, + "_requiredBy": [ + "/nopt" + ], + "_resolved": "https://registry.npmjs.org/abbrev/-/abbrev-1.1.1.tgz", + "_shasum": "f8f2c887ad10bf67f634f005b6987fed3179aac8", + "_spec": "abbrev@1", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\nopt", + "author": { + "name": "Isaac Z. Schlueter", + "email": "i@izs.me" + }, + "bugs": { + "url": "https://github.com/isaacs/abbrev-js/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Like ruby's abbrev module, but in js", + "devDependencies": { + "tap": "^10.1" + }, + "files": [ + "abbrev.js" + ], + "homepage": "https://github.com/isaacs/abbrev-js#readme", + "license": "ISC", + "main": "abbrev.js", + "name": "abbrev", + "repository": { + "type": "git", + "url": "git+ssh://git@github.com/isaacs/abbrev-js.git" + }, + "scripts": { + "postpublish": "git push origin --all; git push origin --tags", + "postversion": "npm publish", + "preversion": "npm test", + "test": "tap test.js --100" + }, + "version": "1.1.1" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/accepts/HISTORY.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/accepts/HISTORY.md new file mode 100644 index 00000000..cb5990c7 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/accepts/HISTORY.md @@ -0,0 +1,243 @@ +1.3.8 / 2022-02-02 +================== + + * deps: mime-types@~2.1.34 + - deps: mime-db@~1.51.0 + * deps: negotiator@0.6.3 + +1.3.7 / 2019-04-29 +================== + + * deps: negotiator@0.6.2 + - Fix sorting charset, encoding, and language with extra parameters + +1.3.6 / 2019-04-28 +================== + + * deps: mime-types@~2.1.24 + - deps: mime-db@~1.40.0 + +1.3.5 / 2018-02-28 +================== + + * deps: mime-types@~2.1.18 + - deps: mime-db@~1.33.0 + +1.3.4 / 2017-08-22 +================== + + * deps: mime-types@~2.1.16 + - deps: mime-db@~1.29.0 + +1.3.3 / 2016-05-02 +================== + + * deps: mime-types@~2.1.11 + - deps: mime-db@~1.23.0 + * deps: negotiator@0.6.1 + - perf: improve `Accept` parsing speed + - perf: improve `Accept-Charset` parsing speed + - perf: improve `Accept-Encoding` parsing speed + - perf: improve `Accept-Language` parsing speed + +1.3.2 / 2016-03-08 +================== + + * deps: mime-types@~2.1.10 + - Fix extension of `application/dash+xml` + - Update primary extension for `audio/mp4` + - deps: mime-db@~1.22.0 + +1.3.1 / 2016-01-19 +================== + + * deps: mime-types@~2.1.9 + - deps: mime-db@~1.21.0 + +1.3.0 / 2015-09-29 +================== + + * deps: mime-types@~2.1.7 + - deps: mime-db@~1.19.0 + * deps: negotiator@0.6.0 + - Fix including type extensions in parameters in `Accept` parsing + - Fix parsing `Accept` parameters with quoted equals + - Fix parsing `Accept` parameters with quoted semicolons + - Lazy-load modules from main entry point + - perf: delay type concatenation until needed + - perf: enable strict mode + - perf: hoist regular expressions + - perf: remove closures getting spec properties + - perf: remove a closure from media type parsing + - perf: remove property delete from media type parsing + +1.2.13 / 2015-09-06 +=================== + + * deps: mime-types@~2.1.6 + - deps: mime-db@~1.18.0 + +1.2.12 / 2015-07-30 +=================== + + * deps: mime-types@~2.1.4 + - deps: mime-db@~1.16.0 + +1.2.11 / 2015-07-16 +=================== + + * deps: mime-types@~2.1.3 + - deps: mime-db@~1.15.0 + +1.2.10 / 2015-07-01 +=================== + + * deps: mime-types@~2.1.2 + - deps: mime-db@~1.14.0 + +1.2.9 / 2015-06-08 +================== + + * deps: mime-types@~2.1.1 + - perf: fix deopt during mapping + +1.2.8 / 2015-06-07 +================== + + * deps: mime-types@~2.1.0 + - deps: mime-db@~1.13.0 + * perf: avoid argument reassignment & argument slice + * perf: avoid negotiator recursive construction + * perf: enable strict mode + * perf: remove unnecessary bitwise operator + +1.2.7 / 2015-05-10 +================== + + * deps: negotiator@0.5.3 + - Fix media type parameter matching to be case-insensitive + +1.2.6 / 2015-05-07 +================== + + * deps: mime-types@~2.0.11 + - deps: mime-db@~1.9.1 + * deps: negotiator@0.5.2 + - Fix comparing media types with quoted values + - Fix splitting media types with quoted commas + +1.2.5 / 2015-03-13 +================== + + * deps: mime-types@~2.0.10 + - deps: mime-db@~1.8.0 + +1.2.4 / 2015-02-14 +================== + + * Support Node.js 0.6 + * deps: mime-types@~2.0.9 + - deps: mime-db@~1.7.0 + * deps: negotiator@0.5.1 + - Fix preference sorting to be stable for long acceptable lists + +1.2.3 / 2015-01-31 +================== + + * deps: mime-types@~2.0.8 + - deps: mime-db@~1.6.0 + +1.2.2 / 2014-12-30 +================== + + * deps: mime-types@~2.0.7 + - deps: mime-db@~1.5.0 + +1.2.1 / 2014-12-30 +================== + + * deps: mime-types@~2.0.5 + - deps: mime-db@~1.3.1 + +1.2.0 / 2014-12-19 +================== + + * deps: negotiator@0.5.0 + - Fix list return order when large accepted list + - Fix missing identity encoding when q=0 exists + - Remove dynamic building of Negotiator class + +1.1.4 / 2014-12-10 +================== + + * deps: mime-types@~2.0.4 + - deps: mime-db@~1.3.0 + +1.1.3 / 2014-11-09 +================== + + * deps: mime-types@~2.0.3 + - deps: mime-db@~1.2.0 + +1.1.2 / 2014-10-14 +================== + + * deps: negotiator@0.4.9 + - Fix error when media type has invalid parameter + +1.1.1 / 2014-09-28 +================== + + * deps: mime-types@~2.0.2 + - deps: mime-db@~1.1.0 + * deps: negotiator@0.4.8 + - Fix all negotiations to be case-insensitive + - Stable sort preferences of same quality according to client order + +1.1.0 / 2014-09-02 +================== + + * update `mime-types` + +1.0.7 / 2014-07-04 +================== + + * Fix wrong type returned from `type` when match after unknown extension + +1.0.6 / 2014-06-24 +================== + + * deps: negotiator@0.4.7 + +1.0.5 / 2014-06-20 +================== + + * fix crash when unknown extension given + +1.0.4 / 2014-06-19 +================== + + * use `mime-types` + +1.0.3 / 2014-06-11 +================== + + * deps: negotiator@0.4.6 + - Order by specificity when quality is the same + +1.0.2 / 2014-05-29 +================== + + * Fix interpretation when header not in request + * deps: pin negotiator@0.4.5 + +1.0.1 / 2014-01-18 +================== + + * Identity encoding isn't always acceptable + * deps: negotiator@~0.4.0 + +1.0.0 / 2013-12-27 +================== + + * Genesis diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/accepts/LICENSE b/25_03_11/frontend_vizsgafeladat/backend/node_modules/accepts/LICENSE new file mode 100644 index 00000000..06166077 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/accepts/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2014 Jonathan Ong +Copyright (c) 2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/accepts/README.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/accepts/README.md new file mode 100644 index 00000000..82680c53 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/accepts/README.md @@ -0,0 +1,140 @@ +# accepts + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][github-actions-ci-image]][github-actions-ci-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Higher level content negotiation based on [negotiator](https://www.npmjs.com/package/negotiator). +Extracted from [koa](https://www.npmjs.com/package/koa) for general use. + +In addition to negotiator, it allows: + +- Allows types as an array or arguments list, ie `(['text/html', 'application/json'])` + as well as `('text/html', 'application/json')`. +- Allows type shorthands such as `json`. +- Returns `false` when no types match +- Treats non-existent headers as `*` + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install accepts +``` + +## API + +```js +var accepts = require('accepts') +``` + +### accepts(req) + +Create a new `Accepts` object for the given `req`. + +#### .charset(charsets) + +Return the first accepted charset. If nothing in `charsets` is accepted, +then `false` is returned. + +#### .charsets() + +Return the charsets that the request accepts, in the order of the client's +preference (most preferred first). + +#### .encoding(encodings) + +Return the first accepted encoding. If nothing in `encodings` is accepted, +then `false` is returned. + +#### .encodings() + +Return the encodings that the request accepts, in the order of the client's +preference (most preferred first). + +#### .language(languages) + +Return the first accepted language. If nothing in `languages` is accepted, +then `false` is returned. + +#### .languages() + +Return the languages that the request accepts, in the order of the client's +preference (most preferred first). + +#### .type(types) + +Return the first accepted type (and it is returned as the same text as what +appears in the `types` array). If nothing in `types` is accepted, then `false` +is returned. + +The `types` array can contain full MIME types or file extensions. Any value +that is not a full MIME types is passed to `require('mime-types').lookup`. + +#### .types() + +Return the types that the request accepts, in the order of the client's +preference (most preferred first). + +## Examples + +### Simple type negotiation + +This simple example shows how to use `accepts` to return a different typed +respond body based on what the client wants to accept. The server lists it's +preferences in order and will get back the best match between the client and +server. + +```js +var accepts = require('accepts') +var http = require('http') + +function app (req, res) { + var accept = accepts(req) + + // the order of this list is significant; should be server preferred order + switch (accept.type(['json', 'html'])) { + case 'json': + res.setHeader('Content-Type', 'application/json') + res.write('{"hello":"world!"}') + break + case 'html': + res.setHeader('Content-Type', 'text/html') + res.write('hello, world!') + break + default: + // the fallback is text/plain, so no need to specify it above + res.setHeader('Content-Type', 'text/plain') + res.write('hello, world!') + break + } + + res.end() +} + +http.createServer(app).listen(3000) +``` + +You can test this out with the cURL program: +```sh +curl -I -H'Accept: text/html' http://localhost:3000/ +``` + +## License + +[MIT](LICENSE) + +[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/accepts/master +[coveralls-url]: https://coveralls.io/r/jshttp/accepts?branch=master +[github-actions-ci-image]: https://badgen.net/github/checks/jshttp/accepts/master?label=ci +[github-actions-ci-url]: https://github.com/jshttp/accepts/actions/workflows/ci.yml +[node-version-image]: https://badgen.net/npm/node/accepts +[node-version-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/accepts +[npm-url]: https://npmjs.org/package/accepts +[npm-version-image]: https://badgen.net/npm/v/accepts diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/accepts/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/accepts/index.js new file mode 100644 index 00000000..e9b2f63f --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/accepts/index.js @@ -0,0 +1,238 @@ +/*! + * accepts + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var Negotiator = require('negotiator') +var mime = require('mime-types') + +/** + * Module exports. + * @public + */ + +module.exports = Accepts + +/** + * Create a new Accepts object for the given req. + * + * @param {object} req + * @public + */ + +function Accepts (req) { + if (!(this instanceof Accepts)) { + return new Accepts(req) + } + + this.headers = req.headers + this.negotiator = new Negotiator(req) +} + +/** + * Check if the given `type(s)` is acceptable, returning + * the best match when true, otherwise `undefined`, in which + * case you should respond with 406 "Not Acceptable". + * + * The `type` value may be a single mime type string + * such as "application/json", the extension name + * such as "json" or an array `["json", "html", "text/plain"]`. When a list + * or array is given the _best_ match, if any is returned. + * + * Examples: + * + * // Accept: text/html + * this.types('html'); + * // => "html" + * + * // Accept: text/*, application/json + * this.types('html'); + * // => "html" + * this.types('text/html'); + * // => "text/html" + * this.types('json', 'text'); + * // => "json" + * this.types('application/json'); + * // => "application/json" + * + * // Accept: text/*, application/json + * this.types('image/png'); + * this.types('png'); + * // => undefined + * + * // Accept: text/*;q=.5, application/json + * this.types(['html', 'json']); + * this.types('html', 'json'); + * // => "json" + * + * @param {String|Array} types... + * @return {String|Array|Boolean} + * @public + */ + +Accepts.prototype.type = +Accepts.prototype.types = function (types_) { + var types = types_ + + // support flattened arguments + if (types && !Array.isArray(types)) { + types = new Array(arguments.length) + for (var i = 0; i < types.length; i++) { + types[i] = arguments[i] + } + } + + // no types, return all requested types + if (!types || types.length === 0) { + return this.negotiator.mediaTypes() + } + + // no accept header, return first given type + if (!this.headers.accept) { + return types[0] + } + + var mimes = types.map(extToMime) + var accepts = this.negotiator.mediaTypes(mimes.filter(validMime)) + var first = accepts[0] + + return first + ? types[mimes.indexOf(first)] + : false +} + +/** + * Return accepted encodings or best fit based on `encodings`. + * + * Given `Accept-Encoding: gzip, deflate` + * an array sorted by quality is returned: + * + * ['gzip', 'deflate'] + * + * @param {String|Array} encodings... + * @return {String|Array} + * @public + */ + +Accepts.prototype.encoding = +Accepts.prototype.encodings = function (encodings_) { + var encodings = encodings_ + + // support flattened arguments + if (encodings && !Array.isArray(encodings)) { + encodings = new Array(arguments.length) + for (var i = 0; i < encodings.length; i++) { + encodings[i] = arguments[i] + } + } + + // no encodings, return all requested encodings + if (!encodings || encodings.length === 0) { + return this.negotiator.encodings() + } + + return this.negotiator.encodings(encodings)[0] || false +} + +/** + * Return accepted charsets or best fit based on `charsets`. + * + * Given `Accept-Charset: utf-8, iso-8859-1;q=0.2, utf-7;q=0.5` + * an array sorted by quality is returned: + * + * ['utf-8', 'utf-7', 'iso-8859-1'] + * + * @param {String|Array} charsets... + * @return {String|Array} + * @public + */ + +Accepts.prototype.charset = +Accepts.prototype.charsets = function (charsets_) { + var charsets = charsets_ + + // support flattened arguments + if (charsets && !Array.isArray(charsets)) { + charsets = new Array(arguments.length) + for (var i = 0; i < charsets.length; i++) { + charsets[i] = arguments[i] + } + } + + // no charsets, return all requested charsets + if (!charsets || charsets.length === 0) { + return this.negotiator.charsets() + } + + return this.negotiator.charsets(charsets)[0] || false +} + +/** + * Return accepted languages or best fit based on `langs`. + * + * Given `Accept-Language: en;q=0.8, es, pt` + * an array sorted by quality is returned: + * + * ['es', 'pt', 'en'] + * + * @param {String|Array} langs... + * @return {Array|String} + * @public + */ + +Accepts.prototype.lang = +Accepts.prototype.langs = +Accepts.prototype.language = +Accepts.prototype.languages = function (languages_) { + var languages = languages_ + + // support flattened arguments + if (languages && !Array.isArray(languages)) { + languages = new Array(arguments.length) + for (var i = 0; i < languages.length; i++) { + languages[i] = arguments[i] + } + } + + // no languages, return all requested languages + if (!languages || languages.length === 0) { + return this.negotiator.languages() + } + + return this.negotiator.languages(languages)[0] || false +} + +/** + * Convert extnames to mime. + * + * @param {String} type + * @return {String} + * @private + */ + +function extToMime (type) { + return type.indexOf('/') === -1 + ? mime.lookup(type) + : type +} + +/** + * Check if mime is valid. + * + * @param {String} type + * @return {String} + * @private + */ + +function validMime (type) { + return typeof type === 'string' +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/accepts/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/accepts/package.json new file mode 100644 index 00000000..e9b70391 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/accepts/package.json @@ -0,0 +1,86 @@ +{ + "_from": "accepts@~1.3.8", + "_id": "accepts@1.3.8", + "_inBundle": false, + "_integrity": "sha512-PYAthTa2m2VKxuvSD3DPC/Gy+U+sOA1LAuT8mkmRuvw+NACSaeXEQ+NHcVF7rONl6qcaxV3Uuemwawk+7+SJLw==", + "_location": "/accepts", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "accepts@~1.3.8", + "name": "accepts", + "escapedName": "accepts", + "rawSpec": "~1.3.8", + "saveSpec": null, + "fetchSpec": "~1.3.8" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/accepts/-/accepts-1.3.8.tgz", + "_shasum": "0bf0be125b67014adcb0b0921e62db7bffe16b2e", + "_spec": "accepts@~1.3.8", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\express", + "bugs": { + "url": "https://github.com/jshttp/accepts/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + } + ], + "dependencies": { + "mime-types": "~2.1.34", + "negotiator": "0.6.3" + }, + "deprecated": false, + "description": "Higher-level content negotiation", + "devDependencies": { + "deep-equal": "1.0.1", + "eslint": "7.32.0", + "eslint-config-standard": "14.1.1", + "eslint-plugin-import": "2.25.4", + "eslint-plugin-markdown": "2.2.1", + "eslint-plugin-node": "11.1.0", + "eslint-plugin-promise": "4.3.1", + "eslint-plugin-standard": "4.1.0", + "mocha": "9.2.0", + "nyc": "15.1.0" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "index.js" + ], + "homepage": "https://github.com/jshttp/accepts#readme", + "keywords": [ + "content", + "negotiation", + "accept", + "accepts" + ], + "license": "MIT", + "name": "accepts", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/accepts.git" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --reporter spec --check-leaks --bail test/", + "test-ci": "nyc --reporter=lcov --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test" + }, + "version": "1.3.8" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/README.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/README.md new file mode 100644 index 00000000..256f1f32 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/README.md @@ -0,0 +1,145 @@ +agent-base +========== +### Turn a function into an [`http.Agent`][http.Agent] instance +[![Build Status](https://github.com/TooTallNate/node-agent-base/workflows/Node%20CI/badge.svg)](https://github.com/TooTallNate/node-agent-base/actions?workflow=Node+CI) + +This module provides an `http.Agent` generator. That is, you pass it an async +callback function, and it returns a new `http.Agent` instance that will invoke the +given callback function when sending outbound HTTP requests. + +#### Some subclasses: + +Here's some more interesting uses of `agent-base`. +Send a pull request to list yours! + + * [`http-proxy-agent`][http-proxy-agent]: An HTTP(s) proxy `http.Agent` implementation for HTTP endpoints + * [`https-proxy-agent`][https-proxy-agent]: An HTTP(s) proxy `http.Agent` implementation for HTTPS endpoints + * [`pac-proxy-agent`][pac-proxy-agent]: A PAC file proxy `http.Agent` implementation for HTTP and HTTPS + * [`socks-proxy-agent`][socks-proxy-agent]: A SOCKS proxy `http.Agent` implementation for HTTP and HTTPS + + +Installation +------------ + +Install with `npm`: + +``` bash +$ npm install agent-base +``` + + +Example +------- + +Here's a minimal example that creates a new `net.Socket` connection to the server +for every HTTP request (i.e. the equivalent of `agent: false` option): + +```js +var net = require('net'); +var tls = require('tls'); +var url = require('url'); +var http = require('http'); +var agent = require('agent-base'); + +var endpoint = 'http://nodejs.org/api/'; +var parsed = url.parse(endpoint); + +// This is the important part! +parsed.agent = agent(function (req, opts) { + var socket; + // `secureEndpoint` is true when using the https module + if (opts.secureEndpoint) { + socket = tls.connect(opts); + } else { + socket = net.connect(opts); + } + return socket; +}); + +// Everything else works just like normal... +http.get(parsed, function (res) { + console.log('"response" event!', res.headers); + res.pipe(process.stdout); +}); +``` + +Returning a Promise or using an `async` function is also supported: + +```js +agent(async function (req, opts) { + await sleep(1000); + // etc… +}); +``` + +Return another `http.Agent` instance to "pass through" the responsibility +for that HTTP request to that agent: + +```js +agent(function (req, opts) { + return opts.secureEndpoint ? https.globalAgent : http.globalAgent; +}); +``` + + +API +--- + +## Agent(Function callback[, Object options]) → [http.Agent][] + +Creates a base `http.Agent` that will execute the callback function `callback` +for every HTTP request that it is used as the `agent` for. The callback function +is responsible for creating a `stream.Duplex` instance of some kind that will be +used as the underlying socket in the HTTP request. + +The `options` object accepts the following properties: + + * `timeout` - Number - Timeout for the `callback()` function in milliseconds. Defaults to Infinity (optional). + +The callback function should have the following signature: + +### callback(http.ClientRequest req, Object options, Function cb) → undefined + +The ClientRequest `req` can be accessed to read request headers and +and the path, etc. The `options` object contains the options passed +to the `http.request()`/`https.request()` function call, and is formatted +to be directly passed to `net.connect()`/`tls.connect()`, or however +else you want a Socket to be created. Pass the created socket to +the callback function `cb` once created, and the HTTP request will +continue to proceed. + +If the `https` module is used to invoke the HTTP request, then the +`secureEndpoint` property on `options` _will be set to `true`_. + + +License +------- + +(The MIT License) + +Copyright (c) 2013 Nathan Rajlich <nathan@tootallnate.net> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +[http-proxy-agent]: https://github.com/TooTallNate/node-http-proxy-agent +[https-proxy-agent]: https://github.com/TooTallNate/node-https-proxy-agent +[pac-proxy-agent]: https://github.com/TooTallNate/node-pac-proxy-agent +[socks-proxy-agent]: https://github.com/TooTallNate/node-socks-proxy-agent +[http.Agent]: https://nodejs.org/api/http.html#http_class_http_agent diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/dist/src/index.d.ts b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/dist/src/index.d.ts new file mode 100644 index 00000000..bc4ab744 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/dist/src/index.d.ts @@ -0,0 +1,78 @@ +/// +import net from 'net'; +import http from 'http'; +import https from 'https'; +import { Duplex } from 'stream'; +import { EventEmitter } from 'events'; +declare function createAgent(opts?: createAgent.AgentOptions): createAgent.Agent; +declare function createAgent(callback: createAgent.AgentCallback, opts?: createAgent.AgentOptions): createAgent.Agent; +declare namespace createAgent { + interface ClientRequest extends http.ClientRequest { + _last?: boolean; + _hadError?: boolean; + method: string; + } + interface AgentRequestOptions { + host?: string; + path?: string; + port: number; + } + interface HttpRequestOptions extends AgentRequestOptions, Omit { + secureEndpoint: false; + } + interface HttpsRequestOptions extends AgentRequestOptions, Omit { + secureEndpoint: true; + } + type RequestOptions = HttpRequestOptions | HttpsRequestOptions; + type AgentLike = Pick | http.Agent; + type AgentCallbackReturn = Duplex | AgentLike; + type AgentCallbackCallback = (err?: Error | null, socket?: createAgent.AgentCallbackReturn) => void; + type AgentCallbackPromise = (req: createAgent.ClientRequest, opts: createAgent.RequestOptions) => createAgent.AgentCallbackReturn | Promise; + type AgentCallback = typeof Agent.prototype.callback; + type AgentOptions = { + timeout?: number; + }; + /** + * Base `http.Agent` implementation. + * No pooling/keep-alive is implemented by default. + * + * @param {Function} callback + * @api public + */ + class Agent extends EventEmitter { + timeout: number | null; + maxFreeSockets: number; + maxTotalSockets: number; + maxSockets: number; + sockets: { + [key: string]: net.Socket[]; + }; + freeSockets: { + [key: string]: net.Socket[]; + }; + requests: { + [key: string]: http.IncomingMessage[]; + }; + options: https.AgentOptions; + private promisifiedCallback?; + private explicitDefaultPort?; + private explicitProtocol?; + constructor(callback?: createAgent.AgentCallback | createAgent.AgentOptions, _opts?: createAgent.AgentOptions); + get defaultPort(): number; + set defaultPort(v: number); + get protocol(): string; + set protocol(v: string); + callback(req: createAgent.ClientRequest, opts: createAgent.RequestOptions, fn: createAgent.AgentCallbackCallback): void; + callback(req: createAgent.ClientRequest, opts: createAgent.RequestOptions): createAgent.AgentCallbackReturn | Promise; + /** + * Called by node-core's "_http_client.js" module when creating + * a new HTTP request with this Agent instance. + * + * @api public + */ + addRequest(req: ClientRequest, _opts: RequestOptions): void; + freeSocket(socket: net.Socket, opts: AgentOptions): void; + destroy(): void; + } +} +export = createAgent; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/dist/src/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/dist/src/index.js new file mode 100644 index 00000000..bfd9e220 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/dist/src/index.js @@ -0,0 +1,203 @@ +"use strict"; +var __importDefault = (this && this.__importDefault) || function (mod) { + return (mod && mod.__esModule) ? mod : { "default": mod }; +}; +const events_1 = require("events"); +const debug_1 = __importDefault(require("debug")); +const promisify_1 = __importDefault(require("./promisify")); +const debug = debug_1.default('agent-base'); +function isAgent(v) { + return Boolean(v) && typeof v.addRequest === 'function'; +} +function isSecureEndpoint() { + const { stack } = new Error(); + if (typeof stack !== 'string') + return false; + return stack.split('\n').some(l => l.indexOf('(https.js:') !== -1 || l.indexOf('node:https:') !== -1); +} +function createAgent(callback, opts) { + return new createAgent.Agent(callback, opts); +} +(function (createAgent) { + /** + * Base `http.Agent` implementation. + * No pooling/keep-alive is implemented by default. + * + * @param {Function} callback + * @api public + */ + class Agent extends events_1.EventEmitter { + constructor(callback, _opts) { + super(); + let opts = _opts; + if (typeof callback === 'function') { + this.callback = callback; + } + else if (callback) { + opts = callback; + } + // Timeout for the socket to be returned from the callback + this.timeout = null; + if (opts && typeof opts.timeout === 'number') { + this.timeout = opts.timeout; + } + // These aren't actually used by `agent-base`, but are required + // for the TypeScript definition files in `@types/node` :/ + this.maxFreeSockets = 1; + this.maxSockets = 1; + this.maxTotalSockets = Infinity; + this.sockets = {}; + this.freeSockets = {}; + this.requests = {}; + this.options = {}; + } + get defaultPort() { + if (typeof this.explicitDefaultPort === 'number') { + return this.explicitDefaultPort; + } + return isSecureEndpoint() ? 443 : 80; + } + set defaultPort(v) { + this.explicitDefaultPort = v; + } + get protocol() { + if (typeof this.explicitProtocol === 'string') { + return this.explicitProtocol; + } + return isSecureEndpoint() ? 'https:' : 'http:'; + } + set protocol(v) { + this.explicitProtocol = v; + } + callback(req, opts, fn) { + throw new Error('"agent-base" has no default implementation, you must subclass and override `callback()`'); + } + /** + * Called by node-core's "_http_client.js" module when creating + * a new HTTP request with this Agent instance. + * + * @api public + */ + addRequest(req, _opts) { + const opts = Object.assign({}, _opts); + if (typeof opts.secureEndpoint !== 'boolean') { + opts.secureEndpoint = isSecureEndpoint(); + } + if (opts.host == null) { + opts.host = 'localhost'; + } + if (opts.port == null) { + opts.port = opts.secureEndpoint ? 443 : 80; + } + if (opts.protocol == null) { + opts.protocol = opts.secureEndpoint ? 'https:' : 'http:'; + } + if (opts.host && opts.path) { + // If both a `host` and `path` are specified then it's most + // likely the result of a `url.parse()` call... we need to + // remove the `path` portion so that `net.connect()` doesn't + // attempt to open that as a unix socket file. + delete opts.path; + } + delete opts.agent; + delete opts.hostname; + delete opts._defaultAgent; + delete opts.defaultPort; + delete opts.createConnection; + // Hint to use "Connection: close" + // XXX: non-documented `http` module API :( + req._last = true; + req.shouldKeepAlive = false; + let timedOut = false; + let timeoutId = null; + const timeoutMs = opts.timeout || this.timeout; + const onerror = (err) => { + if (req._hadError) + return; + req.emit('error', err); + // For Safety. Some additional errors might fire later on + // and we need to make sure we don't double-fire the error event. + req._hadError = true; + }; + const ontimeout = () => { + timeoutId = null; + timedOut = true; + const err = new Error(`A "socket" was not created for HTTP request before ${timeoutMs}ms`); + err.code = 'ETIMEOUT'; + onerror(err); + }; + const callbackError = (err) => { + if (timedOut) + return; + if (timeoutId !== null) { + clearTimeout(timeoutId); + timeoutId = null; + } + onerror(err); + }; + const onsocket = (socket) => { + if (timedOut) + return; + if (timeoutId != null) { + clearTimeout(timeoutId); + timeoutId = null; + } + if (isAgent(socket)) { + // `socket` is actually an `http.Agent` instance, so + // relinquish responsibility for this `req` to the Agent + // from here on + debug('Callback returned another Agent instance %o', socket.constructor.name); + socket.addRequest(req, opts); + return; + } + if (socket) { + socket.once('free', () => { + this.freeSocket(socket, opts); + }); + req.onSocket(socket); + return; + } + const err = new Error(`no Duplex stream was returned to agent-base for \`${req.method} ${req.path}\``); + onerror(err); + }; + if (typeof this.callback !== 'function') { + onerror(new Error('`callback` is not defined')); + return; + } + if (!this.promisifiedCallback) { + if (this.callback.length >= 3) { + debug('Converting legacy callback function to promise'); + this.promisifiedCallback = promisify_1.default(this.callback); + } + else { + this.promisifiedCallback = this.callback; + } + } + if (typeof timeoutMs === 'number' && timeoutMs > 0) { + timeoutId = setTimeout(ontimeout, timeoutMs); + } + if ('port' in opts && typeof opts.port !== 'number') { + opts.port = Number(opts.port); + } + try { + debug('Resolving socket for %o request: %o', opts.protocol, `${req.method} ${req.path}`); + Promise.resolve(this.promisifiedCallback(req, opts)).then(onsocket, callbackError); + } + catch (err) { + Promise.reject(err).catch(callbackError); + } + } + freeSocket(socket, opts) { + debug('Freeing socket %o %o', socket.constructor.name, opts); + socket.destroy(); + } + destroy() { + debug('Destroying agent %o', this.constructor.name); + } + } + createAgent.Agent = Agent; + // So that `instanceof` works correctly + createAgent.prototype = createAgent.Agent.prototype; +})(createAgent || (createAgent = {})); +module.exports = createAgent; +//# sourceMappingURL=index.js.map \ No newline at end of file diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/dist/src/index.js.map b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/dist/src/index.js.map new file mode 100644 index 00000000..bd118ab6 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/dist/src/index.js.map @@ -0,0 +1 @@ +{"version":3,"file":"index.js","sourceRoot":"","sources":["../../src/index.ts"],"names":[],"mappings":";;;;AAIA,mCAAsC;AACtC,kDAAgC;AAChC,4DAAoC;AAEpC,MAAM,KAAK,GAAG,eAAW,CAAC,YAAY,CAAC,CAAC;AAExC,SAAS,OAAO,CAAC,CAAM;IACtB,OAAO,OAAO,CAAC,CAAC,CAAC,IAAI,OAAO,CAAC,CAAC,UAAU,KAAK,UAAU,CAAC;AACzD,CAAC;AAED,SAAS,gBAAgB;IACxB,MAAM,EAAE,KAAK,EAAE,GAAG,IAAI,KAAK,EAAE,CAAC;IAC9B,IAAI,OAAO,KAAK,KAAK,QAAQ;QAAE,OAAO,KAAK,CAAC;IAC5C,OAAO,KAAK,CAAC,KAAK,CAAC,IAAI,CAAC,CAAC,IAAI,CAAC,CAAC,CAAC,EAAE,CAAC,CAAC,CAAC,OAAO,CAAC,YAAY,CAAC,KAAK,CAAC,CAAC,IAAK,CAAC,CAAC,OAAO,CAAC,aAAa,CAAC,KAAK,CAAC,CAAC,CAAC,CAAC;AACxG,CAAC;AAOD,SAAS,WAAW,CACnB,QAA+D,EAC/D,IAA+B;IAE/B,OAAO,IAAI,WAAW,CAAC,KAAK,CAAC,QAAQ,EAAE,IAAI,CAAC,CAAC;AAC9C,CAAC;AAED,WAAU,WAAW;IAmDpB;;;;;;OAMG;IACH,MAAa,KAAM,SAAQ,qBAAY;QAmBtC,YACC,QAA+D,EAC/D,KAAgC;YAEhC,KAAK,EAAE,CAAC;YAER,IAAI,IAAI,GAAG,KAAK,CAAC;YACjB,IAAI,OAAO,QAAQ,KAAK,UAAU,EAAE;gBACnC,IAAI,CAAC,QAAQ,GAAG,QAAQ,CAAC;aACzB;iBAAM,IAAI,QAAQ,EAAE;gBACpB,IAAI,GAAG,QAAQ,CAAC;aAChB;YAED,0DAA0D;YAC1D,IAAI,CAAC,OAAO,GAAG,IAAI,CAAC;YACpB,IAAI,IAAI,IAAI,OAAO,IAAI,CAAC,OAAO,KAAK,QAAQ,EAAE;gBAC7C,IAAI,CAAC,OAAO,GAAG,IAAI,CAAC,OAAO,CAAC;aAC5B;YAED,+DAA+D;YAC/D,0DAA0D;YAC1D,IAAI,CAAC,cAAc,GAAG,CAAC,CAAC;YACxB,IAAI,CAAC,UAAU,GAAG,CAAC,CAAC;YACpB,IAAI,CAAC,eAAe,GAAG,QAAQ,CAAC;YAChC,IAAI,CAAC,OAAO,GAAG,EAAE,CAAC;YAClB,IAAI,CAAC,WAAW,GAAG,EAAE,CAAC;YACtB,IAAI,CAAC,QAAQ,GAAG,EAAE,CAAC;YACnB,IAAI,CAAC,OAAO,GAAG,EAAE,CAAC;QACnB,CAAC;QAED,IAAI,WAAW;YACd,IAAI,OAAO,IAAI,CAAC,mBAAmB,KAAK,QAAQ,EAAE;gBACjD,OAAO,IAAI,CAAC,mBAAmB,CAAC;aAChC;YACD,OAAO,gBAAgB,EAAE,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,CAAC,EAAE,CAAC;QACtC,CAAC;QAED,IAAI,WAAW,CAAC,CAAS;YACxB,IAAI,CAAC,mBAAmB,GAAG,CAAC,CAAC;QAC9B,CAAC;QAED,IAAI,QAAQ;YACX,IAAI,OAAO,IAAI,CAAC,gBAAgB,KAAK,QAAQ,EAAE;gBAC9C,OAAO,IAAI,CAAC,gBAAgB,CAAC;aAC7B;YACD,OAAO,gBAAgB,EAAE,CAAC,CAAC,CAAC,QAAQ,CAAC,CAAC,CAAC,OAAO,CAAC;QAChD,CAAC;QAED,IAAI,QAAQ,CAAC,CAAS;YACrB,IAAI,CAAC,gBAAgB,GAAG,CAAC,CAAC;QAC3B,CAAC;QAaD,QAAQ,CACP,GAA8B,EAC9B,IAA8B,EAC9B,EAAsC;YAKtC,MAAM,IAAI,KAAK,CACd,yFAAyF,CACzF,CAAC;QACH,CAAC;QAED;;;;;WAKG;QACH,UAAU,CAAC,GAAkB,EAAE,KAAqB;YACnD,MAAM,IAAI,qBAAwB,KAAK,CAAE,CAAC;YAE1C,IAAI,OAAO,IAAI,CAAC,cAAc,KAAK,SAAS,EAAE;gBAC7C,IAAI,CAAC,cAAc,GAAG,gBAAgB,EAAE,CAAC;aACzC;YAED,IAAI,IAAI,CAAC,IAAI,IAAI,IAAI,EAAE;gBACtB,IAAI,CAAC,IAAI,GAAG,WAAW,CAAC;aACxB;YAED,IAAI,IAAI,CAAC,IAAI,IAAI,IAAI,EAAE;gBACtB,IAAI,CAAC,IAAI,GAAG,IAAI,CAAC,cAAc,CAAC,CAAC,CAAC,GAAG,CAAC,CAAC,CAAC,EAAE,CAAC;aAC3C;YAED,IAAI,IAAI,CAAC,QAAQ,IAAI,IAAI,EAAE;gBAC1B,IAAI,CAAC,QAAQ,GAAG,IAAI,CAAC,cAAc,CAAC,CAAC,CAAC,QAAQ,CAAC,CAAC,CAAC,OAAO,CAAC;aACzD;YAED,IAAI,IAAI,CAAC,IAAI,IAAI,IAAI,CAAC,IAAI,EAAE;gBAC3B,2DAA2D;gBAC3D,0DAA0D;gBAC1D,4DAA4D;gBAC5D,8CAA8C;gBAC9C,OAAO,IAAI,CAAC,IAAI,CAAC;aACjB;YAED,OAAO,IAAI,CAAC,KAAK,CAAC;YAClB,OAAO,IAAI,CAAC,QAAQ,CAAC;YACrB,OAAO,IAAI,CAAC,aAAa,CAAC;YAC1B,OAAO,IAAI,CAAC,WAAW,CAAC;YACxB,OAAO,IAAI,CAAC,gBAAgB,CAAC;YAE7B,kCAAkC;YAClC,2CAA2C;YAC3C,GAAG,CAAC,KAAK,GAAG,IAAI,CAAC;YACjB,GAAG,CAAC,eAAe,GAAG,KAAK,CAAC;YAE5B,IAAI,QAAQ,GAAG,KAAK,CAAC;YACrB,IAAI,SAAS,GAAyC,IAAI,CAAC;YAC3D,MAAM,SAAS,GAAG,IAAI,CAAC,OAAO,IAAI,IAAI,CAAC,OAAO,CAAC;YAE/C,MAAM,OAAO,GAAG,CAAC,GAA0B,EAAE,EAAE;gBAC9C,IAAI,GAAG,CAAC,SAAS;oBAAE,OAAO;gBAC1B,GAAG,CAAC,IAAI,CAAC,OAAO,EAAE,GAAG,CAAC,CAAC;gBACvB,yDAAyD;gBACzD,iEAAiE;gBACjE,GAAG,CAAC,SAAS,GAAG,IAAI,CAAC;YACtB,CAAC,CAAC;YAEF,MAAM,SAAS,GAAG,GAAG,EAAE;gBACtB,SAAS,GAAG,IAAI,CAAC;gBACjB,QAAQ,GAAG,IAAI,CAAC;gBAChB,MAAM,GAAG,GAA0B,IAAI,KAAK,CAC3C,sDAAsD,SAAS,IAAI,CACnE,CAAC;gBACF,GAAG,CAAC,IAAI,GAAG,UAAU,CAAC;gBACtB,OAAO,CAAC,GAAG,CAAC,CAAC;YACd,CAAC,CAAC;YAEF,MAAM,aAAa,GAAG,CAAC,GAA0B,EAAE,EAAE;gBACpD,IAAI,QAAQ;oBAAE,OAAO;gBACrB,IAAI,SAAS,KAAK,IAAI,EAAE;oBACvB,YAAY,CAAC,SAAS,CAAC,CAAC;oBACxB,SAAS,GAAG,IAAI,CAAC;iBACjB;gBACD,OAAO,CAAC,GAAG,CAAC,CAAC;YACd,CAAC,CAAC;YAEF,MAAM,QAAQ,GAAG,CAAC,MAA2B,EAAE,EAAE;gBAChD,IAAI,QAAQ;oBAAE,OAAO;gBACrB,IAAI,SAAS,IAAI,IAAI,EAAE;oBACtB,YAAY,CAAC,SAAS,CAAC,CAAC;oBACxB,SAAS,GAAG,IAAI,CAAC;iBACjB;gBAED,IAAI,OAAO,CAAC,MAAM,CAAC,EAAE;oBACpB,oDAAoD;oBACpD,wDAAwD;oBACxD,eAAe;oBACf,KAAK,CACJ,6CAA6C,EAC7C,MAAM,CAAC,WAAW,CAAC,IAAI,CACvB,CAAC;oBACD,MAA4B,CAAC,UAAU,CAAC,GAAG,EAAE,IAAI,CAAC,CAAC;oBACpD,OAAO;iBACP;gBAED,IAAI,MAAM,EAAE;oBACX,MAAM,CAAC,IAAI,CAAC,MAAM,EAAE,GAAG,EAAE;wBACxB,IAAI,CAAC,UAAU,CAAC,MAAoB,EAAE,IAAI,CAAC,CAAC;oBAC7C,CAAC,CAAC,CAAC;oBACH,GAAG,CAAC,QAAQ,CAAC,MAAoB,CAAC,CAAC;oBACnC,OAAO;iBACP;gBAED,MAAM,GAAG,GAAG,IAAI,KAAK,CACpB,qDAAqD,GAAG,CAAC,MAAM,IAAI,GAAG,CAAC,IAAI,IAAI,CAC/E,CAAC;gBACF,OAAO,CAAC,GAAG,CAAC,CAAC;YACd,CAAC,CAAC;YAEF,IAAI,OAAO,IAAI,CAAC,QAAQ,KAAK,UAAU,EAAE;gBACxC,OAAO,CAAC,IAAI,KAAK,CAAC,2BAA2B,CAAC,CAAC,CAAC;gBAChD,OAAO;aACP;YAED,IAAI,CAAC,IAAI,CAAC,mBAAmB,EAAE;gBAC9B,IAAI,IAAI,CAAC,QAAQ,CAAC,MAAM,IAAI,CAAC,EAAE;oBAC9B,KAAK,CAAC,gDAAgD,CAAC,CAAC;oBACxD,IAAI,CAAC,mBAAmB,GAAG,mBAAS,CAAC,IAAI,CAAC,QAAQ,CAAC,CAAC;iBACpD;qBAAM;oBACN,IAAI,CAAC,mBAAmB,GAAG,IAAI,CAAC,QAAQ,CAAC;iBACzC;aACD;YAED,IAAI,OAAO,SAAS,KAAK,QAAQ,IAAI,SAAS,GAAG,CAAC,EAAE;gBACnD,SAAS,GAAG,UAAU,CAAC,SAAS,EAAE,SAAS,CAAC,CAAC;aAC7C;YAED,IAAI,MAAM,IAAI,IAAI,IAAI,OAAO,IAAI,CAAC,IAAI,KAAK,QAAQ,EAAE;gBACpD,IAAI,CAAC,IAAI,GAAG,MAAM,CAAC,IAAI,CAAC,IAAI,CAAC,CAAC;aAC9B;YAED,IAAI;gBACH,KAAK,CACJ,qCAAqC,EACrC,IAAI,CAAC,QAAQ,EACb,GAAG,GAAG,CAAC,MAAM,IAAI,GAAG,CAAC,IAAI,EAAE,CAC3B,CAAC;gBACF,OAAO,CAAC,OAAO,CAAC,IAAI,CAAC,mBAAmB,CAAC,GAAG,EAAE,IAAI,CAAC,CAAC,CAAC,IAAI,CACxD,QAAQ,EACR,aAAa,CACb,CAAC;aACF;YAAC,OAAO,GAAG,EAAE;gBACb,OAAO,CAAC,MAAM,CAAC,GAAG,CAAC,CAAC,KAAK,CAAC,aAAa,CAAC,CAAC;aACzC;QACF,CAAC;QAED,UAAU,CAAC,MAAkB,EAAE,IAAkB;YAChD,KAAK,CAAC,sBAAsB,EAAE,MAAM,CAAC,WAAW,CAAC,IAAI,EAAE,IAAI,CAAC,CAAC;YAC7D,MAAM,CAAC,OAAO,EAAE,CAAC;QAClB,CAAC;QAED,OAAO;YACN,KAAK,CAAC,qBAAqB,EAAE,IAAI,CAAC,WAAW,CAAC,IAAI,CAAC,CAAC;QACrD,CAAC;KACD;IAxPY,iBAAK,QAwPjB,CAAA;IAED,uCAAuC;IACvC,WAAW,CAAC,SAAS,GAAG,WAAW,CAAC,KAAK,CAAC,SAAS,CAAC;AACrD,CAAC,EAtTS,WAAW,KAAX,WAAW,QAsTpB;AAED,iBAAS,WAAW,CAAC"} \ No newline at end of file diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/dist/src/promisify.d.ts b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/dist/src/promisify.d.ts new file mode 100644 index 00000000..02688696 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/dist/src/promisify.d.ts @@ -0,0 +1,4 @@ +import { ClientRequest, RequestOptions, AgentCallbackCallback, AgentCallbackPromise } from './index'; +declare type LegacyCallback = (req: ClientRequest, opts: RequestOptions, fn: AgentCallbackCallback) => void; +export default function promisify(fn: LegacyCallback): AgentCallbackPromise; +export {}; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/dist/src/promisify.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/dist/src/promisify.js new file mode 100644 index 00000000..b2f6132a --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/dist/src/promisify.js @@ -0,0 +1,18 @@ +"use strict"; +Object.defineProperty(exports, "__esModule", { value: true }); +function promisify(fn) { + return function (req, opts) { + return new Promise((resolve, reject) => { + fn.call(this, req, opts, (err, rtn) => { + if (err) { + reject(err); + } + else { + resolve(rtn); + } + }); + }); + }; +} +exports.default = promisify; +//# sourceMappingURL=promisify.js.map \ No newline at end of file diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/dist/src/promisify.js.map b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/dist/src/promisify.js.map new file mode 100644 index 00000000..4bff9bfc --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/dist/src/promisify.js.map @@ -0,0 +1 @@ +{"version":3,"file":"promisify.js","sourceRoot":"","sources":["../../src/promisify.ts"],"names":[],"mappings":";;AAeA,SAAwB,SAAS,CAAC,EAAkB;IACnD,OAAO,UAAsB,GAAkB,EAAE,IAAoB;QACpE,OAAO,IAAI,OAAO,CAAC,CAAC,OAAO,EAAE,MAAM,EAAE,EAAE;YACtC,EAAE,CAAC,IAAI,CACN,IAAI,EACJ,GAAG,EACH,IAAI,EACJ,CAAC,GAA6B,EAAE,GAAyB,EAAE,EAAE;gBAC5D,IAAI,GAAG,EAAE;oBACR,MAAM,CAAC,GAAG,CAAC,CAAC;iBACZ;qBAAM;oBACN,OAAO,CAAC,GAAG,CAAC,CAAC;iBACb;YACF,CAAC,CACD,CAAC;QACH,CAAC,CAAC,CAAC;IACJ,CAAC,CAAC;AACH,CAAC;AAjBD,4BAiBC"} \ No newline at end of file diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/node_modules/debug/LICENSE b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/node_modules/debug/LICENSE new file mode 100644 index 00000000..1a9820e2 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/node_modules/debug/LICENSE @@ -0,0 +1,20 @@ +(The MIT License) + +Copyright (c) 2014-2017 TJ Holowaychuk +Copyright (c) 2018-2021 Josh Junon + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software +and associated documentation files (the 'Software'), to deal in the Software without restriction, +including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, +and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial +portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT +LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/node_modules/debug/README.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/node_modules/debug/README.md new file mode 100644 index 00000000..e9c3e047 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/node_modules/debug/README.md @@ -0,0 +1,481 @@ +# debug +[![Build Status](https://travis-ci.org/debug-js/debug.svg?branch=master)](https://travis-ci.org/debug-js/debug) [![Coverage Status](https://coveralls.io/repos/github/debug-js/debug/badge.svg?branch=master)](https://coveralls.io/github/debug-js/debug?branch=master) [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers) +[![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors) + + + +A tiny JavaScript debugging utility modelled after Node.js core's debugging +technique. Works in Node.js and web browsers. + +## Installation + +```bash +$ npm install debug +``` + +## Usage + +`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole. + +Example [_app.js_](./examples/node/app.js): + +```js +var debug = require('debug')('http') + , http = require('http') + , name = 'My App'; + +// fake app + +debug('booting %o', name); + +http.createServer(function(req, res){ + debug(req.method + ' ' + req.url); + res.end('hello\n'); +}).listen(3000, function(){ + debug('listening'); +}); + +// fake worker of some kind + +require('./worker'); +``` + +Example [_worker.js_](./examples/node/worker.js): + +```js +var a = require('debug')('worker:a') + , b = require('debug')('worker:b'); + +function work() { + a('doing lots of uninteresting work'); + setTimeout(work, Math.random() * 1000); +} + +work(); + +function workb() { + b('doing some work'); + setTimeout(workb, Math.random() * 2000); +} + +workb(); +``` + +The `DEBUG` environment variable is then used to enable these based on space or +comma-delimited names. + +Here are some examples: + +screen shot 2017-08-08 at 12 53 04 pm +screen shot 2017-08-08 at 12 53 38 pm +screen shot 2017-08-08 at 12 53 25 pm + +#### Windows command prompt notes + +##### CMD + +On Windows the environment variable is set using the `set` command. + +```cmd +set DEBUG=*,-not_this +``` + +Example: + +```cmd +set DEBUG=* & node app.js +``` + +##### PowerShell (VS Code default) + +PowerShell uses different syntax to set environment variables. + +```cmd +$env:DEBUG = "*,-not_this" +``` + +Example: + +```cmd +$env:DEBUG='app';node app.js +``` + +Then, run the program to be debugged as usual. + +npm script example: +```js + "windowsDebug": "@powershell -Command $env:DEBUG='*';node app.js", +``` + +## Namespace Colors + +Every debug instance has a color generated for it based on its namespace name. +This helps when visually parsing the debug output to identify which debug instance +a debug line belongs to. + +#### Node.js + +In Node.js, colors are enabled when stderr is a TTY. You also _should_ install +the [`supports-color`](https://npmjs.org/supports-color) module alongside debug, +otherwise debug will only use a small handful of basic colors. + + + +#### Web Browser + +Colors are also enabled on "Web Inspectors" that understand the `%c` formatting +option. These are WebKit web inspectors, Firefox ([since version +31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/)) +and the Firebug plugin for Firefox (any version). + + + + +## Millisecond diff + +When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls. + + + +When stdout is not a TTY, `Date#toISOString()` is used, making it more useful for logging the debug information as shown below: + + + + +## Conventions + +If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser". If you append a "*" to the end of your name, it will always be enabled regardless of the setting of the DEBUG environment variable. You can then use it for normal output as well as debug output. + +## Wildcards + +The `*` character may be used as a wildcard. Suppose for example your library has +debuggers named "connect:bodyParser", "connect:compress", "connect:session", +instead of listing all three with +`DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do +`DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`. + +You can also exclude specific debuggers by prefixing them with a "-" character. +For example, `DEBUG=*,-connect:*` would include all debuggers except those +starting with "connect:". + +## Environment Variables + +When running through Node.js, you can set a few environment variables that will +change the behavior of the debug logging: + +| Name | Purpose | +|-----------|-------------------------------------------------| +| `DEBUG` | Enables/disables specific debugging namespaces. | +| `DEBUG_HIDE_DATE` | Hide date from debug output (non-TTY). | +| `DEBUG_COLORS`| Whether or not to use colors in the debug output. | +| `DEBUG_DEPTH` | Object inspection depth. | +| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. | + + +__Note:__ The environment variables beginning with `DEBUG_` end up being +converted into an Options object that gets used with `%o`/`%O` formatters. +See the Node.js documentation for +[`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options) +for the complete list. + +## Formatters + +Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. +Below are the officially supported formatters: + +| Formatter | Representation | +|-----------|----------------| +| `%O` | Pretty-print an Object on multiple lines. | +| `%o` | Pretty-print an Object all on a single line. | +| `%s` | String. | +| `%d` | Number (both integer and float). | +| `%j` | JSON. Replaced with the string '[Circular]' if the argument contains circular references. | +| `%%` | Single percent sign ('%'). This does not consume an argument. | + + +### Custom formatters + +You can add custom formatters by extending the `debug.formatters` object. +For example, if you wanted to add support for rendering a Buffer as hex with +`%h`, you could do something like: + +```js +const createDebug = require('debug') +createDebug.formatters.h = (v) => { + return v.toString('hex') +} + +// …elsewhere +const debug = createDebug('foo') +debug('this is hex: %h', new Buffer('hello world')) +// foo this is hex: 68656c6c6f20776f726c6421 +0ms +``` + + +## Browser Support + +You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify), +or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest), +if you don't want to build it yourself. + +Debug's enable state is currently persisted by `localStorage`. +Consider the situation shown below where you have `worker:a` and `worker:b`, +and wish to debug both. You can enable this using `localStorage.debug`: + +```js +localStorage.debug = 'worker:*' +``` + +And then refresh the page. + +```js +a = debug('worker:a'); +b = debug('worker:b'); + +setInterval(function(){ + a('doing some work'); +}, 1000); + +setInterval(function(){ + b('doing some work'); +}, 1200); +``` + +In Chromium-based web browsers (e.g. Brave, Chrome, and Electron), the JavaScript console will—by default—only show messages logged by `debug` if the "Verbose" log level is _enabled_. + + + +## Output streams + + By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method: + +Example [_stdout.js_](./examples/node/stdout.js): + +```js +var debug = require('debug'); +var error = debug('app:error'); + +// by default stderr is used +error('goes to stderr!'); + +var log = debug('app:log'); +// set this namespace to log via console.log +log.log = console.log.bind(console); // don't forget to bind to console! +log('goes to stdout'); +error('still goes to stderr!'); + +// set all output to go via console.info +// overrides all per-namespace log settings +debug.log = console.info.bind(console); +error('now goes to stdout via console.info'); +log('still goes to stdout, but via console.info now'); +``` + +## Extend +You can simply extend debugger +```js +const log = require('debug')('auth'); + +//creates new debug instance with extended namespace +const logSign = log.extend('sign'); +const logLogin = log.extend('login'); + +log('hello'); // auth hello +logSign('hello'); //auth:sign hello +logLogin('hello'); //auth:login hello +``` + +## Set dynamically + +You can also enable debug dynamically by calling the `enable()` method : + +```js +let debug = require('debug'); + +console.log(1, debug.enabled('test')); + +debug.enable('test'); +console.log(2, debug.enabled('test')); + +debug.disable(); +console.log(3, debug.enabled('test')); + +``` + +print : +``` +1 false +2 true +3 false +``` + +Usage : +`enable(namespaces)` +`namespaces` can include modes separated by a colon and wildcards. + +Note that calling `enable()` completely overrides previously set DEBUG variable : + +``` +$ DEBUG=foo node -e 'var dbg = require("debug"); dbg.enable("bar"); console.log(dbg.enabled("foo"))' +=> false +``` + +`disable()` + +Will disable all namespaces. The functions returns the namespaces currently +enabled (and skipped). This can be useful if you want to disable debugging +temporarily without knowing what was enabled to begin with. + +For example: + +```js +let debug = require('debug'); +debug.enable('foo:*,-foo:bar'); +let namespaces = debug.disable(); +debug.enable(namespaces); +``` + +Note: There is no guarantee that the string will be identical to the initial +enable string, but semantically they will be identical. + +## Checking whether a debug target is enabled + +After you've created a debug instance, you can determine whether or not it is +enabled by checking the `enabled` property: + +```javascript +const debug = require('debug')('http'); + +if (debug.enabled) { + // do stuff... +} +``` + +You can also manually toggle this property to force the debug instance to be +enabled or disabled. + +## Usage in child processes + +Due to the way `debug` detects if the output is a TTY or not, colors are not shown in child processes when `stderr` is piped. A solution is to pass the `DEBUG_COLORS=1` environment variable to the child process. +For example: + +```javascript +worker = fork(WORKER_WRAP_PATH, [workerPath], { + stdio: [ + /* stdin: */ 0, + /* stdout: */ 'pipe', + /* stderr: */ 'pipe', + 'ipc', + ], + env: Object.assign({}, process.env, { + DEBUG_COLORS: 1 // without this settings, colors won't be shown + }), +}); + +worker.stderr.pipe(process.stderr, { end: false }); +``` + + +## Authors + + - TJ Holowaychuk + - Nathan Rajlich + - Andrew Rhyne + - Josh Junon + +## Backers + +Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)] + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +## Sponsors + +Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)] + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +## License + +(The MIT License) + +Copyright (c) 2014-2017 TJ Holowaychuk <tj@vision-media.ca> +Copyright (c) 2018-2021 Josh Junon + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/node_modules/debug/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/node_modules/debug/package.json new file mode 100644 index 00000000..fbb41add --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/node_modules/debug/package.json @@ -0,0 +1,101 @@ +{ + "_from": "debug@4", + "_id": "debug@4.3.4", + "_inBundle": false, + "_integrity": "sha512-PRWFHuSU3eDtQJPvnNY7Jcket1j0t5OuOsFzPPzsekD52Zl8qUfFIPEiswXqIvHWGVHOgX+7G/vCNNhehwxfkQ==", + "_location": "/agent-base/debug", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "debug@4", + "name": "debug", + "escapedName": "debug", + "rawSpec": "4", + "saveSpec": null, + "fetchSpec": "4" + }, + "_requiredBy": [ + "/agent-base" + ], + "_resolved": "https://registry.npmjs.org/debug/-/debug-4.3.4.tgz", + "_shasum": "1319f6579357f2338d3337d2cdd4914bb5dcc865", + "_spec": "debug@4", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\agent-base", + "author": { + "name": "Josh Junon", + "email": "josh.junon@protonmail.com" + }, + "browser": "./src/browser.js", + "bugs": { + "url": "https://github.com/debug-js/debug/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "TJ Holowaychuk", + "email": "tj@vision-media.ca" + }, + { + "name": "Nathan Rajlich", + "email": "nathan@tootallnate.net", + "url": "http://n8.io" + }, + { + "name": "Andrew Rhyne", + "email": "rhyneandrew@gmail.com" + } + ], + "dependencies": { + "ms": "2.1.2" + }, + "deprecated": false, + "description": "Lightweight debugging utility for Node.js and the browser", + "devDependencies": { + "brfs": "^2.0.1", + "browserify": "^16.2.3", + "coveralls": "^3.0.2", + "istanbul": "^0.4.5", + "karma": "^3.1.4", + "karma-browserify": "^6.0.0", + "karma-chrome-launcher": "^2.2.0", + "karma-mocha": "^1.3.0", + "mocha": "^5.2.0", + "mocha-lcov-reporter": "^1.2.0", + "xo": "^0.23.0" + }, + "engines": { + "node": ">=6.0" + }, + "files": [ + "src", + "LICENSE", + "README.md" + ], + "homepage": "https://github.com/debug-js/debug#readme", + "keywords": [ + "debug", + "log", + "debugger" + ], + "license": "MIT", + "main": "./src/index.js", + "name": "debug", + "peerDependenciesMeta": { + "supports-color": { + "optional": true + } + }, + "repository": { + "type": "git", + "url": "git://github.com/debug-js/debug.git" + }, + "scripts": { + "lint": "xo", + "test": "npm run test:node && npm run test:browser && npm run lint", + "test:browser": "karma start --single-run", + "test:coverage": "cat ./coverage/lcov.info | coveralls", + "test:node": "istanbul cover _mocha -- test.js" + }, + "version": "4.3.4" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/node_modules/debug/src/browser.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/node_modules/debug/src/browser.js new file mode 100644 index 00000000..cd0fc35d --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/node_modules/debug/src/browser.js @@ -0,0 +1,269 @@ +/* eslint-env browser */ + +/** + * This is the web browser implementation of `debug()`. + */ + +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; +exports.storage = localstorage(); +exports.destroy = (() => { + let warned = false; + + return () => { + if (!warned) { + warned = true; + console.warn('Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.'); + } + }; +})(); + +/** + * Colors. + */ + +exports.colors = [ + '#0000CC', + '#0000FF', + '#0033CC', + '#0033FF', + '#0066CC', + '#0066FF', + '#0099CC', + '#0099FF', + '#00CC00', + '#00CC33', + '#00CC66', + '#00CC99', + '#00CCCC', + '#00CCFF', + '#3300CC', + '#3300FF', + '#3333CC', + '#3333FF', + '#3366CC', + '#3366FF', + '#3399CC', + '#3399FF', + '#33CC00', + '#33CC33', + '#33CC66', + '#33CC99', + '#33CCCC', + '#33CCFF', + '#6600CC', + '#6600FF', + '#6633CC', + '#6633FF', + '#66CC00', + '#66CC33', + '#9900CC', + '#9900FF', + '#9933CC', + '#9933FF', + '#99CC00', + '#99CC33', + '#CC0000', + '#CC0033', + '#CC0066', + '#CC0099', + '#CC00CC', + '#CC00FF', + '#CC3300', + '#CC3333', + '#CC3366', + '#CC3399', + '#CC33CC', + '#CC33FF', + '#CC6600', + '#CC6633', + '#CC9900', + '#CC9933', + '#CCCC00', + '#CCCC33', + '#FF0000', + '#FF0033', + '#FF0066', + '#FF0099', + '#FF00CC', + '#FF00FF', + '#FF3300', + '#FF3333', + '#FF3366', + '#FF3399', + '#FF33CC', + '#FF33FF', + '#FF6600', + '#FF6633', + '#FF9900', + '#FF9933', + '#FFCC00', + '#FFCC33' +]; + +/** + * Currently only WebKit-based Web Inspectors, Firefox >= v31, + * and the Firebug extension (any Firefox version) are known + * to support "%c" CSS customizations. + * + * TODO: add a `localStorage` variable to explicitly enable/disable colors + */ + +// eslint-disable-next-line complexity +function useColors() { + // NB: In an Electron preload script, document will be defined but not fully + // initialized. Since we know we're in Chrome, we'll just detect this case + // explicitly + if (typeof window !== 'undefined' && window.process && (window.process.type === 'renderer' || window.process.__nwjs)) { + return true; + } + + // Internet Explorer and Edge do not support colors. + if (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/(edge|trident)\/(\d+)/)) { + return false; + } + + // Is webkit? http://stackoverflow.com/a/16459606/376773 + // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632 + return (typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance) || + // Is firebug? http://stackoverflow.com/a/398120/376773 + (typeof window !== 'undefined' && window.console && (window.console.firebug || (window.console.exception && window.console.table))) || + // Is firefox >= v31? + // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages + (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31) || + // Double check webkit in userAgent just in case we are in a worker + (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/)); +} + +/** + * Colorize log arguments if enabled. + * + * @api public + */ + +function formatArgs(args) { + args[0] = (this.useColors ? '%c' : '') + + this.namespace + + (this.useColors ? ' %c' : ' ') + + args[0] + + (this.useColors ? '%c ' : ' ') + + '+' + module.exports.humanize(this.diff); + + if (!this.useColors) { + return; + } + + const c = 'color: ' + this.color; + args.splice(1, 0, c, 'color: inherit'); + + // The final "%c" is somewhat tricky, because there could be other + // arguments passed either before or after the %c, so we need to + // figure out the correct index to insert the CSS into + let index = 0; + let lastC = 0; + args[0].replace(/%[a-zA-Z%]/g, match => { + if (match === '%%') { + return; + } + index++; + if (match === '%c') { + // We only are interested in the *last* %c + // (the user may have provided their own) + lastC = index; + } + }); + + args.splice(lastC, 0, c); +} + +/** + * Invokes `console.debug()` when available. + * No-op when `console.debug` is not a "function". + * If `console.debug` is not available, falls back + * to `console.log`. + * + * @api public + */ +exports.log = console.debug || console.log || (() => {}); + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ +function save(namespaces) { + try { + if (namespaces) { + exports.storage.setItem('debug', namespaces); + } else { + exports.storage.removeItem('debug'); + } + } catch (error) { + // Swallow + // XXX (@Qix-) should we be logging these? + } +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ +function load() { + let r; + try { + r = exports.storage.getItem('debug'); + } catch (error) { + // Swallow + // XXX (@Qix-) should we be logging these? + } + + // If debug isn't set in LS, and we're in Electron, try to load $DEBUG + if (!r && typeof process !== 'undefined' && 'env' in process) { + r = process.env.DEBUG; + } + + return r; +} + +/** + * Localstorage attempts to return the localstorage. + * + * This is necessary because safari throws + * when a user disables cookies/localstorage + * and you attempt to access it. + * + * @return {LocalStorage} + * @api private + */ + +function localstorage() { + try { + // TVMLKit (Apple TV JS Runtime) does not have a window object, just localStorage in the global context + // The Browser also has localStorage in the global context. + return localStorage; + } catch (error) { + // Swallow + // XXX (@Qix-) should we be logging these? + } +} + +module.exports = require('./common')(exports); + +const {formatters} = module.exports; + +/** + * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default. + */ + +formatters.j = function (v) { + try { + return JSON.stringify(v); + } catch (error) { + return '[UnexpectedJSONParseError]: ' + error.message; + } +}; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/node_modules/debug/src/common.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/node_modules/debug/src/common.js new file mode 100644 index 00000000..e3291b20 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/node_modules/debug/src/common.js @@ -0,0 +1,274 @@ + +/** + * This is the common logic for both the Node.js and web browser + * implementations of `debug()`. + */ + +function setup(env) { + createDebug.debug = createDebug; + createDebug.default = createDebug; + createDebug.coerce = coerce; + createDebug.disable = disable; + createDebug.enable = enable; + createDebug.enabled = enabled; + createDebug.humanize = require('ms'); + createDebug.destroy = destroy; + + Object.keys(env).forEach(key => { + createDebug[key] = env[key]; + }); + + /** + * The currently active debug mode names, and names to skip. + */ + + createDebug.names = []; + createDebug.skips = []; + + /** + * Map of special "%n" handling functions, for the debug "format" argument. + * + * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N". + */ + createDebug.formatters = {}; + + /** + * Selects a color for a debug namespace + * @param {String} namespace The namespace string for the debug instance to be colored + * @return {Number|String} An ANSI color code for the given namespace + * @api private + */ + function selectColor(namespace) { + let hash = 0; + + for (let i = 0; i < namespace.length; i++) { + hash = ((hash << 5) - hash) + namespace.charCodeAt(i); + hash |= 0; // Convert to 32bit integer + } + + return createDebug.colors[Math.abs(hash) % createDebug.colors.length]; + } + createDebug.selectColor = selectColor; + + /** + * Create a debugger with the given `namespace`. + * + * @param {String} namespace + * @return {Function} + * @api public + */ + function createDebug(namespace) { + let prevTime; + let enableOverride = null; + let namespacesCache; + let enabledCache; + + function debug(...args) { + // Disabled? + if (!debug.enabled) { + return; + } + + const self = debug; + + // Set `diff` timestamp + const curr = Number(new Date()); + const ms = curr - (prevTime || curr); + self.diff = ms; + self.prev = prevTime; + self.curr = curr; + prevTime = curr; + + args[0] = createDebug.coerce(args[0]); + + if (typeof args[0] !== 'string') { + // Anything else let's inspect with %O + args.unshift('%O'); + } + + // Apply any `formatters` transformations + let index = 0; + args[0] = args[0].replace(/%([a-zA-Z%])/g, (match, format) => { + // If we encounter an escaped % then don't increase the array index + if (match === '%%') { + return '%'; + } + index++; + const formatter = createDebug.formatters[format]; + if (typeof formatter === 'function') { + const val = args[index]; + match = formatter.call(self, val); + + // Now we need to remove `args[index]` since it's inlined in the `format` + args.splice(index, 1); + index--; + } + return match; + }); + + // Apply env-specific formatting (colors, etc.) + createDebug.formatArgs.call(self, args); + + const logFn = self.log || createDebug.log; + logFn.apply(self, args); + } + + debug.namespace = namespace; + debug.useColors = createDebug.useColors(); + debug.color = createDebug.selectColor(namespace); + debug.extend = extend; + debug.destroy = createDebug.destroy; // XXX Temporary. Will be removed in the next major release. + + Object.defineProperty(debug, 'enabled', { + enumerable: true, + configurable: false, + get: () => { + if (enableOverride !== null) { + return enableOverride; + } + if (namespacesCache !== createDebug.namespaces) { + namespacesCache = createDebug.namespaces; + enabledCache = createDebug.enabled(namespace); + } + + return enabledCache; + }, + set: v => { + enableOverride = v; + } + }); + + // Env-specific initialization logic for debug instances + if (typeof createDebug.init === 'function') { + createDebug.init(debug); + } + + return debug; + } + + function extend(namespace, delimiter) { + const newDebug = createDebug(this.namespace + (typeof delimiter === 'undefined' ? ':' : delimiter) + namespace); + newDebug.log = this.log; + return newDebug; + } + + /** + * Enables a debug mode by namespaces. This can include modes + * separated by a colon and wildcards. + * + * @param {String} namespaces + * @api public + */ + function enable(namespaces) { + createDebug.save(namespaces); + createDebug.namespaces = namespaces; + + createDebug.names = []; + createDebug.skips = []; + + let i; + const split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/); + const len = split.length; + + for (i = 0; i < len; i++) { + if (!split[i]) { + // ignore empty strings + continue; + } + + namespaces = split[i].replace(/\*/g, '.*?'); + + if (namespaces[0] === '-') { + createDebug.skips.push(new RegExp('^' + namespaces.slice(1) + '$')); + } else { + createDebug.names.push(new RegExp('^' + namespaces + '$')); + } + } + } + + /** + * Disable debug output. + * + * @return {String} namespaces + * @api public + */ + function disable() { + const namespaces = [ + ...createDebug.names.map(toNamespace), + ...createDebug.skips.map(toNamespace).map(namespace => '-' + namespace) + ].join(','); + createDebug.enable(''); + return namespaces; + } + + /** + * Returns true if the given mode name is enabled, false otherwise. + * + * @param {String} name + * @return {Boolean} + * @api public + */ + function enabled(name) { + if (name[name.length - 1] === '*') { + return true; + } + + let i; + let len; + + for (i = 0, len = createDebug.skips.length; i < len; i++) { + if (createDebug.skips[i].test(name)) { + return false; + } + } + + for (i = 0, len = createDebug.names.length; i < len; i++) { + if (createDebug.names[i].test(name)) { + return true; + } + } + + return false; + } + + /** + * Convert regexp to namespace + * + * @param {RegExp} regxep + * @return {String} namespace + * @api private + */ + function toNamespace(regexp) { + return regexp.toString() + .substring(2, regexp.toString().length - 2) + .replace(/\.\*\?$/, '*'); + } + + /** + * Coerce `val`. + * + * @param {Mixed} val + * @return {Mixed} + * @api private + */ + function coerce(val) { + if (val instanceof Error) { + return val.stack || val.message; + } + return val; + } + + /** + * XXX DO NOT USE. This is a temporary stub function. + * XXX It WILL be removed in the next major release. + */ + function destroy() { + console.warn('Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.'); + } + + createDebug.enable(createDebug.load()); + + return createDebug; +} + +module.exports = setup; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/node_modules/debug/src/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/node_modules/debug/src/index.js new file mode 100644 index 00000000..bf4c57f2 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/node_modules/debug/src/index.js @@ -0,0 +1,10 @@ +/** + * Detect Electron renderer / nwjs process, which is node, but we should + * treat as a browser. + */ + +if (typeof process === 'undefined' || process.type === 'renderer' || process.browser === true || process.__nwjs) { + module.exports = require('./browser.js'); +} else { + module.exports = require('./node.js'); +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/node_modules/debug/src/node.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/node_modules/debug/src/node.js new file mode 100644 index 00000000..79bc085c --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/node_modules/debug/src/node.js @@ -0,0 +1,263 @@ +/** + * Module dependencies. + */ + +const tty = require('tty'); +const util = require('util'); + +/** + * This is the Node.js implementation of `debug()`. + */ + +exports.init = init; +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; +exports.destroy = util.deprecate( + () => {}, + 'Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.' +); + +/** + * Colors. + */ + +exports.colors = [6, 2, 3, 4, 5, 1]; + +try { + // Optional dependency (as in, doesn't need to be installed, NOT like optionalDependencies in package.json) + // eslint-disable-next-line import/no-extraneous-dependencies + const supportsColor = require('supports-color'); + + if (supportsColor && (supportsColor.stderr || supportsColor).level >= 2) { + exports.colors = [ + 20, + 21, + 26, + 27, + 32, + 33, + 38, + 39, + 40, + 41, + 42, + 43, + 44, + 45, + 56, + 57, + 62, + 63, + 68, + 69, + 74, + 75, + 76, + 77, + 78, + 79, + 80, + 81, + 92, + 93, + 98, + 99, + 112, + 113, + 128, + 129, + 134, + 135, + 148, + 149, + 160, + 161, + 162, + 163, + 164, + 165, + 166, + 167, + 168, + 169, + 170, + 171, + 172, + 173, + 178, + 179, + 184, + 185, + 196, + 197, + 198, + 199, + 200, + 201, + 202, + 203, + 204, + 205, + 206, + 207, + 208, + 209, + 214, + 215, + 220, + 221 + ]; + } +} catch (error) { + // Swallow - we only care if `supports-color` is available; it doesn't have to be. +} + +/** + * Build up the default `inspectOpts` object from the environment variables. + * + * $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js + */ + +exports.inspectOpts = Object.keys(process.env).filter(key => { + return /^debug_/i.test(key); +}).reduce((obj, key) => { + // Camel-case + const prop = key + .substring(6) + .toLowerCase() + .replace(/_([a-z])/g, (_, k) => { + return k.toUpperCase(); + }); + + // Coerce string value into JS value + let val = process.env[key]; + if (/^(yes|on|true|enabled)$/i.test(val)) { + val = true; + } else if (/^(no|off|false|disabled)$/i.test(val)) { + val = false; + } else if (val === 'null') { + val = null; + } else { + val = Number(val); + } + + obj[prop] = val; + return obj; +}, {}); + +/** + * Is stdout a TTY? Colored output is enabled when `true`. + */ + +function useColors() { + return 'colors' in exports.inspectOpts ? + Boolean(exports.inspectOpts.colors) : + tty.isatty(process.stderr.fd); +} + +/** + * Adds ANSI color escape codes if enabled. + * + * @api public + */ + +function formatArgs(args) { + const {namespace: name, useColors} = this; + + if (useColors) { + const c = this.color; + const colorCode = '\u001B[3' + (c < 8 ? c : '8;5;' + c); + const prefix = ` ${colorCode};1m${name} \u001B[0m`; + + args[0] = prefix + args[0].split('\n').join('\n' + prefix); + args.push(colorCode + 'm+' + module.exports.humanize(this.diff) + '\u001B[0m'); + } else { + args[0] = getDate() + name + ' ' + args[0]; + } +} + +function getDate() { + if (exports.inspectOpts.hideDate) { + return ''; + } + return new Date().toISOString() + ' '; +} + +/** + * Invokes `util.format()` with the specified arguments and writes to stderr. + */ + +function log(...args) { + return process.stderr.write(util.format(...args) + '\n'); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ +function save(namespaces) { + if (namespaces) { + process.env.DEBUG = namespaces; + } else { + // If you set a process.env field to null or undefined, it gets cast to the + // string 'null' or 'undefined'. Just delete instead. + delete process.env.DEBUG; + } +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + return process.env.DEBUG; +} + +/** + * Init logic for `debug` instances. + * + * Create a new `inspectOpts` object in case `useColors` is set + * differently for a particular `debug` instance. + */ + +function init(debug) { + debug.inspectOpts = {}; + + const keys = Object.keys(exports.inspectOpts); + for (let i = 0; i < keys.length; i++) { + debug.inspectOpts[keys[i]] = exports.inspectOpts[keys[i]]; + } +} + +module.exports = require('./common')(exports); + +const {formatters} = module.exports; + +/** + * Map %o to `util.inspect()`, all on a single line. + */ + +formatters.o = function (v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts) + .split('\n') + .map(str => str.trim()) + .join(' '); +}; + +/** + * Map %O to `util.inspect()`, allowing multiple lines if needed. + */ + +formatters.O = function (v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts); +}; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/node_modules/ms/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/node_modules/ms/index.js new file mode 100644 index 00000000..c4498bcc --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/node_modules/ms/index.js @@ -0,0 +1,162 @@ +/** + * Helpers. + */ + +var s = 1000; +var m = s * 60; +var h = m * 60; +var d = h * 24; +var w = d * 7; +var y = d * 365.25; + +/** + * Parse or format the given `val`. + * + * Options: + * + * - `long` verbose formatting [false] + * + * @param {String|Number} val + * @param {Object} [options] + * @throws {Error} throw an error if val is not a non-empty string or a number + * @return {String|Number} + * @api public + */ + +module.exports = function(val, options) { + options = options || {}; + var type = typeof val; + if (type === 'string' && val.length > 0) { + return parse(val); + } else if (type === 'number' && isFinite(val)) { + return options.long ? fmtLong(val) : fmtShort(val); + } + throw new Error( + 'val is not a non-empty string or a valid number. val=' + + JSON.stringify(val) + ); +}; + +/** + * Parse the given `str` and return milliseconds. + * + * @param {String} str + * @return {Number} + * @api private + */ + +function parse(str) { + str = String(str); + if (str.length > 100) { + return; + } + var match = /^(-?(?:\d+)?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|weeks?|w|years?|yrs?|y)?$/i.exec( + str + ); + if (!match) { + return; + } + var n = parseFloat(match[1]); + var type = (match[2] || 'ms').toLowerCase(); + switch (type) { + case 'years': + case 'year': + case 'yrs': + case 'yr': + case 'y': + return n * y; + case 'weeks': + case 'week': + case 'w': + return n * w; + case 'days': + case 'day': + case 'd': + return n * d; + case 'hours': + case 'hour': + case 'hrs': + case 'hr': + case 'h': + return n * h; + case 'minutes': + case 'minute': + case 'mins': + case 'min': + case 'm': + return n * m; + case 'seconds': + case 'second': + case 'secs': + case 'sec': + case 's': + return n * s; + case 'milliseconds': + case 'millisecond': + case 'msecs': + case 'msec': + case 'ms': + return n; + default: + return undefined; + } +} + +/** + * Short format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function fmtShort(ms) { + var msAbs = Math.abs(ms); + if (msAbs >= d) { + return Math.round(ms / d) + 'd'; + } + if (msAbs >= h) { + return Math.round(ms / h) + 'h'; + } + if (msAbs >= m) { + return Math.round(ms / m) + 'm'; + } + if (msAbs >= s) { + return Math.round(ms / s) + 's'; + } + return ms + 'ms'; +} + +/** + * Long format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function fmtLong(ms) { + var msAbs = Math.abs(ms); + if (msAbs >= d) { + return plural(ms, msAbs, d, 'day'); + } + if (msAbs >= h) { + return plural(ms, msAbs, h, 'hour'); + } + if (msAbs >= m) { + return plural(ms, msAbs, m, 'minute'); + } + if (msAbs >= s) { + return plural(ms, msAbs, s, 'second'); + } + return ms + ' ms'; +} + +/** + * Pluralization helper. + */ + +function plural(ms, msAbs, n, name) { + var isPlural = msAbs >= n * 1.5; + return Math.round(ms / n) + ' ' + name + (isPlural ? 's' : ''); +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/node_modules/ms/license.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/node_modules/ms/license.md new file mode 100644 index 00000000..69b61253 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/node_modules/ms/license.md @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2016 Zeit, Inc. + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/node_modules/ms/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/node_modules/ms/package.json new file mode 100644 index 00000000..49ddafd3 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/node_modules/ms/package.json @@ -0,0 +1,69 @@ +{ + "_from": "ms@2.1.2", + "_id": "ms@2.1.2", + "_inBundle": false, + "_integrity": "sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==", + "_location": "/agent-base/ms", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "ms@2.1.2", + "name": "ms", + "escapedName": "ms", + "rawSpec": "2.1.2", + "saveSpec": null, + "fetchSpec": "2.1.2" + }, + "_requiredBy": [ + "/agent-base/debug" + ], + "_resolved": "https://registry.npmjs.org/ms/-/ms-2.1.2.tgz", + "_shasum": "d09d1f357b443f493382a8eb3ccd183872ae6009", + "_spec": "ms@2.1.2", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\agent-base\\node_modules\\debug", + "bugs": { + "url": "https://github.com/zeit/ms/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Tiny millisecond conversion utility", + "devDependencies": { + "eslint": "4.12.1", + "expect.js": "0.3.1", + "husky": "0.14.3", + "lint-staged": "5.0.0", + "mocha": "4.0.1" + }, + "eslintConfig": { + "extends": "eslint:recommended", + "env": { + "node": true, + "es6": true + } + }, + "files": [ + "index.js" + ], + "homepage": "https://github.com/zeit/ms#readme", + "license": "MIT", + "lint-staged": { + "*.js": [ + "npm run lint", + "prettier --single-quote --write", + "git add" + ] + }, + "main": "./index", + "name": "ms", + "repository": { + "type": "git", + "url": "git+https://github.com/zeit/ms.git" + }, + "scripts": { + "lint": "eslint lib/* bin/*", + "precommit": "lint-staged", + "test": "mocha tests.js" + }, + "version": "2.1.2" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/node_modules/ms/readme.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/node_modules/ms/readme.md new file mode 100644 index 00000000..9a1996b1 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/node_modules/ms/readme.md @@ -0,0 +1,60 @@ +# ms + +[![Build Status](https://travis-ci.org/zeit/ms.svg?branch=master)](https://travis-ci.org/zeit/ms) +[![Join the community on Spectrum](https://withspectrum.github.io/badge/badge.svg)](https://spectrum.chat/zeit) + +Use this package to easily convert various time formats to milliseconds. + +## Examples + +```js +ms('2 days') // 172800000 +ms('1d') // 86400000 +ms('10h') // 36000000 +ms('2.5 hrs') // 9000000 +ms('2h') // 7200000 +ms('1m') // 60000 +ms('5s') // 5000 +ms('1y') // 31557600000 +ms('100') // 100 +ms('-3 days') // -259200000 +ms('-1h') // -3600000 +ms('-200') // -200 +``` + +### Convert from Milliseconds + +```js +ms(60000) // "1m" +ms(2 * 60000) // "2m" +ms(-3 * 60000) // "-3m" +ms(ms('10 hours')) // "10h" +``` + +### Time Format Written-Out + +```js +ms(60000, { long: true }) // "1 minute" +ms(2 * 60000, { long: true }) // "2 minutes" +ms(-3 * 60000, { long: true }) // "-3 minutes" +ms(ms('10 hours'), { long: true }) // "10 hours" +``` + +## Features + +- Works both in [Node.js](https://nodejs.org) and in the browser +- If a number is supplied to `ms`, a string with a unit is returned +- If a string that contains the number is supplied, it returns it as a number (e.g.: it returns `100` for `'100'`) +- If you pass a string with a number and a valid unit, the number of equivalent milliseconds is returned + +## Related Packages + +- [ms.macro](https://github.com/knpwrs/ms.macro) - Run `ms` as a macro at build-time. + +## Caught a Bug? + +1. [Fork](https://help.github.com/articles/fork-a-repo/) this repository to your own GitHub account and then [clone](https://help.github.com/articles/cloning-a-repository/) it to your local device +2. Link the package to the global module directory: `npm link` +3. Within the module you want to test your local development instance of ms, just link it to the dependencies: `npm link ms`. Instead of the default one from npm, Node.js will now use your clone of ms! + +As always, you can run the tests using: `npm test` diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/package.json new file mode 100644 index 00000000..0b0256f6 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/package.json @@ -0,0 +1,96 @@ +{ + "_from": "agent-base@6", + "_id": "agent-base@6.0.2", + "_inBundle": false, + "_integrity": "sha512-RZNwNclF7+MS/8bDg70amg32dyeZGZxiDuQmZxKLAlQjr3jGyLx+4Kkk58UO7D2QdgFIQCovuSuZESne6RG6XQ==", + "_location": "/agent-base", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "agent-base@6", + "name": "agent-base", + "escapedName": "agent-base", + "rawSpec": "6", + "saveSpec": null, + "fetchSpec": "6" + }, + "_requiredBy": [ + "/http-proxy-agent", + "/https-proxy-agent", + "/socks-proxy-agent" + ], + "_resolved": "https://registry.npmjs.org/agent-base/-/agent-base-6.0.2.tgz", + "_shasum": "49fff58577cfee3f37176feab4c22e00f86d7f77", + "_spec": "agent-base@6", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\https-proxy-agent", + "author": { + "name": "Nathan Rajlich", + "email": "nathan@tootallnate.net", + "url": "http://n8.io/" + }, + "bugs": { + "url": "https://github.com/TooTallNate/node-agent-base/issues" + }, + "bundleDependencies": false, + "dependencies": { + "debug": "4" + }, + "deprecated": false, + "description": "Turn a function into an `http.Agent` instance", + "devDependencies": { + "@types/debug": "4", + "@types/mocha": "^5.2.7", + "@types/node": "^14.0.20", + "@types/semver": "^7.1.0", + "@types/ws": "^6.0.3", + "@typescript-eslint/eslint-plugin": "1.6.0", + "@typescript-eslint/parser": "1.1.0", + "async-listen": "^1.2.0", + "cpy-cli": "^2.0.0", + "eslint": "5.16.0", + "eslint-config-airbnb": "17.1.0", + "eslint-config-prettier": "4.1.0", + "eslint-import-resolver-typescript": "1.1.1", + "eslint-plugin-import": "2.16.0", + "eslint-plugin-jsx-a11y": "6.2.1", + "eslint-plugin-react": "7.12.4", + "mocha": "^6.2.0", + "rimraf": "^3.0.0", + "semver": "^7.1.2", + "typescript": "^3.5.3", + "ws": "^3.0.0" + }, + "engines": { + "node": ">= 6.0.0" + }, + "files": [ + "dist/src", + "src" + ], + "homepage": "https://github.com/TooTallNate/node-agent-base#readme", + "keywords": [ + "http", + "agent", + "base", + "barebones", + "https" + ], + "license": "MIT", + "main": "dist/src/index", + "name": "agent-base", + "repository": { + "type": "git", + "url": "git://github.com/TooTallNate/node-agent-base.git" + }, + "scripts": { + "build": "tsc", + "postbuild": "cpy --parents src test '!**/*.ts' dist", + "prebuild": "rimraf dist", + "prepublishOnly": "npm run build", + "test": "mocha --reporter spec dist/test/*.js", + "test-lint": "eslint src --ext .js,.ts" + }, + "typings": "dist/src/index", + "version": "6.0.2" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/src/index.ts b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/src/index.ts new file mode 100644 index 00000000..a47ccd49 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/src/index.ts @@ -0,0 +1,345 @@ +import net from 'net'; +import http from 'http'; +import https from 'https'; +import { Duplex } from 'stream'; +import { EventEmitter } from 'events'; +import createDebug from 'debug'; +import promisify from './promisify'; + +const debug = createDebug('agent-base'); + +function isAgent(v: any): v is createAgent.AgentLike { + return Boolean(v) && typeof v.addRequest === 'function'; +} + +function isSecureEndpoint(): boolean { + const { stack } = new Error(); + if (typeof stack !== 'string') return false; + return stack.split('\n').some(l => l.indexOf('(https.js:') !== -1 || l.indexOf('node:https:') !== -1); +} + +function createAgent(opts?: createAgent.AgentOptions): createAgent.Agent; +function createAgent( + callback: createAgent.AgentCallback, + opts?: createAgent.AgentOptions +): createAgent.Agent; +function createAgent( + callback?: createAgent.AgentCallback | createAgent.AgentOptions, + opts?: createAgent.AgentOptions +) { + return new createAgent.Agent(callback, opts); +} + +namespace createAgent { + export interface ClientRequest extends http.ClientRequest { + _last?: boolean; + _hadError?: boolean; + method: string; + } + + export interface AgentRequestOptions { + host?: string; + path?: string; + // `port` on `http.RequestOptions` can be a string or undefined, + // but `net.TcpNetConnectOpts` expects only a number + port: number; + } + + export interface HttpRequestOptions + extends AgentRequestOptions, + Omit { + secureEndpoint: false; + } + + export interface HttpsRequestOptions + extends AgentRequestOptions, + Omit { + secureEndpoint: true; + } + + export type RequestOptions = HttpRequestOptions | HttpsRequestOptions; + + export type AgentLike = Pick | http.Agent; + + export type AgentCallbackReturn = Duplex | AgentLike; + + export type AgentCallbackCallback = ( + err?: Error | null, + socket?: createAgent.AgentCallbackReturn + ) => void; + + export type AgentCallbackPromise = ( + req: createAgent.ClientRequest, + opts: createAgent.RequestOptions + ) => + | createAgent.AgentCallbackReturn + | Promise; + + export type AgentCallback = typeof Agent.prototype.callback; + + export type AgentOptions = { + timeout?: number; + }; + + /** + * Base `http.Agent` implementation. + * No pooling/keep-alive is implemented by default. + * + * @param {Function} callback + * @api public + */ + export class Agent extends EventEmitter { + public timeout: number | null; + public maxFreeSockets: number; + public maxTotalSockets: number; + public maxSockets: number; + public sockets: { + [key: string]: net.Socket[]; + }; + public freeSockets: { + [key: string]: net.Socket[]; + }; + public requests: { + [key: string]: http.IncomingMessage[]; + }; + public options: https.AgentOptions; + private promisifiedCallback?: createAgent.AgentCallbackPromise; + private explicitDefaultPort?: number; + private explicitProtocol?: string; + + constructor( + callback?: createAgent.AgentCallback | createAgent.AgentOptions, + _opts?: createAgent.AgentOptions + ) { + super(); + + let opts = _opts; + if (typeof callback === 'function') { + this.callback = callback; + } else if (callback) { + opts = callback; + } + + // Timeout for the socket to be returned from the callback + this.timeout = null; + if (opts && typeof opts.timeout === 'number') { + this.timeout = opts.timeout; + } + + // These aren't actually used by `agent-base`, but are required + // for the TypeScript definition files in `@types/node` :/ + this.maxFreeSockets = 1; + this.maxSockets = 1; + this.maxTotalSockets = Infinity; + this.sockets = {}; + this.freeSockets = {}; + this.requests = {}; + this.options = {}; + } + + get defaultPort(): number { + if (typeof this.explicitDefaultPort === 'number') { + return this.explicitDefaultPort; + } + return isSecureEndpoint() ? 443 : 80; + } + + set defaultPort(v: number) { + this.explicitDefaultPort = v; + } + + get protocol(): string { + if (typeof this.explicitProtocol === 'string') { + return this.explicitProtocol; + } + return isSecureEndpoint() ? 'https:' : 'http:'; + } + + set protocol(v: string) { + this.explicitProtocol = v; + } + + callback( + req: createAgent.ClientRequest, + opts: createAgent.RequestOptions, + fn: createAgent.AgentCallbackCallback + ): void; + callback( + req: createAgent.ClientRequest, + opts: createAgent.RequestOptions + ): + | createAgent.AgentCallbackReturn + | Promise; + callback( + req: createAgent.ClientRequest, + opts: createAgent.AgentOptions, + fn?: createAgent.AgentCallbackCallback + ): + | createAgent.AgentCallbackReturn + | Promise + | void { + throw new Error( + '"agent-base" has no default implementation, you must subclass and override `callback()`' + ); + } + + /** + * Called by node-core's "_http_client.js" module when creating + * a new HTTP request with this Agent instance. + * + * @api public + */ + addRequest(req: ClientRequest, _opts: RequestOptions): void { + const opts: RequestOptions = { ..._opts }; + + if (typeof opts.secureEndpoint !== 'boolean') { + opts.secureEndpoint = isSecureEndpoint(); + } + + if (opts.host == null) { + opts.host = 'localhost'; + } + + if (opts.port == null) { + opts.port = opts.secureEndpoint ? 443 : 80; + } + + if (opts.protocol == null) { + opts.protocol = opts.secureEndpoint ? 'https:' : 'http:'; + } + + if (opts.host && opts.path) { + // If both a `host` and `path` are specified then it's most + // likely the result of a `url.parse()` call... we need to + // remove the `path` portion so that `net.connect()` doesn't + // attempt to open that as a unix socket file. + delete opts.path; + } + + delete opts.agent; + delete opts.hostname; + delete opts._defaultAgent; + delete opts.defaultPort; + delete opts.createConnection; + + // Hint to use "Connection: close" + // XXX: non-documented `http` module API :( + req._last = true; + req.shouldKeepAlive = false; + + let timedOut = false; + let timeoutId: ReturnType | null = null; + const timeoutMs = opts.timeout || this.timeout; + + const onerror = (err: NodeJS.ErrnoException) => { + if (req._hadError) return; + req.emit('error', err); + // For Safety. Some additional errors might fire later on + // and we need to make sure we don't double-fire the error event. + req._hadError = true; + }; + + const ontimeout = () => { + timeoutId = null; + timedOut = true; + const err: NodeJS.ErrnoException = new Error( + `A "socket" was not created for HTTP request before ${timeoutMs}ms` + ); + err.code = 'ETIMEOUT'; + onerror(err); + }; + + const callbackError = (err: NodeJS.ErrnoException) => { + if (timedOut) return; + if (timeoutId !== null) { + clearTimeout(timeoutId); + timeoutId = null; + } + onerror(err); + }; + + const onsocket = (socket: AgentCallbackReturn) => { + if (timedOut) return; + if (timeoutId != null) { + clearTimeout(timeoutId); + timeoutId = null; + } + + if (isAgent(socket)) { + // `socket` is actually an `http.Agent` instance, so + // relinquish responsibility for this `req` to the Agent + // from here on + debug( + 'Callback returned another Agent instance %o', + socket.constructor.name + ); + (socket as createAgent.Agent).addRequest(req, opts); + return; + } + + if (socket) { + socket.once('free', () => { + this.freeSocket(socket as net.Socket, opts); + }); + req.onSocket(socket as net.Socket); + return; + } + + const err = new Error( + `no Duplex stream was returned to agent-base for \`${req.method} ${req.path}\`` + ); + onerror(err); + }; + + if (typeof this.callback !== 'function') { + onerror(new Error('`callback` is not defined')); + return; + } + + if (!this.promisifiedCallback) { + if (this.callback.length >= 3) { + debug('Converting legacy callback function to promise'); + this.promisifiedCallback = promisify(this.callback); + } else { + this.promisifiedCallback = this.callback; + } + } + + if (typeof timeoutMs === 'number' && timeoutMs > 0) { + timeoutId = setTimeout(ontimeout, timeoutMs); + } + + if ('port' in opts && typeof opts.port !== 'number') { + opts.port = Number(opts.port); + } + + try { + debug( + 'Resolving socket for %o request: %o', + opts.protocol, + `${req.method} ${req.path}` + ); + Promise.resolve(this.promisifiedCallback(req, opts)).then( + onsocket, + callbackError + ); + } catch (err) { + Promise.reject(err).catch(callbackError); + } + } + + freeSocket(socket: net.Socket, opts: AgentOptions) { + debug('Freeing socket %o %o', socket.constructor.name, opts); + socket.destroy(); + } + + destroy() { + debug('Destroying agent %o', this.constructor.name); + } + } + + // So that `instanceof` works correctly + createAgent.prototype = createAgent.Agent.prototype; +} + +export = createAgent; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/src/promisify.ts b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/src/promisify.ts new file mode 100644 index 00000000..60cc6627 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agent-base/src/promisify.ts @@ -0,0 +1,33 @@ +import { + Agent, + ClientRequest, + RequestOptions, + AgentCallbackCallback, + AgentCallbackPromise, + AgentCallbackReturn +} from './index'; + +type LegacyCallback = ( + req: ClientRequest, + opts: RequestOptions, + fn: AgentCallbackCallback +) => void; + +export default function promisify(fn: LegacyCallback): AgentCallbackPromise { + return function(this: Agent, req: ClientRequest, opts: RequestOptions) { + return new Promise((resolve, reject) => { + fn.call( + this, + req, + opts, + (err: Error | null | undefined, rtn?: AgentCallbackReturn) => { + if (err) { + reject(err); + } else { + resolve(rtn); + } + } + ); + }); + }; +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/History.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/History.md new file mode 100644 index 00000000..9db6e557 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/History.md @@ -0,0 +1,248 @@ + +4.2.1 / 2022-02-21 +================== + +**fixes** + * [[`8b13b5c`](http://github.com/node-modules/agentkeepalive/commit/8b13b5ca797f4779a0a8d393ad8ecb622cd27987)] - fix: explicitly set `| undefined` in type definitions (#99) (Benoit Lemoine <>) + +4.2.0 / 2021-12-31 +================== + +**fixes** + * [[`f418c67`](http://github.com/node-modules/agentkeepalive/commit/f418c67a63c061c7261592d4553bc455e0b0d306)] - fix: change `freeSocketTimeout` default value to 4000 (#102) (fengmk2 <>) + +**others** + * [[`bc2a1ce`](http://github.com/node-modules/agentkeepalive/commit/bc2a1cea0884b4d18b0d244bf00006d9107963df)] - doc(readme): making `timeout`'s default clear (#100) (Aaron <>) + +4.1.4 / 2021-02-05 +================== + +**fixes** + * [[`4d04794`](http://github.com/node-modules/agentkeepalive/commit/4d047946b1547b4edff92ea40205aee4f0c8aa46)] - fix(types): correct `Https` constructor argument (#89) (Simen Bekkhus <>) + +4.1.3 / 2020-06-15 +================== + +**fixes** + * [[`4ba9f9c`](http://github.com/node-modules/agentkeepalive/commit/4ba9f9c844f2a6b8037ce56599d25c69ef054d91)] - fix: compatible with node v12.16.3 (#91) (killa <>) + +4.1.2 / 2020-04-25 +================== + +**fixes** + * [[`de66b02`](http://github.com/node-modules/agentkeepalive/commit/de66b0206d064a97129c2c31bcdabd4d64557b91)] - fix: detect http request timeout handler (#88) (fengmk2 <>) + +4.1.1 / 2020-04-25 +================== + +**fixes** + * [[`bbd20c0`](http://github.com/node-modules/agentkeepalive/commit/bbd20c03b8cf7dfb00b3aad1ada26d4ab90d2d6e)] - fix: definition error (#87) (吖猩 <>) + +**others** + * [[`3b01699`](http://github.com/node-modules/agentkeepalive/commit/3b01699b8e90022d5f56898dd709e4fe7ee7cdaa)] - test: run test on node 12 (#84) (Igor Savin <>) + +4.1.0 / 2019-10-12 +================== + +**features** + * [[`fe33b80`](http://github.com/node-modules/agentkeepalive/commit/fe33b800acc09109388bfe65107550952b6fc7b0)] - feat: Add `reusedSocket` property on client request (#82) (Weijia Wang <>) + +**others** + * [[`77ba744`](http://github.com/node-modules/agentkeepalive/commit/77ba744667bb6b9e5986a53e5222f62094db12b9)] - docs: fix grammar in readme (#81) (Herrington Darkholme <<2883231+HerringtonDarkholme@users.noreply.github.com>>) + +4.0.2 / 2019-02-19 +================== + +**fixes** + * [[`56d4a9b`](http://github.com/node-modules/agentkeepalive/commit/56d4a9b2a4499ea28943ddb590358d7831a02cb1)] - fix: HttpAgent export = internal (#74) (Andrew Leedham <>) + +4.0.1 / 2019-02-19 +================== + +**fixes** + * [[`bad1ac0`](http://github.com/node-modules/agentkeepalive/commit/bad1ac0e710fbc486717e14e68c59266d35df6a8)] - fix: HttpsAgent Type Definition (#71) (#72) (Andrew Leedham <>) + * [[`f48a4a7`](http://github.com/node-modules/agentkeepalive/commit/f48a4a701ea6fbe43781c91e1c0aaad6e328ac7f)] - fix: export interface (#70) (Vinay <>) + +**others** + * [[`9124343`](http://github.com/node-modules/agentkeepalive/commit/91243437cfdd324cb97f39dee76746d5e5f4cd72)] - chore: add agent.options.keepAlive instead agent.keepAlive (fengmk2 <>) + * [[`d177d40`](http://github.com/node-modules/agentkeepalive/commit/d177d40422fe7296990b4e270cf498e3f33c18fa)] - test: add request timeout bigger than agent timeout cases (fengmk2 <>) + +4.0.0 / 2018-10-23 +================== + +**features** + * [[`5c9f3bb`](http://github.com/node-modules/agentkeepalive/commit/5c9f3bbd60555744edcf777105b148982a1a42b6)] - feat: impl the new Agent extend http.Agent (fengmk2 <>) + +**others** + * [[`498c8f1`](http://github.com/node-modules/agentkeepalive/commit/498c8f13cf76600d3dd6e1c91cdf2d8292355dff)] - chore: move LICENSE from readme to file (fengmk2 <>) + * [[`4f39894`](http://github.com/node-modules/agentkeepalive/commit/4f398942ba2f90cf4501239e56ac4e6344931a01)] - bugfix: support agent.options.timeout on https agent (fengmk2 <>) + +3.5.2 / 2018-10-19 +================== + +**fixes** + * [[`5751fc1`](http://github.com/node-modules/agentkeepalive/commit/5751fc1180ed6544602c681ffbd08ca66a0cb12c)] - fix: sockLen being miscalculated when removing sockets (#60) (Ehden Sinai <>) + +3.5.1 / 2018-07-31 +================== + +**fixes** + * [[`495f1ab`](http://github.com/node-modules/agentkeepalive/commit/495f1ab625d43945d72f68096b97db723d4f0657)] - fix: add the lost npm files (#66) (Henry Zhuang <>) + +3.5.0 / 2018-07-31 +================== + +**features** + * [[`16f5aea`](http://github.com/node-modules/agentkeepalive/commit/16f5aeadfda57f1c602652f1472a63cc83cd05bf)] - feat: add typing define. (#65) (Henry Zhuang <>) + +**others** + * [[`28fa062`](http://github.com/node-modules/agentkeepalive/commit/28fa06246fb5103f88ebeeb8563757a9078b8157)] - docs: add "per host" to description of maxFreeSockets (tony-gutierrez <>) + * [[`7df2577`](http://github.com/node-modules/agentkeepalive/commit/7df25774f00a1031ca4daad2878a17e0539072a2)] - test: run test on node 10 (#63) (fengmk2 <>) + +3.4.1 / 2018-03-08 +================== + +**fixes** + * [[`4d3a3b1`](http://github.com/node-modules/agentkeepalive/commit/4d3a3b1f7b16595febbbd39eeed72b2663549014)] - fix: Handle ipv6 addresses in host-header correctly with TLS (#53) (Mattias Holmlund <>) + +**others** + * [[`55a7a5c`](http://github.com/node-modules/agentkeepalive/commit/55a7a5cd33e97f9a8370083dcb041c5552f10ac9)] - test: stop timer after test end (fengmk2 <>) + +3.4.0 / 2018-02-27 +================== + +**features** + * [[`bc7cadb`](http://github.com/node-modules/agentkeepalive/commit/bc7cadb30ecd2071e2b341ac53ae1a2b8155c43d)] - feat: use socket custom freeSocketKeepAliveTimeout first (#59) (fengmk2 <>) + +**others** + * [[`138eda8`](http://github.com/node-modules/agentkeepalive/commit/138eda81e10b632aaa87bea0cb66d8667124c4e8)] - doc: fix `keepAliveMsecs` params description (#55) (Hongcai Deng <>) + +3.3.0 / 2017-06-20 +================== + + * feat: add statusChanged getter (#51) + * chore: format License + +3.2.0 / 2017-06-10 +================== + + * feat: add expiring active sockets + * test: add node 8 (#49) + +3.1.0 / 2017-02-20 +================== + + * feat: timeout support humanize ms (#48) + +3.0.0 / 2016-12-20 +================== + + * fix: emit agent socket close event + * test: add remove excess calls to removeSocket + * test: use egg-ci + * test: refactor test with eslint rules + * feat: merge _http_agent.js from 7.2.1 + +2.2.0 / 2016-06-26 +================== + + * feat: Add browser shim (noop) for isomorphic use. (#39) + * chore: add security check badge + +2.1.1 / 2016-04-06 +================== + + * https: fix ssl socket leak when keepalive is used + * chore: remove circle ci image + +2.1.0 / 2016-04-02 +================== + + * fix: opened sockets number overflow maxSockets + +2.0.5 / 2016-03-16 +================== + + * fix: pick _evictSession to httpsAgent + +2.0.4 / 2016-03-13 +================== + + * test: add Circle ci + * test: add appveyor ci build + * refactor: make sure only one error listener + * chore: use codecov + * fix: handle idle socket error + * test: run on more node versions + +2.0.3 / 2015-08-03 +================== + + * fix: add default error handler to avoid Unhandled error event throw + +2.0.2 / 2015-04-25 +================== + + * fix: remove socket from freeSockets on 'timeout' (@pmalouin) + +2.0.1 / 2015-04-19 +================== + + * fix: add timeoutSocketCount to getCurrentStatus() + * feat(getCurrentStatus): add getCurrentStatus + +2.0.0 / 2015-04-01 +================== + + * fix: socket.destroyed always be undefined on 0.10.x + * Make it compatible with node v0.10.x (@lattmann) + +1.2.1 / 2015-03-23 +================== + + * patch from iojs: don't overwrite servername option + * patch commits from joyent/node + * add max sockets test case + * add nagle algorithm delayed link + +1.2.0 / 2014-09-02 +================== + + * allow set keepAliveTimeout = 0 + * support timeout on working socket. fixed #6 + +1.1.0 / 2014-08-28 +================== + + * add some socket counter for deep monitor + +1.0.0 / 2014-08-13 +================== + + * update _http_agent, only support 0.11+, only support node 0.11.0+ + +0.2.2 / 2013-11-19 +================== + + * support node 0.8 and node 0.10 + +0.2.1 / 2013-11-08 +================== + + * fix socket does not timeout bug, it will hang on life, must use 0.2.x on node 0.11 + +0.2.0 / 2013-11-06 +================== + + * use keepalive agent on node 0.11+ impl + +0.1.5 / 2013-06-24 +================== + + * support coveralls + * add node 0.10 test + * add 0.8.22 original https.js + * add original http.js module to diff + * update jscover + * mv pem to fixtures + * add https agent usage diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/LICENSE b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/LICENSE new file mode 100644 index 00000000..941258ca --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/LICENSE @@ -0,0 +1,23 @@ +The MIT License + +Copyright(c) node-modules and other contributors. +Copyright(c) 2012 - 2015 fengmk2 + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/README.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/README.md new file mode 100644 index 00000000..137935c1 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/README.md @@ -0,0 +1,246 @@ +# agentkeepalive + +[![NPM version][npm-image]][npm-url] +[![Known Vulnerabilities][snyk-image]][snyk-url] +[![Node.js CI](https://github.com/node-modules/agentkeepalive/actions/workflows/nodejs.yml/badge.svg)](https://github.com/node-modules/agentkeepalive/actions/workflows/nodejs.yml) +[![npm download][download-image]][download-url] + +[npm-image]: https://img.shields.io/npm/v/agentkeepalive.svg?style=flat +[npm-url]: https://npmjs.org/package/agentkeepalive +[snyk-image]: https://snyk.io/test/npm/agentkeepalive/badge.svg?style=flat-square +[snyk-url]: https://snyk.io/test/npm/agentkeepalive +[download-image]: https://img.shields.io/npm/dm/agentkeepalive.svg?style=flat-square +[download-url]: https://npmjs.org/package/agentkeepalive + +The enhancement features `keep alive` `http.Agent`. Support `http` and `https`. + +## What's different from original `http.Agent`? + +- `keepAlive=true` by default +- Disable Nagle's algorithm: `socket.setNoDelay(true)` +- Add free socket timeout: avoid long time inactivity socket leak in the free-sockets queue. +- Add active socket timeout: avoid long time inactivity socket leak in the active-sockets queue. +- TTL for active socket. + +## Node.js version required + +Support Node.js >= `8.0.0` + +## Install + +```bash +$ npm install agentkeepalive --save +``` + +## new Agent([options]) + +* `options` {Object} Set of configurable options to set on the agent. + Can have the following fields: + * `keepAlive` {Boolean} Keep sockets around in a pool to be used by + other requests in the future. Default = `true`. + * `keepAliveMsecs` {Number} When using the keepAlive option, specifies the initial delay + for TCP Keep-Alive packets. Ignored when the keepAlive option is false or undefined. Defaults to 1000. + Default = `1000`. Only relevant if `keepAlive` is set to `true`. + * `freeSocketTimeout`: {Number} Sets the free socket to timeout + after `freeSocketTimeout` milliseconds of inactivity on the free socket. + The default [server-side timeout](https://nodejs.org/api/http.html#serverkeepalivetimeout) is 5000 milliseconds, to [avoid ECONNRESET exceptions](https://medium.com/ssense-tech/reduce-networking-errors-in-nodejs-23b4eb9f2d83), we set the default value to `4000` milliseconds. + Only relevant if `keepAlive` is set to `true`. + * `timeout`: {Number} Sets the working socket to timeout + after `timeout` milliseconds of inactivity on the working socket. + Default is `freeSocketTimeout * 2` so long as that value is greater than or equal to 8 seconds, otherwise the default is 8 seconds. + * `maxSockets` {Number} Maximum number of sockets to allow per + host. Default = `Infinity`. + * `maxFreeSockets` {Number} Maximum number of sockets (per host) to leave open + in a free state. Only relevant if `keepAlive` is set to `true`. + Default = `256`. + * `socketActiveTTL` {Number} Sets the socket active time to live, even if it's in use. + If not set, the behaviour keeps the same (the socket will be released only when free) + Default = `null`. + +## Usage + +```js +const http = require('http'); +const Agent = require('agentkeepalive'); + +const keepaliveAgent = new Agent({ + maxSockets: 100, + maxFreeSockets: 10, + timeout: 60000, // active socket keepalive for 60 seconds + freeSocketTimeout: 30000, // free socket keepalive for 30 seconds +}); + +const options = { + host: 'cnodejs.org', + port: 80, + path: '/', + method: 'GET', + agent: keepaliveAgent, +}; + +const req = http.request(options, res => { + console.log('STATUS: ' + res.statusCode); + console.log('HEADERS: ' + JSON.stringify(res.headers)); + res.setEncoding('utf8'); + res.on('data', function (chunk) { + console.log('BODY: ' + chunk); + }); +}); +req.on('error', e => { + console.log('problem with request: ' + e.message); +}); +req.end(); + +setTimeout(() => { + if (keepaliveAgent.statusChanged) { + console.log('[%s] agent status changed: %j', Date(), keepaliveAgent.getCurrentStatus()); + } +}, 2000); + +``` + +### `getter agent.statusChanged` + +counters have change or not after last checkpoint. + +### `agent.getCurrentStatus()` + +`agent.getCurrentStatus()` will return a object to show the status of this agent: + +```js +{ + createSocketCount: 10, + closeSocketCount: 5, + timeoutSocketCount: 0, + requestCount: 5, + freeSockets: { 'localhost:57479:': 3 }, + sockets: { 'localhost:57479:': 5 }, + requests: {} +} +``` + +### Support `https` + +```js +const https = require('https'); +const HttpsAgent = require('agentkeepalive').HttpsAgent; + +const keepaliveAgent = new HttpsAgent(); +// https://www.google.com/search?q=nodejs&sugexp=chrome,mod=12&sourceid=chrome&ie=UTF-8 +const options = { + host: 'www.google.com', + port: 443, + path: '/search?q=nodejs&sugexp=chrome,mod=12&sourceid=chrome&ie=UTF-8', + method: 'GET', + agent: keepaliveAgent, +}; + +const req = https.request(options, res => { + console.log('STATUS: ' + res.statusCode); + console.log('HEADERS: ' + JSON.stringify(res.headers)); + res.setEncoding('utf8'); + res.on('data', chunk => { + console.log('BODY: ' + chunk); + }); +}); + +req.on('error', e => { + console.log('problem with request: ' + e.message); +}); +req.end(); + +setTimeout(() => { + console.log('agent status: %j', keepaliveAgent.getCurrentStatus()); +}, 2000); +``` + +### Support `req.reusedSocket` + +This agent implements the `req.reusedSocket` to determine whether a request is send through a reused socket. + +When server closes connection at unfortunate time ([keep-alive race](https://code-examples.net/en/q/28a8069)), the http client will throw a `ECONNRESET` error. Under this circumstance, `req.reusedSocket` is useful when we want to retry the request automatically. + +```js +const http = require('http'); +const Agent = require('agentkeepalive'); +const agent = new Agent(); + +const req = http + .get('http://localhost:3000', { agent }, (res) => { + // ... + }) + .on('error', (err) => { + if (req.reusedSocket && err.code === 'ECONNRESET') { + // retry the request or anything else... + } + }) +``` + +This behavior is consistent with Node.js core. But through `agentkeepalive`, you can use this feature in older Node.js version. + +## [Benchmark](https://github.com/node-modules/agentkeepalive/tree/master/benchmark) + +run the benchmark: + +```bash +cd benchmark +sh start.sh +``` + +Intel(R) Core(TM)2 Duo CPU P8600 @ 2.40GHz + +node@v0.8.9 + +50 maxSockets, 60 concurrent, 1000 requests per concurrent, 5ms delay + +Keep alive agent (30 seconds): + +```js +Transactions: 60000 hits +Availability: 100.00 % +Elapsed time: 29.70 secs +Data transferred: 14.88 MB +Response time: 0.03 secs +Transaction rate: 2020.20 trans/sec +Throughput: 0.50 MB/sec +Concurrency: 59.84 +Successful transactions: 60000 +Failed transactions: 0 +Longest transaction: 0.15 +Shortest transaction: 0.01 +``` + +Normal agent: + +```js +Transactions: 60000 hits +Availability: 100.00 % +Elapsed time: 46.53 secs +Data transferred: 14.88 MB +Response time: 0.05 secs +Transaction rate: 1289.49 trans/sec +Throughput: 0.32 MB/sec +Concurrency: 59.81 +Successful transactions: 60000 +Failed transactions: 0 +Longest transaction: 0.45 +Shortest transaction: 0.00 +``` + +Socket created: + +```bash +[proxy.js:120000] keepalive, 50 created, 60000 requestFinished, 1200 req/socket, 0 requests, 0 sockets, 0 unusedSockets, 50 timeout +{" <10ms":662," <15ms":17825," <20ms":20552," <30ms":17646," <40ms":2315," <50ms":567," <100ms":377," <150ms":56," <200ms":0," >=200ms+":0} +---------------------------------------------------------------- +[proxy.js:120000] normal , 53866 created, 84260 requestFinished, 1.56 req/socket, 0 requests, 0 sockets +{" <10ms":75," <15ms":1112," <20ms":10947," <30ms":32130," <40ms":8228," <50ms":3002," <100ms":4274," <150ms":181," <200ms":18," >=200ms+":33} +``` + +## License + +[MIT](LICENSE) + +## Contributors + +[![](https://ergatejs.implements.io/badges/contributors/node-modules/agentkeepalive.svg?size=96)](https://github.com/node-modules/agentkeepalive/graphs/contributors) diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/browser.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/browser.js new file mode 100644 index 00000000..29c9398a --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/browser.js @@ -0,0 +1,5 @@ +module.exports = noop; +module.exports.HttpsAgent = noop; + +// Noop function for browser since native api's don't use agents. +function noop () {} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/index.d.ts b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/index.d.ts new file mode 100644 index 00000000..c2ce7d20 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/index.d.ts @@ -0,0 +1,62 @@ +import * as http from 'http'; +import * as https from 'https'; + +interface PlainObject { + [key: string]: any; +} + +declare class HttpAgent extends http.Agent { + constructor(opts?: AgentKeepAlive.HttpOptions); + readonly statusChanged: boolean; + createSocket(req: http.IncomingMessage, options: http.RequestOptions, cb: Function): void; + getCurrentStatus(): AgentKeepAlive.AgentStatus; +} + +interface Constants { + CURRENT_ID: Symbol; + CREATE_ID: Symbol; + INIT_SOCKET: Symbol; + CREATE_HTTPS_CONNECTION: Symbol; + SOCKET_CREATED_TIME: Symbol; + SOCKET_NAME: Symbol; + SOCKET_REQUEST_COUNT: Symbol; + SOCKET_REQUEST_FINISHED_COUNT: Symbol; +} + +declare class AgentKeepAlive extends HttpAgent {} + +declare namespace AgentKeepAlive { + export interface AgentStatus { + createSocketCount: number; + createSocketErrorCount: number; + closeSocketCount: number; + errorSocketCount: number; + timeoutSocketCount: number; + requestCount: number; + freeSockets: PlainObject; + sockets: PlainObject; + requests: PlainObject; + } + + interface CommonHttpOption { + keepAlive?: boolean | undefined; + freeSocketTimeout?: number | undefined; + freeSocketKeepAliveTimeout?: number | undefined; + timeout?: number | undefined; + socketActiveTTL?: number | undefined; + } + + export interface HttpOptions extends http.AgentOptions, CommonHttpOption { } + export interface HttpsOptions extends https.AgentOptions, CommonHttpOption { } + + export class HttpsAgent extends https.Agent { + constructor(opts?: HttpsOptions); + readonly statusChanged: boolean; + createSocket(req: http.IncomingMessage, options: http.RequestOptions, cb: Function): void; + getCurrentStatus(): AgentStatus; + } + + export const constants: Constants; +} + +export = AgentKeepAlive; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/index.js new file mode 100644 index 00000000..6ca15134 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = require('./lib/agent'); +module.exports.HttpsAgent = require('./lib/https_agent'); +module.exports.constants = require('./lib/constants'); diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/lib/agent.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/lib/agent.js new file mode 100644 index 00000000..a7065b5e --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/lib/agent.js @@ -0,0 +1,398 @@ +'use strict'; + +const OriginalAgent = require('http').Agent; +const ms = require('humanize-ms'); +const debug = require('debug')('agentkeepalive'); +const deprecate = require('depd')('agentkeepalive'); +const { + INIT_SOCKET, + CURRENT_ID, + CREATE_ID, + SOCKET_CREATED_TIME, + SOCKET_NAME, + SOCKET_REQUEST_COUNT, + SOCKET_REQUEST_FINISHED_COUNT, +} = require('./constants'); + +// OriginalAgent come from +// - https://github.com/nodejs/node/blob/v8.12.0/lib/_http_agent.js +// - https://github.com/nodejs/node/blob/v10.12.0/lib/_http_agent.js + +// node <= 10 +let defaultTimeoutListenerCount = 1; +const majorVersion = parseInt(process.version.split('.', 1)[0].substring(1)); +if (majorVersion >= 11 && majorVersion <= 12) { + defaultTimeoutListenerCount = 2; +} else if (majorVersion >= 13) { + defaultTimeoutListenerCount = 3; +} + +class Agent extends OriginalAgent { + constructor(options) { + options = options || {}; + options.keepAlive = options.keepAlive !== false; + // default is keep-alive and 4s free socket timeout + // see https://medium.com/ssense-tech/reduce-networking-errors-in-nodejs-23b4eb9f2d83 + if (options.freeSocketTimeout === undefined) { + options.freeSocketTimeout = 4000; + } + // Legacy API: keepAliveTimeout should be rename to `freeSocketTimeout` + if (options.keepAliveTimeout) { + deprecate('options.keepAliveTimeout is deprecated, please use options.freeSocketTimeout instead'); + options.freeSocketTimeout = options.keepAliveTimeout; + delete options.keepAliveTimeout; + } + // Legacy API: freeSocketKeepAliveTimeout should be rename to `freeSocketTimeout` + if (options.freeSocketKeepAliveTimeout) { + deprecate('options.freeSocketKeepAliveTimeout is deprecated, please use options.freeSocketTimeout instead'); + options.freeSocketTimeout = options.freeSocketKeepAliveTimeout; + delete options.freeSocketKeepAliveTimeout; + } + + // Sets the socket to timeout after timeout milliseconds of inactivity on the socket. + // By default is double free socket timeout. + if (options.timeout === undefined) { + // make sure socket default inactivity timeout >= 8s + options.timeout = Math.max(options.freeSocketTimeout * 2, 8000); + } + + // support humanize format + options.timeout = ms(options.timeout); + options.freeSocketTimeout = ms(options.freeSocketTimeout); + options.socketActiveTTL = options.socketActiveTTL ? ms(options.socketActiveTTL) : 0; + + super(options); + + this[CURRENT_ID] = 0; + + // create socket success counter + this.createSocketCount = 0; + this.createSocketCountLastCheck = 0; + + this.createSocketErrorCount = 0; + this.createSocketErrorCountLastCheck = 0; + + this.closeSocketCount = 0; + this.closeSocketCountLastCheck = 0; + + // socket error event count + this.errorSocketCount = 0; + this.errorSocketCountLastCheck = 0; + + // request finished counter + this.requestCount = 0; + this.requestCountLastCheck = 0; + + // including free socket timeout counter + this.timeoutSocketCount = 0; + this.timeoutSocketCountLastCheck = 0; + + this.on('free', socket => { + // https://github.com/nodejs/node/pull/32000 + // Node.js native agent will check socket timeout eqs agent.options.timeout. + // Use the ttl or freeSocketTimeout to overwrite. + const timeout = this.calcSocketTimeout(socket); + if (timeout > 0 && socket.timeout !== timeout) { + socket.setTimeout(timeout); + } + }); + } + + get freeSocketKeepAliveTimeout() { + deprecate('agent.freeSocketKeepAliveTimeout is deprecated, please use agent.options.freeSocketTimeout instead'); + return this.options.freeSocketTimeout; + } + + get timeout() { + deprecate('agent.timeout is deprecated, please use agent.options.timeout instead'); + return this.options.timeout; + } + + get socketActiveTTL() { + deprecate('agent.socketActiveTTL is deprecated, please use agent.options.socketActiveTTL instead'); + return this.options.socketActiveTTL; + } + + calcSocketTimeout(socket) { + /** + * return <= 0: should free socket + * return > 0: should update socket timeout + * return undefined: not find custom timeout + */ + let freeSocketTimeout = this.options.freeSocketTimeout; + const socketActiveTTL = this.options.socketActiveTTL; + if (socketActiveTTL) { + // check socketActiveTTL + const aliveTime = Date.now() - socket[SOCKET_CREATED_TIME]; + const diff = socketActiveTTL - aliveTime; + if (diff <= 0) { + return diff; + } + if (freeSocketTimeout && diff < freeSocketTimeout) { + freeSocketTimeout = diff; + } + } + // set freeSocketTimeout + if (freeSocketTimeout) { + // set free keepalive timer + // try to use socket custom freeSocketTimeout first, support headers['keep-alive'] + // https://github.com/node-modules/urllib/blob/b76053020923f4d99a1c93cf2e16e0c5ba10bacf/lib/urllib.js#L498 + const customFreeSocketTimeout = socket.freeSocketTimeout || socket.freeSocketKeepAliveTimeout; + return customFreeSocketTimeout || freeSocketTimeout; + } + } + + keepSocketAlive(socket) { + const result = super.keepSocketAlive(socket); + // should not keepAlive, do nothing + if (!result) return result; + + const customTimeout = this.calcSocketTimeout(socket); + if (typeof customTimeout === 'undefined') { + return true; + } + if (customTimeout <= 0) { + debug('%s(requests: %s, finished: %s) free but need to destroy by TTL, request count %s, diff is %s', + socket[SOCKET_NAME], socket[SOCKET_REQUEST_COUNT], socket[SOCKET_REQUEST_FINISHED_COUNT], customTimeout); + return false; + } + if (socket.timeout !== customTimeout) { + socket.setTimeout(customTimeout); + } + return true; + } + + // only call on addRequest + reuseSocket(...args) { + // reuseSocket(socket, req) + super.reuseSocket(...args); + const socket = args[0]; + const req = args[1]; + req.reusedSocket = true; + const agentTimeout = this.options.timeout; + if (getSocketTimeout(socket) !== agentTimeout) { + // reset timeout before use + socket.setTimeout(agentTimeout); + debug('%s reset timeout to %sms', socket[SOCKET_NAME], agentTimeout); + } + socket[SOCKET_REQUEST_COUNT]++; + debug('%s(requests: %s, finished: %s) reuse on addRequest, timeout %sms', + socket[SOCKET_NAME], socket[SOCKET_REQUEST_COUNT], socket[SOCKET_REQUEST_FINISHED_COUNT], + getSocketTimeout(socket)); + } + + [CREATE_ID]() { + const id = this[CURRENT_ID]++; + if (this[CURRENT_ID] === Number.MAX_SAFE_INTEGER) this[CURRENT_ID] = 0; + return id; + } + + [INIT_SOCKET](socket, options) { + // bugfix here. + // https on node 8, 10 won't set agent.options.timeout by default + // TODO: need to fix on node itself + if (options.timeout) { + const timeout = getSocketTimeout(socket); + if (!timeout) { + socket.setTimeout(options.timeout); + } + } + + if (this.options.keepAlive) { + // Disable Nagle's algorithm: http://blog.caustik.com/2012/04/08/scaling-node-js-to-100k-concurrent-connections/ + // https://fengmk2.com/benchmark/nagle-algorithm-delayed-ack-mock.html + socket.setNoDelay(true); + } + this.createSocketCount++; + if (this.options.socketActiveTTL) { + socket[SOCKET_CREATED_TIME] = Date.now(); + } + // don't show the hole '-----BEGIN CERTIFICATE----' key string + socket[SOCKET_NAME] = `sock[${this[CREATE_ID]()}#${options._agentKey}]`.split('-----BEGIN', 1)[0]; + socket[SOCKET_REQUEST_COUNT] = 1; + socket[SOCKET_REQUEST_FINISHED_COUNT] = 0; + installListeners(this, socket, options); + } + + createConnection(options, oncreate) { + let called = false; + const onNewCreate = (err, socket) => { + if (called) return; + called = true; + + if (err) { + this.createSocketErrorCount++; + return oncreate(err); + } + this[INIT_SOCKET](socket, options); + oncreate(err, socket); + }; + + const newSocket = super.createConnection(options, onNewCreate); + if (newSocket) onNewCreate(null, newSocket); + } + + get statusChanged() { + const changed = this.createSocketCount !== this.createSocketCountLastCheck || + this.createSocketErrorCount !== this.createSocketErrorCountLastCheck || + this.closeSocketCount !== this.closeSocketCountLastCheck || + this.errorSocketCount !== this.errorSocketCountLastCheck || + this.timeoutSocketCount !== this.timeoutSocketCountLastCheck || + this.requestCount !== this.requestCountLastCheck; + if (changed) { + this.createSocketCountLastCheck = this.createSocketCount; + this.createSocketErrorCountLastCheck = this.createSocketErrorCount; + this.closeSocketCountLastCheck = this.closeSocketCount; + this.errorSocketCountLastCheck = this.errorSocketCount; + this.timeoutSocketCountLastCheck = this.timeoutSocketCount; + this.requestCountLastCheck = this.requestCount; + } + return changed; + } + + getCurrentStatus() { + return { + createSocketCount: this.createSocketCount, + createSocketErrorCount: this.createSocketErrorCount, + closeSocketCount: this.closeSocketCount, + errorSocketCount: this.errorSocketCount, + timeoutSocketCount: this.timeoutSocketCount, + requestCount: this.requestCount, + freeSockets: inspect(this.freeSockets), + sockets: inspect(this.sockets), + requests: inspect(this.requests), + }; + } +} + +// node 8 don't has timeout attribute on socket +// https://github.com/nodejs/node/pull/21204/files#diff-e6ef024c3775d787c38487a6309e491dR408 +function getSocketTimeout(socket) { + return socket.timeout || socket._idleTimeout; +} + +function installListeners(agent, socket, options) { + debug('%s create, timeout %sms', socket[SOCKET_NAME], getSocketTimeout(socket)); + + // listener socket events: close, timeout, error, free + function onFree() { + // create and socket.emit('free') logic + // https://github.com/nodejs/node/blob/master/lib/_http_agent.js#L311 + // no req on the socket, it should be the new socket + if (!socket._httpMessage && socket[SOCKET_REQUEST_COUNT] === 1) return; + + socket[SOCKET_REQUEST_FINISHED_COUNT]++; + agent.requestCount++; + debug('%s(requests: %s, finished: %s) free', + socket[SOCKET_NAME], socket[SOCKET_REQUEST_COUNT], socket[SOCKET_REQUEST_FINISHED_COUNT]); + + // should reuse on pedding requests? + const name = agent.getName(options); + if (socket.writable && agent.requests[name] && agent.requests[name].length) { + // will be reuse on agent free listener + socket[SOCKET_REQUEST_COUNT]++; + debug('%s(requests: %s, finished: %s) will be reuse on agent free event', + socket[SOCKET_NAME], socket[SOCKET_REQUEST_COUNT], socket[SOCKET_REQUEST_FINISHED_COUNT]); + } + } + socket.on('free', onFree); + + function onClose(isError) { + debug('%s(requests: %s, finished: %s) close, isError: %s', + socket[SOCKET_NAME], socket[SOCKET_REQUEST_COUNT], socket[SOCKET_REQUEST_FINISHED_COUNT], isError); + agent.closeSocketCount++; + } + socket.on('close', onClose); + + // start socket timeout handler + function onTimeout() { + // onTimeout and emitRequestTimeout(_http_client.js) + // https://github.com/nodejs/node/blob/v12.x/lib/_http_client.js#L711 + const listenerCount = socket.listeners('timeout').length; + // node <= 10, default listenerCount is 1, onTimeout + // 11 < node <= 12, default listenerCount is 2, onTimeout and emitRequestTimeout + // node >= 13, default listenerCount is 3, onTimeout, + // onTimeout(https://github.com/nodejs/node/pull/32000/files#diff-5f7fb0850412c6be189faeddea6c5359R333) + // and emitRequestTimeout + const timeout = getSocketTimeout(socket); + const req = socket._httpMessage; + const reqTimeoutListenerCount = req && req.listeners('timeout').length || 0; + debug('%s(requests: %s, finished: %s) timeout after %sms, listeners %s, defaultTimeoutListenerCount %s, hasHttpRequest %s, HttpRequest timeoutListenerCount %s', + socket[SOCKET_NAME], socket[SOCKET_REQUEST_COUNT], socket[SOCKET_REQUEST_FINISHED_COUNT], + timeout, listenerCount, defaultTimeoutListenerCount, !!req, reqTimeoutListenerCount); + if (debug.enabled) { + debug('timeout listeners: %s', socket.listeners('timeout').map(f => f.name).join(', ')); + } + agent.timeoutSocketCount++; + const name = agent.getName(options); + if (agent.freeSockets[name] && agent.freeSockets[name].indexOf(socket) !== -1) { + // free socket timeout, destroy quietly + socket.destroy(); + // Remove it from freeSockets list immediately to prevent new requests + // from being sent through this socket. + agent.removeSocket(socket, options); + debug('%s is free, destroy quietly', socket[SOCKET_NAME]); + } else { + // if there is no any request socket timeout handler, + // agent need to handle socket timeout itself. + // + // custom request socket timeout handle logic must follow these rules: + // 1. Destroy socket first + // 2. Must emit socket 'agentRemove' event tell agent remove socket + // from freeSockets list immediately. + // Otherise you may be get 'socket hang up' error when reuse + // free socket and timeout happen in the same time. + if (reqTimeoutListenerCount === 0) { + const error = new Error('Socket timeout'); + error.code = 'ERR_SOCKET_TIMEOUT'; + error.timeout = timeout; + // must manually call socket.end() or socket.destroy() to end the connection. + // https://nodejs.org/dist/latest-v10.x/docs/api/net.html#net_socket_settimeout_timeout_callback + socket.destroy(error); + agent.removeSocket(socket, options); + debug('%s destroy with timeout error', socket[SOCKET_NAME]); + } + } + } + socket.on('timeout', onTimeout); + + function onError(err) { + const listenerCount = socket.listeners('error').length; + debug('%s(requests: %s, finished: %s) error: %s, listenerCount: %s', + socket[SOCKET_NAME], socket[SOCKET_REQUEST_COUNT], socket[SOCKET_REQUEST_FINISHED_COUNT], + err, listenerCount); + agent.errorSocketCount++; + if (listenerCount === 1) { + // if socket don't contain error event handler, don't catch it, emit it again + debug('%s emit uncaught error event', socket[SOCKET_NAME]); + socket.removeListener('error', onError); + socket.emit('error', err); + } + } + socket.on('error', onError); + + function onRemove() { + debug('%s(requests: %s, finished: %s) agentRemove', + socket[SOCKET_NAME], + socket[SOCKET_REQUEST_COUNT], socket[SOCKET_REQUEST_FINISHED_COUNT]); + // We need this function for cases like HTTP 'upgrade' + // (defined by WebSockets) where we need to remove a socket from the + // pool because it'll be locked up indefinitely + socket.removeListener('close', onClose); + socket.removeListener('error', onError); + socket.removeListener('free', onFree); + socket.removeListener('timeout', onTimeout); + socket.removeListener('agentRemove', onRemove); + } + socket.on('agentRemove', onRemove); +} + +module.exports = Agent; + +function inspect(obj) { + const res = {}; + for (const key in obj) { + res[key] = obj[key].length; + } + return res; +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/lib/constants.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/lib/constants.js new file mode 100644 index 00000000..ca7ab97e --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/lib/constants.js @@ -0,0 +1,14 @@ +'use strict'; + +module.exports = { + // agent + CURRENT_ID: Symbol('agentkeepalive#currentId'), + CREATE_ID: Symbol('agentkeepalive#createId'), + INIT_SOCKET: Symbol('agentkeepalive#initSocket'), + CREATE_HTTPS_CONNECTION: Symbol('agentkeepalive#createHttpsConnection'), + // socket + SOCKET_CREATED_TIME: Symbol('agentkeepalive#socketCreatedTime'), + SOCKET_NAME: Symbol('agentkeepalive#socketName'), + SOCKET_REQUEST_COUNT: Symbol('agentkeepalive#socketRequestCount'), + SOCKET_REQUEST_FINISHED_COUNT: Symbol('agentkeepalive#socketRequestFinishedCount'), +}; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/lib/https_agent.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/lib/https_agent.js new file mode 100644 index 00000000..73f529d6 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/lib/https_agent.js @@ -0,0 +1,51 @@ +'use strict'; + +const OriginalHttpsAgent = require('https').Agent; +const HttpAgent = require('./agent'); +const { + INIT_SOCKET, + CREATE_HTTPS_CONNECTION, +} = require('./constants'); + +class HttpsAgent extends HttpAgent { + constructor(options) { + super(options); + + this.defaultPort = 443; + this.protocol = 'https:'; + this.maxCachedSessions = this.options.maxCachedSessions; + /* istanbul ignore next */ + if (this.maxCachedSessions === undefined) { + this.maxCachedSessions = 100; + } + + this._sessionCache = { + map: {}, + list: [], + }; + } + + createConnection(options) { + const socket = this[CREATE_HTTPS_CONNECTION](options); + this[INIT_SOCKET](socket, options); + return socket; + } +} + +// https://github.com/nodejs/node/blob/master/lib/https.js#L89 +HttpsAgent.prototype[CREATE_HTTPS_CONNECTION] = OriginalHttpsAgent.prototype.createConnection; + +[ + 'getName', + '_getSession', + '_cacheSession', + // https://github.com/nodejs/node/pull/4982 + '_evictSession', +].forEach(function(method) { + /* istanbul ignore next */ + if (typeof OriginalHttpsAgent.prototype[method] === 'function') { + HttpsAgent.prototype[method] = OriginalHttpsAgent.prototype[method]; + } +}); + +module.exports = HttpsAgent; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/debug/LICENSE b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/debug/LICENSE new file mode 100644 index 00000000..1a9820e2 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/debug/LICENSE @@ -0,0 +1,20 @@ +(The MIT License) + +Copyright (c) 2014-2017 TJ Holowaychuk +Copyright (c) 2018-2021 Josh Junon + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software +and associated documentation files (the 'Software'), to deal in the Software without restriction, +including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, +and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial +portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT +LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/debug/README.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/debug/README.md new file mode 100644 index 00000000..e9c3e047 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/debug/README.md @@ -0,0 +1,481 @@ +# debug +[![Build Status](https://travis-ci.org/debug-js/debug.svg?branch=master)](https://travis-ci.org/debug-js/debug) [![Coverage Status](https://coveralls.io/repos/github/debug-js/debug/badge.svg?branch=master)](https://coveralls.io/github/debug-js/debug?branch=master) [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers) +[![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors) + + + +A tiny JavaScript debugging utility modelled after Node.js core's debugging +technique. Works in Node.js and web browsers. + +## Installation + +```bash +$ npm install debug +``` + +## Usage + +`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole. + +Example [_app.js_](./examples/node/app.js): + +```js +var debug = require('debug')('http') + , http = require('http') + , name = 'My App'; + +// fake app + +debug('booting %o', name); + +http.createServer(function(req, res){ + debug(req.method + ' ' + req.url); + res.end('hello\n'); +}).listen(3000, function(){ + debug('listening'); +}); + +// fake worker of some kind + +require('./worker'); +``` + +Example [_worker.js_](./examples/node/worker.js): + +```js +var a = require('debug')('worker:a') + , b = require('debug')('worker:b'); + +function work() { + a('doing lots of uninteresting work'); + setTimeout(work, Math.random() * 1000); +} + +work(); + +function workb() { + b('doing some work'); + setTimeout(workb, Math.random() * 2000); +} + +workb(); +``` + +The `DEBUG` environment variable is then used to enable these based on space or +comma-delimited names. + +Here are some examples: + +screen shot 2017-08-08 at 12 53 04 pm +screen shot 2017-08-08 at 12 53 38 pm +screen shot 2017-08-08 at 12 53 25 pm + +#### Windows command prompt notes + +##### CMD + +On Windows the environment variable is set using the `set` command. + +```cmd +set DEBUG=*,-not_this +``` + +Example: + +```cmd +set DEBUG=* & node app.js +``` + +##### PowerShell (VS Code default) + +PowerShell uses different syntax to set environment variables. + +```cmd +$env:DEBUG = "*,-not_this" +``` + +Example: + +```cmd +$env:DEBUG='app';node app.js +``` + +Then, run the program to be debugged as usual. + +npm script example: +```js + "windowsDebug": "@powershell -Command $env:DEBUG='*';node app.js", +``` + +## Namespace Colors + +Every debug instance has a color generated for it based on its namespace name. +This helps when visually parsing the debug output to identify which debug instance +a debug line belongs to. + +#### Node.js + +In Node.js, colors are enabled when stderr is a TTY. You also _should_ install +the [`supports-color`](https://npmjs.org/supports-color) module alongside debug, +otherwise debug will only use a small handful of basic colors. + + + +#### Web Browser + +Colors are also enabled on "Web Inspectors" that understand the `%c` formatting +option. These are WebKit web inspectors, Firefox ([since version +31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/)) +and the Firebug plugin for Firefox (any version). + + + + +## Millisecond diff + +When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls. + + + +When stdout is not a TTY, `Date#toISOString()` is used, making it more useful for logging the debug information as shown below: + + + + +## Conventions + +If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser". If you append a "*" to the end of your name, it will always be enabled regardless of the setting of the DEBUG environment variable. You can then use it for normal output as well as debug output. + +## Wildcards + +The `*` character may be used as a wildcard. Suppose for example your library has +debuggers named "connect:bodyParser", "connect:compress", "connect:session", +instead of listing all three with +`DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do +`DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`. + +You can also exclude specific debuggers by prefixing them with a "-" character. +For example, `DEBUG=*,-connect:*` would include all debuggers except those +starting with "connect:". + +## Environment Variables + +When running through Node.js, you can set a few environment variables that will +change the behavior of the debug logging: + +| Name | Purpose | +|-----------|-------------------------------------------------| +| `DEBUG` | Enables/disables specific debugging namespaces. | +| `DEBUG_HIDE_DATE` | Hide date from debug output (non-TTY). | +| `DEBUG_COLORS`| Whether or not to use colors in the debug output. | +| `DEBUG_DEPTH` | Object inspection depth. | +| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. | + + +__Note:__ The environment variables beginning with `DEBUG_` end up being +converted into an Options object that gets used with `%o`/`%O` formatters. +See the Node.js documentation for +[`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options) +for the complete list. + +## Formatters + +Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. +Below are the officially supported formatters: + +| Formatter | Representation | +|-----------|----------------| +| `%O` | Pretty-print an Object on multiple lines. | +| `%o` | Pretty-print an Object all on a single line. | +| `%s` | String. | +| `%d` | Number (both integer and float). | +| `%j` | JSON. Replaced with the string '[Circular]' if the argument contains circular references. | +| `%%` | Single percent sign ('%'). This does not consume an argument. | + + +### Custom formatters + +You can add custom formatters by extending the `debug.formatters` object. +For example, if you wanted to add support for rendering a Buffer as hex with +`%h`, you could do something like: + +```js +const createDebug = require('debug') +createDebug.formatters.h = (v) => { + return v.toString('hex') +} + +// …elsewhere +const debug = createDebug('foo') +debug('this is hex: %h', new Buffer('hello world')) +// foo this is hex: 68656c6c6f20776f726c6421 +0ms +``` + + +## Browser Support + +You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify), +or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest), +if you don't want to build it yourself. + +Debug's enable state is currently persisted by `localStorage`. +Consider the situation shown below where you have `worker:a` and `worker:b`, +and wish to debug both. You can enable this using `localStorage.debug`: + +```js +localStorage.debug = 'worker:*' +``` + +And then refresh the page. + +```js +a = debug('worker:a'); +b = debug('worker:b'); + +setInterval(function(){ + a('doing some work'); +}, 1000); + +setInterval(function(){ + b('doing some work'); +}, 1200); +``` + +In Chromium-based web browsers (e.g. Brave, Chrome, and Electron), the JavaScript console will—by default—only show messages logged by `debug` if the "Verbose" log level is _enabled_. + + + +## Output streams + + By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method: + +Example [_stdout.js_](./examples/node/stdout.js): + +```js +var debug = require('debug'); +var error = debug('app:error'); + +// by default stderr is used +error('goes to stderr!'); + +var log = debug('app:log'); +// set this namespace to log via console.log +log.log = console.log.bind(console); // don't forget to bind to console! +log('goes to stdout'); +error('still goes to stderr!'); + +// set all output to go via console.info +// overrides all per-namespace log settings +debug.log = console.info.bind(console); +error('now goes to stdout via console.info'); +log('still goes to stdout, but via console.info now'); +``` + +## Extend +You can simply extend debugger +```js +const log = require('debug')('auth'); + +//creates new debug instance with extended namespace +const logSign = log.extend('sign'); +const logLogin = log.extend('login'); + +log('hello'); // auth hello +logSign('hello'); //auth:sign hello +logLogin('hello'); //auth:login hello +``` + +## Set dynamically + +You can also enable debug dynamically by calling the `enable()` method : + +```js +let debug = require('debug'); + +console.log(1, debug.enabled('test')); + +debug.enable('test'); +console.log(2, debug.enabled('test')); + +debug.disable(); +console.log(3, debug.enabled('test')); + +``` + +print : +``` +1 false +2 true +3 false +``` + +Usage : +`enable(namespaces)` +`namespaces` can include modes separated by a colon and wildcards. + +Note that calling `enable()` completely overrides previously set DEBUG variable : + +``` +$ DEBUG=foo node -e 'var dbg = require("debug"); dbg.enable("bar"); console.log(dbg.enabled("foo"))' +=> false +``` + +`disable()` + +Will disable all namespaces. The functions returns the namespaces currently +enabled (and skipped). This can be useful if you want to disable debugging +temporarily without knowing what was enabled to begin with. + +For example: + +```js +let debug = require('debug'); +debug.enable('foo:*,-foo:bar'); +let namespaces = debug.disable(); +debug.enable(namespaces); +``` + +Note: There is no guarantee that the string will be identical to the initial +enable string, but semantically they will be identical. + +## Checking whether a debug target is enabled + +After you've created a debug instance, you can determine whether or not it is +enabled by checking the `enabled` property: + +```javascript +const debug = require('debug')('http'); + +if (debug.enabled) { + // do stuff... +} +``` + +You can also manually toggle this property to force the debug instance to be +enabled or disabled. + +## Usage in child processes + +Due to the way `debug` detects if the output is a TTY or not, colors are not shown in child processes when `stderr` is piped. A solution is to pass the `DEBUG_COLORS=1` environment variable to the child process. +For example: + +```javascript +worker = fork(WORKER_WRAP_PATH, [workerPath], { + stdio: [ + /* stdin: */ 0, + /* stdout: */ 'pipe', + /* stderr: */ 'pipe', + 'ipc', + ], + env: Object.assign({}, process.env, { + DEBUG_COLORS: 1 // without this settings, colors won't be shown + }), +}); + +worker.stderr.pipe(process.stderr, { end: false }); +``` + + +## Authors + + - TJ Holowaychuk + - Nathan Rajlich + - Andrew Rhyne + - Josh Junon + +## Backers + +Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)] + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +## Sponsors + +Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)] + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +## License + +(The MIT License) + +Copyright (c) 2014-2017 TJ Holowaychuk <tj@vision-media.ca> +Copyright (c) 2018-2021 Josh Junon + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/debug/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/debug/package.json new file mode 100644 index 00000000..7bb6a15d --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/debug/package.json @@ -0,0 +1,101 @@ +{ + "_from": "debug@^4.1.0", + "_id": "debug@4.3.4", + "_inBundle": false, + "_integrity": "sha512-PRWFHuSU3eDtQJPvnNY7Jcket1j0t5OuOsFzPPzsekD52Zl8qUfFIPEiswXqIvHWGVHOgX+7G/vCNNhehwxfkQ==", + "_location": "/agentkeepalive/debug", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "debug@^4.1.0", + "name": "debug", + "escapedName": "debug", + "rawSpec": "^4.1.0", + "saveSpec": null, + "fetchSpec": "^4.1.0" + }, + "_requiredBy": [ + "/agentkeepalive" + ], + "_resolved": "https://registry.npmjs.org/debug/-/debug-4.3.4.tgz", + "_shasum": "1319f6579357f2338d3337d2cdd4914bb5dcc865", + "_spec": "debug@^4.1.0", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\agentkeepalive", + "author": { + "name": "Josh Junon", + "email": "josh.junon@protonmail.com" + }, + "browser": "./src/browser.js", + "bugs": { + "url": "https://github.com/debug-js/debug/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "TJ Holowaychuk", + "email": "tj@vision-media.ca" + }, + { + "name": "Nathan Rajlich", + "email": "nathan@tootallnate.net", + "url": "http://n8.io" + }, + { + "name": "Andrew Rhyne", + "email": "rhyneandrew@gmail.com" + } + ], + "dependencies": { + "ms": "2.1.2" + }, + "deprecated": false, + "description": "Lightweight debugging utility for Node.js and the browser", + "devDependencies": { + "brfs": "^2.0.1", + "browserify": "^16.2.3", + "coveralls": "^3.0.2", + "istanbul": "^0.4.5", + "karma": "^3.1.4", + "karma-browserify": "^6.0.0", + "karma-chrome-launcher": "^2.2.0", + "karma-mocha": "^1.3.0", + "mocha": "^5.2.0", + "mocha-lcov-reporter": "^1.2.0", + "xo": "^0.23.0" + }, + "engines": { + "node": ">=6.0" + }, + "files": [ + "src", + "LICENSE", + "README.md" + ], + "homepage": "https://github.com/debug-js/debug#readme", + "keywords": [ + "debug", + "log", + "debugger" + ], + "license": "MIT", + "main": "./src/index.js", + "name": "debug", + "peerDependenciesMeta": { + "supports-color": { + "optional": true + } + }, + "repository": { + "type": "git", + "url": "git://github.com/debug-js/debug.git" + }, + "scripts": { + "lint": "xo", + "test": "npm run test:node && npm run test:browser && npm run lint", + "test:browser": "karma start --single-run", + "test:coverage": "cat ./coverage/lcov.info | coveralls", + "test:node": "istanbul cover _mocha -- test.js" + }, + "version": "4.3.4" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/debug/src/browser.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/debug/src/browser.js new file mode 100644 index 00000000..cd0fc35d --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/debug/src/browser.js @@ -0,0 +1,269 @@ +/* eslint-env browser */ + +/** + * This is the web browser implementation of `debug()`. + */ + +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; +exports.storage = localstorage(); +exports.destroy = (() => { + let warned = false; + + return () => { + if (!warned) { + warned = true; + console.warn('Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.'); + } + }; +})(); + +/** + * Colors. + */ + +exports.colors = [ + '#0000CC', + '#0000FF', + '#0033CC', + '#0033FF', + '#0066CC', + '#0066FF', + '#0099CC', + '#0099FF', + '#00CC00', + '#00CC33', + '#00CC66', + '#00CC99', + '#00CCCC', + '#00CCFF', + '#3300CC', + '#3300FF', + '#3333CC', + '#3333FF', + '#3366CC', + '#3366FF', + '#3399CC', + '#3399FF', + '#33CC00', + '#33CC33', + '#33CC66', + '#33CC99', + '#33CCCC', + '#33CCFF', + '#6600CC', + '#6600FF', + '#6633CC', + '#6633FF', + '#66CC00', + '#66CC33', + '#9900CC', + '#9900FF', + '#9933CC', + '#9933FF', + '#99CC00', + '#99CC33', + '#CC0000', + '#CC0033', + '#CC0066', + '#CC0099', + '#CC00CC', + '#CC00FF', + '#CC3300', + '#CC3333', + '#CC3366', + '#CC3399', + '#CC33CC', + '#CC33FF', + '#CC6600', + '#CC6633', + '#CC9900', + '#CC9933', + '#CCCC00', + '#CCCC33', + '#FF0000', + '#FF0033', + '#FF0066', + '#FF0099', + '#FF00CC', + '#FF00FF', + '#FF3300', + '#FF3333', + '#FF3366', + '#FF3399', + '#FF33CC', + '#FF33FF', + '#FF6600', + '#FF6633', + '#FF9900', + '#FF9933', + '#FFCC00', + '#FFCC33' +]; + +/** + * Currently only WebKit-based Web Inspectors, Firefox >= v31, + * and the Firebug extension (any Firefox version) are known + * to support "%c" CSS customizations. + * + * TODO: add a `localStorage` variable to explicitly enable/disable colors + */ + +// eslint-disable-next-line complexity +function useColors() { + // NB: In an Electron preload script, document will be defined but not fully + // initialized. Since we know we're in Chrome, we'll just detect this case + // explicitly + if (typeof window !== 'undefined' && window.process && (window.process.type === 'renderer' || window.process.__nwjs)) { + return true; + } + + // Internet Explorer and Edge do not support colors. + if (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/(edge|trident)\/(\d+)/)) { + return false; + } + + // Is webkit? http://stackoverflow.com/a/16459606/376773 + // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632 + return (typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance) || + // Is firebug? http://stackoverflow.com/a/398120/376773 + (typeof window !== 'undefined' && window.console && (window.console.firebug || (window.console.exception && window.console.table))) || + // Is firefox >= v31? + // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages + (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31) || + // Double check webkit in userAgent just in case we are in a worker + (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/)); +} + +/** + * Colorize log arguments if enabled. + * + * @api public + */ + +function formatArgs(args) { + args[0] = (this.useColors ? '%c' : '') + + this.namespace + + (this.useColors ? ' %c' : ' ') + + args[0] + + (this.useColors ? '%c ' : ' ') + + '+' + module.exports.humanize(this.diff); + + if (!this.useColors) { + return; + } + + const c = 'color: ' + this.color; + args.splice(1, 0, c, 'color: inherit'); + + // The final "%c" is somewhat tricky, because there could be other + // arguments passed either before or after the %c, so we need to + // figure out the correct index to insert the CSS into + let index = 0; + let lastC = 0; + args[0].replace(/%[a-zA-Z%]/g, match => { + if (match === '%%') { + return; + } + index++; + if (match === '%c') { + // We only are interested in the *last* %c + // (the user may have provided their own) + lastC = index; + } + }); + + args.splice(lastC, 0, c); +} + +/** + * Invokes `console.debug()` when available. + * No-op when `console.debug` is not a "function". + * If `console.debug` is not available, falls back + * to `console.log`. + * + * @api public + */ +exports.log = console.debug || console.log || (() => {}); + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ +function save(namespaces) { + try { + if (namespaces) { + exports.storage.setItem('debug', namespaces); + } else { + exports.storage.removeItem('debug'); + } + } catch (error) { + // Swallow + // XXX (@Qix-) should we be logging these? + } +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ +function load() { + let r; + try { + r = exports.storage.getItem('debug'); + } catch (error) { + // Swallow + // XXX (@Qix-) should we be logging these? + } + + // If debug isn't set in LS, and we're in Electron, try to load $DEBUG + if (!r && typeof process !== 'undefined' && 'env' in process) { + r = process.env.DEBUG; + } + + return r; +} + +/** + * Localstorage attempts to return the localstorage. + * + * This is necessary because safari throws + * when a user disables cookies/localstorage + * and you attempt to access it. + * + * @return {LocalStorage} + * @api private + */ + +function localstorage() { + try { + // TVMLKit (Apple TV JS Runtime) does not have a window object, just localStorage in the global context + // The Browser also has localStorage in the global context. + return localStorage; + } catch (error) { + // Swallow + // XXX (@Qix-) should we be logging these? + } +} + +module.exports = require('./common')(exports); + +const {formatters} = module.exports; + +/** + * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default. + */ + +formatters.j = function (v) { + try { + return JSON.stringify(v); + } catch (error) { + return '[UnexpectedJSONParseError]: ' + error.message; + } +}; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/debug/src/common.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/debug/src/common.js new file mode 100644 index 00000000..e3291b20 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/debug/src/common.js @@ -0,0 +1,274 @@ + +/** + * This is the common logic for both the Node.js and web browser + * implementations of `debug()`. + */ + +function setup(env) { + createDebug.debug = createDebug; + createDebug.default = createDebug; + createDebug.coerce = coerce; + createDebug.disable = disable; + createDebug.enable = enable; + createDebug.enabled = enabled; + createDebug.humanize = require('ms'); + createDebug.destroy = destroy; + + Object.keys(env).forEach(key => { + createDebug[key] = env[key]; + }); + + /** + * The currently active debug mode names, and names to skip. + */ + + createDebug.names = []; + createDebug.skips = []; + + /** + * Map of special "%n" handling functions, for the debug "format" argument. + * + * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N". + */ + createDebug.formatters = {}; + + /** + * Selects a color for a debug namespace + * @param {String} namespace The namespace string for the debug instance to be colored + * @return {Number|String} An ANSI color code for the given namespace + * @api private + */ + function selectColor(namespace) { + let hash = 0; + + for (let i = 0; i < namespace.length; i++) { + hash = ((hash << 5) - hash) + namespace.charCodeAt(i); + hash |= 0; // Convert to 32bit integer + } + + return createDebug.colors[Math.abs(hash) % createDebug.colors.length]; + } + createDebug.selectColor = selectColor; + + /** + * Create a debugger with the given `namespace`. + * + * @param {String} namespace + * @return {Function} + * @api public + */ + function createDebug(namespace) { + let prevTime; + let enableOverride = null; + let namespacesCache; + let enabledCache; + + function debug(...args) { + // Disabled? + if (!debug.enabled) { + return; + } + + const self = debug; + + // Set `diff` timestamp + const curr = Number(new Date()); + const ms = curr - (prevTime || curr); + self.diff = ms; + self.prev = prevTime; + self.curr = curr; + prevTime = curr; + + args[0] = createDebug.coerce(args[0]); + + if (typeof args[0] !== 'string') { + // Anything else let's inspect with %O + args.unshift('%O'); + } + + // Apply any `formatters` transformations + let index = 0; + args[0] = args[0].replace(/%([a-zA-Z%])/g, (match, format) => { + // If we encounter an escaped % then don't increase the array index + if (match === '%%') { + return '%'; + } + index++; + const formatter = createDebug.formatters[format]; + if (typeof formatter === 'function') { + const val = args[index]; + match = formatter.call(self, val); + + // Now we need to remove `args[index]` since it's inlined in the `format` + args.splice(index, 1); + index--; + } + return match; + }); + + // Apply env-specific formatting (colors, etc.) + createDebug.formatArgs.call(self, args); + + const logFn = self.log || createDebug.log; + logFn.apply(self, args); + } + + debug.namespace = namespace; + debug.useColors = createDebug.useColors(); + debug.color = createDebug.selectColor(namespace); + debug.extend = extend; + debug.destroy = createDebug.destroy; // XXX Temporary. Will be removed in the next major release. + + Object.defineProperty(debug, 'enabled', { + enumerable: true, + configurable: false, + get: () => { + if (enableOverride !== null) { + return enableOverride; + } + if (namespacesCache !== createDebug.namespaces) { + namespacesCache = createDebug.namespaces; + enabledCache = createDebug.enabled(namespace); + } + + return enabledCache; + }, + set: v => { + enableOverride = v; + } + }); + + // Env-specific initialization logic for debug instances + if (typeof createDebug.init === 'function') { + createDebug.init(debug); + } + + return debug; + } + + function extend(namespace, delimiter) { + const newDebug = createDebug(this.namespace + (typeof delimiter === 'undefined' ? ':' : delimiter) + namespace); + newDebug.log = this.log; + return newDebug; + } + + /** + * Enables a debug mode by namespaces. This can include modes + * separated by a colon and wildcards. + * + * @param {String} namespaces + * @api public + */ + function enable(namespaces) { + createDebug.save(namespaces); + createDebug.namespaces = namespaces; + + createDebug.names = []; + createDebug.skips = []; + + let i; + const split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/); + const len = split.length; + + for (i = 0; i < len; i++) { + if (!split[i]) { + // ignore empty strings + continue; + } + + namespaces = split[i].replace(/\*/g, '.*?'); + + if (namespaces[0] === '-') { + createDebug.skips.push(new RegExp('^' + namespaces.slice(1) + '$')); + } else { + createDebug.names.push(new RegExp('^' + namespaces + '$')); + } + } + } + + /** + * Disable debug output. + * + * @return {String} namespaces + * @api public + */ + function disable() { + const namespaces = [ + ...createDebug.names.map(toNamespace), + ...createDebug.skips.map(toNamespace).map(namespace => '-' + namespace) + ].join(','); + createDebug.enable(''); + return namespaces; + } + + /** + * Returns true if the given mode name is enabled, false otherwise. + * + * @param {String} name + * @return {Boolean} + * @api public + */ + function enabled(name) { + if (name[name.length - 1] === '*') { + return true; + } + + let i; + let len; + + for (i = 0, len = createDebug.skips.length; i < len; i++) { + if (createDebug.skips[i].test(name)) { + return false; + } + } + + for (i = 0, len = createDebug.names.length; i < len; i++) { + if (createDebug.names[i].test(name)) { + return true; + } + } + + return false; + } + + /** + * Convert regexp to namespace + * + * @param {RegExp} regxep + * @return {String} namespace + * @api private + */ + function toNamespace(regexp) { + return regexp.toString() + .substring(2, regexp.toString().length - 2) + .replace(/\.\*\?$/, '*'); + } + + /** + * Coerce `val`. + * + * @param {Mixed} val + * @return {Mixed} + * @api private + */ + function coerce(val) { + if (val instanceof Error) { + return val.stack || val.message; + } + return val; + } + + /** + * XXX DO NOT USE. This is a temporary stub function. + * XXX It WILL be removed in the next major release. + */ + function destroy() { + console.warn('Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.'); + } + + createDebug.enable(createDebug.load()); + + return createDebug; +} + +module.exports = setup; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/debug/src/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/debug/src/index.js new file mode 100644 index 00000000..bf4c57f2 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/debug/src/index.js @@ -0,0 +1,10 @@ +/** + * Detect Electron renderer / nwjs process, which is node, but we should + * treat as a browser. + */ + +if (typeof process === 'undefined' || process.type === 'renderer' || process.browser === true || process.__nwjs) { + module.exports = require('./browser.js'); +} else { + module.exports = require('./node.js'); +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/debug/src/node.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/debug/src/node.js new file mode 100644 index 00000000..79bc085c --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/debug/src/node.js @@ -0,0 +1,263 @@ +/** + * Module dependencies. + */ + +const tty = require('tty'); +const util = require('util'); + +/** + * This is the Node.js implementation of `debug()`. + */ + +exports.init = init; +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; +exports.destroy = util.deprecate( + () => {}, + 'Instance method `debug.destroy()` is deprecated and no longer does anything. It will be removed in the next major version of `debug`.' +); + +/** + * Colors. + */ + +exports.colors = [6, 2, 3, 4, 5, 1]; + +try { + // Optional dependency (as in, doesn't need to be installed, NOT like optionalDependencies in package.json) + // eslint-disable-next-line import/no-extraneous-dependencies + const supportsColor = require('supports-color'); + + if (supportsColor && (supportsColor.stderr || supportsColor).level >= 2) { + exports.colors = [ + 20, + 21, + 26, + 27, + 32, + 33, + 38, + 39, + 40, + 41, + 42, + 43, + 44, + 45, + 56, + 57, + 62, + 63, + 68, + 69, + 74, + 75, + 76, + 77, + 78, + 79, + 80, + 81, + 92, + 93, + 98, + 99, + 112, + 113, + 128, + 129, + 134, + 135, + 148, + 149, + 160, + 161, + 162, + 163, + 164, + 165, + 166, + 167, + 168, + 169, + 170, + 171, + 172, + 173, + 178, + 179, + 184, + 185, + 196, + 197, + 198, + 199, + 200, + 201, + 202, + 203, + 204, + 205, + 206, + 207, + 208, + 209, + 214, + 215, + 220, + 221 + ]; + } +} catch (error) { + // Swallow - we only care if `supports-color` is available; it doesn't have to be. +} + +/** + * Build up the default `inspectOpts` object from the environment variables. + * + * $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js + */ + +exports.inspectOpts = Object.keys(process.env).filter(key => { + return /^debug_/i.test(key); +}).reduce((obj, key) => { + // Camel-case + const prop = key + .substring(6) + .toLowerCase() + .replace(/_([a-z])/g, (_, k) => { + return k.toUpperCase(); + }); + + // Coerce string value into JS value + let val = process.env[key]; + if (/^(yes|on|true|enabled)$/i.test(val)) { + val = true; + } else if (/^(no|off|false|disabled)$/i.test(val)) { + val = false; + } else if (val === 'null') { + val = null; + } else { + val = Number(val); + } + + obj[prop] = val; + return obj; +}, {}); + +/** + * Is stdout a TTY? Colored output is enabled when `true`. + */ + +function useColors() { + return 'colors' in exports.inspectOpts ? + Boolean(exports.inspectOpts.colors) : + tty.isatty(process.stderr.fd); +} + +/** + * Adds ANSI color escape codes if enabled. + * + * @api public + */ + +function formatArgs(args) { + const {namespace: name, useColors} = this; + + if (useColors) { + const c = this.color; + const colorCode = '\u001B[3' + (c < 8 ? c : '8;5;' + c); + const prefix = ` ${colorCode};1m${name} \u001B[0m`; + + args[0] = prefix + args[0].split('\n').join('\n' + prefix); + args.push(colorCode + 'm+' + module.exports.humanize(this.diff) + '\u001B[0m'); + } else { + args[0] = getDate() + name + ' ' + args[0]; + } +} + +function getDate() { + if (exports.inspectOpts.hideDate) { + return ''; + } + return new Date().toISOString() + ' '; +} + +/** + * Invokes `util.format()` with the specified arguments and writes to stderr. + */ + +function log(...args) { + return process.stderr.write(util.format(...args) + '\n'); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ +function save(namespaces) { + if (namespaces) { + process.env.DEBUG = namespaces; + } else { + // If you set a process.env field to null or undefined, it gets cast to the + // string 'null' or 'undefined'. Just delete instead. + delete process.env.DEBUG; + } +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + return process.env.DEBUG; +} + +/** + * Init logic for `debug` instances. + * + * Create a new `inspectOpts` object in case `useColors` is set + * differently for a particular `debug` instance. + */ + +function init(debug) { + debug.inspectOpts = {}; + + const keys = Object.keys(exports.inspectOpts); + for (let i = 0; i < keys.length; i++) { + debug.inspectOpts[keys[i]] = exports.inspectOpts[keys[i]]; + } +} + +module.exports = require('./common')(exports); + +const {formatters} = module.exports; + +/** + * Map %o to `util.inspect()`, all on a single line. + */ + +formatters.o = function (v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts) + .split('\n') + .map(str => str.trim()) + .join(' '); +}; + +/** + * Map %O to `util.inspect()`, allowing multiple lines if needed. + */ + +formatters.O = function (v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts); +}; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/depd/History.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/depd/History.md new file mode 100644 index 00000000..507ecb8d --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/depd/History.md @@ -0,0 +1,96 @@ +1.1.2 / 2018-01-11 +================== + + * perf: remove argument reassignment + * Support Node.js 0.6 to 9.x + +1.1.1 / 2017-07-27 +================== + + * Remove unnecessary `Buffer` loading + * Support Node.js 0.6 to 8.x + +1.1.0 / 2015-09-14 +================== + + * Enable strict mode in more places + * Support io.js 3.x + * Support io.js 2.x + * Support web browser loading + - Requires bundler like Browserify or webpack + +1.0.1 / 2015-04-07 +================== + + * Fix `TypeError`s when under `'use strict'` code + * Fix useless type name on auto-generated messages + * Support io.js 1.x + * Support Node.js 0.12 + +1.0.0 / 2014-09-17 +================== + + * No changes + +0.4.5 / 2014-09-09 +================== + + * Improve call speed to functions using the function wrapper + * Support Node.js 0.6 + +0.4.4 / 2014-07-27 +================== + + * Work-around v8 generating empty stack traces + +0.4.3 / 2014-07-26 +================== + + * Fix exception when global `Error.stackTraceLimit` is too low + +0.4.2 / 2014-07-19 +================== + + * Correct call site for wrapped functions and properties + +0.4.1 / 2014-07-19 +================== + + * Improve automatic message generation for function properties + +0.4.0 / 2014-07-19 +================== + + * Add `TRACE_DEPRECATION` environment variable + * Remove non-standard grey color from color output + * Support `--no-deprecation` argument + * Support `--trace-deprecation` argument + * Support `deprecate.property(fn, prop, message)` + +0.3.0 / 2014-06-16 +================== + + * Add `NO_DEPRECATION` environment variable + +0.2.0 / 2014-06-15 +================== + + * Add `deprecate.property(obj, prop, message)` + * Remove `supports-color` dependency for node.js 0.8 + +0.1.0 / 2014-06-15 +================== + + * Add `deprecate.function(fn, message)` + * Add `process.on('deprecation', fn)` emitter + * Automatically generate message when omitted from `deprecate()` + +0.0.1 / 2014-06-15 +================== + + * Fix warning for dynamic calls at singe call site + +0.0.0 / 2014-06-15 +================== + + * Initial implementation diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/depd/LICENSE b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/depd/LICENSE new file mode 100644 index 00000000..84441fbb --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/depd/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2014-2017 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/depd/Readme.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/depd/Readme.md new file mode 100644 index 00000000..77906702 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/depd/Readme.md @@ -0,0 +1,280 @@ +# depd + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-image]][node-url] +[![Linux Build][travis-image]][travis-url] +[![Windows Build][appveyor-image]][appveyor-url] +[![Coverage Status][coveralls-image]][coveralls-url] + +Deprecate all the things + +> With great modules comes great responsibility; mark things deprecated! + +## Install + +This module is installed directly using `npm`: + +```sh +$ npm install depd +``` + +This module can also be bundled with systems like +[Browserify](http://browserify.org/) or [webpack](https://webpack.github.io/), +though by default this module will alter it's API to no longer display or +track deprecations. + +## API + + + +```js +var deprecate = require('depd')('my-module') +``` + +This library allows you to display deprecation messages to your users. +This library goes above and beyond with deprecation warnings by +introspection of the call stack (but only the bits that it is interested +in). + +Instead of just warning on the first invocation of a deprecated +function and never again, this module will warn on the first invocation +of a deprecated function per unique call site, making it ideal to alert +users of all deprecated uses across the code base, rather than just +whatever happens to execute first. + +The deprecation warnings from this module also include the file and line +information for the call into the module that the deprecated function was +in. + +**NOTE** this library has a similar interface to the `debug` module, and +this module uses the calling file to get the boundary for the call stacks, +so you should always create a new `deprecate` object in each file and not +within some central file. + +### depd(namespace) + +Create a new deprecate function that uses the given namespace name in the +messages and will display the call site prior to the stack entering the +file this function was called from. It is highly suggested you use the +name of your module as the namespace. + +### deprecate(message) + +Call this function from deprecated code to display a deprecation message. +This message will appear once per unique caller site. Caller site is the +first call site in the stack in a different file from the caller of this +function. + +If the message is omitted, a message is generated for you based on the site +of the `deprecate()` call and will display the name of the function called, +similar to the name displayed in a stack trace. + +### deprecate.function(fn, message) + +Call this function to wrap a given function in a deprecation message on any +call to the function. An optional message can be supplied to provide a custom +message. + +### deprecate.property(obj, prop, message) + +Call this function to wrap a given property on object in a deprecation message +on any accessing or setting of the property. An optional message can be supplied +to provide a custom message. + +The method must be called on the object where the property belongs (not +inherited from the prototype). + +If the property is a data descriptor, it will be converted to an accessor +descriptor in order to display the deprecation message. + +### process.on('deprecation', fn) + +This module will allow easy capturing of deprecation errors by emitting the +errors as the type "deprecation" on the global `process`. If there are no +listeners for this type, the errors are written to STDERR as normal, but if +there are any listeners, nothing will be written to STDERR and instead only +emitted. From there, you can write the errors in a different format or to a +logging source. + +The error represents the deprecation and is emitted only once with the same +rules as writing to STDERR. The error has the following properties: + + - `message` - This is the message given by the library + - `name` - This is always `'DeprecationError'` + - `namespace` - This is the namespace the deprecation came from + - `stack` - This is the stack of the call to the deprecated thing + +Example `error.stack` output: + +``` +DeprecationError: my-cool-module deprecated oldfunction + at Object. ([eval]-wrapper:6:22) + at Module._compile (module.js:456:26) + at evalScript (node.js:532:25) + at startup (node.js:80:7) + at node.js:902:3 +``` + +### process.env.NO_DEPRECATION + +As a user of modules that are deprecated, the environment variable `NO_DEPRECATION` +is provided as a quick solution to silencing deprecation warnings from being +output. The format of this is similar to that of `DEBUG`: + +```sh +$ NO_DEPRECATION=my-module,othermod node app.js +``` + +This will suppress deprecations from being output for "my-module" and "othermod". +The value is a list of comma-separated namespaces. To suppress every warning +across all namespaces, use the value `*` for a namespace. + +Providing the argument `--no-deprecation` to the `node` executable will suppress +all deprecations (only available in Node.js 0.8 or higher). + +**NOTE** This will not suppress the deperecations given to any "deprecation" +event listeners, just the output to STDERR. + +### process.env.TRACE_DEPRECATION + +As a user of modules that are deprecated, the environment variable `TRACE_DEPRECATION` +is provided as a solution to getting more detailed location information in deprecation +warnings by including the entire stack trace. The format of this is the same as +`NO_DEPRECATION`: + +```sh +$ TRACE_DEPRECATION=my-module,othermod node app.js +``` + +This will include stack traces for deprecations being output for "my-module" and +"othermod". The value is a list of comma-separated namespaces. To trace every +warning across all namespaces, use the value `*` for a namespace. + +Providing the argument `--trace-deprecation` to the `node` executable will trace +all deprecations (only available in Node.js 0.8 or higher). + +**NOTE** This will not trace the deperecations silenced by `NO_DEPRECATION`. + +## Display + +![message](files/message.png) + +When a user calls a function in your library that you mark deprecated, they +will see the following written to STDERR (in the given colors, similar colors +and layout to the `debug` module): + +``` +bright cyan bright yellow +| | reset cyan +| | | | +▼ ▼ ▼ ▼ +my-cool-module deprecated oldfunction [eval]-wrapper:6:22 +▲ ▲ ▲ ▲ +| | | | +namespace | | location of mycoolmod.oldfunction() call + | deprecation message + the word "deprecated" +``` + +If the user redirects their STDERR to a file or somewhere that does not support +colors, they see (similar layout to the `debug` module): + +``` +Sun, 15 Jun 2014 05:21:37 GMT my-cool-module deprecated oldfunction at [eval]-wrapper:6:22 +▲ ▲ ▲ ▲ ▲ +| | | | | +timestamp of message namespace | | location of mycoolmod.oldfunction() call + | deprecation message + the word "deprecated" +``` + +## Examples + +### Deprecating all calls to a function + +This will display a deprecated message about "oldfunction" being deprecated +from "my-module" on STDERR. + +```js +var deprecate = require('depd')('my-cool-module') + +// message automatically derived from function name +// Object.oldfunction +exports.oldfunction = deprecate.function(function oldfunction () { + // all calls to function are deprecated +}) + +// specific message +exports.oldfunction = deprecate.function(function () { + // all calls to function are deprecated +}, 'oldfunction') +``` + +### Conditionally deprecating a function call + +This will display a deprecated message about "weirdfunction" being deprecated +from "my-module" on STDERR when called with less than 2 arguments. + +```js +var deprecate = require('depd')('my-cool-module') + +exports.weirdfunction = function () { + if (arguments.length < 2) { + // calls with 0 or 1 args are deprecated + deprecate('weirdfunction args < 2') + } +} +``` + +When calling `deprecate` as a function, the warning is counted per call site +within your own module, so you can display different deprecations depending +on different situations and the users will still get all the warnings: + +```js +var deprecate = require('depd')('my-cool-module') + +exports.weirdfunction = function () { + if (arguments.length < 2) { + // calls with 0 or 1 args are deprecated + deprecate('weirdfunction args < 2') + } else if (typeof arguments[0] !== 'string') { + // calls with non-string first argument are deprecated + deprecate('weirdfunction non-string first arg') + } +} +``` + +### Deprecating property access + +This will display a deprecated message about "oldprop" being deprecated +from "my-module" on STDERR when accessed. A deprecation will be displayed +when setting the value and when getting the value. + +```js +var deprecate = require('depd')('my-cool-module') + +exports.oldprop = 'something' + +// message automatically derives from property name +deprecate.property(exports, 'oldprop') + +// explicit message +deprecate.property(exports, 'oldprop', 'oldprop >= 0.10') +``` + +## License + +[MIT](LICENSE) + +[npm-version-image]: https://img.shields.io/npm/v/depd.svg +[npm-downloads-image]: https://img.shields.io/npm/dm/depd.svg +[npm-url]: https://npmjs.org/package/depd +[travis-image]: https://img.shields.io/travis/dougwilson/nodejs-depd/master.svg?label=linux +[travis-url]: https://travis-ci.org/dougwilson/nodejs-depd +[appveyor-image]: https://img.shields.io/appveyor/ci/dougwilson/nodejs-depd/master.svg?label=windows +[appveyor-url]: https://ci.appveyor.com/project/dougwilson/nodejs-depd +[coveralls-image]: https://img.shields.io/coveralls/dougwilson/nodejs-depd/master.svg +[coveralls-url]: https://coveralls.io/r/dougwilson/nodejs-depd?branch=master +[node-image]: https://img.shields.io/node/v/depd.svg +[node-url]: https://nodejs.org/en/download/ diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/depd/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/depd/index.js new file mode 100644 index 00000000..d758d3c8 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/depd/index.js @@ -0,0 +1,522 @@ +/*! + * depd + * Copyright(c) 2014-2017 Douglas Christopher Wilson + * MIT Licensed + */ + +/** + * Module dependencies. + */ + +var callSiteToString = require('./lib/compat').callSiteToString +var eventListenerCount = require('./lib/compat').eventListenerCount +var relative = require('path').relative + +/** + * Module exports. + */ + +module.exports = depd + +/** + * Get the path to base files on. + */ + +var basePath = process.cwd() + +/** + * Determine if namespace is contained in the string. + */ + +function containsNamespace (str, namespace) { + var vals = str.split(/[ ,]+/) + var ns = String(namespace).toLowerCase() + + for (var i = 0; i < vals.length; i++) { + var val = vals[i] + + // namespace contained + if (val && (val === '*' || val.toLowerCase() === ns)) { + return true + } + } + + return false +} + +/** + * Convert a data descriptor to accessor descriptor. + */ + +function convertDataDescriptorToAccessor (obj, prop, message) { + var descriptor = Object.getOwnPropertyDescriptor(obj, prop) + var value = descriptor.value + + descriptor.get = function getter () { return value } + + if (descriptor.writable) { + descriptor.set = function setter (val) { return (value = val) } + } + + delete descriptor.value + delete descriptor.writable + + Object.defineProperty(obj, prop, descriptor) + + return descriptor +} + +/** + * Create arguments string to keep arity. + */ + +function createArgumentsString (arity) { + var str = '' + + for (var i = 0; i < arity; i++) { + str += ', arg' + i + } + + return str.substr(2) +} + +/** + * Create stack string from stack. + */ + +function createStackString (stack) { + var str = this.name + ': ' + this.namespace + + if (this.message) { + str += ' deprecated ' + this.message + } + + for (var i = 0; i < stack.length; i++) { + str += '\n at ' + callSiteToString(stack[i]) + } + + return str +} + +/** + * Create deprecate for namespace in caller. + */ + +function depd (namespace) { + if (!namespace) { + throw new TypeError('argument namespace is required') + } + + var stack = getStack() + var site = callSiteLocation(stack[1]) + var file = site[0] + + function deprecate (message) { + // call to self as log + log.call(deprecate, message) + } + + deprecate._file = file + deprecate._ignored = isignored(namespace) + deprecate._namespace = namespace + deprecate._traced = istraced(namespace) + deprecate._warned = Object.create(null) + + deprecate.function = wrapfunction + deprecate.property = wrapproperty + + return deprecate +} + +/** + * Determine if namespace is ignored. + */ + +function isignored (namespace) { + /* istanbul ignore next: tested in a child processs */ + if (process.noDeprecation) { + // --no-deprecation support + return true + } + + var str = process.env.NO_DEPRECATION || '' + + // namespace ignored + return containsNamespace(str, namespace) +} + +/** + * Determine if namespace is traced. + */ + +function istraced (namespace) { + /* istanbul ignore next: tested in a child processs */ + if (process.traceDeprecation) { + // --trace-deprecation support + return true + } + + var str = process.env.TRACE_DEPRECATION || '' + + // namespace traced + return containsNamespace(str, namespace) +} + +/** + * Display deprecation message. + */ + +function log (message, site) { + var haslisteners = eventListenerCount(process, 'deprecation') !== 0 + + // abort early if no destination + if (!haslisteners && this._ignored) { + return + } + + var caller + var callFile + var callSite + var depSite + var i = 0 + var seen = false + var stack = getStack() + var file = this._file + + if (site) { + // provided site + depSite = site + callSite = callSiteLocation(stack[1]) + callSite.name = depSite.name + file = callSite[0] + } else { + // get call site + i = 2 + depSite = callSiteLocation(stack[i]) + callSite = depSite + } + + // get caller of deprecated thing in relation to file + for (; i < stack.length; i++) { + caller = callSiteLocation(stack[i]) + callFile = caller[0] + + if (callFile === file) { + seen = true + } else if (callFile === this._file) { + file = this._file + } else if (seen) { + break + } + } + + var key = caller + ? depSite.join(':') + '__' + caller.join(':') + : undefined + + if (key !== undefined && key in this._warned) { + // already warned + return + } + + this._warned[key] = true + + // generate automatic message from call site + var msg = message + if (!msg) { + msg = callSite === depSite || !callSite.name + ? defaultMessage(depSite) + : defaultMessage(callSite) + } + + // emit deprecation if listeners exist + if (haslisteners) { + var err = DeprecationError(this._namespace, msg, stack.slice(i)) + process.emit('deprecation', err) + return + } + + // format and write message + var format = process.stderr.isTTY + ? formatColor + : formatPlain + var output = format.call(this, msg, caller, stack.slice(i)) + process.stderr.write(output + '\n', 'utf8') +} + +/** + * Get call site location as array. + */ + +function callSiteLocation (callSite) { + var file = callSite.getFileName() || '' + var line = callSite.getLineNumber() + var colm = callSite.getColumnNumber() + + if (callSite.isEval()) { + file = callSite.getEvalOrigin() + ', ' + file + } + + var site = [file, line, colm] + + site.callSite = callSite + site.name = callSite.getFunctionName() + + return site +} + +/** + * Generate a default message from the site. + */ + +function defaultMessage (site) { + var callSite = site.callSite + var funcName = site.name + + // make useful anonymous name + if (!funcName) { + funcName = '' + } + + var context = callSite.getThis() + var typeName = context && callSite.getTypeName() + + // ignore useless type name + if (typeName === 'Object') { + typeName = undefined + } + + // make useful type name + if (typeName === 'Function') { + typeName = context.name || typeName + } + + return typeName && callSite.getMethodName() + ? typeName + '.' + funcName + : funcName +} + +/** + * Format deprecation message without color. + */ + +function formatPlain (msg, caller, stack) { + var timestamp = new Date().toUTCString() + + var formatted = timestamp + + ' ' + this._namespace + + ' deprecated ' + msg + + // add stack trace + if (this._traced) { + for (var i = 0; i < stack.length; i++) { + formatted += '\n at ' + callSiteToString(stack[i]) + } + + return formatted + } + + if (caller) { + formatted += ' at ' + formatLocation(caller) + } + + return formatted +} + +/** + * Format deprecation message with color. + */ + +function formatColor (msg, caller, stack) { + var formatted = '\x1b[36;1m' + this._namespace + '\x1b[22;39m' + // bold cyan + ' \x1b[33;1mdeprecated\x1b[22;39m' + // bold yellow + ' \x1b[0m' + msg + '\x1b[39m' // reset + + // add stack trace + if (this._traced) { + for (var i = 0; i < stack.length; i++) { + formatted += '\n \x1b[36mat ' + callSiteToString(stack[i]) + '\x1b[39m' // cyan + } + + return formatted + } + + if (caller) { + formatted += ' \x1b[36m' + formatLocation(caller) + '\x1b[39m' // cyan + } + + return formatted +} + +/** + * Format call site location. + */ + +function formatLocation (callSite) { + return relative(basePath, callSite[0]) + + ':' + callSite[1] + + ':' + callSite[2] +} + +/** + * Get the stack as array of call sites. + */ + +function getStack () { + var limit = Error.stackTraceLimit + var obj = {} + var prep = Error.prepareStackTrace + + Error.prepareStackTrace = prepareObjectStackTrace + Error.stackTraceLimit = Math.max(10, limit) + + // capture the stack + Error.captureStackTrace(obj) + + // slice this function off the top + var stack = obj.stack.slice(1) + + Error.prepareStackTrace = prep + Error.stackTraceLimit = limit + + return stack +} + +/** + * Capture call site stack from v8. + */ + +function prepareObjectStackTrace (obj, stack) { + return stack +} + +/** + * Return a wrapped function in a deprecation message. + */ + +function wrapfunction (fn, message) { + if (typeof fn !== 'function') { + throw new TypeError('argument fn must be a function') + } + + var args = createArgumentsString(fn.length) + var deprecate = this // eslint-disable-line no-unused-vars + var stack = getStack() + var site = callSiteLocation(stack[1]) + + site.name = fn.name + + // eslint-disable-next-line no-eval + var deprecatedfn = eval('(function (' + args + ') {\n' + + '"use strict"\n' + + 'log.call(deprecate, message, site)\n' + + 'return fn.apply(this, arguments)\n' + + '})') + + return deprecatedfn +} + +/** + * Wrap property in a deprecation message. + */ + +function wrapproperty (obj, prop, message) { + if (!obj || (typeof obj !== 'object' && typeof obj !== 'function')) { + throw new TypeError('argument obj must be object') + } + + var descriptor = Object.getOwnPropertyDescriptor(obj, prop) + + if (!descriptor) { + throw new TypeError('must call property on owner object') + } + + if (!descriptor.configurable) { + throw new TypeError('property must be configurable') + } + + var deprecate = this + var stack = getStack() + var site = callSiteLocation(stack[1]) + + // set site name + site.name = prop + + // convert data descriptor + if ('value' in descriptor) { + descriptor = convertDataDescriptorToAccessor(obj, prop, message) + } + + var get = descriptor.get + var set = descriptor.set + + // wrap getter + if (typeof get === 'function') { + descriptor.get = function getter () { + log.call(deprecate, message, site) + return get.apply(this, arguments) + } + } + + // wrap setter + if (typeof set === 'function') { + descriptor.set = function setter () { + log.call(deprecate, message, site) + return set.apply(this, arguments) + } + } + + Object.defineProperty(obj, prop, descriptor) +} + +/** + * Create DeprecationError for deprecation + */ + +function DeprecationError (namespace, message, stack) { + var error = new Error() + var stackString + + Object.defineProperty(error, 'constructor', { + value: DeprecationError + }) + + Object.defineProperty(error, 'message', { + configurable: true, + enumerable: false, + value: message, + writable: true + }) + + Object.defineProperty(error, 'name', { + enumerable: false, + configurable: true, + value: 'DeprecationError', + writable: true + }) + + Object.defineProperty(error, 'namespace', { + configurable: true, + enumerable: false, + value: namespace, + writable: true + }) + + Object.defineProperty(error, 'stack', { + configurable: true, + enumerable: false, + get: function () { + if (stackString !== undefined) { + return stackString + } + + // prepare stack trace + return (stackString = createStackString.call(this, stack)) + }, + set: function setter (val) { + stackString = val + } + }) + + return error +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/depd/lib/browser/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/depd/lib/browser/index.js new file mode 100644 index 00000000..6be45cc2 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/depd/lib/browser/index.js @@ -0,0 +1,77 @@ +/*! + * depd + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = depd + +/** + * Create deprecate for namespace in caller. + */ + +function depd (namespace) { + if (!namespace) { + throw new TypeError('argument namespace is required') + } + + function deprecate (message) { + // no-op in browser + } + + deprecate._file = undefined + deprecate._ignored = true + deprecate._namespace = namespace + deprecate._traced = false + deprecate._warned = Object.create(null) + + deprecate.function = wrapfunction + deprecate.property = wrapproperty + + return deprecate +} + +/** + * Return a wrapped function in a deprecation message. + * + * This is a no-op version of the wrapper, which does nothing but call + * validation. + */ + +function wrapfunction (fn, message) { + if (typeof fn !== 'function') { + throw new TypeError('argument fn must be a function') + } + + return fn +} + +/** + * Wrap property in a deprecation message. + * + * This is a no-op version of the wrapper, which does nothing but call + * validation. + */ + +function wrapproperty (obj, prop, message) { + if (!obj || (typeof obj !== 'object' && typeof obj !== 'function')) { + throw new TypeError('argument obj must be object') + } + + var descriptor = Object.getOwnPropertyDescriptor(obj, prop) + + if (!descriptor) { + throw new TypeError('must call property on owner object') + } + + if (!descriptor.configurable) { + throw new TypeError('property must be configurable') + } +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/depd/lib/compat/callsite-tostring.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/depd/lib/compat/callsite-tostring.js new file mode 100644 index 00000000..73186dc6 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/depd/lib/compat/callsite-tostring.js @@ -0,0 +1,103 @@ +/*! + * depd + * Copyright(c) 2014 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + */ + +module.exports = callSiteToString + +/** + * Format a CallSite file location to a string. + */ + +function callSiteFileLocation (callSite) { + var fileName + var fileLocation = '' + + if (callSite.isNative()) { + fileLocation = 'native' + } else if (callSite.isEval()) { + fileName = callSite.getScriptNameOrSourceURL() + if (!fileName) { + fileLocation = callSite.getEvalOrigin() + } + } else { + fileName = callSite.getFileName() + } + + if (fileName) { + fileLocation += fileName + + var lineNumber = callSite.getLineNumber() + if (lineNumber != null) { + fileLocation += ':' + lineNumber + + var columnNumber = callSite.getColumnNumber() + if (columnNumber) { + fileLocation += ':' + columnNumber + } + } + } + + return fileLocation || 'unknown source' +} + +/** + * Format a CallSite to a string. + */ + +function callSiteToString (callSite) { + var addSuffix = true + var fileLocation = callSiteFileLocation(callSite) + var functionName = callSite.getFunctionName() + var isConstructor = callSite.isConstructor() + var isMethodCall = !(callSite.isToplevel() || isConstructor) + var line = '' + + if (isMethodCall) { + var methodName = callSite.getMethodName() + var typeName = getConstructorName(callSite) + + if (functionName) { + if (typeName && functionName.indexOf(typeName) !== 0) { + line += typeName + '.' + } + + line += functionName + + if (methodName && functionName.lastIndexOf('.' + methodName) !== functionName.length - methodName.length - 1) { + line += ' [as ' + methodName + ']' + } + } else { + line += typeName + '.' + (methodName || '') + } + } else if (isConstructor) { + line += 'new ' + (functionName || '') + } else if (functionName) { + line += functionName + } else { + addSuffix = false + line += fileLocation + } + + if (addSuffix) { + line += ' (' + fileLocation + ')' + } + + return line +} + +/** + * Get constructor name of reviver. + */ + +function getConstructorName (obj) { + var receiver = obj.receiver + return (receiver.constructor && receiver.constructor.name) || null +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/depd/lib/compat/event-listener-count.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/depd/lib/compat/event-listener-count.js new file mode 100644 index 00000000..3a8925d1 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/depd/lib/compat/event-listener-count.js @@ -0,0 +1,22 @@ +/*! + * depd + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = eventListenerCount + +/** + * Get the count of listeners on an event emitter of a specific type. + */ + +function eventListenerCount (emitter, type) { + return emitter.listeners(type).length +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/depd/lib/compat/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/depd/lib/compat/index.js new file mode 100644 index 00000000..955b3336 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/depd/lib/compat/index.js @@ -0,0 +1,79 @@ +/*! + * depd + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var EventEmitter = require('events').EventEmitter + +/** + * Module exports. + * @public + */ + +lazyProperty(module.exports, 'callSiteToString', function callSiteToString () { + var limit = Error.stackTraceLimit + var obj = {} + var prep = Error.prepareStackTrace + + function prepareObjectStackTrace (obj, stack) { + return stack + } + + Error.prepareStackTrace = prepareObjectStackTrace + Error.stackTraceLimit = 2 + + // capture the stack + Error.captureStackTrace(obj) + + // slice the stack + var stack = obj.stack.slice() + + Error.prepareStackTrace = prep + Error.stackTraceLimit = limit + + return stack[0].toString ? toString : require('./callsite-tostring') +}) + +lazyProperty(module.exports, 'eventListenerCount', function eventListenerCount () { + return EventEmitter.listenerCount || require('./event-listener-count') +}) + +/** + * Define a lazy property. + */ + +function lazyProperty (obj, prop, getter) { + function get () { + var val = getter() + + Object.defineProperty(obj, prop, { + configurable: true, + enumerable: true, + value: val + }) + + return val + } + + Object.defineProperty(obj, prop, { + configurable: true, + enumerable: true, + get: get + }) +} + +/** + * Call toString() on the obj + */ + +function toString (obj) { + return obj.toString() +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/depd/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/depd/package.json new file mode 100644 index 00000000..e0c114fc --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/depd/package.json @@ -0,0 +1,76 @@ +{ + "_from": "depd@^1.1.2", + "_id": "depd@1.1.2", + "_inBundle": false, + "_integrity": "sha1-m81S4UwJd2PnSbJ0xDRu0uVgtak=", + "_location": "/agentkeepalive/depd", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "depd@^1.1.2", + "name": "depd", + "escapedName": "depd", + "rawSpec": "^1.1.2", + "saveSpec": null, + "fetchSpec": "^1.1.2" + }, + "_requiredBy": [ + "/agentkeepalive" + ], + "_resolved": "https://registry.npmjs.org/depd/-/depd-1.1.2.tgz", + "_shasum": "9bcd52e14c097763e749b274c4346ed2e560b5a9", + "_spec": "depd@^1.1.2", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\agentkeepalive", + "author": { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + "browser": "lib/browser/index.js", + "bugs": { + "url": "https://github.com/dougwilson/nodejs-depd/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Deprecate all the things", + "devDependencies": { + "beautify-benchmark": "0.2.4", + "benchmark": "2.1.4", + "eslint": "3.19.0", + "eslint-config-standard": "7.1.0", + "eslint-plugin-markdown": "1.0.0-beta.7", + "eslint-plugin-promise": "3.6.0", + "eslint-plugin-standard": "3.0.1", + "istanbul": "0.4.5", + "mocha": "~1.21.5" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "lib/", + "History.md", + "LICENSE", + "index.js", + "Readme.md" + ], + "homepage": "https://github.com/dougwilson/nodejs-depd#readme", + "keywords": [ + "deprecate", + "deprecated" + ], + "license": "MIT", + "name": "depd", + "repository": { + "type": "git", + "url": "git+https://github.com/dougwilson/nodejs-depd.git" + }, + "scripts": { + "bench": "node benchmark/index.js", + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --bail test/", + "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --no-exit test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot test/" + }, + "version": "1.1.2" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/ms/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/ms/index.js new file mode 100644 index 00000000..c4498bcc --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/ms/index.js @@ -0,0 +1,162 @@ +/** + * Helpers. + */ + +var s = 1000; +var m = s * 60; +var h = m * 60; +var d = h * 24; +var w = d * 7; +var y = d * 365.25; + +/** + * Parse or format the given `val`. + * + * Options: + * + * - `long` verbose formatting [false] + * + * @param {String|Number} val + * @param {Object} [options] + * @throws {Error} throw an error if val is not a non-empty string or a number + * @return {String|Number} + * @api public + */ + +module.exports = function(val, options) { + options = options || {}; + var type = typeof val; + if (type === 'string' && val.length > 0) { + return parse(val); + } else if (type === 'number' && isFinite(val)) { + return options.long ? fmtLong(val) : fmtShort(val); + } + throw new Error( + 'val is not a non-empty string or a valid number. val=' + + JSON.stringify(val) + ); +}; + +/** + * Parse the given `str` and return milliseconds. + * + * @param {String} str + * @return {Number} + * @api private + */ + +function parse(str) { + str = String(str); + if (str.length > 100) { + return; + } + var match = /^(-?(?:\d+)?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|weeks?|w|years?|yrs?|y)?$/i.exec( + str + ); + if (!match) { + return; + } + var n = parseFloat(match[1]); + var type = (match[2] || 'ms').toLowerCase(); + switch (type) { + case 'years': + case 'year': + case 'yrs': + case 'yr': + case 'y': + return n * y; + case 'weeks': + case 'week': + case 'w': + return n * w; + case 'days': + case 'day': + case 'd': + return n * d; + case 'hours': + case 'hour': + case 'hrs': + case 'hr': + case 'h': + return n * h; + case 'minutes': + case 'minute': + case 'mins': + case 'min': + case 'm': + return n * m; + case 'seconds': + case 'second': + case 'secs': + case 'sec': + case 's': + return n * s; + case 'milliseconds': + case 'millisecond': + case 'msecs': + case 'msec': + case 'ms': + return n; + default: + return undefined; + } +} + +/** + * Short format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function fmtShort(ms) { + var msAbs = Math.abs(ms); + if (msAbs >= d) { + return Math.round(ms / d) + 'd'; + } + if (msAbs >= h) { + return Math.round(ms / h) + 'h'; + } + if (msAbs >= m) { + return Math.round(ms / m) + 'm'; + } + if (msAbs >= s) { + return Math.round(ms / s) + 's'; + } + return ms + 'ms'; +} + +/** + * Long format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function fmtLong(ms) { + var msAbs = Math.abs(ms); + if (msAbs >= d) { + return plural(ms, msAbs, d, 'day'); + } + if (msAbs >= h) { + return plural(ms, msAbs, h, 'hour'); + } + if (msAbs >= m) { + return plural(ms, msAbs, m, 'minute'); + } + if (msAbs >= s) { + return plural(ms, msAbs, s, 'second'); + } + return ms + ' ms'; +} + +/** + * Pluralization helper. + */ + +function plural(ms, msAbs, n, name) { + var isPlural = msAbs >= n * 1.5; + return Math.round(ms / n) + ' ' + name + (isPlural ? 's' : ''); +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/ms/license.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/ms/license.md new file mode 100644 index 00000000..69b61253 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/ms/license.md @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2016 Zeit, Inc. + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/ms/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/ms/package.json new file mode 100644 index 00000000..18587812 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/ms/package.json @@ -0,0 +1,69 @@ +{ + "_from": "ms@2.1.2", + "_id": "ms@2.1.2", + "_inBundle": false, + "_integrity": "sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==", + "_location": "/agentkeepalive/ms", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "ms@2.1.2", + "name": "ms", + "escapedName": "ms", + "rawSpec": "2.1.2", + "saveSpec": null, + "fetchSpec": "2.1.2" + }, + "_requiredBy": [ + "/agentkeepalive/debug" + ], + "_resolved": "https://registry.npmjs.org/ms/-/ms-2.1.2.tgz", + "_shasum": "d09d1f357b443f493382a8eb3ccd183872ae6009", + "_spec": "ms@2.1.2", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\agentkeepalive\\node_modules\\debug", + "bugs": { + "url": "https://github.com/zeit/ms/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Tiny millisecond conversion utility", + "devDependencies": { + "eslint": "4.12.1", + "expect.js": "0.3.1", + "husky": "0.14.3", + "lint-staged": "5.0.0", + "mocha": "4.0.1" + }, + "eslintConfig": { + "extends": "eslint:recommended", + "env": { + "node": true, + "es6": true + } + }, + "files": [ + "index.js" + ], + "homepage": "https://github.com/zeit/ms#readme", + "license": "MIT", + "lint-staged": { + "*.js": [ + "npm run lint", + "prettier --single-quote --write", + "git add" + ] + }, + "main": "./index", + "name": "ms", + "repository": { + "type": "git", + "url": "git+https://github.com/zeit/ms.git" + }, + "scripts": { + "lint": "eslint lib/* bin/*", + "precommit": "lint-staged", + "test": "mocha tests.js" + }, + "version": "2.1.2" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/ms/readme.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/ms/readme.md new file mode 100644 index 00000000..9a1996b1 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/node_modules/ms/readme.md @@ -0,0 +1,60 @@ +# ms + +[![Build Status](https://travis-ci.org/zeit/ms.svg?branch=master)](https://travis-ci.org/zeit/ms) +[![Join the community on Spectrum](https://withspectrum.github.io/badge/badge.svg)](https://spectrum.chat/zeit) + +Use this package to easily convert various time formats to milliseconds. + +## Examples + +```js +ms('2 days') // 172800000 +ms('1d') // 86400000 +ms('10h') // 36000000 +ms('2.5 hrs') // 9000000 +ms('2h') // 7200000 +ms('1m') // 60000 +ms('5s') // 5000 +ms('1y') // 31557600000 +ms('100') // 100 +ms('-3 days') // -259200000 +ms('-1h') // -3600000 +ms('-200') // -200 +``` + +### Convert from Milliseconds + +```js +ms(60000) // "1m" +ms(2 * 60000) // "2m" +ms(-3 * 60000) // "-3m" +ms(ms('10 hours')) // "10h" +``` + +### Time Format Written-Out + +```js +ms(60000, { long: true }) // "1 minute" +ms(2 * 60000, { long: true }) // "2 minutes" +ms(-3 * 60000, { long: true }) // "-3 minutes" +ms(ms('10 hours'), { long: true }) // "10 hours" +``` + +## Features + +- Works both in [Node.js](https://nodejs.org) and in the browser +- If a number is supplied to `ms`, a string with a unit is returned +- If a string that contains the number is supplied, it returns it as a number (e.g.: it returns `100` for `'100'`) +- If you pass a string with a number and a valid unit, the number of equivalent milliseconds is returned + +## Related Packages + +- [ms.macro](https://github.com/knpwrs/ms.macro) - Run `ms` as a macro at build-time. + +## Caught a Bug? + +1. [Fork](https://help.github.com/articles/fork-a-repo/) this repository to your own GitHub account and then [clone](https://help.github.com/articles/cloning-a-repository/) it to your local device +2. Link the package to the global module directory: `npm link` +3. Within the module you want to test your local development instance of ms, just link it to the dependencies: `npm link ms`. Instead of the default one from npm, Node.js will now use your clone of ms! + +As always, you can run the tests using: `npm test` diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/package.json new file mode 100644 index 00000000..6a1fc43c --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/agentkeepalive/package.json @@ -0,0 +1,96 @@ +{ + "_from": "agentkeepalive@^4.1.3", + "_id": "agentkeepalive@4.2.1", + "_inBundle": false, + "_integrity": "sha512-Zn4cw2NEqd+9fiSVWMscnjyQ1a8Yfoc5oBajLeo5w+YBHgDUcEBY2hS4YpTz6iN5f/2zQiktcuM6tS8x1p9dpA==", + "_location": "/agentkeepalive", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "agentkeepalive@^4.1.3", + "name": "agentkeepalive", + "escapedName": "agentkeepalive", + "rawSpec": "^4.1.3", + "saveSpec": null, + "fetchSpec": "^4.1.3" + }, + "_requiredBy": [ + "/make-fetch-happen" + ], + "_resolved": "https://registry.npmjs.org/agentkeepalive/-/agentkeepalive-4.2.1.tgz", + "_shasum": "a7975cbb9f83b367f06c90cc51ff28fe7d499717", + "_spec": "agentkeepalive@^4.1.3", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\make-fetch-happen", + "author": { + "name": "fengmk2", + "email": "fengmk2@gmail.com", + "url": "https://fengmk2.com" + }, + "browser": "browser.js", + "bugs": { + "url": "https://github.com/node-modules/agentkeepalive/issues" + }, + "bundleDependencies": false, + "ci": { + "type": "github", + "os": { + "github": "linux" + }, + "version": "8, 10, 12, 14, 16" + }, + "dependencies": { + "debug": "^4.1.0", + "depd": "^1.1.2", + "humanize-ms": "^1.2.1" + }, + "deprecated": false, + "description": "Missing keepalive http.Agent", + "devDependencies": { + "autod": "^3.0.1", + "coffee": "^5.3.0", + "cross-env": "^6.0.3", + "egg-bin": "^4.9.0", + "egg-ci": "^1.10.0", + "eslint": "^5.7.0", + "eslint-config-egg": "^7.1.0", + "mm": "^2.4.1", + "pedding": "^1.1.0", + "typescript": "^3.8.3" + }, + "engines": { + "node": ">= 8.0.0" + }, + "files": [ + "index.js", + "index.d.ts", + "browser.js", + "lib" + ], + "homepage": "https://github.com/node-modules/agentkeepalive#readme", + "keywords": [ + "http", + "https", + "agent", + "keepalive", + "agentkeepalive", + "HttpAgent", + "HttpsAgent" + ], + "license": "MIT", + "main": "index.js", + "name": "agentkeepalive", + "repository": { + "type": "git", + "url": "git://github.com/node-modules/agentkeepalive.git" + }, + "scripts": { + "autod": "autod", + "ci": "npm run lint && npm run cov", + "cov": "cross-env DEBUG=agentkeepalive egg-bin cov --full-trace", + "lint": "eslint lib test index.js", + "test": "npm run lint && egg-bin test --full-trace", + "test-local": "egg-bin test --full-trace" + }, + "version": "4.2.1" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/aggregate-error/index.d.ts b/25_03_11/frontend_vizsgafeladat/backend/node_modules/aggregate-error/index.d.ts new file mode 100644 index 00000000..502bf7ad --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/aggregate-error/index.d.ts @@ -0,0 +1,51 @@ +/** +Create an error from multiple errors. +*/ +declare class AggregateError extends Error implements Iterable { + readonly name: 'AggregateError'; + + /** + @param errors - If a string, a new `Error` is created with the string as the error message. If a non-Error object, a new `Error` is created with all properties from the object copied over. + @returns An Error that is also an [`Iterable`](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Guide/Iterators_and_Generators#Iterables) for the individual errors. + + @example + ``` + import AggregateError = require('aggregate-error'); + + const error = new AggregateError([new Error('foo'), 'bar', {message: 'baz'}]); + + throw error; + + // AggregateError: + // Error: foo + // at Object. (/Users/sindresorhus/dev/aggregate-error/example.js:3:33) + // Error: bar + // at Object. (/Users/sindresorhus/dev/aggregate-error/example.js:3:13) + // Error: baz + // at Object. (/Users/sindresorhus/dev/aggregate-error/example.js:3:13) + // at AggregateError (/Users/sindresorhus/dev/aggregate-error/index.js:19:3) + // at Object. (/Users/sindresorhus/dev/aggregate-error/example.js:3:13) + // at Module._compile (module.js:556:32) + // at Object.Module._extensions..js (module.js:565:10) + // at Module.load (module.js:473:32) + // at tryModuleLoad (module.js:432:12) + // at Function.Module._load (module.js:424:3) + // at Module.runMain (module.js:590:10) + // at run (bootstrap_node.js:394:7) + // at startup (bootstrap_node.js:149:9) + + + for (const individualError of error) { + console.log(individualError); + } + //=> [Error: foo] + //=> [Error: bar] + //=> [Error: baz] + ``` + */ + constructor(errors: ReadonlyArray); + + [Symbol.iterator](): IterableIterator; +} + +export = AggregateError; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/aggregate-error/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/aggregate-error/index.js new file mode 100644 index 00000000..ba5bf022 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/aggregate-error/index.js @@ -0,0 +1,47 @@ +'use strict'; +const indentString = require('indent-string'); +const cleanStack = require('clean-stack'); + +const cleanInternalStack = stack => stack.replace(/\s+at .*aggregate-error\/index.js:\d+:\d+\)?/g, ''); + +class AggregateError extends Error { + constructor(errors) { + if (!Array.isArray(errors)) { + throw new TypeError(`Expected input to be an Array, got ${typeof errors}`); + } + + errors = [...errors].map(error => { + if (error instanceof Error) { + return error; + } + + if (error !== null && typeof error === 'object') { + // Handle plain error objects with message property and/or possibly other metadata + return Object.assign(new Error(error.message), error); + } + + return new Error(error); + }); + + let message = errors + .map(error => { + // The `stack` property is not standardized, so we can't assume it exists + return typeof error.stack === 'string' ? cleanInternalStack(cleanStack(error.stack)) : String(error); + }) + .join('\n'); + message = '\n' + indentString(message, 4); + super(message); + + this.name = 'AggregateError'; + + Object.defineProperty(this, '_errors', {value: errors}); + } + + * [Symbol.iterator]() { + for (const error of this._errors) { + yield error; + } + } +} + +module.exports = AggregateError; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/aggregate-error/license b/25_03_11/frontend_vizsgafeladat/backend/node_modules/aggregate-error/license new file mode 100644 index 00000000..e7af2f77 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/aggregate-error/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/aggregate-error/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/aggregate-error/package.json new file mode 100644 index 00000000..260053de --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/aggregate-error/package.json @@ -0,0 +1,73 @@ +{ + "_from": "aggregate-error@^3.0.0", + "_id": "aggregate-error@3.1.0", + "_inBundle": false, + "_integrity": "sha512-4I7Td01quW/RpocfNayFdFVk1qSuoh0E7JrbRJ16nH01HhKFQ88INq9Sd+nd72zqRySlr9BmDA8xlEJ6vJMrYA==", + "_location": "/aggregate-error", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "aggregate-error@^3.0.0", + "name": "aggregate-error", + "escapedName": "aggregate-error", + "rawSpec": "^3.0.0", + "saveSpec": null, + "fetchSpec": "^3.0.0" + }, + "_requiredBy": [ + "/p-map" + ], + "_resolved": "https://registry.npmjs.org/aggregate-error/-/aggregate-error-3.1.0.tgz", + "_shasum": "92670ff50f5359bdb7a3e0d40d0ec30c5737687a", + "_spec": "aggregate-error@^3.0.0", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\p-map", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "sindresorhus.com" + }, + "bugs": { + "url": "https://github.com/sindresorhus/aggregate-error/issues" + }, + "bundleDependencies": false, + "dependencies": { + "clean-stack": "^2.0.0", + "indent-string": "^4.0.0" + }, + "deprecated": false, + "description": "Create an error from multiple errors", + "devDependencies": { + "ava": "^2.4.0", + "tsd": "^0.7.1", + "xo": "^0.25.3" + }, + "engines": { + "node": ">=8" + }, + "files": [ + "index.js", + "index.d.ts" + ], + "homepage": "https://github.com/sindresorhus/aggregate-error#readme", + "keywords": [ + "aggregate", + "error", + "combine", + "multiple", + "many", + "collection", + "iterable", + "iterator" + ], + "license": "MIT", + "name": "aggregate-error", + "repository": { + "type": "git", + "url": "git+https://github.com/sindresorhus/aggregate-error.git" + }, + "scripts": { + "test": "xo && ava && tsd" + }, + "version": "3.1.0" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/aggregate-error/readme.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/aggregate-error/readme.md new file mode 100644 index 00000000..850de98a --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/aggregate-error/readme.md @@ -0,0 +1,61 @@ +# aggregate-error [![Build Status](https://travis-ci.org/sindresorhus/aggregate-error.svg?branch=master)](https://travis-ci.org/sindresorhus/aggregate-error) + +> Create an error from multiple errors + + +## Install + +``` +$ npm install aggregate-error +``` + + +## Usage + +```js +const AggregateError = require('aggregate-error'); + +const error = new AggregateError([new Error('foo'), 'bar', {message: 'baz'}]); + +throw error; +/* +AggregateError: + Error: foo + at Object. (/Users/sindresorhus/dev/aggregate-error/example.js:3:33) + Error: bar + at Object. (/Users/sindresorhus/dev/aggregate-error/example.js:3:13) + Error: baz + at Object. (/Users/sindresorhus/dev/aggregate-error/example.js:3:13) + at AggregateError (/Users/sindresorhus/dev/aggregate-error/index.js:19:3) + at Object. (/Users/sindresorhus/dev/aggregate-error/example.js:3:13) + at Module._compile (module.js:556:32) + at Object.Module._extensions..js (module.js:565:10) + at Module.load (module.js:473:32) + at tryModuleLoad (module.js:432:12) + at Function.Module._load (module.js:424:3) + at Module.runMain (module.js:590:10) + at run (bootstrap_node.js:394:7) + at startup (bootstrap_node.js:149:9) +*/ + +for (const individualError of error) { + console.log(individualError); +} +//=> [Error: foo] +//=> [Error: bar] +//=> [Error: baz] +``` + + +## API + +### AggregateError(errors) + +Returns an `Error` that is also an [`Iterable`](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Guide/Iterators_and_Generators#Iterables) for the individual errors. + +#### errors + +Type: `Array` + +If a string, a new `Error` is created with the string as the error message.
+If a non-Error object, a new `Error` is created with all properties from the object copied over. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-align/CHANGELOG.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-align/CHANGELOG.md new file mode 100644 index 00000000..36eeb52c --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-align/CHANGELOG.md @@ -0,0 +1,58 @@ +# Changelog + +All notable changes to this project will be documented in this file. See [standard-version](https://github.com/conventional-changelog/standard-version) for commit guidelines. + +### [3.0.1](https://github.com/nexdrew/ansi-align/compare/v3.0.0...v3.0.1) (2021-09-27) + + +### Bug Fixes + +* **package:** update string-width to version 4.1.0 ([#52](https://github.com/nexdrew/ansi-align/issues/52)) ([ab5b733](https://github.com/nexdrew/ansi-align/commit/ab5b733b1c30eef87b75e15459f2216db28d7ed3)) + + +# [3.0.0](https://github.com/nexdrew/ansi-align/compare/v2.0.0...v3.0.0) (2018-12-17) + + +### Bug Fixes + +* **package:** update string-width to version 3.0.0 ([#50](https://github.com/nexdrew/ansi-align/issues/50)) ([67f0d8f](https://github.com/nexdrew/ansi-align/commit/67f0d8f)) + + +### BREAKING CHANGES + +* **package:** Node 4 no longer supported, please update to Node 6+ or use ansi-align@2.0.0 + + + + +# [2.0.0](https://github.com/nexdrew/ansi-align/compare/v1.1.0...v2.0.0) (2017-05-01) + + +### Features + +* ES2015ify, dropping support for Node <4 ([#30](https://github.com/nexdrew/ansi-align/issues/30)) ([7b43f48](https://github.com/nexdrew/ansi-align/commit/7b43f48)) + + +### BREAKING CHANGES + +* Node 0.10 or 0.12 no longer supported, please update to Node 4+ or use ansi-align@1.1.0 + + + + +# [1.1.0](https://github.com/nexdrew/ansi-align/compare/v1.0.0...v1.1.0) (2016-06-06) + + +### Features + +* support left-alignment as no-op ([#3](https://github.com/nexdrew/ansi-align/issues/3)) ([e581db6](https://github.com/nexdrew/ansi-align/commit/e581db6)) + + + + +# 1.0.0 (2016-04-30) + + +### Features + +* initial commit ([1914d90](https://github.com/nexdrew/ansi-align/commit/1914d90)) diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-align/LICENSE b/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-align/LICENSE new file mode 100644 index 00000000..ab601b65 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-align/LICENSE @@ -0,0 +1,13 @@ +Copyright (c) 2016, Contributors + +Permission to use, copy, modify, and/or distribute this software for any purpose +with or without fee is hereby granted, provided that the above copyright notice +and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH +REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND +FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT, +INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS +OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER +TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF +THIS SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-align/README.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-align/README.md new file mode 100644 index 00000000..5e516825 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-align/README.md @@ -0,0 +1,80 @@ +# ansi-align + +> align-text with ANSI support for CLIs + +[![Build Status](https://travis-ci.org/nexdrew/ansi-align.svg?branch=master)](https://travis-ci.org/nexdrew/ansi-align) +[![Coverage Status](https://coveralls.io/repos/github/nexdrew/ansi-align/badge.svg?branch=master)](https://coveralls.io/github/nexdrew/ansi-align?branch=master) +[![Standard Version](https://img.shields.io/badge/release-standard%20version-brightgreen.svg)](https://github.com/conventional-changelog/standard-version) +[![Greenkeeper badge](https://badges.greenkeeper.io/nexdrew/ansi-align.svg)](https://greenkeeper.io/) + +Easily center- or right- align a block of text, carefully ignoring ANSI escape codes. + +E.g. turn this: + +ansi text block no alignment :( + +Into this: + +ansi text block center aligned! + +## Install + +```sh +npm install --save ansi-align +``` + +```js +var ansiAlign = require('ansi-align') +``` + +## API + +### `ansiAlign(text, [opts])` + +Align the given text per the line with the greatest [`string-width`](https://github.com/sindresorhus/string-width), returning a new string (or array). + +#### Arguments + +- `text`: required, string or array + + The text to align. If a string is given, it will be split using either the `opts.split` value or `'\n'` by default. If an array is given, a different array of modified strings will be returned. + +- `opts`: optional, object + + Options to change behavior, see below. + +#### Options + +- `opts.align`: string, default `'center'` + + The alignment mode. Use `'center'` for center-alignment, `'right'` for right-alignment, or `'left'` for left-alignment. Note that the given `text` is assumed to be left-aligned already, so specifying `align: 'left'` just returns the `text` as is (no-op). + +- `opts.split`: string or RegExp, default `'\n'` + + The separator to use when splitting the text. Only used if text is given as a string. + +- `opts.pad`: string, default `' '` + + The value used to left-pad (prepend to) lines of lesser width. Will be repeated as necessary to adjust alignment to the line with the greatest width. + +### `ansiAlign.center(text)` + +Alias for `ansiAlign(text, { align: 'center' })`. + +### `ansiAlign.right(text)` + +Alias for `ansiAlign(text, { align: 'right' })`. + +### `ansiAlign.left(text)` + +Alias for `ansiAlign(text, { align: 'left' })`, which is a no-op. + +## Similar Packages + +- [`center-align`](https://github.com/jonschlinkert/center-align): Very close to this package, except it doesn't support ANSI codes. +- [`left-pad`](https://github.com/camwest/left-pad): Great for left-padding but does not support center alignment or ANSI codes. +- Pretty much anything by the [chalk](https://github.com/chalk) team + +## License + +ISC © Contributors diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-align/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-align/index.js new file mode 100644 index 00000000..67fa826d --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-align/index.js @@ -0,0 +1,61 @@ +'use strict' + +const stringWidth = require('string-width') + +function ansiAlign (text, opts) { + if (!text) return text + + opts = opts || {} + const align = opts.align || 'center' + + // short-circuit `align: 'left'` as no-op + if (align === 'left') return text + + const split = opts.split || '\n' + const pad = opts.pad || ' ' + const widthDiffFn = align !== 'right' ? halfDiff : fullDiff + + let returnString = false + if (!Array.isArray(text)) { + returnString = true + text = String(text).split(split) + } + + let width + let maxWidth = 0 + text = text.map(function (str) { + str = String(str) + width = stringWidth(str) + maxWidth = Math.max(width, maxWidth) + return { + str, + width + } + }).map(function (obj) { + return new Array(widthDiffFn(maxWidth, obj.width) + 1).join(pad) + obj.str + }) + + return returnString ? text.join(split) : text +} + +ansiAlign.left = function left (text) { + return ansiAlign(text, { align: 'left' }) +} + +ansiAlign.center = function center (text) { + return ansiAlign(text, { align: 'center' }) +} + +ansiAlign.right = function right (text) { + return ansiAlign(text, { align: 'right' }) +} + +module.exports = ansiAlign + +function halfDiff (maxWidth, curWidth) { + return Math.floor((maxWidth - curWidth) / 2) +} + +function fullDiff (maxWidth, curWidth) { + return maxWidth - curWidth +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-align/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-align/package.json new file mode 100644 index 00000000..7487e5ad --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-align/package.json @@ -0,0 +1,70 @@ +{ + "_from": "ansi-align@^3.0.0", + "_id": "ansi-align@3.0.1", + "_inBundle": false, + "_integrity": "sha512-IOfwwBF5iczOjp/WeY4YxyjqAFMQoZufdQWDd19SEExbVLNXqvpzSJ/M7Za4/sCPmQ0+GRquoA7bGcINcxew6w==", + "_location": "/ansi-align", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "ansi-align@^3.0.0", + "name": "ansi-align", + "escapedName": "ansi-align", + "rawSpec": "^3.0.0", + "saveSpec": null, + "fetchSpec": "^3.0.0" + }, + "_requiredBy": [ + "/boxen" + ], + "_resolved": "https://registry.npmjs.org/ansi-align/-/ansi-align-3.0.1.tgz", + "_shasum": "0cdf12e111ace773a86e9a1fad1225c43cb19a59", + "_spec": "ansi-align@^3.0.0", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\boxen", + "author": { + "name": "nexdrew" + }, + "bugs": { + "url": "https://github.com/nexdrew/ansi-align/issues" + }, + "bundleDependencies": false, + "dependencies": { + "string-width": "^4.1.0" + }, + "deprecated": false, + "description": "align-text with ANSI support for CLIs", + "devDependencies": { + "ava": "^2.0.0", + "chalk": "^2.4.2", + "coveralls": "^3.0.3", + "nyc": "^14.0.0", + "standard": "^14.0.0", + "standard-version": "^7.0.0" + }, + "files": [ + "index.js" + ], + "homepage": "https://github.com/nexdrew/ansi-align#readme", + "keywords": [ + "ansi", + "align", + "cli", + "center", + "pad" + ], + "license": "ISC", + "main": "index.js", + "name": "ansi-align", + "repository": { + "type": "git", + "url": "git+https://github.com/nexdrew/ansi-align.git" + }, + "scripts": { + "coverage": "nyc report --reporter=text-lcov | coveralls", + "pretest": "standard", + "release": "standard-version", + "test": "nyc ava" + }, + "version": "3.0.1" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-regex/index.d.ts b/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-regex/index.d.ts new file mode 100644 index 00000000..2dbf6af2 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-regex/index.d.ts @@ -0,0 +1,37 @@ +declare namespace ansiRegex { + interface Options { + /** + Match only the first ANSI escape. + + @default false + */ + onlyFirst: boolean; + } +} + +/** +Regular expression for matching ANSI escape codes. + +@example +``` +import ansiRegex = require('ansi-regex'); + +ansiRegex().test('\u001B[4mcake\u001B[0m'); +//=> true + +ansiRegex().test('cake'); +//=> false + +'\u001B[4mcake\u001B[0m'.match(ansiRegex()); +//=> ['\u001B[4m', '\u001B[0m'] + +'\u001B[4mcake\u001B[0m'.match(ansiRegex({onlyFirst: true})); +//=> ['\u001B[4m'] + +'\u001B]8;;https://github.com\u0007click\u001B]8;;\u0007'.match(ansiRegex()); +//=> ['\u001B]8;;https://github.com\u0007', '\u001B]8;;\u0007'] +``` +*/ +declare function ansiRegex(options?: ansiRegex.Options): RegExp; + +export = ansiRegex; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-regex/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-regex/index.js new file mode 100644 index 00000000..616ff837 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-regex/index.js @@ -0,0 +1,10 @@ +'use strict'; + +module.exports = ({onlyFirst = false} = {}) => { + const pattern = [ + '[\\u001B\\u009B][[\\]()#;?]*(?:(?:(?:(?:;[-a-zA-Z\\d\\/#&.:=?%@~_]+)*|[a-zA-Z\\d]+(?:;[-a-zA-Z\\d\\/#&.:=?%@~_]*)*)?\\u0007)', + '(?:(?:\\d{1,4}(?:;\\d{0,4})*)?[\\dA-PR-TZcf-ntqry=><~]))' + ].join('|'); + + return new RegExp(pattern, onlyFirst ? undefined : 'g'); +}; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-regex/license b/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-regex/license new file mode 100644 index 00000000..e7af2f77 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-regex/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-regex/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-regex/package.json new file mode 100644 index 00000000..26c79908 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-regex/package.json @@ -0,0 +1,87 @@ +{ + "_from": "ansi-regex@^5.0.1", + "_id": "ansi-regex@5.0.1", + "_inBundle": false, + "_integrity": "sha512-quJQXlTSUGL2LH9SUXo8VwsY4soanhgo6LNSm84E1LBcE8s3O0wpdiRzyR9z/ZZJMlMWv37qOOb9pdJlMUEKFQ==", + "_location": "/ansi-regex", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "ansi-regex@^5.0.1", + "name": "ansi-regex", + "escapedName": "ansi-regex", + "rawSpec": "^5.0.1", + "saveSpec": null, + "fetchSpec": "^5.0.1" + }, + "_requiredBy": [ + "/strip-ansi" + ], + "_resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-5.0.1.tgz", + "_shasum": "082cb2c89c9fe8659a311a53bd6a4dc5301db304", + "_spec": "ansi-regex@^5.0.1", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\strip-ansi", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "sindresorhus.com" + }, + "bugs": { + "url": "https://github.com/chalk/ansi-regex/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Regular expression for matching ANSI escape codes", + "devDependencies": { + "ava": "^2.4.0", + "tsd": "^0.9.0", + "xo": "^0.25.3" + }, + "engines": { + "node": ">=8" + }, + "files": [ + "index.js", + "index.d.ts" + ], + "homepage": "https://github.com/chalk/ansi-regex#readme", + "keywords": [ + "ansi", + "styles", + "color", + "colour", + "colors", + "terminal", + "console", + "cli", + "string", + "tty", + "escape", + "formatting", + "rgb", + "256", + "shell", + "xterm", + "command-line", + "text", + "regex", + "regexp", + "re", + "match", + "test", + "find", + "pattern" + ], + "license": "MIT", + "name": "ansi-regex", + "repository": { + "type": "git", + "url": "git+https://github.com/chalk/ansi-regex.git" + }, + "scripts": { + "test": "xo && ava && tsd", + "view-supported": "node fixtures/view-codes.js" + }, + "version": "5.0.1" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-regex/readme.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-regex/readme.md new file mode 100644 index 00000000..4d848bc3 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-regex/readme.md @@ -0,0 +1,78 @@ +# ansi-regex + +> Regular expression for matching [ANSI escape codes](https://en.wikipedia.org/wiki/ANSI_escape_code) + + +## Install + +``` +$ npm install ansi-regex +``` + + +## Usage + +```js +const ansiRegex = require('ansi-regex'); + +ansiRegex().test('\u001B[4mcake\u001B[0m'); +//=> true + +ansiRegex().test('cake'); +//=> false + +'\u001B[4mcake\u001B[0m'.match(ansiRegex()); +//=> ['\u001B[4m', '\u001B[0m'] + +'\u001B[4mcake\u001B[0m'.match(ansiRegex({onlyFirst: true})); +//=> ['\u001B[4m'] + +'\u001B]8;;https://github.com\u0007click\u001B]8;;\u0007'.match(ansiRegex()); +//=> ['\u001B]8;;https://github.com\u0007', '\u001B]8;;\u0007'] +``` + + +## API + +### ansiRegex(options?) + +Returns a regex for matching ANSI escape codes. + +#### options + +Type: `object` + +##### onlyFirst + +Type: `boolean`
+Default: `false` *(Matches any ANSI escape codes in a string)* + +Match only the first ANSI escape. + + +## FAQ + +### Why do you test for codes not in the ECMA 48 standard? + +Some of the codes we run as a test are codes that we acquired finding various lists of non-standard or manufacturer specific codes. We test for both standard and non-standard codes, as most of them follow the same or similar format and can be safely matched in strings without the risk of removing actual string content. There are a few non-standard control codes that do not follow the traditional format (i.e. they end in numbers) thus forcing us to exclude them from the test because we cannot reliably match them. + +On the historical side, those ECMA standards were established in the early 90's whereas the VT100, for example, was designed in the mid/late 70's. At that point in time, control codes were still pretty ungoverned and engineers used them for a multitude of things, namely to activate hardware ports that may have been proprietary. Somewhere else you see a similar 'anarchy' of codes is in the x86 architecture for processors; there are a ton of "interrupts" that can mean different things on certain brands of processors, most of which have been phased out. + + +## Maintainers + +- [Sindre Sorhus](https://github.com/sindresorhus) +- [Josh Junon](https://github.com/qix-) + + +--- + +
+ + Get professional support for this package with a Tidelift subscription + +
+ + Tidelift helps make open source sustainable for maintainers while giving companies
assurances about security, maintenance, and licensing for their dependencies. + +
diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-styles/index.d.ts b/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-styles/index.d.ts new file mode 100644 index 00000000..44a907e5 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-styles/index.d.ts @@ -0,0 +1,345 @@ +declare type CSSColor = + | 'aliceblue' + | 'antiquewhite' + | 'aqua' + | 'aquamarine' + | 'azure' + | 'beige' + | 'bisque' + | 'black' + | 'blanchedalmond' + | 'blue' + | 'blueviolet' + | 'brown' + | 'burlywood' + | 'cadetblue' + | 'chartreuse' + | 'chocolate' + | 'coral' + | 'cornflowerblue' + | 'cornsilk' + | 'crimson' + | 'cyan' + | 'darkblue' + | 'darkcyan' + | 'darkgoldenrod' + | 'darkgray' + | 'darkgreen' + | 'darkgrey' + | 'darkkhaki' + | 'darkmagenta' + | 'darkolivegreen' + | 'darkorange' + | 'darkorchid' + | 'darkred' + | 'darksalmon' + | 'darkseagreen' + | 'darkslateblue' + | 'darkslategray' + | 'darkslategrey' + | 'darkturquoise' + | 'darkviolet' + | 'deeppink' + | 'deepskyblue' + | 'dimgray' + | 'dimgrey' + | 'dodgerblue' + | 'firebrick' + | 'floralwhite' + | 'forestgreen' + | 'fuchsia' + | 'gainsboro' + | 'ghostwhite' + | 'gold' + | 'goldenrod' + | 'gray' + | 'green' + | 'greenyellow' + | 'grey' + | 'honeydew' + | 'hotpink' + | 'indianred' + | 'indigo' + | 'ivory' + | 'khaki' + | 'lavender' + | 'lavenderblush' + | 'lawngreen' + | 'lemonchiffon' + | 'lightblue' + | 'lightcoral' + | 'lightcyan' + | 'lightgoldenrodyellow' + | 'lightgray' + | 'lightgreen' + | 'lightgrey' + | 'lightpink' + | 'lightsalmon' + | 'lightseagreen' + | 'lightskyblue' + | 'lightslategray' + | 'lightslategrey' + | 'lightsteelblue' + | 'lightyellow' + | 'lime' + | 'limegreen' + | 'linen' + | 'magenta' + | 'maroon' + | 'mediumaquamarine' + | 'mediumblue' + | 'mediumorchid' + | 'mediumpurple' + | 'mediumseagreen' + | 'mediumslateblue' + | 'mediumspringgreen' + | 'mediumturquoise' + | 'mediumvioletred' + | 'midnightblue' + | 'mintcream' + | 'mistyrose' + | 'moccasin' + | 'navajowhite' + | 'navy' + | 'oldlace' + | 'olive' + | 'olivedrab' + | 'orange' + | 'orangered' + | 'orchid' + | 'palegoldenrod' + | 'palegreen' + | 'paleturquoise' + | 'palevioletred' + | 'papayawhip' + | 'peachpuff' + | 'peru' + | 'pink' + | 'plum' + | 'powderblue' + | 'purple' + | 'rebeccapurple' + | 'red' + | 'rosybrown' + | 'royalblue' + | 'saddlebrown' + | 'salmon' + | 'sandybrown' + | 'seagreen' + | 'seashell' + | 'sienna' + | 'silver' + | 'skyblue' + | 'slateblue' + | 'slategray' + | 'slategrey' + | 'snow' + | 'springgreen' + | 'steelblue' + | 'tan' + | 'teal' + | 'thistle' + | 'tomato' + | 'turquoise' + | 'violet' + | 'wheat' + | 'white' + | 'whitesmoke' + | 'yellow' + | 'yellowgreen'; + +declare namespace ansiStyles { + interface ColorConvert { + /** + The RGB color space. + + @param red - (`0`-`255`) + @param green - (`0`-`255`) + @param blue - (`0`-`255`) + */ + rgb(red: number, green: number, blue: number): string; + + /** + The RGB HEX color space. + + @param hex - A hexadecimal string containing RGB data. + */ + hex(hex: string): string; + + /** + @param keyword - A CSS color name. + */ + keyword(keyword: CSSColor): string; + + /** + The HSL color space. + + @param hue - (`0`-`360`) + @param saturation - (`0`-`100`) + @param lightness - (`0`-`100`) + */ + hsl(hue: number, saturation: number, lightness: number): string; + + /** + The HSV color space. + + @param hue - (`0`-`360`) + @param saturation - (`0`-`100`) + @param value - (`0`-`100`) + */ + hsv(hue: number, saturation: number, value: number): string; + + /** + The HSV color space. + + @param hue - (`0`-`360`) + @param whiteness - (`0`-`100`) + @param blackness - (`0`-`100`) + */ + hwb(hue: number, whiteness: number, blackness: number): string; + + /** + Use a [4-bit unsigned number](https://en.wikipedia.org/wiki/ANSI_escape_code#3/4-bit) to set text color. + */ + ansi(ansi: number): string; + + /** + Use an [8-bit unsigned number](https://en.wikipedia.org/wiki/ANSI_escape_code#8-bit) to set text color. + */ + ansi256(ansi: number): string; + } + + interface CSPair { + /** + The ANSI terminal control sequence for starting this style. + */ + readonly open: string; + + /** + The ANSI terminal control sequence for ending this style. + */ + readonly close: string; + } + + interface ColorBase { + readonly ansi: ColorConvert; + readonly ansi256: ColorConvert; + readonly ansi16m: ColorConvert; + + /** + The ANSI terminal control sequence for ending this color. + */ + readonly close: string; + } + + interface Modifier { + /** + Resets the current color chain. + */ + readonly reset: CSPair; + + /** + Make text bold. + */ + readonly bold: CSPair; + + /** + Emitting only a small amount of light. + */ + readonly dim: CSPair; + + /** + Make text italic. (Not widely supported) + */ + readonly italic: CSPair; + + /** + Make text underline. (Not widely supported) + */ + readonly underline: CSPair; + + /** + Inverse background and foreground colors. + */ + readonly inverse: CSPair; + + /** + Prints the text, but makes it invisible. + */ + readonly hidden: CSPair; + + /** + Puts a horizontal line through the center of the text. (Not widely supported) + */ + readonly strikethrough: CSPair; + } + + interface ForegroundColor { + readonly black: CSPair; + readonly red: CSPair; + readonly green: CSPair; + readonly yellow: CSPair; + readonly blue: CSPair; + readonly cyan: CSPair; + readonly magenta: CSPair; + readonly white: CSPair; + + /** + Alias for `blackBright`. + */ + readonly gray: CSPair; + + /** + Alias for `blackBright`. + */ + readonly grey: CSPair; + + readonly blackBright: CSPair; + readonly redBright: CSPair; + readonly greenBright: CSPair; + readonly yellowBright: CSPair; + readonly blueBright: CSPair; + readonly cyanBright: CSPair; + readonly magentaBright: CSPair; + readonly whiteBright: CSPair; + } + + interface BackgroundColor { + readonly bgBlack: CSPair; + readonly bgRed: CSPair; + readonly bgGreen: CSPair; + readonly bgYellow: CSPair; + readonly bgBlue: CSPair; + readonly bgCyan: CSPair; + readonly bgMagenta: CSPair; + readonly bgWhite: CSPair; + + /** + Alias for `bgBlackBright`. + */ + readonly bgGray: CSPair; + + /** + Alias for `bgBlackBright`. + */ + readonly bgGrey: CSPair; + + readonly bgBlackBright: CSPair; + readonly bgRedBright: CSPair; + readonly bgGreenBright: CSPair; + readonly bgYellowBright: CSPair; + readonly bgBlueBright: CSPair; + readonly bgCyanBright: CSPair; + readonly bgMagentaBright: CSPair; + readonly bgWhiteBright: CSPair; + } +} + +declare const ansiStyles: { + readonly modifier: ansiStyles.Modifier; + readonly color: ansiStyles.ForegroundColor & ansiStyles.ColorBase; + readonly bgColor: ansiStyles.BackgroundColor & ansiStyles.ColorBase; + readonly codes: ReadonlyMap; +} & ansiStyles.BackgroundColor & ansiStyles.ForegroundColor & ansiStyles.Modifier; + +export = ansiStyles; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-styles/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-styles/index.js new file mode 100644 index 00000000..5d82581a --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-styles/index.js @@ -0,0 +1,163 @@ +'use strict'; + +const wrapAnsi16 = (fn, offset) => (...args) => { + const code = fn(...args); + return `\u001B[${code + offset}m`; +}; + +const wrapAnsi256 = (fn, offset) => (...args) => { + const code = fn(...args); + return `\u001B[${38 + offset};5;${code}m`; +}; + +const wrapAnsi16m = (fn, offset) => (...args) => { + const rgb = fn(...args); + return `\u001B[${38 + offset};2;${rgb[0]};${rgb[1]};${rgb[2]}m`; +}; + +const ansi2ansi = n => n; +const rgb2rgb = (r, g, b) => [r, g, b]; + +const setLazyProperty = (object, property, get) => { + Object.defineProperty(object, property, { + get: () => { + const value = get(); + + Object.defineProperty(object, property, { + value, + enumerable: true, + configurable: true + }); + + return value; + }, + enumerable: true, + configurable: true + }); +}; + +/** @type {typeof import('color-convert')} */ +let colorConvert; +const makeDynamicStyles = (wrap, targetSpace, identity, isBackground) => { + if (colorConvert === undefined) { + colorConvert = require('color-convert'); + } + + const offset = isBackground ? 10 : 0; + const styles = {}; + + for (const [sourceSpace, suite] of Object.entries(colorConvert)) { + const name = sourceSpace === 'ansi16' ? 'ansi' : sourceSpace; + if (sourceSpace === targetSpace) { + styles[name] = wrap(identity, offset); + } else if (typeof suite === 'object') { + styles[name] = wrap(suite[targetSpace], offset); + } + } + + return styles; +}; + +function assembleStyles() { + const codes = new Map(); + const styles = { + modifier: { + reset: [0, 0], + // 21 isn't widely supported and 22 does the same thing + bold: [1, 22], + dim: [2, 22], + italic: [3, 23], + underline: [4, 24], + inverse: [7, 27], + hidden: [8, 28], + strikethrough: [9, 29] + }, + color: { + black: [30, 39], + red: [31, 39], + green: [32, 39], + yellow: [33, 39], + blue: [34, 39], + magenta: [35, 39], + cyan: [36, 39], + white: [37, 39], + + // Bright color + blackBright: [90, 39], + redBright: [91, 39], + greenBright: [92, 39], + yellowBright: [93, 39], + blueBright: [94, 39], + magentaBright: [95, 39], + cyanBright: [96, 39], + whiteBright: [97, 39] + }, + bgColor: { + bgBlack: [40, 49], + bgRed: [41, 49], + bgGreen: [42, 49], + bgYellow: [43, 49], + bgBlue: [44, 49], + bgMagenta: [45, 49], + bgCyan: [46, 49], + bgWhite: [47, 49], + + // Bright color + bgBlackBright: [100, 49], + bgRedBright: [101, 49], + bgGreenBright: [102, 49], + bgYellowBright: [103, 49], + bgBlueBright: [104, 49], + bgMagentaBright: [105, 49], + bgCyanBright: [106, 49], + bgWhiteBright: [107, 49] + } + }; + + // Alias bright black as gray (and grey) + styles.color.gray = styles.color.blackBright; + styles.bgColor.bgGray = styles.bgColor.bgBlackBright; + styles.color.grey = styles.color.blackBright; + styles.bgColor.bgGrey = styles.bgColor.bgBlackBright; + + for (const [groupName, group] of Object.entries(styles)) { + for (const [styleName, style] of Object.entries(group)) { + styles[styleName] = { + open: `\u001B[${style[0]}m`, + close: `\u001B[${style[1]}m` + }; + + group[styleName] = styles[styleName]; + + codes.set(style[0], style[1]); + } + + Object.defineProperty(styles, groupName, { + value: group, + enumerable: false + }); + } + + Object.defineProperty(styles, 'codes', { + value: codes, + enumerable: false + }); + + styles.color.close = '\u001B[39m'; + styles.bgColor.close = '\u001B[49m'; + + setLazyProperty(styles.color, 'ansi', () => makeDynamicStyles(wrapAnsi16, 'ansi16', ansi2ansi, false)); + setLazyProperty(styles.color, 'ansi256', () => makeDynamicStyles(wrapAnsi256, 'ansi256', ansi2ansi, false)); + setLazyProperty(styles.color, 'ansi16m', () => makeDynamicStyles(wrapAnsi16m, 'rgb', rgb2rgb, false)); + setLazyProperty(styles.bgColor, 'ansi', () => makeDynamicStyles(wrapAnsi16, 'ansi16', ansi2ansi, true)); + setLazyProperty(styles.bgColor, 'ansi256', () => makeDynamicStyles(wrapAnsi256, 'ansi256', ansi2ansi, true)); + setLazyProperty(styles.bgColor, 'ansi16m', () => makeDynamicStyles(wrapAnsi16m, 'rgb', rgb2rgb, true)); + + return styles; +} + +// Make the export immutable +Object.defineProperty(module, 'exports', { + enumerable: true, + get: assembleStyles +}); diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-styles/license b/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-styles/license new file mode 100644 index 00000000..e7af2f77 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-styles/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-styles/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-styles/package.json new file mode 100644 index 00000000..98c0b18a --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-styles/package.json @@ -0,0 +1,89 @@ +{ + "_from": "ansi-styles@^4.1.0", + "_id": "ansi-styles@4.3.0", + "_inBundle": false, + "_integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==", + "_location": "/ansi-styles", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "ansi-styles@^4.1.0", + "name": "ansi-styles", + "escapedName": "ansi-styles", + "rawSpec": "^4.1.0", + "saveSpec": null, + "fetchSpec": "^4.1.0" + }, + "_requiredBy": [ + "/chalk", + "/wrap-ansi" + ], + "_resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", + "_shasum": "edd803628ae71c04c85ae7a0906edad34b648937", + "_spec": "ansi-styles@^4.1.0", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\chalk", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "sindresorhus.com" + }, + "bugs": { + "url": "https://github.com/chalk/ansi-styles/issues" + }, + "bundleDependencies": false, + "dependencies": { + "color-convert": "^2.0.1" + }, + "deprecated": false, + "description": "ANSI escape codes for styling strings in the terminal", + "devDependencies": { + "@types/color-convert": "^1.9.0", + "ava": "^2.3.0", + "svg-term-cli": "^2.1.1", + "tsd": "^0.11.0", + "xo": "^0.25.3" + }, + "engines": { + "node": ">=8" + }, + "files": [ + "index.js", + "index.d.ts" + ], + "funding": "https://github.com/chalk/ansi-styles?sponsor=1", + "homepage": "https://github.com/chalk/ansi-styles#readme", + "keywords": [ + "ansi", + "styles", + "color", + "colour", + "colors", + "terminal", + "console", + "cli", + "string", + "tty", + "escape", + "formatting", + "rgb", + "256", + "shell", + "xterm", + "log", + "logging", + "command-line", + "text" + ], + "license": "MIT", + "name": "ansi-styles", + "repository": { + "type": "git", + "url": "git+https://github.com/chalk/ansi-styles.git" + }, + "scripts": { + "screenshot": "svg-term --command='node screenshot' --out=screenshot.svg --padding=3 --width=55 --height=3 --at=1000 --no-cursor", + "test": "xo && ava && tsd" + }, + "version": "4.3.0" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-styles/readme.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-styles/readme.md new file mode 100644 index 00000000..24883de8 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/ansi-styles/readme.md @@ -0,0 +1,152 @@ +# ansi-styles [![Build Status](https://travis-ci.org/chalk/ansi-styles.svg?branch=master)](https://travis-ci.org/chalk/ansi-styles) + +> [ANSI escape codes](https://en.wikipedia.org/wiki/ANSI_escape_code#Colors_and_Styles) for styling strings in the terminal + +You probably want the higher-level [chalk](https://github.com/chalk/chalk) module for styling your strings. + + + +## Install + +``` +$ npm install ansi-styles +``` + +## Usage + +```js +const style = require('ansi-styles'); + +console.log(`${style.green.open}Hello world!${style.green.close}`); + + +// Color conversion between 16/256/truecolor +// NOTE: If conversion goes to 16 colors or 256 colors, the original color +// may be degraded to fit that color palette. This means terminals +// that do not support 16 million colors will best-match the +// original color. +console.log(style.bgColor.ansi.hsl(120, 80, 72) + 'Hello world!' + style.bgColor.close); +console.log(style.color.ansi256.rgb(199, 20, 250) + 'Hello world!' + style.color.close); +console.log(style.color.ansi16m.hex('#abcdef') + 'Hello world!' + style.color.close); +``` + +## API + +Each style has an `open` and `close` property. + +## Styles + +### Modifiers + +- `reset` +- `bold` +- `dim` +- `italic` *(Not widely supported)* +- `underline` +- `inverse` +- `hidden` +- `strikethrough` *(Not widely supported)* + +### Colors + +- `black` +- `red` +- `green` +- `yellow` +- `blue` +- `magenta` +- `cyan` +- `white` +- `blackBright` (alias: `gray`, `grey`) +- `redBright` +- `greenBright` +- `yellowBright` +- `blueBright` +- `magentaBright` +- `cyanBright` +- `whiteBright` + +### Background colors + +- `bgBlack` +- `bgRed` +- `bgGreen` +- `bgYellow` +- `bgBlue` +- `bgMagenta` +- `bgCyan` +- `bgWhite` +- `bgBlackBright` (alias: `bgGray`, `bgGrey`) +- `bgRedBright` +- `bgGreenBright` +- `bgYellowBright` +- `bgBlueBright` +- `bgMagentaBright` +- `bgCyanBright` +- `bgWhiteBright` + +## Advanced usage + +By default, you get a map of styles, but the styles are also available as groups. They are non-enumerable so they don't show up unless you access them explicitly. This makes it easier to expose only a subset in a higher-level module. + +- `style.modifier` +- `style.color` +- `style.bgColor` + +###### Example + +```js +console.log(style.color.green.open); +``` + +Raw escape codes (i.e. without the CSI escape prefix `\u001B[` and render mode postfix `m`) are available under `style.codes`, which returns a `Map` with the open codes as keys and close codes as values. + +###### Example + +```js +console.log(style.codes.get(36)); +//=> 39 +``` + +## [256 / 16 million (TrueColor) support](https://gist.github.com/XVilka/8346728) + +`ansi-styles` uses the [`color-convert`](https://github.com/Qix-/color-convert) package to allow for converting between various colors and ANSI escapes, with support for 256 and 16 million colors. + +The following color spaces from `color-convert` are supported: + +- `rgb` +- `hex` +- `keyword` +- `hsl` +- `hsv` +- `hwb` +- `ansi` +- `ansi256` + +To use these, call the associated conversion function with the intended output, for example: + +```js +style.color.ansi.rgb(100, 200, 15); // RGB to 16 color ansi foreground code +style.bgColor.ansi.rgb(100, 200, 15); // RGB to 16 color ansi background code + +style.color.ansi256.hsl(120, 100, 60); // HSL to 256 color ansi foreground code +style.bgColor.ansi256.hsl(120, 100, 60); // HSL to 256 color ansi foreground code + +style.color.ansi16m.hex('#C0FFEE'); // Hex (RGB) to 16 million color foreground code +style.bgColor.ansi16m.hex('#C0FFEE'); // Hex (RGB) to 16 million color background code +``` + +## Related + +- [ansi-escapes](https://github.com/sindresorhus/ansi-escapes) - ANSI escape codes for manipulating the terminal + +## Maintainers + +- [Sindre Sorhus](https://github.com/sindresorhus) +- [Josh Junon](https://github.com/qix-) + +## For enterprise + +Available as part of the Tidelift Subscription. + +The maintainers of `ansi-styles` and thousands of other packages are working with Tidelift to deliver commercial support and maintenance for the open source dependencies you use to build your applications. Save time, reduce risk, and improve code health, while paying the maintainers of the exact dependencies you use. [Learn more.](https://tidelift.com/subscription/pkg/npm-ansi-styles?utm_source=npm-ansi-styles&utm_medium=referral&utm_campaign=enterprise&utm_term=repo) diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/anymatch/LICENSE b/25_03_11/frontend_vizsgafeladat/backend/node_modules/anymatch/LICENSE new file mode 100644 index 00000000..491766ca --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/anymatch/LICENSE @@ -0,0 +1,15 @@ +The ISC License + +Copyright (c) 2019 Elan Shanker, Paul Miller (https://paulmillr.com) + +Permission to use, copy, modify, and/or distribute this software for any +purpose with or without fee is hereby granted, provided that the above +copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF +MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR +ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR +IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/anymatch/README.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/anymatch/README.md new file mode 100644 index 00000000..1dd67f53 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/anymatch/README.md @@ -0,0 +1,87 @@ +anymatch [![Build Status](https://travis-ci.org/micromatch/anymatch.svg?branch=master)](https://travis-ci.org/micromatch/anymatch) [![Coverage Status](https://img.shields.io/coveralls/micromatch/anymatch.svg?branch=master)](https://coveralls.io/r/micromatch/anymatch?branch=master) +====== +Javascript module to match a string against a regular expression, glob, string, +or function that takes the string as an argument and returns a truthy or falsy +value. The matcher can also be an array of any or all of these. Useful for +allowing a very flexible user-defined config to define things like file paths. + +__Note: This module has Bash-parity, please be aware that Windows-style backslashes are not supported as separators. See https://github.com/micromatch/micromatch#backslashes for more information.__ + + +Usage +----- +```sh +npm install anymatch +``` + +#### anymatch(matchers, testString, [returnIndex], [options]) +* __matchers__: (_Array|String|RegExp|Function_) +String to be directly matched, string with glob patterns, regular expression +test, function that takes the testString as an argument and returns a truthy +value if it should be matched, or an array of any number and mix of these types. +* __testString__: (_String|Array_) The string to test against the matchers. If +passed as an array, the first element of the array will be used as the +`testString` for non-function matchers, while the entire array will be applied +as the arguments for function matchers. +* __options__: (_Object_ [optional]_) Any of the [picomatch](https://github.com/micromatch/picomatch#options) options. + * __returnIndex__: (_Boolean [optional]_) If true, return the array index of +the first matcher that that testString matched, or -1 if no match, instead of a +boolean result. + +```js +const anymatch = require('anymatch'); + +const matchers = [ 'path/to/file.js', 'path/anyjs/**/*.js', /foo.js$/, string => string.includes('bar') && string.length > 10 ] ; + +anymatch(matchers, 'path/to/file.js'); // true +anymatch(matchers, 'path/anyjs/baz.js'); // true +anymatch(matchers, 'path/to/foo.js'); // true +anymatch(matchers, 'path/to/bar.js'); // true +anymatch(matchers, 'bar.js'); // false + +// returnIndex = true +anymatch(matchers, 'foo.js', {returnIndex: true}); // 2 +anymatch(matchers, 'path/anyjs/foo.js', {returnIndex: true}); // 1 + +// any picomatc + +// using globs to match directories and their children +anymatch('node_modules', 'node_modules'); // true +anymatch('node_modules', 'node_modules/somelib/index.js'); // false +anymatch('node_modules/**', 'node_modules/somelib/index.js'); // true +anymatch('node_modules/**', '/absolute/path/to/node_modules/somelib/index.js'); // false +anymatch('**/node_modules/**', '/absolute/path/to/node_modules/somelib/index.js'); // true + +const matcher = anymatch(matchers); +['foo.js', 'bar.js'].filter(matcher); // [ 'foo.js' ] +anymatch master* ❯ + +``` + +#### anymatch(matchers) +You can also pass in only your matcher(s) to get a curried function that has +already been bound to the provided matching criteria. This can be used as an +`Array#filter` callback. + +```js +var matcher = anymatch(matchers); + +matcher('path/to/file.js'); // true +matcher('path/anyjs/baz.js', true); // 1 + +['foo.js', 'bar.js'].filter(matcher); // ['foo.js'] +``` + +Changelog +---------- +[See release notes page on GitHub](https://github.com/micromatch/anymatch/releases) + +- **v3.0:** Removed `startIndex` and `endIndex` arguments. Node 8.x-only. +- **v2.0:** [micromatch](https://github.com/jonschlinkert/micromatch) moves away from minimatch-parity and inline with Bash. This includes handling backslashes differently (see https://github.com/micromatch/micromatch#backslashes for more information). +- **v1.2:** anymatch uses [micromatch](https://github.com/jonschlinkert/micromatch) +for glob pattern matching. Issues with glob pattern matching should be +reported directly to the [micromatch issue tracker](https://github.com/jonschlinkert/micromatch/issues). + +License +------- +[ISC](https://raw.github.com/micromatch/anymatch/master/LICENSE) diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/anymatch/index.d.ts b/25_03_11/frontend_vizsgafeladat/backend/node_modules/anymatch/index.d.ts new file mode 100644 index 00000000..196d0617 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/anymatch/index.d.ts @@ -0,0 +1,19 @@ +type AnymatchFn = (testString: string) => boolean; +type AnymatchPattern = string|RegExp|AnymatchFn; +type AnymatchMatcher = AnymatchPattern|AnymatchPattern[] +type AnymatchTester = { + (testString: string|any[], returnIndex: true): number; + (testString: string|any[]): boolean; +} + +type PicomatchOptions = {dot: boolean}; + +declare const anymatch: { + (matchers: AnymatchMatcher): AnymatchTester; + (matchers: AnymatchMatcher, testString: string|any[], returnIndex: true | PicomatchOptions): number; + (matchers: AnymatchMatcher, testString: string|any[]): boolean; +} + +export {AnymatchMatcher as Matcher} +export {AnymatchTester as Tester} +export default anymatch diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/anymatch/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/anymatch/index.js new file mode 100644 index 00000000..9fb3ebb1 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/anymatch/index.js @@ -0,0 +1,104 @@ +'use strict'; + +Object.defineProperty(exports, "__esModule", { value: true }); + +const picomatch = require('picomatch'); +const normalizePath = require('normalize-path'); + +/** + * @typedef {(testString: string) => boolean} AnymatchFn + * @typedef {string|RegExp|AnymatchFn} AnymatchPattern + * @typedef {AnymatchPattern|AnymatchPattern[]} AnymatchMatcher + */ +const BANG = '!'; +const DEFAULT_OPTIONS = {returnIndex: false}; +const arrify = (item) => Array.isArray(item) ? item : [item]; + +/** + * @param {AnymatchPattern} matcher + * @param {object} options + * @returns {AnymatchFn} + */ +const createPattern = (matcher, options) => { + if (typeof matcher === 'function') { + return matcher; + } + if (typeof matcher === 'string') { + const glob = picomatch(matcher, options); + return (string) => matcher === string || glob(string); + } + if (matcher instanceof RegExp) { + return (string) => matcher.test(string); + } + return (string) => false; +}; + +/** + * @param {Array} patterns + * @param {Array} negPatterns + * @param {String|Array} args + * @param {Boolean} returnIndex + * @returns {boolean|number} + */ +const matchPatterns = (patterns, negPatterns, args, returnIndex) => { + const isList = Array.isArray(args); + const _path = isList ? args[0] : args; + if (!isList && typeof _path !== 'string') { + throw new TypeError('anymatch: second argument must be a string: got ' + + Object.prototype.toString.call(_path)) + } + const path = normalizePath(_path); + + for (let index = 0; index < negPatterns.length; index++) { + const nglob = negPatterns[index]; + if (nglob(path)) { + return returnIndex ? -1 : false; + } + } + + const applied = isList && [path].concat(args.slice(1)); + for (let index = 0; index < patterns.length; index++) { + const pattern = patterns[index]; + if (isList ? pattern(...applied) : pattern(path)) { + return returnIndex ? index : true; + } + } + + return returnIndex ? -1 : false; +}; + +/** + * @param {AnymatchMatcher} matchers + * @param {Array|string} testString + * @param {object} options + * @returns {boolean|number|Function} + */ +const anymatch = (matchers, testString, options = DEFAULT_OPTIONS) => { + if (matchers == null) { + throw new TypeError('anymatch: specify first argument'); + } + const opts = typeof options === 'boolean' ? {returnIndex: options} : options; + const returnIndex = opts.returnIndex || false; + + // Early cache for matchers. + const mtchers = arrify(matchers); + const negatedGlobs = mtchers + .filter(item => typeof item === 'string' && item.charAt(0) === BANG) + .map(item => item.slice(1)) + .map(item => picomatch(item, opts)); + const patterns = mtchers + .filter(item => typeof item !== 'string' || (typeof item === 'string' && item.charAt(0) !== BANG)) + .map(matcher => createPattern(matcher, opts)); + + if (testString == null) { + return (testString, ri = false) => { + const returnIndex = typeof ri === 'boolean' ? ri : false; + return matchPatterns(patterns, negatedGlobs, testString, returnIndex); + } + } + + return matchPatterns(patterns, negatedGlobs, testString, returnIndex); +}; + +anymatch.default = anymatch; +module.exports = anymatch; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/anymatch/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/anymatch/package.json new file mode 100644 index 00000000..d4acc758 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/anymatch/package.json @@ -0,0 +1,76 @@ +{ + "_from": "anymatch@~3.1.2", + "_id": "anymatch@3.1.2", + "_inBundle": false, + "_integrity": "sha512-P43ePfOAIupkguHUycrc4qJ9kz8ZiuOUijaETwX7THt0Y/GNK7v0aa8rY816xWjZ7rJdA5XdMcpVFTKMq+RvWg==", + "_location": "/anymatch", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "anymatch@~3.1.2", + "name": "anymatch", + "escapedName": "anymatch", + "rawSpec": "~3.1.2", + "saveSpec": null, + "fetchSpec": "~3.1.2" + }, + "_requiredBy": [ + "/chokidar" + ], + "_resolved": "https://registry.npmjs.org/anymatch/-/anymatch-3.1.2.tgz", + "_shasum": "c0557c096af32f106198f4f4e2a383537e378716", + "_spec": "anymatch@~3.1.2", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\chokidar", + "author": { + "name": "Elan Shanker", + "url": "https://github.com/es128" + }, + "bugs": { + "url": "https://github.com/micromatch/anymatch/issues" + }, + "bundleDependencies": false, + "dependencies": { + "normalize-path": "^3.0.0", + "picomatch": "^2.0.4" + }, + "deprecated": false, + "description": "Matches strings against configurable strings, globs, regular expressions, and/or functions", + "devDependencies": { + "mocha": "^6.1.3", + "nyc": "^14.0.0" + }, + "engines": { + "node": ">= 8" + }, + "files": [ + "index.js", + "index.d.ts" + ], + "homepage": "https://github.com/micromatch/anymatch", + "keywords": [ + "match", + "any", + "string", + "file", + "fs", + "list", + "glob", + "regex", + "regexp", + "regular", + "expression", + "function" + ], + "license": "ISC", + "name": "anymatch", + "repository": { + "type": "git", + "url": "git+https://github.com/micromatch/anymatch.git" + }, + "scripts": { + "mocha": "mocha", + "test": "nyc mocha" + }, + "version": "3.1.2" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/aproba/CHANGELOG.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/aproba/CHANGELOG.md new file mode 100644 index 00000000..bab30ecb --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/aproba/CHANGELOG.md @@ -0,0 +1,4 @@ +2.0.0 + * Drop support for 0.10 and 0.12. They haven't been in travis but still, + since we _know_ we'll break with them now it's only polite to do a + major bump. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/aproba/LICENSE b/25_03_11/frontend_vizsgafeladat/backend/node_modules/aproba/LICENSE new file mode 100644 index 00000000..f4be44d8 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/aproba/LICENSE @@ -0,0 +1,14 @@ +Copyright (c) 2015, Rebecca Turner + +Permission to use, copy, modify, and/or distribute this software for any +purpose with or without fee is hereby granted, provided that the above +copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF +MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR +ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF +OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/aproba/README.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/aproba/README.md new file mode 100644 index 00000000..0bfc594c --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/aproba/README.md @@ -0,0 +1,94 @@ +aproba +====== + +A ridiculously light-weight function argument validator + +``` +var validate = require("aproba") + +function myfunc(a, b, c) { + // `a` must be a string, `b` a number, `c` a function + validate('SNF', arguments) // [a,b,c] is also valid +} + +myfunc('test', 23, function () {}) // ok +myfunc(123, 23, function () {}) // type error +myfunc('test', 23) // missing arg error +myfunc('test', 23, function () {}, true) // too many args error + +``` + +Valid types are: + +| type | description +| :--: | :---------- +| * | matches any type +| A | `Array.isArray` OR an `arguments` object +| S | typeof == string +| N | typeof == number +| F | typeof == function +| O | typeof == object and not type A and not type E +| B | typeof == boolean +| E | `instanceof Error` OR `null` **(special: see below)** +| Z | == `null` + +Validation failures throw one of three exception types, distinguished by a +`code` property of `EMISSINGARG`, `EINVALIDTYPE` or `ETOOMANYARGS`. + +If you pass in an invalid type then it will throw with a code of +`EUNKNOWNTYPE`. + +If an **error** argument is found and is not null then the remaining +arguments are optional. That is, if you say `ESO` then that's like using a +non-magical `E` in: `E|ESO|ZSO`. + +### But I have optional arguments?! + +You can provide more than one signature by separating them with pipes `|`. +If any signature matches the arguments then they'll be considered valid. + +So for example, say you wanted to write a signature for +`fs.createWriteStream`. The docs for it describe it thusly: + +``` +fs.createWriteStream(path[, options]) +``` + +This would be a signature of `SO|S`. That is, a string and and object, or +just a string. + +Now, if you read the full `fs` docs, you'll see that actually path can ALSO +be a buffer. And options can be a string, that is: +``` +path | +options | +``` + +To reproduce this you have to fully enumerate all of the possible +combinations and that implies a signature of `SO|SS|OO|OS|S|O`. The +awkwardness is a feature: It reminds you of the complexity you're adding to +your API when you do this sort of thing. + + +### Browser support + +This has no dependencies and should work in browsers, though you'll have +noisier stack traces. + +### Why this exists + +I wanted a very simple argument validator. It needed to do two things: + +1. Be more concise and easier to use than assertions + +2. Not encourage an infinite bikeshed of DSLs + +This is why types are specified by a single character and there's no such +thing as an optional argument. + +This is not intended to validate user data. This is specifically about +asserting the interface of your functions. + +If you need greater validation, I encourage you to write them by hand or +look elsewhere. + diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/aproba/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/aproba/index.js new file mode 100644 index 00000000..fd947481 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/aproba/index.js @@ -0,0 +1,105 @@ +'use strict' +module.exports = validate + +function isArguments (thingy) { + return thingy != null && typeof thingy === 'object' && thingy.hasOwnProperty('callee') +} + +const types = { + '*': {label: 'any', check: () => true}, + A: {label: 'array', check: _ => Array.isArray(_) || isArguments(_)}, + S: {label: 'string', check: _ => typeof _ === 'string'}, + N: {label: 'number', check: _ => typeof _ === 'number'}, + F: {label: 'function', check: _ => typeof _ === 'function'}, + O: {label: 'object', check: _ => typeof _ === 'object' && _ != null && !types.A.check(_) && !types.E.check(_)}, + B: {label: 'boolean', check: _ => typeof _ === 'boolean'}, + E: {label: 'error', check: _ => _ instanceof Error}, + Z: {label: 'null', check: _ => _ == null} +} + +function addSchema (schema, arity) { + const group = arity[schema.length] = arity[schema.length] || [] + if (group.indexOf(schema) === -1) group.push(schema) +} + +function validate (rawSchemas, args) { + if (arguments.length !== 2) throw wrongNumberOfArgs(['SA'], arguments.length) + if (!rawSchemas) throw missingRequiredArg(0, 'rawSchemas') + if (!args) throw missingRequiredArg(1, 'args') + if (!types.S.check(rawSchemas)) throw invalidType(0, ['string'], rawSchemas) + if (!types.A.check(args)) throw invalidType(1, ['array'], args) + const schemas = rawSchemas.split('|') + const arity = {} + + schemas.forEach(schema => { + for (let ii = 0; ii < schema.length; ++ii) { + const type = schema[ii] + if (!types[type]) throw unknownType(ii, type) + } + if (/E.*E/.test(schema)) throw moreThanOneError(schema) + addSchema(schema, arity) + if (/E/.test(schema)) { + addSchema(schema.replace(/E.*$/, 'E'), arity) + addSchema(schema.replace(/E/, 'Z'), arity) + if (schema.length === 1) addSchema('', arity) + } + }) + let matching = arity[args.length] + if (!matching) { + throw wrongNumberOfArgs(Object.keys(arity), args.length) + } + for (let ii = 0; ii < args.length; ++ii) { + let newMatching = matching.filter(schema => { + const type = schema[ii] + const typeCheck = types[type].check + return typeCheck(args[ii]) + }) + if (!newMatching.length) { + const labels = matching.map(_ => types[_[ii]].label).filter(_ => _ != null) + throw invalidType(ii, labels, args[ii]) + } + matching = newMatching + } +} + +function missingRequiredArg (num) { + return newException('EMISSINGARG', 'Missing required argument #' + (num + 1)) +} + +function unknownType (num, type) { + return newException('EUNKNOWNTYPE', 'Unknown type ' + type + ' in argument #' + (num + 1)) +} + +function invalidType (num, expectedTypes, value) { + let valueType + Object.keys(types).forEach(typeCode => { + if (types[typeCode].check(value)) valueType = types[typeCode].label + }) + return newException('EINVALIDTYPE', 'Argument #' + (num + 1) + ': Expected ' + + englishList(expectedTypes) + ' but got ' + valueType) +} + +function englishList (list) { + return list.join(', ').replace(/, ([^,]+)$/, ' or $1') +} + +function wrongNumberOfArgs (expected, got) { + const english = englishList(expected) + const args = expected.every(ex => ex.length === 1) + ? 'argument' + : 'arguments' + return newException('EWRONGARGCOUNT', 'Expected ' + english + ' ' + args + ' but got ' + got) +} + +function moreThanOneError (schema) { + return newException('ETOOMANYERRORTYPES', + 'Only one error type per argument signature is allowed, more than one found in "' + schema + '"') +} + +function newException (code, msg) { + const err = new Error(msg) + err.code = code + /* istanbul ignore else */ + if (Error.captureStackTrace) Error.captureStackTrace(err, validate) + return err +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/aproba/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/aproba/package.json new file mode 100644 index 00000000..07eaf11d --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/aproba/package.json @@ -0,0 +1,64 @@ +{ + "_from": "aproba@^1.0.3 || ^2.0.0", + "_id": "aproba@2.0.0", + "_inBundle": false, + "_integrity": "sha512-lYe4Gx7QT+MKGbDsA+Z+he/Wtef0BiwDOlK/XkBrdfsh9J/jPPXbX0tE9x9cl27Tmu5gg3QUbUrQYa/y+KOHPQ==", + "_location": "/aproba", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "aproba@^1.0.3 || ^2.0.0", + "name": "aproba", + "escapedName": "aproba", + "rawSpec": "^1.0.3 || ^2.0.0", + "saveSpec": null, + "fetchSpec": "^1.0.3 || ^2.0.0" + }, + "_requiredBy": [ + "/gauge", + "/node-gyp/gauge" + ], + "_resolved": "https://registry.npmjs.org/aproba/-/aproba-2.0.0.tgz", + "_shasum": "52520b8ae5b569215b354efc0caa3fe1e45a8adc", + "_spec": "aproba@^1.0.3 || ^2.0.0", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\gauge", + "author": { + "name": "Rebecca Turner", + "email": "me@re-becca.org" + }, + "bugs": { + "url": "https://github.com/iarna/aproba/issues" + }, + "bundleDependencies": false, + "dependencies": {}, + "deprecated": false, + "description": "A ridiculously light-weight argument validator (now browser friendly)", + "devDependencies": { + "standard": "^11.0.1", + "tap": "^12.0.1" + }, + "directories": { + "test": "test" + }, + "files": [ + "index.js" + ], + "homepage": "https://github.com/iarna/aproba", + "keywords": [ + "argument", + "validate" + ], + "license": "ISC", + "main": "index.js", + "name": "aproba", + "repository": { + "type": "git", + "url": "git+https://github.com/iarna/aproba.git" + }, + "scripts": { + "pretest": "standard", + "test": "tap --100 -J test/*.js" + }, + "version": "2.0.0" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/are-we-there-yet/LICENSE.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/are-we-there-yet/LICENSE.md new file mode 100644 index 00000000..845be76f --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/are-we-there-yet/LICENSE.md @@ -0,0 +1,18 @@ +ISC License + +Copyright npm, Inc. + +Permission to use, copy, modify, and/or distribute this +software for any purpose with or without fee is hereby +granted, provided that the above copyright notice and this +permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND NPM DISCLAIMS ALL +WARRANTIES WITH REGARD TO THIS SOFTWARE INCLUDING ALL +IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS. IN NO +EVENT SHALL NPM BE LIABLE FOR ANY SPECIAL, DIRECT, +INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER +TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE +USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/are-we-there-yet/README.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/are-we-there-yet/README.md new file mode 100644 index 00000000..caae19b0 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/are-we-there-yet/README.md @@ -0,0 +1,208 @@ +are-we-there-yet +---------------- + +Track complex hierarchies of asynchronous task completion statuses. This is +intended to give you a way of recording and reporting the progress of the big +recursive fan-out and gather type workflows that are so common in async. + +What you do with this completion data is up to you, but the most common use case is to +feed it to one of the many progress bar modules. + +Most progress bar modules include a rudimentary version of this, but my +needs were more complex. + +Usage +===== + +```javascript +var TrackerGroup = require("are-we-there-yet").TrackerGroup + +var top = new TrackerGroup("program") + +var single = top.newItem("one thing", 100) +single.completeWork(20) + +console.log(top.completed()) // 0.2 + +fs.stat("file", function(er, stat) { + if (er) throw er + var stream = top.newStream("file", stat.size) + console.log(top.completed()) // now 0.1 as single is 50% of the job and is 20% complete + // and 50% * 20% == 10% + fs.createReadStream("file").pipe(stream).on("data", function (chunk) { + // do stuff with chunk + }) + top.on("change", function (name) { + // called each time a chunk is read from "file" + // top.completed() will start at 0.1 and fill up to 0.6 as the file is read + }) +}) +``` + +Shared Methods +============== + +* var completed = tracker.completed() + +Implemented in: `Tracker`, `TrackerGroup`, `TrackerStream` + +Returns the ratio of completed work to work to be done. Range of 0 to 1. + +* tracker.finish() + +Implemented in: `Tracker`, `TrackerGroup` + +Marks the tracker as completed. With a TrackerGroup this marks all of its +components as completed. + +Marks all of the components of this tracker as finished, which in turn means +that `tracker.completed()` for this will now be 1. + +This will result in one or more `change` events being emitted. + +Events +====== + +All tracker objects emit `change` events with the following arguments: + +``` +function (name, completed, tracker) +``` + +`name` is the name of the tracker that originally emitted the event, +or if it didn't have one, the first containing tracker group that had one. + +`completed` is the percent complete (as returned by `tracker.completed()` method). + +`tracker` is the tracker object that you are listening for events on. + +TrackerGroup +============ + +* var tracker = new TrackerGroup(**name**) + + * **name** *(optional)* - The name of this tracker group, used in change + notifications if the component updating didn't have a name. Defaults to undefined. + +Creates a new empty tracker aggregation group. These are trackers whose +completion status is determined by the completion status of other trackers added to this aggregation group. + +Ex. + +```javascript +var tracker = new TrackerGroup("parent") +var foo = tracker.newItem("firstChild", 100) +var bar = tracker.newItem("secondChild", 100) + +foo.finish() +console.log(tracker.completed()) // 0.5 +bar.finish() +console.log(tracker.completed()) // 1 +``` + +* tracker.addUnit(**otherTracker**, **weight**) + + * **otherTracker** - Any of the other are-we-there-yet tracker objects + * **weight** *(optional)* - The weight to give the tracker, defaults to 1. + +Adds the **otherTracker** to this aggregation group. The weight determines +how long you expect this tracker to take to complete in proportion to other +units. So for instance, if you add one tracker with a weight of 1 and +another with a weight of 2, you're saying the second will take twice as long +to complete as the first. As such, the first will account for 33% of the +completion of this tracker and the second will account for the other 67%. + +Returns **otherTracker**. + +* var subGroup = tracker.newGroup(**name**, **weight**) + +The above is exactly equivalent to: + +```javascript + var subGroup = tracker.addUnit(new TrackerGroup(name), weight) +``` + +* var subItem = tracker.newItem(**name**, **todo**, **weight**) + +The above is exactly equivalent to: + +```javascript + var subItem = tracker.addUnit(new Tracker(name, todo), weight) +``` + +* var subStream = tracker.newStream(**name**, **todo**, **weight**) + +The above is exactly equivalent to: + +```javascript + var subStream = tracker.addUnit(new TrackerStream(name, todo), weight) +``` + +* console.log( tracker.debug() ) + +Returns a tree showing the completion of this tracker group and all of its +children, including recursively entering all of the children. + +Tracker +======= + +* var tracker = new Tracker(**name**, **todo**) + + * **name** *(optional)* The name of this counter to report in change + events. Defaults to undefined. + * **todo** *(optional)* The amount of work todo (a number). Defaults to 0. + +Ordinarily these are constructed as a part of a tracker group (via +`newItem`). + +* var completed = tracker.completed() + +Returns the ratio of completed work to work to be done. Range of 0 to 1. If +total work to be done is 0 then it will return 0. + +* tracker.addWork(**todo**) + + * **todo** A number to add to the amount of work to be done. + +Increases the amount of work to be done, thus decreasing the completion +percentage. Triggers a `change` event. + +* tracker.completeWork(**completed**) + + * **completed** A number to add to the work complete + +Increase the amount of work complete, thus increasing the completion percentage. +Will never increase the work completed past the amount of work todo. That is, +percentages > 100% are not allowed. Triggers a `change` event. + +* tracker.finish() + +Marks this tracker as finished, tracker.completed() will now be 1. Triggers +a `change` event. + +TrackerStream +============= + +* var tracker = new TrackerStream(**name**, **size**, **options**) + + * **name** *(optional)* The name of this counter to report in change + events. Defaults to undefined. + * **size** *(optional)* The number of bytes being sent through this stream. + * **options** *(optional)* A hash of stream options + +The tracker stream object is a pass through stream that updates an internal +tracker object each time a block passes through. It's intended to track +downloads, file extraction and other related activities. You use it by piping +your data source into it and then using it as your data source. + +If your data has a length attribute then that's used as the amount of work +completed when the chunk is passed through. If it does not (eg, object +streams) then each chunk counts as completing 1 unit of work, so your size +should be the total number of objects being streamed. + +* tracker.addWork(**todo**) + + * **todo** Increase the expected overall size by **todo** bytes. + +Increases the amount of work to be done, thus decreasing the completion +percentage. Triggers a `change` event. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/are-we-there-yet/lib/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/are-we-there-yet/lib/index.js new file mode 100644 index 00000000..57d8743f --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/are-we-there-yet/lib/index.js @@ -0,0 +1,4 @@ +'use strict' +exports.TrackerGroup = require('./tracker-group.js') +exports.Tracker = require('./tracker.js') +exports.TrackerStream = require('./tracker-stream.js') diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/are-we-there-yet/lib/tracker-base.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/are-we-there-yet/lib/tracker-base.js new file mode 100644 index 00000000..6f436875 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/are-we-there-yet/lib/tracker-base.js @@ -0,0 +1,11 @@ +'use strict' +var EventEmitter = require('events').EventEmitter +var util = require('util') + +var trackerId = 0 +var TrackerBase = module.exports = function (name) { + EventEmitter.call(this) + this.id = ++trackerId + this.name = name +} +util.inherits(TrackerBase, EventEmitter) diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/are-we-there-yet/lib/tracker-group.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/are-we-there-yet/lib/tracker-group.js new file mode 100644 index 00000000..9da13f8a --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/are-we-there-yet/lib/tracker-group.js @@ -0,0 +1,116 @@ +'use strict' +var util = require('util') +var TrackerBase = require('./tracker-base.js') +var Tracker = require('./tracker.js') +var TrackerStream = require('./tracker-stream.js') + +var TrackerGroup = module.exports = function (name) { + TrackerBase.call(this, name) + this.parentGroup = null + this.trackers = [] + this.completion = {} + this.weight = {} + this.totalWeight = 0 + this.finished = false + this.bubbleChange = bubbleChange(this) +} +util.inherits(TrackerGroup, TrackerBase) + +function bubbleChange (trackerGroup) { + return function (name, completed, tracker) { + trackerGroup.completion[tracker.id] = completed + if (trackerGroup.finished) { + return + } + trackerGroup.emit('change', name || trackerGroup.name, trackerGroup.completed(), trackerGroup) + } +} + +TrackerGroup.prototype.nameInTree = function () { + var names = [] + var from = this + while (from) { + names.unshift(from.name) + from = from.parentGroup + } + return names.join('/') +} + +TrackerGroup.prototype.addUnit = function (unit, weight) { + if (unit.addUnit) { + var toTest = this + while (toTest) { + if (unit === toTest) { + throw new Error( + 'Attempted to add tracker group ' + + unit.name + ' to tree that already includes it ' + + this.nameInTree(this)) + } + toTest = toTest.parentGroup + } + unit.parentGroup = this + } + this.weight[unit.id] = weight || 1 + this.totalWeight += this.weight[unit.id] + this.trackers.push(unit) + this.completion[unit.id] = unit.completed() + unit.on('change', this.bubbleChange) + if (!this.finished) { + this.emit('change', unit.name, this.completion[unit.id], unit) + } + return unit +} + +TrackerGroup.prototype.completed = function () { + if (this.trackers.length === 0) { + return 0 + } + var valPerWeight = 1 / this.totalWeight + var completed = 0 + for (var ii = 0; ii < this.trackers.length; ii++) { + var trackerId = this.trackers[ii].id + completed += + valPerWeight * this.weight[trackerId] * this.completion[trackerId] + } + return completed +} + +TrackerGroup.prototype.newGroup = function (name, weight) { + return this.addUnit(new TrackerGroup(name), weight) +} + +TrackerGroup.prototype.newItem = function (name, todo, weight) { + return this.addUnit(new Tracker(name, todo), weight) +} + +TrackerGroup.prototype.newStream = function (name, todo, weight) { + return this.addUnit(new TrackerStream(name, todo), weight) +} + +TrackerGroup.prototype.finish = function () { + this.finished = true + if (!this.trackers.length) { + this.addUnit(new Tracker(), 1, true) + } + for (var ii = 0; ii < this.trackers.length; ii++) { + var tracker = this.trackers[ii] + tracker.finish() + tracker.removeListener('change', this.bubbleChange) + } + this.emit('change', this.name, 1, this) +} + +var buffer = ' ' +TrackerGroup.prototype.debug = function (depth) { + depth = depth || 0 + var indent = depth ? buffer.substr(0, depth) : '' + var output = indent + (this.name || 'top') + ': ' + this.completed() + '\n' + this.trackers.forEach(function (tracker) { + if (tracker instanceof TrackerGroup) { + output += tracker.debug(depth + 1) + } else { + output += indent + ' ' + tracker.name + ': ' + tracker.completed() + '\n' + } + }) + return output +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/are-we-there-yet/lib/tracker-stream.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/are-we-there-yet/lib/tracker-stream.js new file mode 100644 index 00000000..e1cf8505 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/are-we-there-yet/lib/tracker-stream.js @@ -0,0 +1,36 @@ +'use strict' +var util = require('util') +var stream = require('readable-stream') +var delegate = require('delegates') +var Tracker = require('./tracker.js') + +var TrackerStream = module.exports = function (name, size, options) { + stream.Transform.call(this, options) + this.tracker = new Tracker(name, size) + this.name = name + this.id = this.tracker.id + this.tracker.on('change', delegateChange(this)) +} +util.inherits(TrackerStream, stream.Transform) + +function delegateChange (trackerStream) { + return function (name, completion, tracker) { + trackerStream.emit('change', name, completion, trackerStream) + } +} + +TrackerStream.prototype._transform = function (data, encoding, cb) { + this.tracker.completeWork(data.length ? data.length : 1) + this.push(data) + cb() +} + +TrackerStream.prototype._flush = function (cb) { + this.tracker.finish() + cb() +} + +delegate(TrackerStream.prototype, 'tracker') + .method('completed') + .method('addWork') + .method('finish') diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/are-we-there-yet/lib/tracker.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/are-we-there-yet/lib/tracker.js new file mode 100644 index 00000000..a8f8b3ba --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/are-we-there-yet/lib/tracker.js @@ -0,0 +1,32 @@ +'use strict' +var util = require('util') +var TrackerBase = require('./tracker-base.js') + +var Tracker = module.exports = function (name, todo) { + TrackerBase.call(this, name) + this.workDone = 0 + this.workTodo = todo || 0 +} +util.inherits(Tracker, TrackerBase) + +Tracker.prototype.completed = function () { + return this.workTodo === 0 ? 0 : this.workDone / this.workTodo +} + +Tracker.prototype.addWork = function (work) { + this.workTodo += work + this.emit('change', this.name, this.completed(), this) +} + +Tracker.prototype.completeWork = function (work) { + this.workDone += work + if (this.workDone > this.workTodo) { + this.workDone = this.workTodo + } + this.emit('change', this.name, this.completed(), this) +} + +Tracker.prototype.finish = function () { + this.workTodo = this.workDone = 1 + this.emit('change', this.name, 1, this) +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/are-we-there-yet/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/are-we-there-yet/package.json new file mode 100644 index 00000000..c59ffc70 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/are-we-there-yet/package.json @@ -0,0 +1,80 @@ +{ + "_from": "are-we-there-yet@^2.0.0", + "_id": "are-we-there-yet@2.0.0", + "_inBundle": false, + "_integrity": "sha512-Ci/qENmwHnsYo9xKIcUJN5LeDKdJ6R1Z1j9V/J5wyq8nh/mYPEpIKJbBZXtZjG04HiK7zV/p6Vs9952MrMeUIw==", + "_location": "/are-we-there-yet", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "are-we-there-yet@^2.0.0", + "name": "are-we-there-yet", + "escapedName": "are-we-there-yet", + "rawSpec": "^2.0.0", + "saveSpec": null, + "fetchSpec": "^2.0.0" + }, + "_requiredBy": [ + "/npmlog" + ], + "_resolved": "https://registry.npmjs.org/are-we-there-yet/-/are-we-there-yet-2.0.0.tgz", + "_shasum": "372e0e7bd279d8e94c653aaa1f67200884bf3e1c", + "_spec": "are-we-there-yet@^2.0.0", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\npmlog", + "author": { + "name": "GitHub Inc." + }, + "bugs": { + "url": "https://github.com/npm/are-we-there-yet/issues" + }, + "bundleDependencies": false, + "dependencies": { + "delegates": "^1.0.0", + "readable-stream": "^3.6.0" + }, + "deprecated": false, + "description": "Keep track of the overall completion of many disparate processes", + "devDependencies": { + "@npmcli/eslint-config": "^1.0.0", + "@npmcli/template-oss": "^1.0.2", + "eslint": "^7.32.0", + "eslint-plugin-node": "^11.1.0", + "tap": "^15.0.9" + }, + "engines": { + "node": ">=10" + }, + "files": [ + "bin", + "lib" + ], + "homepage": "https://github.com/npm/are-we-there-yet", + "license": "ISC", + "main": "lib/index.js", + "name": "are-we-there-yet", + "repository": { + "type": "git", + "url": "git+https://github.com/npm/are-we-there-yet.git" + }, + "scripts": { + "lint": "eslint '**/*.js'", + "lintfix": "npm run lint -- --fix", + "npmclilint": "npmcli-lint", + "postsnap": "npm run lintfix --", + "posttest": "npm run lint", + "postversion": "npm publish", + "prepublishOnly": "git push origin --follow-tags", + "preversion": "npm test", + "snap": "tap", + "test": "tap" + }, + "tap": { + "branches": 68, + "statements": 92, + "functions": 86, + "lines": 92 + }, + "templateVersion": "1.0.2", + "version": "2.0.0" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/array-flatten/LICENSE b/25_03_11/frontend_vizsgafeladat/backend/node_modules/array-flatten/LICENSE new file mode 100644 index 00000000..983fbe8a --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/array-flatten/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2014 Blake Embrey (hello@blakeembrey.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/array-flatten/README.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/array-flatten/README.md new file mode 100644 index 00000000..91fa5b63 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/array-flatten/README.md @@ -0,0 +1,43 @@ +# Array Flatten + +[![NPM version][npm-image]][npm-url] +[![NPM downloads][downloads-image]][downloads-url] +[![Build status][travis-image]][travis-url] +[![Test coverage][coveralls-image]][coveralls-url] + +> Flatten an array of nested arrays into a single flat array. Accepts an optional depth. + +## Installation + +``` +npm install array-flatten --save +``` + +## Usage + +```javascript +var flatten = require('array-flatten') + +flatten([1, [2, [3, [4, [5], 6], 7], 8], 9]) +//=> [1, 2, 3, 4, 5, 6, 7, 8, 9] + +flatten([1, [2, [3, [4, [5], 6], 7], 8], 9], 2) +//=> [1, 2, 3, [4, [5], 6], 7, 8, 9] + +(function () { + flatten(arguments) //=> [1, 2, 3] +})(1, [2, 3]) +``` + +## License + +MIT + +[npm-image]: https://img.shields.io/npm/v/array-flatten.svg?style=flat +[npm-url]: https://npmjs.org/package/array-flatten +[downloads-image]: https://img.shields.io/npm/dm/array-flatten.svg?style=flat +[downloads-url]: https://npmjs.org/package/array-flatten +[travis-image]: https://img.shields.io/travis/blakeembrey/array-flatten.svg?style=flat +[travis-url]: https://travis-ci.org/blakeembrey/array-flatten +[coveralls-image]: https://img.shields.io/coveralls/blakeembrey/array-flatten.svg?style=flat +[coveralls-url]: https://coveralls.io/r/blakeembrey/array-flatten?branch=master diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/array-flatten/array-flatten.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/array-flatten/array-flatten.js new file mode 100644 index 00000000..089117b3 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/array-flatten/array-flatten.js @@ -0,0 +1,64 @@ +'use strict' + +/** + * Expose `arrayFlatten`. + */ +module.exports = arrayFlatten + +/** + * Recursive flatten function with depth. + * + * @param {Array} array + * @param {Array} result + * @param {Number} depth + * @return {Array} + */ +function flattenWithDepth (array, result, depth) { + for (var i = 0; i < array.length; i++) { + var value = array[i] + + if (depth > 0 && Array.isArray(value)) { + flattenWithDepth(value, result, depth - 1) + } else { + result.push(value) + } + } + + return result +} + +/** + * Recursive flatten function. Omitting depth is slightly faster. + * + * @param {Array} array + * @param {Array} result + * @return {Array} + */ +function flattenForever (array, result) { + for (var i = 0; i < array.length; i++) { + var value = array[i] + + if (Array.isArray(value)) { + flattenForever(value, result) + } else { + result.push(value) + } + } + + return result +} + +/** + * Flatten an array, with the ability to define a depth. + * + * @param {Array} array + * @param {Number} depth + * @return {Array} + */ +function arrayFlatten (array, depth) { + if (depth == null) { + return flattenForever(array, []) + } + + return flattenWithDepth(array, [], depth) +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/array-flatten/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/array-flatten/package.json new file mode 100644 index 00000000..9b7e9ebc --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/array-flatten/package.json @@ -0,0 +1,64 @@ +{ + "_from": "array-flatten@1.1.1", + "_id": "array-flatten@1.1.1", + "_inBundle": false, + "_integrity": "sha1-ml9pkFGx5wczKPKgCJaLZOopVdI=", + "_location": "/array-flatten", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "array-flatten@1.1.1", + "name": "array-flatten", + "escapedName": "array-flatten", + "rawSpec": "1.1.1", + "saveSpec": null, + "fetchSpec": "1.1.1" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/array-flatten/-/array-flatten-1.1.1.tgz", + "_shasum": "9a5f699051b1e7073328f2a008968b64ea2955d2", + "_spec": "array-flatten@1.1.1", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\express", + "author": { + "name": "Blake Embrey", + "email": "hello@blakeembrey.com", + "url": "http://blakeembrey.me" + }, + "bugs": { + "url": "https://github.com/blakeembrey/array-flatten/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Flatten an array of nested arrays into a single flat array", + "devDependencies": { + "istanbul": "^0.3.13", + "mocha": "^2.2.4", + "pre-commit": "^1.0.7", + "standard": "^3.7.3" + }, + "files": [ + "array-flatten.js", + "LICENSE" + ], + "homepage": "https://github.com/blakeembrey/array-flatten", + "keywords": [ + "array", + "flatten", + "arguments", + "depth" + ], + "license": "MIT", + "main": "array-flatten.js", + "name": "array-flatten", + "repository": { + "type": "git", + "url": "git://github.com/blakeembrey/array-flatten.git" + }, + "scripts": { + "test": "istanbul cover _mocha -- -R spec" + }, + "version": "1.1.1" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/balanced-match/.github/FUNDING.yml b/25_03_11/frontend_vizsgafeladat/backend/node_modules/balanced-match/.github/FUNDING.yml new file mode 100644 index 00000000..cea8b16e --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/balanced-match/.github/FUNDING.yml @@ -0,0 +1,2 @@ +tidelift: "npm/balanced-match" +patreon: juliangruber diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/balanced-match/LICENSE.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/balanced-match/LICENSE.md new file mode 100644 index 00000000..2cdc8e41 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/balanced-match/LICENSE.md @@ -0,0 +1,21 @@ +(MIT) + +Copyright (c) 2013 Julian Gruber <julian@juliangruber.com> + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies +of the Software, and to permit persons to whom the Software is furnished to do +so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/balanced-match/README.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/balanced-match/README.md new file mode 100644 index 00000000..d2a48b6b --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/balanced-match/README.md @@ -0,0 +1,97 @@ +# balanced-match + +Match balanced string pairs, like `{` and `}` or `` and ``. Supports regular expressions as well! + +[![build status](https://secure.travis-ci.org/juliangruber/balanced-match.svg)](http://travis-ci.org/juliangruber/balanced-match) +[![downloads](https://img.shields.io/npm/dm/balanced-match.svg)](https://www.npmjs.org/package/balanced-match) + +[![testling badge](https://ci.testling.com/juliangruber/balanced-match.png)](https://ci.testling.com/juliangruber/balanced-match) + +## Example + +Get the first matching pair of braces: + +```js +var balanced = require('balanced-match'); + +console.log(balanced('{', '}', 'pre{in{nested}}post')); +console.log(balanced('{', '}', 'pre{first}between{second}post')); +console.log(balanced(/\s+\{\s+/, /\s+\}\s+/, 'pre { in{nest} } post')); +``` + +The matches are: + +```bash +$ node example.js +{ start: 3, end: 14, pre: 'pre', body: 'in{nested}', post: 'post' } +{ start: 3, + end: 9, + pre: 'pre', + body: 'first', + post: 'between{second}post' } +{ start: 3, end: 17, pre: 'pre', body: 'in{nest}', post: 'post' } +``` + +## API + +### var m = balanced(a, b, str) + +For the first non-nested matching pair of `a` and `b` in `str`, return an +object with those keys: + +* **start** the index of the first match of `a` +* **end** the index of the matching `b` +* **pre** the preamble, `a` and `b` not included +* **body** the match, `a` and `b` not included +* **post** the postscript, `a` and `b` not included + +If there's no match, `undefined` will be returned. + +If the `str` contains more `a` than `b` / there are unmatched pairs, the first match that was closed will be used. For example, `{{a}` will match `['{', 'a', '']` and `{a}}` will match `['', 'a', '}']`. + +### var r = balanced.range(a, b, str) + +For the first non-nested matching pair of `a` and `b` in `str`, return an +array with indexes: `[ , ]`. + +If there's no match, `undefined` will be returned. + +If the `str` contains more `a` than `b` / there are unmatched pairs, the first match that was closed will be used. For example, `{{a}` will match `[ 1, 3 ]` and `{a}}` will match `[0, 2]`. + +## Installation + +With [npm](https://npmjs.org) do: + +```bash +npm install balanced-match +``` + +## Security contact information + +To report a security vulnerability, please use the +[Tidelift security contact](https://tidelift.com/security). +Tidelift will coordinate the fix and disclosure. + +## License + +(MIT) + +Copyright (c) 2013 Julian Gruber <julian@juliangruber.com> + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies +of the Software, and to permit persons to whom the Software is furnished to do +so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/balanced-match/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/balanced-match/index.js new file mode 100644 index 00000000..c67a6460 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/balanced-match/index.js @@ -0,0 +1,62 @@ +'use strict'; +module.exports = balanced; +function balanced(a, b, str) { + if (a instanceof RegExp) a = maybeMatch(a, str); + if (b instanceof RegExp) b = maybeMatch(b, str); + + var r = range(a, b, str); + + return r && { + start: r[0], + end: r[1], + pre: str.slice(0, r[0]), + body: str.slice(r[0] + a.length, r[1]), + post: str.slice(r[1] + b.length) + }; +} + +function maybeMatch(reg, str) { + var m = str.match(reg); + return m ? m[0] : null; +} + +balanced.range = range; +function range(a, b, str) { + var begs, beg, left, right, result; + var ai = str.indexOf(a); + var bi = str.indexOf(b, ai + 1); + var i = ai; + + if (ai >= 0 && bi > 0) { + if(a===b) { + return [ai, bi]; + } + begs = []; + left = str.length; + + while (i >= 0 && !result) { + if (i == ai) { + begs.push(i); + ai = str.indexOf(a, i + 1); + } else if (begs.length == 1) { + result = [ begs.pop(), bi ]; + } else { + beg = begs.pop(); + if (beg < left) { + left = beg; + right = bi; + } + + bi = str.indexOf(b, i + 1); + } + + i = ai < bi && ai >= 0 ? ai : bi; + } + + if (begs.length) { + result = [ left, right ]; + } + } + + return result; +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/balanced-match/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/balanced-match/package.json new file mode 100644 index 00000000..0dcac0c9 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/balanced-match/package.json @@ -0,0 +1,76 @@ +{ + "_from": "balanced-match@^1.0.0", + "_id": "balanced-match@1.0.2", + "_inBundle": false, + "_integrity": "sha512-3oSeUO0TMV67hN1AmbXsK4yaqU7tjiHlbxRDZOpH0KW9+CeX4bRAaX0Anxt0tx2MrpRpWwQaPwIlISEJhYU5Pw==", + "_location": "/balanced-match", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "balanced-match@^1.0.0", + "name": "balanced-match", + "escapedName": "balanced-match", + "rawSpec": "^1.0.0", + "saveSpec": null, + "fetchSpec": "^1.0.0" + }, + "_requiredBy": [ + "/brace-expansion" + ], + "_resolved": "https://registry.npmjs.org/balanced-match/-/balanced-match-1.0.2.tgz", + "_shasum": "e83e3a7e3f300b34cb9d87f615fa0cbf357690ee", + "_spec": "balanced-match@^1.0.0", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\brace-expansion", + "author": { + "name": "Julian Gruber", + "email": "mail@juliangruber.com", + "url": "http://juliangruber.com" + }, + "bugs": { + "url": "https://github.com/juliangruber/balanced-match/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Match balanced character pairs, like \"{\" and \"}\"", + "devDependencies": { + "matcha": "^0.7.0", + "tape": "^4.6.0" + }, + "homepage": "https://github.com/juliangruber/balanced-match", + "keywords": [ + "match", + "regexp", + "test", + "balanced", + "parse" + ], + "license": "MIT", + "main": "index.js", + "name": "balanced-match", + "repository": { + "type": "git", + "url": "git://github.com/juliangruber/balanced-match.git" + }, + "scripts": { + "bench": "matcha test/bench.js", + "test": "tape test/test.js" + }, + "testling": { + "files": "test/*.js", + "browsers": [ + "ie/8..latest", + "firefox/20..latest", + "firefox/nightly", + "chrome/25..latest", + "chrome/canary", + "opera/12..latest", + "opera/next", + "safari/5.1..latest", + "ipad/6.0..latest", + "iphone/6.0..latest", + "android-browser/4.2..latest" + ] + }, + "version": "1.0.2" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/binary-extensions/binary-extensions.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/binary-extensions/binary-extensions.json new file mode 100644 index 00000000..4aab3837 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/binary-extensions/binary-extensions.json @@ -0,0 +1,260 @@ +[ + "3dm", + "3ds", + "3g2", + "3gp", + "7z", + "a", + "aac", + "adp", + "ai", + "aif", + "aiff", + "alz", + "ape", + "apk", + "appimage", + "ar", + "arj", + "asf", + "au", + "avi", + "bak", + "baml", + "bh", + "bin", + "bk", + "bmp", + "btif", + "bz2", + "bzip2", + "cab", + "caf", + "cgm", + "class", + "cmx", + "cpio", + "cr2", + "cur", + "dat", + "dcm", + "deb", + "dex", + "djvu", + "dll", + "dmg", + "dng", + "doc", + "docm", + "docx", + "dot", + "dotm", + "dra", + "DS_Store", + "dsk", + "dts", + "dtshd", + "dvb", + "dwg", + "dxf", + "ecelp4800", + "ecelp7470", + "ecelp9600", + "egg", + "eol", + "eot", + "epub", + "exe", + "f4v", + "fbs", + "fh", + "fla", + "flac", + "flatpak", + "fli", + "flv", + "fpx", + "fst", + "fvt", + "g3", + "gh", + "gif", + "graffle", + "gz", + "gzip", + "h261", + "h263", + "h264", + "icns", + "ico", + "ief", + "img", + "ipa", + "iso", + "jar", + "jpeg", + "jpg", + "jpgv", + "jpm", + "jxr", + "key", + "ktx", + "lha", + "lib", + "lvp", + "lz", + "lzh", + "lzma", + "lzo", + "m3u", + "m4a", + "m4v", + "mar", + "mdi", + "mht", + "mid", + "midi", + "mj2", + "mka", + "mkv", + "mmr", + "mng", + "mobi", + "mov", + "movie", + "mp3", + "mp4", + "mp4a", + "mpeg", + "mpg", + "mpga", + "mxu", + "nef", + "npx", + "numbers", + "nupkg", + "o", + "odp", + "ods", + "odt", + "oga", + "ogg", + "ogv", + "otf", + "ott", + "pages", + "pbm", + "pcx", + "pdb", + "pdf", + "pea", + "pgm", + "pic", + "png", + "pnm", + "pot", + "potm", + "potx", + "ppa", + "ppam", + "ppm", + "pps", + "ppsm", + "ppsx", + "ppt", + "pptm", + "pptx", + "psd", + "pya", + "pyc", + "pyo", + "pyv", + "qt", + "rar", + "ras", + "raw", + "resources", + "rgb", + "rip", + "rlc", + "rmf", + "rmvb", + "rpm", + "rtf", + "rz", + "s3m", + "s7z", + "scpt", + "sgi", + "shar", + "snap", + "sil", + "sketch", + "slk", + "smv", + "snk", + "so", + "stl", + "suo", + "sub", + "swf", + "tar", + "tbz", + "tbz2", + "tga", + "tgz", + "thmx", + "tif", + "tiff", + "tlz", + "ttc", + "ttf", + "txz", + "udf", + "uvh", + "uvi", + "uvm", + "uvp", + "uvs", + "uvu", + "viv", + "vob", + "war", + "wav", + "wax", + "wbmp", + "wdp", + "weba", + "webm", + "webp", + "whl", + "wim", + "wm", + "wma", + "wmv", + "wmx", + "woff", + "woff2", + "wrm", + "wvx", + "xbm", + "xif", + "xla", + "xlam", + "xls", + "xlsb", + "xlsm", + "xlsx", + "xlt", + "xltm", + "xltx", + "xm", + "xmind", + "xpi", + "xpm", + "xwd", + "xz", + "z", + "zip", + "zipx" +] diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/binary-extensions/binary-extensions.json.d.ts b/25_03_11/frontend_vizsgafeladat/backend/node_modules/binary-extensions/binary-extensions.json.d.ts new file mode 100644 index 00000000..94a248c2 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/binary-extensions/binary-extensions.json.d.ts @@ -0,0 +1,3 @@ +declare const binaryExtensionsJson: readonly string[]; + +export = binaryExtensionsJson; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/binary-extensions/index.d.ts b/25_03_11/frontend_vizsgafeladat/backend/node_modules/binary-extensions/index.d.ts new file mode 100644 index 00000000..f469ac5f --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/binary-extensions/index.d.ts @@ -0,0 +1,14 @@ +/** +List of binary file extensions. + +@example +``` +import binaryExtensions = require('binary-extensions'); + +console.log(binaryExtensions); +//=> ['3ds', '3g2', …] +``` +*/ +declare const binaryExtensions: readonly string[]; + +export = binaryExtensions; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/binary-extensions/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/binary-extensions/index.js new file mode 100644 index 00000000..d46e4688 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/binary-extensions/index.js @@ -0,0 +1 @@ +module.exports = require('./binary-extensions.json'); diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/binary-extensions/license b/25_03_11/frontend_vizsgafeladat/backend/node_modules/binary-extensions/license new file mode 100644 index 00000000..401b1c73 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/binary-extensions/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) 2019 Sindre Sorhus (https://sindresorhus.com), Paul Miller (https://paulmillr.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/binary-extensions/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/binary-extensions/package.json new file mode 100644 index 00000000..0ce5f445 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/binary-extensions/package.json @@ -0,0 +1,70 @@ +{ + "_from": "binary-extensions@^2.0.0", + "_id": "binary-extensions@2.2.0", + "_inBundle": false, + "_integrity": "sha512-jDctJ/IVQbZoJykoeHbhXpOlNBqGNcwXJKJog42E5HDPUwQTSdjCHdihjj0DlnheQ7blbT6dHOafNAiS8ooQKA==", + "_location": "/binary-extensions", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "binary-extensions@^2.0.0", + "name": "binary-extensions", + "escapedName": "binary-extensions", + "rawSpec": "^2.0.0", + "saveSpec": null, + "fetchSpec": "^2.0.0" + }, + "_requiredBy": [ + "/is-binary-path" + ], + "_resolved": "https://registry.npmjs.org/binary-extensions/-/binary-extensions-2.2.0.tgz", + "_shasum": "75f502eeaf9ffde42fc98829645be4ea76bd9e2d", + "_spec": "binary-extensions@^2.0.0", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\is-binary-path", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "sindresorhus.com" + }, + "bugs": { + "url": "https://github.com/sindresorhus/binary-extensions/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "List of binary file extensions", + "devDependencies": { + "ava": "^1.4.1", + "tsd": "^0.7.2", + "xo": "^0.24.0" + }, + "engines": { + "node": ">=8" + }, + "files": [ + "index.js", + "index.d.ts", + "binary-extensions.json", + "binary-extensions.json.d.ts" + ], + "homepage": "https://github.com/sindresorhus/binary-extensions#readme", + "keywords": [ + "binary", + "extensions", + "extension", + "file", + "json", + "list", + "array" + ], + "license": "MIT", + "name": "binary-extensions", + "repository": { + "type": "git", + "url": "git+https://github.com/sindresorhus/binary-extensions.git" + }, + "scripts": { + "test": "xo && ava && tsd" + }, + "version": "2.2.0" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/binary-extensions/readme.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/binary-extensions/readme.md new file mode 100644 index 00000000..3e25dd83 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/binary-extensions/readme.md @@ -0,0 +1,41 @@ +# binary-extensions + +> List of binary file extensions + +The list is just a [JSON file](binary-extensions.json) and can be used anywhere. + + +## Install + +``` +$ npm install binary-extensions +``` + + +## Usage + +```js +const binaryExtensions = require('binary-extensions'); + +console.log(binaryExtensions); +//=> ['3ds', '3g2', …] +``` + + +## Related + +- [is-binary-path](https://github.com/sindresorhus/is-binary-path) - Check if a filepath is a binary file +- [text-extensions](https://github.com/sindresorhus/text-extensions) - List of text file extensions + + +--- + +
+ + Get professional support for this package with a Tidelift subscription + +
+ + Tidelift helps make open source sustainable for maintainers while giving companies
assurances about security, maintenance, and licensing for their dependencies. + +
diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/body-parser/HISTORY.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/body-parser/HISTORY.md new file mode 100644 index 00000000..e114f6af --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/body-parser/HISTORY.md @@ -0,0 +1,651 @@ +1.20.0 / 2022-04-02 +=================== + + * Fix error message for json parse whitespace in `strict` + * Fix internal error when inflated body exceeds limit + * Prevent loss of async hooks context + * Prevent hanging when request already read + * deps: depd@2.0.0 + - Replace internal `eval` usage with `Function` constructor + - Use instance methods on `process` to check for listeners + * deps: http-errors@2.0.0 + - deps: depd@2.0.0 + - deps: statuses@2.0.1 + * deps: on-finished@2.4.1 + * deps: qs@6.10.3 + * deps: raw-body@2.5.1 + - deps: http-errors@2.0.0 + +1.19.2 / 2022-02-15 +=================== + + * deps: bytes@3.1.2 + * deps: qs@6.9.7 + * Fix handling of `__proto__` keys + * deps: raw-body@2.4.3 + - deps: bytes@3.1.2 + +1.19.1 / 2021-12-10 +=================== + + * deps: bytes@3.1.1 + * deps: http-errors@1.8.1 + - deps: inherits@2.0.4 + - deps: toidentifier@1.0.1 + - deps: setprototypeof@1.2.0 + * deps: qs@6.9.6 + * deps: raw-body@2.4.2 + - deps: bytes@3.1.1 + - deps: http-errors@1.8.1 + * deps: safe-buffer@5.2.1 + * deps: type-is@~1.6.18 + +1.19.0 / 2019-04-25 +=================== + + * deps: bytes@3.1.0 + - Add petabyte (`pb`) support + * deps: http-errors@1.7.2 + - Set constructor name when possible + - deps: setprototypeof@1.1.1 + - deps: statuses@'>= 1.5.0 < 2' + * deps: iconv-lite@0.4.24 + - Added encoding MIK + * deps: qs@6.7.0 + - Fix parsing array brackets after index + * deps: raw-body@2.4.0 + - deps: bytes@3.1.0 + - deps: http-errors@1.7.2 + - deps: iconv-lite@0.4.24 + * deps: type-is@~1.6.17 + - deps: mime-types@~2.1.24 + - perf: prevent internal `throw` on invalid type + +1.18.3 / 2018-05-14 +=================== + + * Fix stack trace for strict json parse error + * deps: depd@~1.1.2 + - perf: remove argument reassignment + * deps: http-errors@~1.6.3 + - deps: depd@~1.1.2 + - deps: setprototypeof@1.1.0 + - deps: statuses@'>= 1.3.1 < 2' + * deps: iconv-lite@0.4.23 + - Fix loading encoding with year appended + - Fix deprecation warnings on Node.js 10+ + * deps: qs@6.5.2 + * deps: raw-body@2.3.3 + - deps: http-errors@1.6.3 + - deps: iconv-lite@0.4.23 + * deps: type-is@~1.6.16 + - deps: mime-types@~2.1.18 + +1.18.2 / 2017-09-22 +=================== + + * deps: debug@2.6.9 + * perf: remove argument reassignment + +1.18.1 / 2017-09-12 +=================== + + * deps: content-type@~1.0.4 + - perf: remove argument reassignment + - perf: skip parameter parsing when no parameters + * deps: iconv-lite@0.4.19 + - Fix ISO-8859-1 regression + - Update Windows-1255 + * deps: qs@6.5.1 + - Fix parsing & compacting very deep objects + * deps: raw-body@2.3.2 + - deps: iconv-lite@0.4.19 + +1.18.0 / 2017-09-08 +=================== + + * Fix JSON strict violation error to match native parse error + * Include the `body` property on verify errors + * Include the `type` property on all generated errors + * Use `http-errors` to set status code on errors + * deps: bytes@3.0.0 + * deps: debug@2.6.8 + * deps: depd@~1.1.1 + - Remove unnecessary `Buffer` loading + * deps: http-errors@~1.6.2 + - deps: depd@1.1.1 + * deps: iconv-lite@0.4.18 + - Add support for React Native + - Add a warning if not loaded as utf-8 + - Fix CESU-8 decoding in Node.js 8 + - Improve speed of ISO-8859-1 encoding + * deps: qs@6.5.0 + * deps: raw-body@2.3.1 + - Use `http-errors` for standard emitted errors + - deps: bytes@3.0.0 + - deps: iconv-lite@0.4.18 + - perf: skip buffer decoding on overage chunk + * perf: prevent internal `throw` when missing charset + +1.17.2 / 2017-05-17 +=================== + + * deps: debug@2.6.7 + - Fix `DEBUG_MAX_ARRAY_LENGTH` + - deps: ms@2.0.0 + * deps: type-is@~1.6.15 + - deps: mime-types@~2.1.15 + +1.17.1 / 2017-03-06 +=================== + + * deps: qs@6.4.0 + - Fix regression parsing keys starting with `[` + +1.17.0 / 2017-03-01 +=================== + + * deps: http-errors@~1.6.1 + - Make `message` property enumerable for `HttpError`s + - deps: setprototypeof@1.0.3 + * deps: qs@6.3.1 + - Fix compacting nested arrays + +1.16.1 / 2017-02-10 +=================== + + * deps: debug@2.6.1 + - Fix deprecation messages in WebStorm and other editors + - Undeprecate `DEBUG_FD` set to `1` or `2` + +1.16.0 / 2017-01-17 +=================== + + * deps: debug@2.6.0 + - Allow colors in workers + - Deprecated `DEBUG_FD` environment variable + - Fix error when running under React Native + - Use same color for same namespace + - deps: ms@0.7.2 + * deps: http-errors@~1.5.1 + - deps: inherits@2.0.3 + - deps: setprototypeof@1.0.2 + - deps: statuses@'>= 1.3.1 < 2' + * deps: iconv-lite@0.4.15 + - Added encoding MS-31J + - Added encoding MS-932 + - Added encoding MS-936 + - Added encoding MS-949 + - Added encoding MS-950 + - Fix GBK/GB18030 handling of Euro character + * deps: qs@6.2.1 + - Fix array parsing from skipping empty values + * deps: raw-body@~2.2.0 + - deps: iconv-lite@0.4.15 + * deps: type-is@~1.6.14 + - deps: mime-types@~2.1.13 + +1.15.2 / 2016-06-19 +=================== + + * deps: bytes@2.4.0 + * deps: content-type@~1.0.2 + - perf: enable strict mode + * deps: http-errors@~1.5.0 + - Use `setprototypeof` module to replace `__proto__` setting + - deps: statuses@'>= 1.3.0 < 2' + - perf: enable strict mode + * deps: qs@6.2.0 + * deps: raw-body@~2.1.7 + - deps: bytes@2.4.0 + - perf: remove double-cleanup on happy path + * deps: type-is@~1.6.13 + - deps: mime-types@~2.1.11 + +1.15.1 / 2016-05-05 +=================== + + * deps: bytes@2.3.0 + - Drop partial bytes on all parsed units + - Fix parsing byte string that looks like hex + * deps: raw-body@~2.1.6 + - deps: bytes@2.3.0 + * deps: type-is@~1.6.12 + - deps: mime-types@~2.1.10 + +1.15.0 / 2016-02-10 +=================== + + * deps: http-errors@~1.4.0 + - Add `HttpError` export, for `err instanceof createError.HttpError` + - deps: inherits@2.0.1 + - deps: statuses@'>= 1.2.1 < 2' + * deps: qs@6.1.0 + * deps: type-is@~1.6.11 + - deps: mime-types@~2.1.9 + +1.14.2 / 2015-12-16 +=================== + + * deps: bytes@2.2.0 + * deps: iconv-lite@0.4.13 + * deps: qs@5.2.0 + * deps: raw-body@~2.1.5 + - deps: bytes@2.2.0 + - deps: iconv-lite@0.4.13 + * deps: type-is@~1.6.10 + - deps: mime-types@~2.1.8 + +1.14.1 / 2015-09-27 +=================== + + * Fix issue where invalid charset results in 400 when `verify` used + * deps: iconv-lite@0.4.12 + - Fix CESU-8 decoding in Node.js 4.x + * deps: raw-body@~2.1.4 + - Fix masking critical errors from `iconv-lite` + - deps: iconv-lite@0.4.12 + * deps: type-is@~1.6.9 + - deps: mime-types@~2.1.7 + +1.14.0 / 2015-09-16 +=================== + + * Fix JSON strict parse error to match syntax errors + * Provide static `require` analysis in `urlencoded` parser + * deps: depd@~1.1.0 + - Support web browser loading + * deps: qs@5.1.0 + * deps: raw-body@~2.1.3 + - Fix sync callback when attaching data listener causes sync read + * deps: type-is@~1.6.8 + - Fix type error when given invalid type to match against + - deps: mime-types@~2.1.6 + +1.13.3 / 2015-07-31 +=================== + + * deps: type-is@~1.6.6 + - deps: mime-types@~2.1.4 + +1.13.2 / 2015-07-05 +=================== + + * deps: iconv-lite@0.4.11 + * deps: qs@4.0.0 + - Fix dropping parameters like `hasOwnProperty` + - Fix user-visible incompatibilities from 3.1.0 + - Fix various parsing edge cases + * deps: raw-body@~2.1.2 + - Fix error stack traces to skip `makeError` + - deps: iconv-lite@0.4.11 + * deps: type-is@~1.6.4 + - deps: mime-types@~2.1.2 + - perf: enable strict mode + - perf: remove argument reassignment + +1.13.1 / 2015-06-16 +=================== + + * deps: qs@2.4.2 + - Downgraded from 3.1.0 because of user-visible incompatibilities + +1.13.0 / 2015-06-14 +=================== + + * Add `statusCode` property on `Error`s, in addition to `status` + * Change `type` default to `application/json` for JSON parser + * Change `type` default to `application/x-www-form-urlencoded` for urlencoded parser + * Provide static `require` analysis + * Use the `http-errors` module to generate errors + * deps: bytes@2.1.0 + - Slight optimizations + * deps: iconv-lite@0.4.10 + - The encoding UTF-16 without BOM now defaults to UTF-16LE when detection fails + - Leading BOM is now removed when decoding + * deps: on-finished@~2.3.0 + - Add defined behavior for HTTP `CONNECT` requests + - Add defined behavior for HTTP `Upgrade` requests + - deps: ee-first@1.1.1 + * deps: qs@3.1.0 + - Fix dropping parameters like `hasOwnProperty` + - Fix various parsing edge cases + - Parsed object now has `null` prototype + * deps: raw-body@~2.1.1 + - Use `unpipe` module for unpiping requests + - deps: iconv-lite@0.4.10 + * deps: type-is@~1.6.3 + - deps: mime-types@~2.1.1 + - perf: reduce try block size + - perf: remove bitwise operations + * perf: enable strict mode + * perf: remove argument reassignment + * perf: remove delete call + +1.12.4 / 2015-05-10 +=================== + + * deps: debug@~2.2.0 + * deps: qs@2.4.2 + - Fix allowing parameters like `constructor` + * deps: on-finished@~2.2.1 + * deps: raw-body@~2.0.1 + - Fix a false-positive when unpiping in Node.js 0.8 + - deps: bytes@2.0.1 + * deps: type-is@~1.6.2 + - deps: mime-types@~2.0.11 + +1.12.3 / 2015-04-15 +=================== + + * Slight efficiency improvement when not debugging + * deps: depd@~1.0.1 + * deps: iconv-lite@0.4.8 + - Add encoding alias UNICODE-1-1-UTF-7 + * deps: raw-body@1.3.4 + - Fix hanging callback if request aborts during read + - deps: iconv-lite@0.4.8 + +1.12.2 / 2015-03-16 +=================== + + * deps: qs@2.4.1 + - Fix error when parameter `hasOwnProperty` is present + +1.12.1 / 2015-03-15 +=================== + + * deps: debug@~2.1.3 + - Fix high intensity foreground color for bold + - deps: ms@0.7.0 + * deps: type-is@~1.6.1 + - deps: mime-types@~2.0.10 + +1.12.0 / 2015-02-13 +=================== + + * add `debug` messages + * accept a function for the `type` option + * use `content-type` to parse `Content-Type` headers + * deps: iconv-lite@0.4.7 + - Gracefully support enumerables on `Object.prototype` + * deps: raw-body@1.3.3 + - deps: iconv-lite@0.4.7 + * deps: type-is@~1.6.0 + - fix argument reassignment + - fix false-positives in `hasBody` `Transfer-Encoding` check + - support wildcard for both type and subtype (`*/*`) + - deps: mime-types@~2.0.9 + +1.11.0 / 2015-01-30 +=================== + + * make internal `extended: true` depth limit infinity + * deps: type-is@~1.5.6 + - deps: mime-types@~2.0.8 + +1.10.2 / 2015-01-20 +=================== + + * deps: iconv-lite@0.4.6 + - Fix rare aliases of single-byte encodings + * deps: raw-body@1.3.2 + - deps: iconv-lite@0.4.6 + +1.10.1 / 2015-01-01 +=================== + + * deps: on-finished@~2.2.0 + * deps: type-is@~1.5.5 + - deps: mime-types@~2.0.7 + +1.10.0 / 2014-12-02 +=================== + + * make internal `extended: true` array limit dynamic + +1.9.3 / 2014-11-21 +================== + + * deps: iconv-lite@0.4.5 + - Fix Windows-31J and X-SJIS encoding support + * deps: qs@2.3.3 + - Fix `arrayLimit` behavior + * deps: raw-body@1.3.1 + - deps: iconv-lite@0.4.5 + * deps: type-is@~1.5.3 + - deps: mime-types@~2.0.3 + +1.9.2 / 2014-10-27 +================== + + * deps: qs@2.3.2 + - Fix parsing of mixed objects and values + +1.9.1 / 2014-10-22 +================== + + * deps: on-finished@~2.1.1 + - Fix handling of pipelined requests + * deps: qs@2.3.0 + - Fix parsing of mixed implicit and explicit arrays + * deps: type-is@~1.5.2 + - deps: mime-types@~2.0.2 + +1.9.0 / 2014-09-24 +================== + + * include the charset in "unsupported charset" error message + * include the encoding in "unsupported content encoding" error message + * deps: depd@~1.0.0 + +1.8.4 / 2014-09-23 +================== + + * fix content encoding to be case-insensitive + +1.8.3 / 2014-09-19 +================== + + * deps: qs@2.2.4 + - Fix issue with object keys starting with numbers truncated + +1.8.2 / 2014-09-15 +================== + + * deps: depd@0.4.5 + +1.8.1 / 2014-09-07 +================== + + * deps: media-typer@0.3.0 + * deps: type-is@~1.5.1 + +1.8.0 / 2014-09-05 +================== + + * make empty-body-handling consistent between chunked requests + - empty `json` produces `{}` + - empty `raw` produces `new Buffer(0)` + - empty `text` produces `''` + - empty `urlencoded` produces `{}` + * deps: qs@2.2.3 + - Fix issue where first empty value in array is discarded + * deps: type-is@~1.5.0 + - fix `hasbody` to be true for `content-length: 0` + +1.7.0 / 2014-09-01 +================== + + * add `parameterLimit` option to `urlencoded` parser + * change `urlencoded` extended array limit to 100 + * respond with 413 when over `parameterLimit` in `urlencoded` + +1.6.7 / 2014-08-29 +================== + + * deps: qs@2.2.2 + - Remove unnecessary cloning + +1.6.6 / 2014-08-27 +================== + + * deps: qs@2.2.0 + - Array parsing fix + - Performance improvements + +1.6.5 / 2014-08-16 +================== + + * deps: on-finished@2.1.0 + +1.6.4 / 2014-08-14 +================== + + * deps: qs@1.2.2 + +1.6.3 / 2014-08-10 +================== + + * deps: qs@1.2.1 + +1.6.2 / 2014-08-07 +================== + + * deps: qs@1.2.0 + - Fix parsing array of objects + +1.6.1 / 2014-08-06 +================== + + * deps: qs@1.1.0 + - Accept urlencoded square brackets + - Accept empty values in implicit array notation + +1.6.0 / 2014-08-05 +================== + + * deps: qs@1.0.2 + - Complete rewrite + - Limits array length to 20 + - Limits object depth to 5 + - Limits parameters to 1,000 + +1.5.2 / 2014-07-27 +================== + + * deps: depd@0.4.4 + - Work-around v8 generating empty stack traces + +1.5.1 / 2014-07-26 +================== + + * deps: depd@0.4.3 + - Fix exception when global `Error.stackTraceLimit` is too low + +1.5.0 / 2014-07-20 +================== + + * deps: depd@0.4.2 + - Add `TRACE_DEPRECATION` environment variable + - Remove non-standard grey color from color output + - Support `--no-deprecation` argument + - Support `--trace-deprecation` argument + * deps: iconv-lite@0.4.4 + - Added encoding UTF-7 + * deps: raw-body@1.3.0 + - deps: iconv-lite@0.4.4 + - Added encoding UTF-7 + - Fix `Cannot switch to old mode now` error on Node.js 0.10+ + * deps: type-is@~1.3.2 + +1.4.3 / 2014-06-19 +================== + + * deps: type-is@1.3.1 + - fix global variable leak + +1.4.2 / 2014-06-19 +================== + + * deps: type-is@1.3.0 + - improve type parsing + +1.4.1 / 2014-06-19 +================== + + * fix urlencoded extended deprecation message + +1.4.0 / 2014-06-19 +================== + + * add `text` parser + * add `raw` parser + * check accepted charset in content-type (accepts utf-8) + * check accepted encoding in content-encoding (accepts identity) + * deprecate `bodyParser()` middleware; use `.json()` and `.urlencoded()` as needed + * deprecate `urlencoded()` without provided `extended` option + * lazy-load urlencoded parsers + * parsers split into files for reduced mem usage + * support gzip and deflate bodies + - set `inflate: false` to turn off + * deps: raw-body@1.2.2 + - Support all encodings from `iconv-lite` + +1.3.1 / 2014-06-11 +================== + + * deps: type-is@1.2.1 + - Switch dependency from mime to mime-types@1.0.0 + +1.3.0 / 2014-05-31 +================== + + * add `extended` option to urlencoded parser + +1.2.2 / 2014-05-27 +================== + + * deps: raw-body@1.1.6 + - assert stream encoding on node.js 0.8 + - assert stream encoding on node.js < 0.10.6 + - deps: bytes@1 + +1.2.1 / 2014-05-26 +================== + + * invoke `next(err)` after request fully read + - prevents hung responses and socket hang ups + +1.2.0 / 2014-05-11 +================== + + * add `verify` option + * deps: type-is@1.2.0 + - support suffix matching + +1.1.2 / 2014-05-11 +================== + + * improve json parser speed + +1.1.1 / 2014-05-11 +================== + + * fix repeated limit parsing with every request + +1.1.0 / 2014-05-10 +================== + + * add `type` option + * deps: pin for safety and consistency + +1.0.2 / 2014-04-14 +================== + + * use `type-is` module + +1.0.1 / 2014-03-20 +================== + + * lower default limits to 100kb diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/body-parser/LICENSE b/25_03_11/frontend_vizsgafeladat/backend/node_modules/body-parser/LICENSE new file mode 100644 index 00000000..386b7b69 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/body-parser/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2014 Jonathan Ong +Copyright (c) 2014-2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/body-parser/README.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/body-parser/README.md new file mode 100644 index 00000000..1149aff5 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/body-parser/README.md @@ -0,0 +1,464 @@ +# body-parser + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Build Status][github-actions-ci-image]][github-actions-ci-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Node.js body parsing middleware. + +Parse incoming request bodies in a middleware before your handlers, available +under the `req.body` property. + +**Note** As `req.body`'s shape is based on user-controlled input, all +properties and values in this object are untrusted and should be validated +before trusting. For example, `req.body.foo.toString()` may fail in multiple +ways, for example the `foo` property may not be there or may not be a string, +and `toString` may not be a function and instead a string or other user input. + +[Learn about the anatomy of an HTTP transaction in Node.js](https://nodejs.org/en/docs/guides/anatomy-of-an-http-transaction/). + +_This does not handle multipart bodies_, due to their complex and typically +large nature. For multipart bodies, you may be interested in the following +modules: + + * [busboy](https://www.npmjs.org/package/busboy#readme) and + [connect-busboy](https://www.npmjs.org/package/connect-busboy#readme) + * [multiparty](https://www.npmjs.org/package/multiparty#readme) and + [connect-multiparty](https://www.npmjs.org/package/connect-multiparty#readme) + * [formidable](https://www.npmjs.org/package/formidable#readme) + * [multer](https://www.npmjs.org/package/multer#readme) + +This module provides the following parsers: + + * [JSON body parser](#bodyparserjsonoptions) + * [Raw body parser](#bodyparserrawoptions) + * [Text body parser](#bodyparsertextoptions) + * [URL-encoded form body parser](#bodyparserurlencodedoptions) + +Other body parsers you might be interested in: + +- [body](https://www.npmjs.org/package/body#readme) +- [co-body](https://www.npmjs.org/package/co-body#readme) + +## Installation + +```sh +$ npm install body-parser +``` + +## API + +```js +var bodyParser = require('body-parser') +``` + +The `bodyParser` object exposes various factories to create middlewares. All +middlewares will populate the `req.body` property with the parsed body when +the `Content-Type` request header matches the `type` option, or an empty +object (`{}`) if there was no body to parse, the `Content-Type` was not matched, +or an error occurred. + +The various errors returned by this module are described in the +[errors section](#errors). + +### bodyParser.json([options]) + +Returns middleware that only parses `json` and only looks at requests where +the `Content-Type` header matches the `type` option. This parser accepts any +Unicode encoding of the body and supports automatic inflation of `gzip` and +`deflate` encodings. + +A new `body` object containing the parsed data is populated on the `request` +object after the middleware (i.e. `req.body`). + +#### Options + +The `json` function takes an optional `options` object that may contain any of +the following keys: + +##### inflate + +When set to `true`, then deflated (compressed) bodies will be inflated; when +`false`, deflated bodies are rejected. Defaults to `true`. + +##### limit + +Controls the maximum request body size. If this is a number, then the value +specifies the number of bytes; if it is a string, the value is passed to the +[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults +to `'100kb'`. + +##### reviver + +The `reviver` option is passed directly to `JSON.parse` as the second +argument. You can find more information on this argument +[in the MDN documentation about JSON.parse](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/JSON/parse#Example.3A_Using_the_reviver_parameter). + +##### strict + +When set to `true`, will only accept arrays and objects; when `false` will +accept anything `JSON.parse` accepts. Defaults to `true`. + +##### type + +The `type` option is used to determine what media type the middleware will +parse. This option can be a string, array of strings, or a function. If not a +function, `type` option is passed directly to the +[type-is](https://www.npmjs.org/package/type-is#readme) library and this can +be an extension name (like `json`), a mime type (like `application/json`), or +a mime type with a wildcard (like `*/*` or `*/json`). If a function, the `type` +option is called as `fn(req)` and the request is parsed if it returns a truthy +value. Defaults to `application/json`. + +##### verify + +The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`, +where `buf` is a `Buffer` of the raw request body and `encoding` is the +encoding of the request. The parsing can be aborted by throwing an error. + +### bodyParser.raw([options]) + +Returns middleware that parses all bodies as a `Buffer` and only looks at +requests where the `Content-Type` header matches the `type` option. This +parser supports automatic inflation of `gzip` and `deflate` encodings. + +A new `body` object containing the parsed data is populated on the `request` +object after the middleware (i.e. `req.body`). This will be a `Buffer` object +of the body. + +#### Options + +The `raw` function takes an optional `options` object that may contain any of +the following keys: + +##### inflate + +When set to `true`, then deflated (compressed) bodies will be inflated; when +`false`, deflated bodies are rejected. Defaults to `true`. + +##### limit + +Controls the maximum request body size. If this is a number, then the value +specifies the number of bytes; if it is a string, the value is passed to the +[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults +to `'100kb'`. + +##### type + +The `type` option is used to determine what media type the middleware will +parse. This option can be a string, array of strings, or a function. +If not a function, `type` option is passed directly to the +[type-is](https://www.npmjs.org/package/type-is#readme) library and this +can be an extension name (like `bin`), a mime type (like +`application/octet-stream`), or a mime type with a wildcard (like `*/*` or +`application/*`). If a function, the `type` option is called as `fn(req)` +and the request is parsed if it returns a truthy value. Defaults to +`application/octet-stream`. + +##### verify + +The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`, +where `buf` is a `Buffer` of the raw request body and `encoding` is the +encoding of the request. The parsing can be aborted by throwing an error. + +### bodyParser.text([options]) + +Returns middleware that parses all bodies as a string and only looks at +requests where the `Content-Type` header matches the `type` option. This +parser supports automatic inflation of `gzip` and `deflate` encodings. + +A new `body` string containing the parsed data is populated on the `request` +object after the middleware (i.e. `req.body`). This will be a string of the +body. + +#### Options + +The `text` function takes an optional `options` object that may contain any of +the following keys: + +##### defaultCharset + +Specify the default character set for the text content if the charset is not +specified in the `Content-Type` header of the request. Defaults to `utf-8`. + +##### inflate + +When set to `true`, then deflated (compressed) bodies will be inflated; when +`false`, deflated bodies are rejected. Defaults to `true`. + +##### limit + +Controls the maximum request body size. If this is a number, then the value +specifies the number of bytes; if it is a string, the value is passed to the +[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults +to `'100kb'`. + +##### type + +The `type` option is used to determine what media type the middleware will +parse. This option can be a string, array of strings, or a function. If not +a function, `type` option is passed directly to the +[type-is](https://www.npmjs.org/package/type-is#readme) library and this can +be an extension name (like `txt`), a mime type (like `text/plain`), or a mime +type with a wildcard (like `*/*` or `text/*`). If a function, the `type` +option is called as `fn(req)` and the request is parsed if it returns a +truthy value. Defaults to `text/plain`. + +##### verify + +The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`, +where `buf` is a `Buffer` of the raw request body and `encoding` is the +encoding of the request. The parsing can be aborted by throwing an error. + +### bodyParser.urlencoded([options]) + +Returns middleware that only parses `urlencoded` bodies and only looks at +requests where the `Content-Type` header matches the `type` option. This +parser accepts only UTF-8 encoding of the body and supports automatic +inflation of `gzip` and `deflate` encodings. + +A new `body` object containing the parsed data is populated on the `request` +object after the middleware (i.e. `req.body`). This object will contain +key-value pairs, where the value can be a string or array (when `extended` is +`false`), or any type (when `extended` is `true`). + +#### Options + +The `urlencoded` function takes an optional `options` object that may contain +any of the following keys: + +##### extended + +The `extended` option allows to choose between parsing the URL-encoded data +with the `querystring` library (when `false`) or the `qs` library (when +`true`). The "extended" syntax allows for rich objects and arrays to be +encoded into the URL-encoded format, allowing for a JSON-like experience +with URL-encoded. For more information, please +[see the qs library](https://www.npmjs.org/package/qs#readme). + +Defaults to `true`, but using the default has been deprecated. Please +research into the difference between `qs` and `querystring` and choose the +appropriate setting. + +##### inflate + +When set to `true`, then deflated (compressed) bodies will be inflated; when +`false`, deflated bodies are rejected. Defaults to `true`. + +##### limit + +Controls the maximum request body size. If this is a number, then the value +specifies the number of bytes; if it is a string, the value is passed to the +[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults +to `'100kb'`. + +##### parameterLimit + +The `parameterLimit` option controls the maximum number of parameters that +are allowed in the URL-encoded data. If a request contains more parameters +than this value, a 413 will be returned to the client. Defaults to `1000`. + +##### type + +The `type` option is used to determine what media type the middleware will +parse. This option can be a string, array of strings, or a function. If not +a function, `type` option is passed directly to the +[type-is](https://www.npmjs.org/package/type-is#readme) library and this can +be an extension name (like `urlencoded`), a mime type (like +`application/x-www-form-urlencoded`), or a mime type with a wildcard (like +`*/x-www-form-urlencoded`). If a function, the `type` option is called as +`fn(req)` and the request is parsed if it returns a truthy value. Defaults +to `application/x-www-form-urlencoded`. + +##### verify + +The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`, +where `buf` is a `Buffer` of the raw request body and `encoding` is the +encoding of the request. The parsing can be aborted by throwing an error. + +## Errors + +The middlewares provided by this module create errors using the +[`http-errors` module](https://www.npmjs.com/package/http-errors). The errors +will typically have a `status`/`statusCode` property that contains the suggested +HTTP response code, an `expose` property to determine if the `message` property +should be displayed to the client, a `type` property to determine the type of +error without matching against the `message`, and a `body` property containing +the read body, if available. + +The following are the common errors created, though any error can come through +for various reasons. + +### content encoding unsupported + +This error will occur when the request had a `Content-Encoding` header that +contained an encoding but the "inflation" option was set to `false`. The +`status` property is set to `415`, the `type` property is set to +`'encoding.unsupported'`, and the `charset` property will be set to the +encoding that is unsupported. + +### entity parse failed + +This error will occur when the request contained an entity that could not be +parsed by the middleware. The `status` property is set to `400`, the `type` +property is set to `'entity.parse.failed'`, and the `body` property is set to +the entity value that failed parsing. + +### entity verify failed + +This error will occur when the request contained an entity that could not be +failed verification by the defined `verify` option. The `status` property is +set to `403`, the `type` property is set to `'entity.verify.failed'`, and the +`body` property is set to the entity value that failed verification. + +### request aborted + +This error will occur when the request is aborted by the client before reading +the body has finished. The `received` property will be set to the number of +bytes received before the request was aborted and the `expected` property is +set to the number of expected bytes. The `status` property is set to `400` +and `type` property is set to `'request.aborted'`. + +### request entity too large + +This error will occur when the request body's size is larger than the "limit" +option. The `limit` property will be set to the byte limit and the `length` +property will be set to the request body's length. The `status` property is +set to `413` and the `type` property is set to `'entity.too.large'`. + +### request size did not match content length + +This error will occur when the request's length did not match the length from +the `Content-Length` header. This typically occurs when the request is malformed, +typically when the `Content-Length` header was calculated based on characters +instead of bytes. The `status` property is set to `400` and the `type` property +is set to `'request.size.invalid'`. + +### stream encoding should not be set + +This error will occur when something called the `req.setEncoding` method prior +to this middleware. This module operates directly on bytes only and you cannot +call `req.setEncoding` when using this module. The `status` property is set to +`500` and the `type` property is set to `'stream.encoding.set'`. + +### stream is not readable + +This error will occur when the request is no longer readable when this middleware +attempts to read it. This typically means something other than a middleware from +this module read the reqest body already and the middleware was also configured to +read the same request. The `status` property is set to `500` and the `type` +property is set to `'stream.not.readable'`. + +### too many parameters + +This error will occur when the content of the request exceeds the configured +`parameterLimit` for the `urlencoded` parser. The `status` property is set to +`413` and the `type` property is set to `'parameters.too.many'`. + +### unsupported charset "BOGUS" + +This error will occur when the request had a charset parameter in the +`Content-Type` header, but the `iconv-lite` module does not support it OR the +parser does not support it. The charset is contained in the message as well +as in the `charset` property. The `status` property is set to `415`, the +`type` property is set to `'charset.unsupported'`, and the `charset` property +is set to the charset that is unsupported. + +### unsupported content encoding "bogus" + +This error will occur when the request had a `Content-Encoding` header that +contained an unsupported encoding. The encoding is contained in the message +as well as in the `encoding` property. The `status` property is set to `415`, +the `type` property is set to `'encoding.unsupported'`, and the `encoding` +property is set to the encoding that is unsupported. + +## Examples + +### Express/Connect top-level generic + +This example demonstrates adding a generic JSON and URL-encoded parser as a +top-level middleware, which will parse the bodies of all incoming requests. +This is the simplest setup. + +```js +var express = require('express') +var bodyParser = require('body-parser') + +var app = express() + +// parse application/x-www-form-urlencoded +app.use(bodyParser.urlencoded({ extended: false })) + +// parse application/json +app.use(bodyParser.json()) + +app.use(function (req, res) { + res.setHeader('Content-Type', 'text/plain') + res.write('you posted:\n') + res.end(JSON.stringify(req.body, null, 2)) +}) +``` + +### Express route-specific + +This example demonstrates adding body parsers specifically to the routes that +need them. In general, this is the most recommended way to use body-parser with +Express. + +```js +var express = require('express') +var bodyParser = require('body-parser') + +var app = express() + +// create application/json parser +var jsonParser = bodyParser.json() + +// create application/x-www-form-urlencoded parser +var urlencodedParser = bodyParser.urlencoded({ extended: false }) + +// POST /login gets urlencoded bodies +app.post('/login', urlencodedParser, function (req, res) { + res.send('welcome, ' + req.body.username) +}) + +// POST /api/users gets JSON bodies +app.post('/api/users', jsonParser, function (req, res) { + // create user in req.body +}) +``` + +### Change accepted type for parsers + +All the parsers accept a `type` option which allows you to change the +`Content-Type` that the middleware will parse. + +```js +var express = require('express') +var bodyParser = require('body-parser') + +var app = express() + +// parse various different custom JSON types as JSON +app.use(bodyParser.json({ type: 'application/*+json' })) + +// parse some custom thing into a Buffer +app.use(bodyParser.raw({ type: 'application/vnd.custom-type' })) + +// parse an HTML body into a string +app.use(bodyParser.text({ type: 'text/html' })) +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/body-parser.svg +[npm-url]: https://npmjs.org/package/body-parser +[coveralls-image]: https://img.shields.io/coveralls/expressjs/body-parser/master.svg +[coveralls-url]: https://coveralls.io/r/expressjs/body-parser?branch=master +[downloads-image]: https://img.shields.io/npm/dm/body-parser.svg +[downloads-url]: https://npmjs.org/package/body-parser +[github-actions-ci-image]: https://img.shields.io/github/workflow/status/expressjs/body-parser/ci/master?label=ci +[github-actions-ci-url]: https://github.com/expressjs/body-parser/actions/workflows/ci.yml diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/body-parser/SECURITY.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/body-parser/SECURITY.md new file mode 100644 index 00000000..9694d429 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/body-parser/SECURITY.md @@ -0,0 +1,25 @@ +# Security Policies and Procedures + +## Reporting a Bug + +The Express team and community take all security bugs seriously. Thank you +for improving the security of Express. We appreciate your efforts and +responsible disclosure and will make every effort to acknowledge your +contributions. + +Report security bugs by emailing the current owner(s) of `body-parser`. This +information can be found in the npm registry using the command +`npm owner ls body-parser`. +If unsure or unable to get the information from the above, open an issue +in the [project issue tracker](https://github.com/expressjs/body-parser/issues) +asking for the current contact information. + +To ensure the timely response to your report, please ensure that the entirety +of the report is contained within the email body and not solely behind a web +link or an attachment. + +At least one owner will acknowledge your email within 48 hours, and will send a +more detailed response within 48 hours indicating the next steps in handling +your report. After the initial reply to your report, the owners will +endeavor to keep you informed of the progress towards a fix and full +announcement, and may ask for additional information or guidance. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/body-parser/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/body-parser/index.js new file mode 100644 index 00000000..93c3a1ff --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/body-parser/index.js @@ -0,0 +1,157 @@ +/*! + * body-parser + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var deprecate = require('depd')('body-parser') + +/** + * Cache of loaded parsers. + * @private + */ + +var parsers = Object.create(null) + +/** + * @typedef Parsers + * @type {function} + * @property {function} json + * @property {function} raw + * @property {function} text + * @property {function} urlencoded + */ + +/** + * Module exports. + * @type {Parsers} + */ + +exports = module.exports = deprecate.function(bodyParser, + 'bodyParser: use individual json/urlencoded middlewares') + +/** + * JSON parser. + * @public + */ + +Object.defineProperty(exports, 'json', { + configurable: true, + enumerable: true, + get: createParserGetter('json') +}) + +/** + * Raw parser. + * @public + */ + +Object.defineProperty(exports, 'raw', { + configurable: true, + enumerable: true, + get: createParserGetter('raw') +}) + +/** + * Text parser. + * @public + */ + +Object.defineProperty(exports, 'text', { + configurable: true, + enumerable: true, + get: createParserGetter('text') +}) + +/** + * URL-encoded parser. + * @public + */ + +Object.defineProperty(exports, 'urlencoded', { + configurable: true, + enumerable: true, + get: createParserGetter('urlencoded') +}) + +/** + * Create a middleware to parse json and urlencoded bodies. + * + * @param {object} [options] + * @return {function} + * @deprecated + * @public + */ + +function bodyParser (options) { + var opts = {} + + // exclude type option + if (options) { + for (var prop in options) { + if (prop !== 'type') { + opts[prop] = options[prop] + } + } + } + + var _urlencoded = exports.urlencoded(opts) + var _json = exports.json(opts) + + return function bodyParser (req, res, next) { + _json(req, res, function (err) { + if (err) return next(err) + _urlencoded(req, res, next) + }) + } +} + +/** + * Create a getter for loading a parser. + * @private + */ + +function createParserGetter (name) { + return function get () { + return loadParser(name) + } +} + +/** + * Load a parser module. + * @private + */ + +function loadParser (parserName) { + var parser = parsers[parserName] + + if (parser !== undefined) { + return parser + } + + // this uses a switch for static require analysis + switch (parserName) { + case 'json': + parser = require('./lib/types/json') + break + case 'raw': + parser = require('./lib/types/raw') + break + case 'text': + parser = require('./lib/types/text') + break + case 'urlencoded': + parser = require('./lib/types/urlencoded') + break + } + + // store to prevent invoking require() + return (parsers[parserName] = parser) +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/body-parser/lib/read.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/body-parser/lib/read.js new file mode 100644 index 00000000..fce6283f --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/body-parser/lib/read.js @@ -0,0 +1,205 @@ +/*! + * body-parser + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var createError = require('http-errors') +var destroy = require('destroy') +var getBody = require('raw-body') +var iconv = require('iconv-lite') +var onFinished = require('on-finished') +var unpipe = require('unpipe') +var zlib = require('zlib') + +/** + * Module exports. + */ + +module.exports = read + +/** + * Read a request into a buffer and parse. + * + * @param {object} req + * @param {object} res + * @param {function} next + * @param {function} parse + * @param {function} debug + * @param {object} options + * @private + */ + +function read (req, res, next, parse, debug, options) { + var length + var opts = options + var stream + + // flag as parsed + req._body = true + + // read options + var encoding = opts.encoding !== null + ? opts.encoding + : null + var verify = opts.verify + + try { + // get the content stream + stream = contentstream(req, debug, opts.inflate) + length = stream.length + stream.length = undefined + } catch (err) { + return next(err) + } + + // set raw-body options + opts.length = length + opts.encoding = verify + ? null + : encoding + + // assert charset is supported + if (opts.encoding === null && encoding !== null && !iconv.encodingExists(encoding)) { + return next(createError(415, 'unsupported charset "' + encoding.toUpperCase() + '"', { + charset: encoding.toLowerCase(), + type: 'charset.unsupported' + })) + } + + // read body + debug('read body') + getBody(stream, opts, function (error, body) { + if (error) { + var _error + + if (error.type === 'encoding.unsupported') { + // echo back charset + _error = createError(415, 'unsupported charset "' + encoding.toUpperCase() + '"', { + charset: encoding.toLowerCase(), + type: 'charset.unsupported' + }) + } else { + // set status code on error + _error = createError(400, error) + } + + // unpipe from stream and destroy + if (stream !== req) { + unpipe(req) + destroy(stream, true) + } + + // read off entire request + dump(req, function onfinished () { + next(createError(400, _error)) + }) + return + } + + // verify + if (verify) { + try { + debug('verify body') + verify(req, res, body, encoding) + } catch (err) { + next(createError(403, err, { + body: body, + type: err.type || 'entity.verify.failed' + })) + return + } + } + + // parse + var str = body + try { + debug('parse body') + str = typeof body !== 'string' && encoding !== null + ? iconv.decode(body, encoding) + : body + req.body = parse(str) + } catch (err) { + next(createError(400, err, { + body: str, + type: err.type || 'entity.parse.failed' + })) + return + } + + next() + }) +} + +/** + * Get the content stream of the request. + * + * @param {object} req + * @param {function} debug + * @param {boolean} [inflate=true] + * @return {object} + * @api private + */ + +function contentstream (req, debug, inflate) { + var encoding = (req.headers['content-encoding'] || 'identity').toLowerCase() + var length = req.headers['content-length'] + var stream + + debug('content-encoding "%s"', encoding) + + if (inflate === false && encoding !== 'identity') { + throw createError(415, 'content encoding unsupported', { + encoding: encoding, + type: 'encoding.unsupported' + }) + } + + switch (encoding) { + case 'deflate': + stream = zlib.createInflate() + debug('inflate body') + req.pipe(stream) + break + case 'gzip': + stream = zlib.createGunzip() + debug('gunzip body') + req.pipe(stream) + break + case 'identity': + stream = req + stream.length = length + break + default: + throw createError(415, 'unsupported content encoding "' + encoding + '"', { + encoding: encoding, + type: 'encoding.unsupported' + }) + } + + return stream +} + +/** + * Dump the contents of a request. + * + * @param {object} req + * @param {function} callback + * @api private + */ + +function dump (req, callback) { + if (onFinished.isFinished(req)) { + callback(null) + } else { + onFinished(req, callback) + req.resume() + } +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/body-parser/lib/types/json.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/body-parser/lib/types/json.js new file mode 100644 index 00000000..c2745be3 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/body-parser/lib/types/json.js @@ -0,0 +1,236 @@ +/*! + * body-parser + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var bytes = require('bytes') +var contentType = require('content-type') +var createError = require('http-errors') +var debug = require('debug')('body-parser:json') +var read = require('../read') +var typeis = require('type-is') + +/** + * Module exports. + */ + +module.exports = json + +/** + * RegExp to match the first non-space in a string. + * + * Allowed whitespace is defined in RFC 7159: + * + * ws = *( + * %x20 / ; Space + * %x09 / ; Horizontal tab + * %x0A / ; Line feed or New line + * %x0D ) ; Carriage return + */ + +var FIRST_CHAR_REGEXP = /^[\x20\x09\x0a\x0d]*([^\x20\x09\x0a\x0d])/ // eslint-disable-line no-control-regex + +/** + * Create a middleware to parse JSON bodies. + * + * @param {object} [options] + * @return {function} + * @public + */ + +function json (options) { + var opts = options || {} + + var limit = typeof opts.limit !== 'number' + ? bytes.parse(opts.limit || '100kb') + : opts.limit + var inflate = opts.inflate !== false + var reviver = opts.reviver + var strict = opts.strict !== false + var type = opts.type || 'application/json' + var verify = opts.verify || false + + if (verify !== false && typeof verify !== 'function') { + throw new TypeError('option verify must be function') + } + + // create the appropriate type checking function + var shouldParse = typeof type !== 'function' + ? typeChecker(type) + : type + + function parse (body) { + if (body.length === 0) { + // special-case empty json body, as it's a common client-side mistake + // TODO: maybe make this configurable or part of "strict" option + return {} + } + + if (strict) { + var first = firstchar(body) + + if (first !== '{' && first !== '[') { + debug('strict violation') + throw createStrictSyntaxError(body, first) + } + } + + try { + debug('parse json') + return JSON.parse(body, reviver) + } catch (e) { + throw normalizeJsonSyntaxError(e, { + message: e.message, + stack: e.stack + }) + } + } + + return function jsonParser (req, res, next) { + if (req._body) { + debug('body already parsed') + next() + return + } + + req.body = req.body || {} + + // skip requests without bodies + if (!typeis.hasBody(req)) { + debug('skip empty body') + next() + return + } + + debug('content-type %j', req.headers['content-type']) + + // determine if request should be parsed + if (!shouldParse(req)) { + debug('skip parsing') + next() + return + } + + // assert charset per RFC 7159 sec 8.1 + var charset = getCharset(req) || 'utf-8' + if (charset.slice(0, 4) !== 'utf-') { + debug('invalid charset') + next(createError(415, 'unsupported charset "' + charset.toUpperCase() + '"', { + charset: charset, + type: 'charset.unsupported' + })) + return + } + + // read + read(req, res, next, parse, debug, { + encoding: charset, + inflate: inflate, + limit: limit, + verify: verify + }) + } +} + +/** + * Create strict violation syntax error matching native error. + * + * @param {string} str + * @param {string} char + * @return {Error} + * @private + */ + +function createStrictSyntaxError (str, char) { + var index = str.indexOf(char) + var partial = index !== -1 + ? str.substring(0, index) + '#' + : '' + + try { + JSON.parse(partial); /* istanbul ignore next */ throw new SyntaxError('strict violation') + } catch (e) { + return normalizeJsonSyntaxError(e, { + message: e.message.replace('#', char), + stack: e.stack + }) + } +} + +/** + * Get the first non-whitespace character in a string. + * + * @param {string} str + * @return {function} + * @private + */ + +function firstchar (str) { + var match = FIRST_CHAR_REGEXP.exec(str) + + return match + ? match[1] + : undefined +} + +/** + * Get the charset of a request. + * + * @param {object} req + * @api private + */ + +function getCharset (req) { + try { + return (contentType.parse(req).parameters.charset || '').toLowerCase() + } catch (e) { + return undefined + } +} + +/** + * Normalize a SyntaxError for JSON.parse. + * + * @param {SyntaxError} error + * @param {object} obj + * @return {SyntaxError} + */ + +function normalizeJsonSyntaxError (error, obj) { + var keys = Object.getOwnPropertyNames(error) + + for (var i = 0; i < keys.length; i++) { + var key = keys[i] + if (key !== 'stack' && key !== 'message') { + delete error[key] + } + } + + // replace stack before message for Node.js 0.10 and below + error.stack = obj.stack.replace(error.message, obj.message) + error.message = obj.message + + return error +} + +/** + * Get the simple type checker. + * + * @param {string} type + * @return {function} + */ + +function typeChecker (type) { + return function checkType (req) { + return Boolean(typeis(req, type)) + } +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/body-parser/lib/types/raw.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/body-parser/lib/types/raw.js new file mode 100644 index 00000000..f5d1b674 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/body-parser/lib/types/raw.js @@ -0,0 +1,101 @@ +/*! + * body-parser + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + */ + +var bytes = require('bytes') +var debug = require('debug')('body-parser:raw') +var read = require('../read') +var typeis = require('type-is') + +/** + * Module exports. + */ + +module.exports = raw + +/** + * Create a middleware to parse raw bodies. + * + * @param {object} [options] + * @return {function} + * @api public + */ + +function raw (options) { + var opts = options || {} + + var inflate = opts.inflate !== false + var limit = typeof opts.limit !== 'number' + ? bytes.parse(opts.limit || '100kb') + : opts.limit + var type = opts.type || 'application/octet-stream' + var verify = opts.verify || false + + if (verify !== false && typeof verify !== 'function') { + throw new TypeError('option verify must be function') + } + + // create the appropriate type checking function + var shouldParse = typeof type !== 'function' + ? typeChecker(type) + : type + + function parse (buf) { + return buf + } + + return function rawParser (req, res, next) { + if (req._body) { + debug('body already parsed') + next() + return + } + + req.body = req.body || {} + + // skip requests without bodies + if (!typeis.hasBody(req)) { + debug('skip empty body') + next() + return + } + + debug('content-type %j', req.headers['content-type']) + + // determine if request should be parsed + if (!shouldParse(req)) { + debug('skip parsing') + next() + return + } + + // read + read(req, res, next, parse, debug, { + encoding: null, + inflate: inflate, + limit: limit, + verify: verify + }) + } +} + +/** + * Get the simple type checker. + * + * @param {string} type + * @return {function} + */ + +function typeChecker (type) { + return function checkType (req) { + return Boolean(typeis(req, type)) + } +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/body-parser/lib/types/text.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/body-parser/lib/types/text.js new file mode 100644 index 00000000..083a0090 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/body-parser/lib/types/text.js @@ -0,0 +1,121 @@ +/*! + * body-parser + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + */ + +var bytes = require('bytes') +var contentType = require('content-type') +var debug = require('debug')('body-parser:text') +var read = require('../read') +var typeis = require('type-is') + +/** + * Module exports. + */ + +module.exports = text + +/** + * Create a middleware to parse text bodies. + * + * @param {object} [options] + * @return {function} + * @api public + */ + +function text (options) { + var opts = options || {} + + var defaultCharset = opts.defaultCharset || 'utf-8' + var inflate = opts.inflate !== false + var limit = typeof opts.limit !== 'number' + ? bytes.parse(opts.limit || '100kb') + : opts.limit + var type = opts.type || 'text/plain' + var verify = opts.verify || false + + if (verify !== false && typeof verify !== 'function') { + throw new TypeError('option verify must be function') + } + + // create the appropriate type checking function + var shouldParse = typeof type !== 'function' + ? typeChecker(type) + : type + + function parse (buf) { + return buf + } + + return function textParser (req, res, next) { + if (req._body) { + debug('body already parsed') + next() + return + } + + req.body = req.body || {} + + // skip requests without bodies + if (!typeis.hasBody(req)) { + debug('skip empty body') + next() + return + } + + debug('content-type %j', req.headers['content-type']) + + // determine if request should be parsed + if (!shouldParse(req)) { + debug('skip parsing') + next() + return + } + + // get charset + var charset = getCharset(req) || defaultCharset + + // read + read(req, res, next, parse, debug, { + encoding: charset, + inflate: inflate, + limit: limit, + verify: verify + }) + } +} + +/** + * Get the charset of a request. + * + * @param {object} req + * @api private + */ + +function getCharset (req) { + try { + return (contentType.parse(req).parameters.charset || '').toLowerCase() + } catch (e) { + return undefined + } +} + +/** + * Get the simple type checker. + * + * @param {string} type + * @return {function} + */ + +function typeChecker (type) { + return function checkType (req) { + return Boolean(typeis(req, type)) + } +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/body-parser/lib/types/urlencoded.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/body-parser/lib/types/urlencoded.js new file mode 100644 index 00000000..b2ca8f16 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/body-parser/lib/types/urlencoded.js @@ -0,0 +1,284 @@ +/*! + * body-parser + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var bytes = require('bytes') +var contentType = require('content-type') +var createError = require('http-errors') +var debug = require('debug')('body-parser:urlencoded') +var deprecate = require('depd')('body-parser') +var read = require('../read') +var typeis = require('type-is') + +/** + * Module exports. + */ + +module.exports = urlencoded + +/** + * Cache of parser modules. + */ + +var parsers = Object.create(null) + +/** + * Create a middleware to parse urlencoded bodies. + * + * @param {object} [options] + * @return {function} + * @public + */ + +function urlencoded (options) { + var opts = options || {} + + // notice because option default will flip in next major + if (opts.extended === undefined) { + deprecate('undefined extended: provide extended option') + } + + var extended = opts.extended !== false + var inflate = opts.inflate !== false + var limit = typeof opts.limit !== 'number' + ? bytes.parse(opts.limit || '100kb') + : opts.limit + var type = opts.type || 'application/x-www-form-urlencoded' + var verify = opts.verify || false + + if (verify !== false && typeof verify !== 'function') { + throw new TypeError('option verify must be function') + } + + // create the appropriate query parser + var queryparse = extended + ? extendedparser(opts) + : simpleparser(opts) + + // create the appropriate type checking function + var shouldParse = typeof type !== 'function' + ? typeChecker(type) + : type + + function parse (body) { + return body.length + ? queryparse(body) + : {} + } + + return function urlencodedParser (req, res, next) { + if (req._body) { + debug('body already parsed') + next() + return + } + + req.body = req.body || {} + + // skip requests without bodies + if (!typeis.hasBody(req)) { + debug('skip empty body') + next() + return + } + + debug('content-type %j', req.headers['content-type']) + + // determine if request should be parsed + if (!shouldParse(req)) { + debug('skip parsing') + next() + return + } + + // assert charset + var charset = getCharset(req) || 'utf-8' + if (charset !== 'utf-8') { + debug('invalid charset') + next(createError(415, 'unsupported charset "' + charset.toUpperCase() + '"', { + charset: charset, + type: 'charset.unsupported' + })) + return + } + + // read + read(req, res, next, parse, debug, { + debug: debug, + encoding: charset, + inflate: inflate, + limit: limit, + verify: verify + }) + } +} + +/** + * Get the extended query parser. + * + * @param {object} options + */ + +function extendedparser (options) { + var parameterLimit = options.parameterLimit !== undefined + ? options.parameterLimit + : 1000 + var parse = parser('qs') + + if (isNaN(parameterLimit) || parameterLimit < 1) { + throw new TypeError('option parameterLimit must be a positive number') + } + + if (isFinite(parameterLimit)) { + parameterLimit = parameterLimit | 0 + } + + return function queryparse (body) { + var paramCount = parameterCount(body, parameterLimit) + + if (paramCount === undefined) { + debug('too many parameters') + throw createError(413, 'too many parameters', { + type: 'parameters.too.many' + }) + } + + var arrayLimit = Math.max(100, paramCount) + + debug('parse extended urlencoding') + return parse(body, { + allowPrototypes: true, + arrayLimit: arrayLimit, + depth: Infinity, + parameterLimit: parameterLimit + }) + } +} + +/** + * Get the charset of a request. + * + * @param {object} req + * @api private + */ + +function getCharset (req) { + try { + return (contentType.parse(req).parameters.charset || '').toLowerCase() + } catch (e) { + return undefined + } +} + +/** + * Count the number of parameters, stopping once limit reached + * + * @param {string} body + * @param {number} limit + * @api private + */ + +function parameterCount (body, limit) { + var count = 0 + var index = 0 + + while ((index = body.indexOf('&', index)) !== -1) { + count++ + index++ + + if (count === limit) { + return undefined + } + } + + return count +} + +/** + * Get parser for module name dynamically. + * + * @param {string} name + * @return {function} + * @api private + */ + +function parser (name) { + var mod = parsers[name] + + if (mod !== undefined) { + return mod.parse + } + + // this uses a switch for static require analysis + switch (name) { + case 'qs': + mod = require('qs') + break + case 'querystring': + mod = require('querystring') + break + } + + // store to prevent invoking require() + parsers[name] = mod + + return mod.parse +} + +/** + * Get the simple query parser. + * + * @param {object} options + */ + +function simpleparser (options) { + var parameterLimit = options.parameterLimit !== undefined + ? options.parameterLimit + : 1000 + var parse = parser('querystring') + + if (isNaN(parameterLimit) || parameterLimit < 1) { + throw new TypeError('option parameterLimit must be a positive number') + } + + if (isFinite(parameterLimit)) { + parameterLimit = parameterLimit | 0 + } + + return function queryparse (body) { + var paramCount = parameterCount(body, parameterLimit) + + if (paramCount === undefined) { + debug('too many parameters') + throw createError(413, 'too many parameters', { + type: 'parameters.too.many' + }) + } + + debug('parse urlencoding') + return parse(body, undefined, undefined, { maxKeys: parameterLimit }) + } +} + +/** + * Get the simple type checker. + * + * @param {string} type + * @return {function} + */ + +function typeChecker (type) { + return function checkType (req) { + return Boolean(typeis(req, type)) + } +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/body-parser/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/body-parser/package.json new file mode 100644 index 00000000..0f884c3c --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/body-parser/package.json @@ -0,0 +1,95 @@ +{ + "_from": "body-parser@1.20.0", + "_id": "body-parser@1.20.0", + "_inBundle": false, + "_integrity": "sha512-DfJ+q6EPcGKZD1QWUjSpqp+Q7bDQTsQIF4zfUAtZ6qk+H/3/QRhg9CEp39ss+/T2vw0+HaidC0ecJj/DRLIaKg==", + "_location": "/body-parser", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "body-parser@1.20.0", + "name": "body-parser", + "escapedName": "body-parser", + "rawSpec": "1.20.0", + "saveSpec": null, + "fetchSpec": "1.20.0" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/body-parser/-/body-parser-1.20.0.tgz", + "_shasum": "3de69bd89011c11573d7bfee6a64f11b6bd27cc5", + "_spec": "body-parser@1.20.0", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\express", + "bugs": { + "url": "https://github.com/expressjs/body-parser/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + } + ], + "dependencies": { + "bytes": "3.1.2", + "content-type": "~1.0.4", + "debug": "2.6.9", + "depd": "2.0.0", + "destroy": "1.2.0", + "http-errors": "2.0.0", + "iconv-lite": "0.4.24", + "on-finished": "2.4.1", + "qs": "6.10.3", + "raw-body": "2.5.1", + "type-is": "~1.6.18", + "unpipe": "1.0.0" + }, + "deprecated": false, + "description": "Node.js body parsing middleware", + "devDependencies": { + "eslint": "7.32.0", + "eslint-config-standard": "14.1.1", + "eslint-plugin-import": "2.25.4", + "eslint-plugin-markdown": "2.2.1", + "eslint-plugin-node": "11.1.0", + "eslint-plugin-promise": "5.2.0", + "eslint-plugin-standard": "4.1.0", + "methods": "1.1.2", + "mocha": "9.2.2", + "nyc": "15.1.0", + "safe-buffer": "5.2.1", + "supertest": "6.2.2" + }, + "engines": { + "node": ">= 0.8", + "npm": "1.2.8000 || >= 1.4.16" + }, + "files": [ + "lib/", + "LICENSE", + "HISTORY.md", + "SECURITY.md", + "index.js" + ], + "homepage": "https://github.com/expressjs/body-parser#readme", + "license": "MIT", + "name": "body-parser", + "repository": { + "type": "git", + "url": "git+https://github.com/expressjs/body-parser.git" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --require test/support/env --reporter spec --check-leaks --bail test/", + "test-ci": "nyc --reporter=lcov --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test" + }, + "version": "1.20.0" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/boxen/index.d.ts b/25_03_11/frontend_vizsgafeladat/backend/node_modules/boxen/index.d.ts new file mode 100644 index 00000000..69ebd426 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/boxen/index.d.ts @@ -0,0 +1,200 @@ +import {LiteralUnion} from 'type-fest'; +import {BoxStyle, Boxes} from 'cli-boxes'; + +declare namespace boxen { + /** + Characters used for custom border. + + @example + ``` + // affffb + // e e + // dffffc + + const border: CustomBorderStyle = { + topLeft: 'a', + topRight: 'b', + bottomRight: 'c', + bottomLeft: 'd', + vertical: 'e', + horizontal: 'f' + }; + ``` + */ + interface CustomBorderStyle extends BoxStyle {} + + /** + Spacing used for `padding` and `margin`. + */ + interface Spacing { + readonly top: number; + readonly right: number; + readonly bottom: number; + readonly left: number; + } + + interface Options { + /** + Color of the box border. + */ + readonly borderColor?: LiteralUnion< + | 'black' + | 'red' + | 'green' + | 'yellow' + | 'blue' + | 'magenta' + | 'cyan' + | 'white' + | 'gray' + | 'grey' + | 'blackBright' + | 'redBright' + | 'greenBright' + | 'yellowBright' + | 'blueBright' + | 'magentaBright' + | 'cyanBright' + | 'whiteBright', + string + >; + + /** + Style of the box border. + + @default 'single' + */ + readonly borderStyle?: keyof Boxes | CustomBorderStyle; + + /** + Reduce opacity of the border. + + @default false + */ + readonly dimBorder?: boolean; + + /** + Space between the text and box border. + + @default 0 + */ + readonly padding?: number | Spacing; + + /** + Space around the box. + + @default 0 + */ + readonly margin?: number | Spacing; + + /** + Float the box on the available terminal screen space. + + @default 'left' + */ + readonly float?: 'left' | 'right' | 'center'; + + /** + Color of the background. + */ + readonly backgroundColor?: LiteralUnion< + | 'black' + | 'red' + | 'green' + | 'yellow' + | 'blue' + | 'magenta' + | 'cyan' + | 'white' + | 'blackBright' + | 'redBright' + | 'greenBright' + | 'yellowBright' + | 'blueBright' + | 'magentaBright' + | 'cyanBright' + | 'whiteBright', + string + >; + + /** + Align the text in the box based on the widest line. + + @default 'left' + @deprecated Use `textAlignment` instead. + */ + readonly align?: 'left' | 'right' | 'center'; + + /** + Align the text in the box based on the widest line. + + @default 'left' + */ + readonly textAlignment?: 'left' | 'right' | 'center'; + + /** + Display a title at the top of the box. + If needed, the box will horizontally expand to fit the title. + + @example + ``` + console.log(boxen('foo bar', {title: 'example'})); + // ┌ example ┐ + // │foo bar │ + // └─────────┘ + ``` + */ + readonly title?: string; + + /** + Align the title in the top bar. + + @default 'left' + + @example + ``` + console.log(boxen('foo bar foo bar', {title: 'example', titleAlignment: 'center'})); + // ┌─── example ───┐ + // │foo bar foo bar│ + // └───────────────┘ + + console.log(boxen('foo bar foo bar', {title: 'example', titleAlignment: 'right'})); + // ┌────── example ┐ + // │foo bar foo bar│ + // └───────────────┘ + ``` + */ + readonly titleAlignment?: 'left' | 'right' | 'center'; + } +} + +/** +Creates a box in the terminal. + +@param text - The text inside the box. +@returns The box. + +@example +``` +import boxen = require('boxen'); + +console.log(boxen('unicorn', {padding: 1})); +// ┌─────────────┐ +// │ │ +// │ unicorn │ +// │ │ +// └─────────────┘ + +console.log(boxen('unicorn', {padding: 1, margin: 1, borderStyle: 'double'})); +// +// ╔═════════════╗ +// ║ ║ +// ║ unicorn ║ +// ║ ║ +// ╚═════════════╝ +// +``` +*/ +declare const boxen: (text: string, options?: boxen.Options) => string; + +export = boxen; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/boxen/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/boxen/index.js new file mode 100644 index 00000000..d6bc693c --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/boxen/index.js @@ -0,0 +1,279 @@ +'use strict'; +const stringWidth = require('string-width'); +const chalk = require('chalk'); +const widestLine = require('widest-line'); +const cliBoxes = require('cli-boxes'); +const camelCase = require('camelcase'); +const ansiAlign = require('ansi-align'); +const wrapAnsi = require('wrap-ansi'); + +const NL = '\n'; +const PAD = ' '; + +const terminalColumns = () => { + const {env, stdout, stderr} = process; + + if (stdout && stdout.columns) { + return stdout.columns; + } + + if (stderr && stderr.columns) { + return stderr.columns; + } + + if (env.COLUMNS) { + return Number.parseInt(env.COLUMNS, 10); + } + + return 80; +}; + +const getObject = detail => { + return typeof detail === 'number' ? { + top: detail, + right: detail * 3, + bottom: detail, + left: detail * 3 + } : { + top: 0, + right: 0, + bottom: 0, + left: 0, + ...detail + }; +}; + +const getBorderChars = borderStyle => { + const sides = [ + 'topLeft', + 'topRight', + 'bottomRight', + 'bottomLeft', + 'vertical', + 'horizontal' + ]; + + let chararacters; + + if (typeof borderStyle === 'string') { + chararacters = cliBoxes[borderStyle]; + + if (!chararacters) { + throw new TypeError(`Invalid border style: ${borderStyle}`); + } + } else { + for (const side of sides) { + if (!borderStyle[side] || typeof borderStyle[side] !== 'string') { + throw new TypeError(`Invalid border style: ${side}`); + } + } + + chararacters = borderStyle; + } + + return chararacters; +}; + +const makeTitle = (text, horizontal, alignement) => { + let title = ''; + + const textWidth = stringWidth(text); + + switch (alignement) { + case 'left': + title = text + horizontal.slice(textWidth); + break; + case 'right': + title = horizontal.slice(textWidth) + text; + break; + default: + horizontal = horizontal.slice(textWidth); + + if (horizontal.length % 2 === 1) { // This is needed in case the length is odd + horizontal = horizontal.slice(Math.floor(horizontal.length / 2)); + title = horizontal.slice(1) + text + horizontal; // We reduce the left part of one character to avoid the bar to go beyond its limit + } else { + horizontal = horizontal.slice(horizontal.length / 2); + title = horizontal + text + horizontal; + } + + break; + } + + return title; +}; + +const makeContentText = (text, padding, columns, align) => { + text = ansiAlign(text, {align}); + let lines = text.split(NL); + const textWidth = widestLine(text); + + const max = columns - padding.left - padding.right; + + if (textWidth > max) { + const newLines = []; + for (const line of lines) { + const createdLines = wrapAnsi(line, max, {hard: true}); + const alignedLines = ansiAlign(createdLines, {align}); + const alignedLinesArray = alignedLines.split('\n'); + const longestLength = Math.max(...alignedLinesArray.map(s => stringWidth(s))); + + for (const alignedLine of alignedLinesArray) { + let paddedLine; + switch (align) { + case 'center': + paddedLine = PAD.repeat((max - longestLength) / 2) + alignedLine; + break; + case 'right': + paddedLine = PAD.repeat(max - longestLength) + alignedLine; + break; + default: + paddedLine = alignedLine; + break; + } + + newLines.push(paddedLine); + } + } + + lines = newLines; + } + + if (align === 'center' && textWidth < max) { + lines = lines.map(line => PAD.repeat((max - textWidth) / 2) + line); + } else if (align === 'right' && textWidth < max) { + lines = lines.map(line => PAD.repeat(max - textWidth) + line); + } + + const paddingLeft = PAD.repeat(padding.left); + const paddingRight = PAD.repeat(padding.right); + + lines = lines.map(line => paddingLeft + line + paddingRight); + + lines = lines.map(line => { + if (columns - stringWidth(line) > 0) { + switch (align) { + case 'center': + return line + PAD.repeat(columns - stringWidth(line)); + case 'right': + return line + PAD.repeat(columns - stringWidth(line)); + default: + return line + PAD.repeat(columns - stringWidth(line)); + } + } + + return line; + }); + + if (padding.top > 0) { + lines = new Array(padding.top).fill(PAD.repeat(columns)).concat(lines); + } + + if (padding.bottom > 0) { + lines = lines.concat(new Array(padding.bottom).fill(PAD.repeat(columns))); + } + + return lines.join(NL); +}; + +const isHex = color => color.match(/^#(?:[0-f]{3}){1,2}$/i); +const isColorValid = color => typeof color === 'string' && ((chalk[color]) || isHex(color)); +const getColorFn = color => isHex(color) ? chalk.hex(color) : chalk[color]; +const getBGColorFn = color => isHex(color) ? chalk.bgHex(color) : chalk[camelCase(['bg', color])]; + +module.exports = (text, options) => { + options = { + padding: 0, + borderStyle: 'single', + dimBorder: false, + textAlignment: 'left', + float: 'left', + titleAlignment: 'left', + ...options + }; + + // This option is deprecated + if (options.align) { + options.textAlignment = options.align; + } + + const BORDERS_WIDTH = 2; + + if (options.borderColor && !isColorValid(options.borderColor)) { + throw new Error(`${options.borderColor} is not a valid borderColor`); + } + + if (options.backgroundColor && !isColorValid(options.backgroundColor)) { + throw new Error(`${options.backgroundColor} is not a valid backgroundColor`); + } + + const chars = getBorderChars(options.borderStyle); + const padding = getObject(options.padding); + const margin = getObject(options.margin); + + const colorizeBorder = border => { + const newBorder = options.borderColor ? getColorFn(options.borderColor)(border) : border; + return options.dimBorder ? chalk.dim(newBorder) : newBorder; + }; + + const colorizeContent = content => options.backgroundColor ? getBGColorFn(options.backgroundColor)(content) : content; + + const columns = terminalColumns(); + + let contentWidth = widestLine(wrapAnsi(text, columns - BORDERS_WIDTH, {hard: true, trim: false})) + padding.left + padding.right; + + // This prevents the title bar to exceed the console's width + let title = options.title && options.title.slice(0, columns - 4 - margin.left - margin.right); + + if (title) { + title = ` ${title} `; + // Make the box larger to fit a larger title + if (stringWidth(title) > contentWidth) { + contentWidth = stringWidth(title); + } + } + + if ((margin.left && margin.right) && contentWidth + BORDERS_WIDTH + margin.left + margin.right > columns) { + // Let's assume we have margins: left = 3, right = 5, in total = 8 + const spaceForMargins = columns - contentWidth - BORDERS_WIDTH; + // Let's assume we have space = 4 + const multiplier = spaceForMargins / (margin.left + margin.right); + // Here: multiplier = 4/8 = 0.5 + margin.left = Math.max(0, Math.floor(margin.left * multiplier)); + margin.right = Math.max(0, Math.floor(margin.right * multiplier)); + // Left: 3 * 0.5 = 1.5 -> 1 + // Right: 6 * 0.5 = 3 + } + + // Prevent content from exceeding the console's width + contentWidth = Math.min(contentWidth, columns - BORDERS_WIDTH - margin.left - margin.right); + + text = makeContentText(text, padding, contentWidth, options.textAlignment); + + let marginLeft = PAD.repeat(margin.left); + + if (options.float === 'center') { + const marginWidth = Math.max((columns - contentWidth - BORDERS_WIDTH) / 2, 0); + marginLeft = PAD.repeat(marginWidth); + } else if (options.float === 'right') { + const marginWidth = Math.max(columns - contentWidth - margin.right - BORDERS_WIDTH, 0); + marginLeft = PAD.repeat(marginWidth); + } + + const horizontal = chars.horizontal.repeat(contentWidth); + const top = colorizeBorder(NL.repeat(margin.top) + marginLeft + chars.topLeft + (title ? makeTitle(title, horizontal, options.titleAlignment) : horizontal) + chars.topRight); + const bottom = colorizeBorder(marginLeft + chars.bottomLeft + horizontal + chars.bottomRight + NL.repeat(margin.bottom)); + const side = colorizeBorder(chars.vertical); + + const LINE_SEPARATOR = (contentWidth + BORDERS_WIDTH + margin.left >= columns) ? '' : NL; + + const lines = text.split(NL); + + const middle = lines.map(line => { + return marginLeft + side + colorizeContent(line) + side; + }).join(LINE_SEPARATOR); + + return top + LINE_SEPARATOR + middle + LINE_SEPARATOR + bottom; +}; + +module.exports._borderStyles = cliBoxes; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/boxen/license b/25_03_11/frontend_vizsgafeladat/backend/node_modules/boxen/license new file mode 100644 index 00000000..fa7ceba3 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/boxen/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus (https://sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/boxen/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/boxen/package.json new file mode 100644 index 00000000..dec6d995 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/boxen/package.json @@ -0,0 +1,83 @@ +{ + "_from": "boxen@^5.0.0", + "_id": "boxen@5.1.2", + "_inBundle": false, + "_integrity": "sha512-9gYgQKXx+1nP8mP7CzFyaUARhg7D3n1dF/FnErWmu9l6JvGpNUN278h0aSb+QjoiKSWG+iZ3uHrcqk0qrY9RQQ==", + "_location": "/boxen", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "boxen@^5.0.0", + "name": "boxen", + "escapedName": "boxen", + "rawSpec": "^5.0.0", + "saveSpec": null, + "fetchSpec": "^5.0.0" + }, + "_requiredBy": [ + "/update-notifier" + ], + "_resolved": "https://registry.npmjs.org/boxen/-/boxen-5.1.2.tgz", + "_shasum": "788cb686fc83c1f486dfa8a40c68fc2b831d2b50", + "_spec": "boxen@^5.0.0", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\update-notifier", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "https://sindresorhus.com" + }, + "bugs": { + "url": "https://github.com/sindresorhus/boxen/issues" + }, + "bundleDependencies": false, + "dependencies": { + "ansi-align": "^3.0.0", + "camelcase": "^6.2.0", + "chalk": "^4.1.0", + "cli-boxes": "^2.2.1", + "string-width": "^4.2.2", + "type-fest": "^0.20.2", + "widest-line": "^3.1.0", + "wrap-ansi": "^7.0.0" + }, + "deprecated": false, + "description": "Create boxes in the terminal", + "devDependencies": { + "ava": "^2.4.0", + "nyc": "^15.1.0", + "tsd": "^0.14.0", + "xo": "^0.36.1" + }, + "engines": { + "node": ">=10" + }, + "files": [ + "index.js", + "index.d.ts" + ], + "funding": "https://github.com/sponsors/sindresorhus", + "homepage": "https://github.com/sindresorhus/boxen#readme", + "keywords": [ + "cli", + "box", + "boxes", + "terminal", + "term", + "console", + "ascii", + "unicode", + "border", + "text" + ], + "license": "MIT", + "name": "boxen", + "repository": { + "type": "git", + "url": "git+https://github.com/sindresorhus/boxen.git" + }, + "scripts": { + "test": "xo && nyc ava && tsd" + }, + "version": "5.1.2" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/boxen/readme.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/boxen/readme.md new file mode 100644 index 00000000..c7ed496c --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/boxen/readme.md @@ -0,0 +1,244 @@ +# boxen + +> Create boxes in the terminal + +![](screenshot.png) + +## Install + +``` +$ npm install boxen +``` + +## Usage + +```js +const boxen = require('boxen'); + +console.log(boxen('unicorn', {padding: 1})); +/* +┌─────────────┐ +│ │ +│ unicorn │ +│ │ +└─────────────┘ +*/ + +console.log(boxen('unicorn', {padding: 1, margin: 1, borderStyle: 'double'})); +/* + + ╔═════════════╗ + ║ ║ + ║ unicorn ║ + ║ ║ + ╚═════════════╝ + +*/ + +console.log(boxen('unicorns love rainbows', {title: 'magical', titleAlignment: 'center'})); +/* +┌────── magical ───────┐ +│unicorns love rainbows│ +└──────────────────────┘ +*/ +``` + +## API + +### boxen(text, options?) + +#### text + +Type: `string` + +Text inside the box. + +#### options + +Type: `object` + +##### borderColor + +Type: `string`\ +Values: `'black'` `'red'` `'green'` `'yellow'` `'blue'` `'magenta'` `'cyan'` `'white'` `'gray'` or a hex value like `'#ff0000'` + +Color of the box border. + +##### borderStyle + +Type: `string | object`\ +Default: `'single'`\ +Values: +- `'single'` +``` +┌───┐ +│foo│ +└───┘ +``` +- `'double'` +``` +╔═══╗ +║foo║ +╚═══╝ +``` +- `'round'` (`'single'` sides with round corners) +``` +╭───╮ +│foo│ +╰───╯ +``` +- `'bold'` +``` +┏━━━┓ +┃foo┃ +┗━━━┛ +``` +- `'singleDouble'` (`'single'` on top and bottom, `'double'` on right and left) +``` +╓───╖ +║foo║ +╙───╜ +``` +- `'doubleSingle'` (`'double'` on top and bottom, `'single'` on right and left) +``` +╒═══╕ +│foo│ +╘═══╛ +``` +- `'classic'` +``` ++---+ +|foo| ++---+ +``` + +Style of the box border. + +Can be any of the above predefined styles or an object with the following keys: + +```js +{ + topLeft: '+', + topRight: '+', + bottomLeft: '+', + bottomRight: '+', + horizontal: '-', + vertical: '|' +} +``` + +##### dimBorder + +Type: `boolean`\ +Default: `false` + +Reduce opacity of the border. + +##### title + +Type: `string` + +Display a title at the top of the box. +If needed, the box will horizontally expand to fit the title. + +Example: +```js +console.log(boxen('foo bar', {title: 'example'})); +/* +┌ example ┐ +│foo bar │ +└─────────┘ +*/ +``` + +##### titleAlignment + +Type: `string`\ +Default: `'left'` + +Align the title in the top bar. + +Values: +- `'left'` +```js +/* +┌ example ──────┐ +│foo bar foo bar│ +└───────────────┘ +*/ +``` +- `'center'` +```js +/* +┌─── example ───┐ +│foo bar foo bar│ +└───────────────┘ +*/ +``` +- `'right'` +```js +/* +┌────── example ┐ +│foo bar foo bar│ +└───────────────┘ +*/ +``` + +##### padding + +Type: `number | object`\ +Default: `0` + +Space between the text and box border. + +Accepts a number or an object with any of the `top`, `right`, `bottom`, `left` properties. When a number is specified, the left/right padding is 3 times the top/bottom to make it look nice. + +##### margin + +Type: `number | object`\ +Default: `0` + +Space around the box. + +Accepts a number or an object with any of the `top`, `right`, `bottom`, `left` properties. When a number is specified, the left/right margin is 3 times the top/bottom to make it look nice. + +##### float + +Type: `string`\ +Default: `'left'`\ +Values: `'right'` `'center'` `'left'` + +Float the box on the available terminal screen space. + +##### backgroundColor + +Type: `string`\ +Values: `'black'` `'red'` `'green'` `'yellow'` `'blue'` `'magenta'` `'cyan'` `'white'` `'gray'` or a hex value like `'#ff0000'` + +Color of the background. + +##### textAlignment + +Type: `string`\ +Default: `'left'`\ +Values: `'left'` `'center'` `'right'` + +Align the text in the box based on the widest line. + +## Related + +- [boxen-cli](https://github.com/sindresorhus/boxen-cli) - CLI for this module +- [cli-boxes](https://github.com/sindresorhus/cli-boxes) - Boxes for use in the terminal +- [ink-box](https://github.com/sindresorhus/ink-box) - Box component for Ink that uses this package + +--- + +
+ + Get professional support for this package with a Tidelift subscription + +
+ + Tidelift helps make open source sustainable for maintainers while giving companies
assurances about security, maintenance, and licensing for their dependencies. + +
diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/brace-expansion/LICENSE b/25_03_11/frontend_vizsgafeladat/backend/node_modules/brace-expansion/LICENSE new file mode 100644 index 00000000..de322667 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/brace-expansion/LICENSE @@ -0,0 +1,21 @@ +MIT License + +Copyright (c) 2013 Julian Gruber + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/brace-expansion/README.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/brace-expansion/README.md new file mode 100644 index 00000000..6b4e0e16 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/brace-expansion/README.md @@ -0,0 +1,129 @@ +# brace-expansion + +[Brace expansion](https://www.gnu.org/software/bash/manual/html_node/Brace-Expansion.html), +as known from sh/bash, in JavaScript. + +[![build status](https://secure.travis-ci.org/juliangruber/brace-expansion.svg)](http://travis-ci.org/juliangruber/brace-expansion) +[![downloads](https://img.shields.io/npm/dm/brace-expansion.svg)](https://www.npmjs.org/package/brace-expansion) +[![Greenkeeper badge](https://badges.greenkeeper.io/juliangruber/brace-expansion.svg)](https://greenkeeper.io/) + +[![testling badge](https://ci.testling.com/juliangruber/brace-expansion.png)](https://ci.testling.com/juliangruber/brace-expansion) + +## Example + +```js +var expand = require('brace-expansion'); + +expand('file-{a,b,c}.jpg') +// => ['file-a.jpg', 'file-b.jpg', 'file-c.jpg'] + +expand('-v{,,}') +// => ['-v', '-v', '-v'] + +expand('file{0..2}.jpg') +// => ['file0.jpg', 'file1.jpg', 'file2.jpg'] + +expand('file-{a..c}.jpg') +// => ['file-a.jpg', 'file-b.jpg', 'file-c.jpg'] + +expand('file{2..0}.jpg') +// => ['file2.jpg', 'file1.jpg', 'file0.jpg'] + +expand('file{0..4..2}.jpg') +// => ['file0.jpg', 'file2.jpg', 'file4.jpg'] + +expand('file-{a..e..2}.jpg') +// => ['file-a.jpg', 'file-c.jpg', 'file-e.jpg'] + +expand('file{00..10..5}.jpg') +// => ['file00.jpg', 'file05.jpg', 'file10.jpg'] + +expand('{{A..C},{a..c}}') +// => ['A', 'B', 'C', 'a', 'b', 'c'] + +expand('ppp{,config,oe{,conf}}') +// => ['ppp', 'pppconfig', 'pppoe', 'pppoeconf'] +``` + +## API + +```js +var expand = require('brace-expansion'); +``` + +### var expanded = expand(str) + +Return an array of all possible and valid expansions of `str`. If none are +found, `[str]` is returned. + +Valid expansions are: + +```js +/^(.*,)+(.+)?$/ +// {a,b,...} +``` + +A comma separated list of options, like `{a,b}` or `{a,{b,c}}` or `{,a,}`. + +```js +/^-?\d+\.\.-?\d+(\.\.-?\d+)?$/ +// {x..y[..incr]} +``` + +A numeric sequence from `x` to `y` inclusive, with optional increment. +If `x` or `y` start with a leading `0`, all the numbers will be padded +to have equal length. Negative numbers and backwards iteration work too. + +```js +/^-?\d+\.\.-?\d+(\.\.-?\d+)?$/ +// {x..y[..incr]} +``` + +An alphabetic sequence from `x` to `y` inclusive, with optional increment. +`x` and `y` must be exactly one character, and if given, `incr` must be a +number. + +For compatibility reasons, the string `${` is not eligible for brace expansion. + +## Installation + +With [npm](https://npmjs.org) do: + +```bash +npm install brace-expansion +``` + +## Contributors + +- [Julian Gruber](https://github.com/juliangruber) +- [Isaac Z. Schlueter](https://github.com/isaacs) + +## Sponsors + +This module is proudly supported by my [Sponsors](https://github.com/juliangruber/sponsors)! + +Do you want to support modules like this to improve their quality, stability and weigh in on new features? Then please consider donating to my [Patreon](https://www.patreon.com/juliangruber). Not sure how much of my modules you're using? Try [feross/thanks](https://github.com/feross/thanks)! + +## License + +(MIT) + +Copyright (c) 2013 Julian Gruber <julian@juliangruber.com> + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies +of the Software, and to permit persons to whom the Software is furnished to do +so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/brace-expansion/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/brace-expansion/index.js new file mode 100644 index 00000000..0478be81 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/brace-expansion/index.js @@ -0,0 +1,201 @@ +var concatMap = require('concat-map'); +var balanced = require('balanced-match'); + +module.exports = expandTop; + +var escSlash = '\0SLASH'+Math.random()+'\0'; +var escOpen = '\0OPEN'+Math.random()+'\0'; +var escClose = '\0CLOSE'+Math.random()+'\0'; +var escComma = '\0COMMA'+Math.random()+'\0'; +var escPeriod = '\0PERIOD'+Math.random()+'\0'; + +function numeric(str) { + return parseInt(str, 10) == str + ? parseInt(str, 10) + : str.charCodeAt(0); +} + +function escapeBraces(str) { + return str.split('\\\\').join(escSlash) + .split('\\{').join(escOpen) + .split('\\}').join(escClose) + .split('\\,').join(escComma) + .split('\\.').join(escPeriod); +} + +function unescapeBraces(str) { + return str.split(escSlash).join('\\') + .split(escOpen).join('{') + .split(escClose).join('}') + .split(escComma).join(',') + .split(escPeriod).join('.'); +} + + +// Basically just str.split(","), but handling cases +// where we have nested braced sections, which should be +// treated as individual members, like {a,{b,c},d} +function parseCommaParts(str) { + if (!str) + return ['']; + + var parts = []; + var m = balanced('{', '}', str); + + if (!m) + return str.split(','); + + var pre = m.pre; + var body = m.body; + var post = m.post; + var p = pre.split(','); + + p[p.length-1] += '{' + body + '}'; + var postParts = parseCommaParts(post); + if (post.length) { + p[p.length-1] += postParts.shift(); + p.push.apply(p, postParts); + } + + parts.push.apply(parts, p); + + return parts; +} + +function expandTop(str) { + if (!str) + return []; + + // I don't know why Bash 4.3 does this, but it does. + // Anything starting with {} will have the first two bytes preserved + // but *only* at the top level, so {},a}b will not expand to anything, + // but a{},b}c will be expanded to [a}c,abc]. + // One could argue that this is a bug in Bash, but since the goal of + // this module is to match Bash's rules, we escape a leading {} + if (str.substr(0, 2) === '{}') { + str = '\\{\\}' + str.substr(2); + } + + return expand(escapeBraces(str), true).map(unescapeBraces); +} + +function identity(e) { + return e; +} + +function embrace(str) { + return '{' + str + '}'; +} +function isPadded(el) { + return /^-?0\d/.test(el); +} + +function lte(i, y) { + return i <= y; +} +function gte(i, y) { + return i >= y; +} + +function expand(str, isTop) { + var expansions = []; + + var m = balanced('{', '}', str); + if (!m || /\$$/.test(m.pre)) return [str]; + + var isNumericSequence = /^-?\d+\.\.-?\d+(?:\.\.-?\d+)?$/.test(m.body); + var isAlphaSequence = /^[a-zA-Z]\.\.[a-zA-Z](?:\.\.-?\d+)?$/.test(m.body); + var isSequence = isNumericSequence || isAlphaSequence; + var isOptions = m.body.indexOf(',') >= 0; + if (!isSequence && !isOptions) { + // {a},b} + if (m.post.match(/,.*\}/)) { + str = m.pre + '{' + m.body + escClose + m.post; + return expand(str); + } + return [str]; + } + + var n; + if (isSequence) { + n = m.body.split(/\.\./); + } else { + n = parseCommaParts(m.body); + if (n.length === 1) { + // x{{a,b}}y ==> x{a}y x{b}y + n = expand(n[0], false).map(embrace); + if (n.length === 1) { + var post = m.post.length + ? expand(m.post, false) + : ['']; + return post.map(function(p) { + return m.pre + n[0] + p; + }); + } + } + } + + // at this point, n is the parts, and we know it's not a comma set + // with a single entry. + + // no need to expand pre, since it is guaranteed to be free of brace-sets + var pre = m.pre; + var post = m.post.length + ? expand(m.post, false) + : ['']; + + var N; + + if (isSequence) { + var x = numeric(n[0]); + var y = numeric(n[1]); + var width = Math.max(n[0].length, n[1].length) + var incr = n.length == 3 + ? Math.abs(numeric(n[2])) + : 1; + var test = lte; + var reverse = y < x; + if (reverse) { + incr *= -1; + test = gte; + } + var pad = n.some(isPadded); + + N = []; + + for (var i = x; test(i, y); i += incr) { + var c; + if (isAlphaSequence) { + c = String.fromCharCode(i); + if (c === '\\') + c = ''; + } else { + c = String(i); + if (pad) { + var need = width - c.length; + if (need > 0) { + var z = new Array(need + 1).join('0'); + if (i < 0) + c = '-' + z + c.slice(1); + else + c = z + c; + } + } + } + N.push(c); + } + } else { + N = concatMap(n, function(el) { return expand(el, false) }); + } + + for (var j = 0; j < N.length; j++) { + for (var k = 0; k < post.length; k++) { + var expansion = pre + N[j] + post[k]; + if (!isTop || isSequence || expansion) + expansions.push(expansion); + } + } + + return expansions; +} + diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/brace-expansion/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/brace-expansion/package.json new file mode 100644 index 00000000..7b4713a2 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/brace-expansion/package.json @@ -0,0 +1,75 @@ +{ + "_from": "brace-expansion@^1.1.7", + "_id": "brace-expansion@1.1.11", + "_inBundle": false, + "_integrity": "sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==", + "_location": "/brace-expansion", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "brace-expansion@^1.1.7", + "name": "brace-expansion", + "escapedName": "brace-expansion", + "rawSpec": "^1.1.7", + "saveSpec": null, + "fetchSpec": "^1.1.7" + }, + "_requiredBy": [ + "/minimatch" + ], + "_resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.11.tgz", + "_shasum": "3c7fcbf529d87226f3d2f52b966ff5271eb441dd", + "_spec": "brace-expansion@^1.1.7", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\minimatch", + "author": { + "name": "Julian Gruber", + "email": "mail@juliangruber.com", + "url": "http://juliangruber.com" + }, + "bugs": { + "url": "https://github.com/juliangruber/brace-expansion/issues" + }, + "bundleDependencies": false, + "dependencies": { + "balanced-match": "^1.0.0", + "concat-map": "0.0.1" + }, + "deprecated": false, + "description": "Brace expansion as known from sh/bash", + "devDependencies": { + "matcha": "^0.7.0", + "tape": "^4.6.0" + }, + "homepage": "https://github.com/juliangruber/brace-expansion", + "keywords": [], + "license": "MIT", + "main": "index.js", + "name": "brace-expansion", + "repository": { + "type": "git", + "url": "git://github.com/juliangruber/brace-expansion.git" + }, + "scripts": { + "bench": "matcha test/perf/bench.js", + "gentest": "bash test/generate.sh", + "test": "tape test/*.js" + }, + "testling": { + "files": "test/*.js", + "browsers": [ + "ie/8..latest", + "firefox/20..latest", + "firefox/nightly", + "chrome/25..latest", + "chrome/canary", + "opera/12..latest", + "opera/next", + "safari/5.1..latest", + "ipad/6.0..latest", + "iphone/6.0..latest", + "android-browser/4.2..latest" + ] + }, + "version": "1.1.11" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/braces/CHANGELOG.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/braces/CHANGELOG.md new file mode 100644 index 00000000..36f798b0 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/braces/CHANGELOG.md @@ -0,0 +1,184 @@ +# Release history + +All notable changes to this project will be documented in this file. + +The format is based on [Keep a Changelog](http://keepachangelog.com/en/1.0.0/) +and this project adheres to [Semantic Versioning](http://semver.org/spec/v2.0.0.html). + +
+ Guiding Principles + +- Changelogs are for humans, not machines. +- There should be an entry for every single version. +- The same types of changes should be grouped. +- Versions and sections should be linkable. +- The latest version comes first. +- The release date of each versions is displayed. +- Mention whether you follow Semantic Versioning. + +
+ +
+ Types of changes + +Changelog entries are classified using the following labels _(from [keep-a-changelog](http://keepachangelog.com/)_): + +- `Added` for new features. +- `Changed` for changes in existing functionality. +- `Deprecated` for soon-to-be removed features. +- `Removed` for now removed features. +- `Fixed` for any bug fixes. +- `Security` in case of vulnerabilities. + +
+ +## [3.0.0] - 2018-04-08 + +v3.0 is a complete refactor, resulting in a faster, smaller codebase, with fewer deps, and a more accurate parser and compiler. + +**Breaking Changes** + +- The undocumented `.makeRe` method was removed + +**Non-breaking changes** + +- Caching was removed + +## [2.3.2] - 2018-04-08 + +- start refactoring +- cover sets +- better range handling + +## [2.3.1] - 2018-02-17 + +- Remove unnecessary escape in Regex. (#14) + +## [2.3.0] - 2017-10-19 + +- minor code reorganization +- optimize regex +- expose `maxLength` option + +## [2.2.1] - 2017-05-30 + +- don't condense when braces contain extglobs + +## [2.2.0] - 2017-05-28 + +- ensure word boundaries are preserved +- fixes edge case where extglob characters precede a brace pattern + +## [2.1.1] - 2017-04-27 + +- use snapdragon-node +- handle edge case +- optimizations, lint + +## [2.0.4] - 2017-04-11 + +- pass opts to compiler +- minor optimization in create method +- re-write parser handlers to remove negation regex + +## [2.0.3] - 2016-12-10 + +- use split-string +- clear queue at the end +- adds sequences example +- add unit tests + +## [2.0.2] - 2016-10-21 + +- fix comma handling in nested extglobs + +## [2.0.1] - 2016-10-20 + +- add comments +- more tests, ensure quotes are stripped + +## [2.0.0] - 2016-10-19 + +- don't expand braces inside character classes +- add quantifier pattern + +## [1.8.5] - 2016-05-21 + +- Refactor (#10) + +## [1.8.4] - 2016-04-20 + +- fixes https://github.com/jonschlinkert/micromatch/issues/66 + +## [1.8.0] - 2015-03-18 + +- adds exponent examples, tests +- fixes the first example in https://github.com/jonschlinkert/micromatch/issues/38 + +## [1.6.0] - 2015-01-30 + +- optimizations, `bash` mode: +- improve path escaping + +## [1.5.0] - 2015-01-28 + +- Merge pull request #5 from eush77/lib-files + +## [1.4.0] - 2015-01-24 + +- add extglob tests +- externalize exponent function +- better whitespace handling + +## [1.3.0] - 2015-01-24 + +- make regex patterns explicity + +## [1.1.0] - 2015-01-11 + +- don't create a match group with `makeRe` + +## [1.0.0] - 2014-12-23 + +- Merge commit '97b05f5544f8348736a8efaecf5c32bbe3e2ad6e' +- support empty brace syntax +- better bash coverage +- better support for regex strings + +## [0.1.4] - 2014-11-14 + +- improve recognition of bad args, recognize mismatched argument types +- support escaping +- remove pathname-expansion +- support whitespace in patterns + +## [0.1.0] + +- first commit + +[2.3.2]: https://github.com/micromatch/braces/compare/2.3.1...2.3.2 +[2.3.1]: https://github.com/micromatch/braces/compare/2.3.0...2.3.1 +[2.3.0]: https://github.com/micromatch/braces/compare/2.2.1...2.3.0 +[2.2.1]: https://github.com/micromatch/braces/compare/2.2.0...2.2.1 +[2.2.0]: https://github.com/micromatch/braces/compare/2.1.1...2.2.0 +[2.1.1]: https://github.com/micromatch/braces/compare/2.1.0...2.1.1 +[2.1.0]: https://github.com/micromatch/braces/compare/2.0.4...2.1.0 +[2.0.4]: https://github.com/micromatch/braces/compare/2.0.3...2.0.4 +[2.0.3]: https://github.com/micromatch/braces/compare/2.0.2...2.0.3 +[2.0.2]: https://github.com/micromatch/braces/compare/2.0.1...2.0.2 +[2.0.1]: https://github.com/micromatch/braces/compare/2.0.0...2.0.1 +[2.0.0]: https://github.com/micromatch/braces/compare/1.8.5...2.0.0 +[1.8.5]: https://github.com/micromatch/braces/compare/1.8.4...1.8.5 +[1.8.4]: https://github.com/micromatch/braces/compare/1.8.0...1.8.4 +[1.8.0]: https://github.com/micromatch/braces/compare/1.6.0...1.8.0 +[1.6.0]: https://github.com/micromatch/braces/compare/1.5.0...1.6.0 +[1.5.0]: https://github.com/micromatch/braces/compare/1.4.0...1.5.0 +[1.4.0]: https://github.com/micromatch/braces/compare/1.3.0...1.4.0 +[1.3.0]: https://github.com/micromatch/braces/compare/1.2.0...1.3.0 +[1.2.0]: https://github.com/micromatch/braces/compare/1.1.0...1.2.0 +[1.1.0]: https://github.com/micromatch/braces/compare/1.0.0...1.1.0 +[1.0.0]: https://github.com/micromatch/braces/compare/0.1.4...1.0.0 +[0.1.4]: https://github.com/micromatch/braces/compare/0.1.0...0.1.4 + +[Unreleased]: https://github.com/micromatch/braces/compare/0.1.0...HEAD +[keep-a-changelog]: https://github.com/olivierlacan/keep-a-changelog \ No newline at end of file diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/braces/LICENSE b/25_03_11/frontend_vizsgafeladat/backend/node_modules/braces/LICENSE new file mode 100644 index 00000000..d32ab442 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/braces/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2014-2018, Jon Schlinkert. + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/braces/README.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/braces/README.md new file mode 100644 index 00000000..cba2f600 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/braces/README.md @@ -0,0 +1,593 @@ +# braces [![Donate](https://img.shields.io/badge/Donate-PayPal-green.svg)](https://www.paypal.com/cgi-bin/webscr?cmd=_s-xclick&hosted_button_id=W8YFZ425KND68) [![NPM version](https://img.shields.io/npm/v/braces.svg?style=flat)](https://www.npmjs.com/package/braces) [![NPM monthly downloads](https://img.shields.io/npm/dm/braces.svg?style=flat)](https://npmjs.org/package/braces) [![NPM total downloads](https://img.shields.io/npm/dt/braces.svg?style=flat)](https://npmjs.org/package/braces) [![Linux Build Status](https://img.shields.io/travis/micromatch/braces.svg?style=flat&label=Travis)](https://travis-ci.org/micromatch/braces) + +> Bash-like brace expansion, implemented in JavaScript. Safer than other brace expansion libs, with complete support for the Bash 4.3 braces specification, without sacrificing speed. + +Please consider following this project's author, [Jon Schlinkert](https://github.com/jonschlinkert), and consider starring the project to show your :heart: and support. + +## Install + +Install with [npm](https://www.npmjs.com/): + +```sh +$ npm install --save braces +``` + +## v3.0.0 Released!! + +See the [changelog](CHANGELOG.md) for details. + +## Why use braces? + +Brace patterns make globs more powerful by adding the ability to match specific ranges and sequences of characters. + +* **Accurate** - complete support for the [Bash 4.3 Brace Expansion](www.gnu.org/software/bash/) specification (passes all of the Bash braces tests) +* **[fast and performant](#benchmarks)** - Starts fast, runs fast and [scales well](#performance) as patterns increase in complexity. +* **Organized code base** - The parser and compiler are easy to maintain and update when edge cases crop up. +* **Well-tested** - Thousands of test assertions, and passes all of the Bash, minimatch, and [brace-expansion](https://github.com/juliangruber/brace-expansion) unit tests (as of the date this was written). +* **Safer** - You shouldn't have to worry about users defining aggressive or malicious brace patterns that can break your application. Braces takes measures to prevent malicious regex that can be used for DDoS attacks (see [catastrophic backtracking](https://www.regular-expressions.info/catastrophic.html)). +* [Supports lists](#lists) - (aka "sets") `a/{b,c}/d` => `['a/b/d', 'a/c/d']` +* [Supports sequences](#sequences) - (aka "ranges") `{01..03}` => `['01', '02', '03']` +* [Supports steps](#steps) - (aka "increments") `{2..10..2}` => `['2', '4', '6', '8', '10']` +* [Supports escaping](#escaping) - To prevent evaluation of special characters. + +## Usage + +The main export is a function that takes one or more brace `patterns` and `options`. + +```js +const braces = require('braces'); +// braces(patterns[, options]); + +console.log(braces(['{01..05}', '{a..e}'])); +//=> ['(0[1-5])', '([a-e])'] + +console.log(braces(['{01..05}', '{a..e}'], { expand: true })); +//=> ['01', '02', '03', '04', '05', 'a', 'b', 'c', 'd', 'e'] +``` + +### Brace Expansion vs. Compilation + +By default, brace patterns are compiled into strings that are optimized for creating regular expressions and matching. + +**Compiled** + +```js +console.log(braces('a/{x,y,z}/b')); +//=> ['a/(x|y|z)/b'] +console.log(braces(['a/{01..20}/b', 'a/{1..5}/b'])); +//=> [ 'a/(0[1-9]|1[0-9]|20)/b', 'a/([1-5])/b' ] +``` + +**Expanded** + +Enable brace expansion by setting the `expand` option to true, or by using [braces.expand()](#expand) (returns an array similar to what you'd expect from Bash, or `echo {1..5}`, or [minimatch](https://github.com/isaacs/minimatch)): + +```js +console.log(braces('a/{x,y,z}/b', { expand: true })); +//=> ['a/x/b', 'a/y/b', 'a/z/b'] + +console.log(braces.expand('{01..10}')); +//=> ['01','02','03','04','05','06','07','08','09','10'] +``` + +### Lists + +Expand lists (like Bash "sets"): + +```js +console.log(braces('a/{foo,bar,baz}/*.js')); +//=> ['a/(foo|bar|baz)/*.js'] + +console.log(braces.expand('a/{foo,bar,baz}/*.js')); +//=> ['a/foo/*.js', 'a/bar/*.js', 'a/baz/*.js'] +``` + +### Sequences + +Expand ranges of characters (like Bash "sequences"): + +```js +console.log(braces.expand('{1..3}')); // ['1', '2', '3'] +console.log(braces.expand('a/{1..3}/b')); // ['a/1/b', 'a/2/b', 'a/3/b'] +console.log(braces('{a..c}', { expand: true })); // ['a', 'b', 'c'] +console.log(braces('foo/{a..c}', { expand: true })); // ['foo/a', 'foo/b', 'foo/c'] + +// supports zero-padded ranges +console.log(braces('a/{01..03}/b')); //=> ['a/(0[1-3])/b'] +console.log(braces('a/{001..300}/b')); //=> ['a/(0{2}[1-9]|0[1-9][0-9]|[12][0-9]{2}|300)/b'] +``` + +See [fill-range](https://github.com/jonschlinkert/fill-range) for all available range-expansion options. + +### Steppped ranges + +Steps, or increments, may be used with ranges: + +```js +console.log(braces.expand('{2..10..2}')); +//=> ['2', '4', '6', '8', '10'] + +console.log(braces('{2..10..2}')); +//=> ['(2|4|6|8|10)'] +``` + +When the [.optimize](#optimize) method is used, or [options.optimize](#optionsoptimize) is set to true, sequences are passed to [to-regex-range](https://github.com/jonschlinkert/to-regex-range) for expansion. + +### Nesting + +Brace patterns may be nested. The results of each expanded string are not sorted, and left to right order is preserved. + +**"Expanded" braces** + +```js +console.log(braces.expand('a{b,c,/{x,y}}/e')); +//=> ['ab/e', 'ac/e', 'a/x/e', 'a/y/e'] + +console.log(braces.expand('a/{x,{1..5},y}/c')); +//=> ['a/x/c', 'a/1/c', 'a/2/c', 'a/3/c', 'a/4/c', 'a/5/c', 'a/y/c'] +``` + +**"Optimized" braces** + +```js +console.log(braces('a{b,c,/{x,y}}/e')); +//=> ['a(b|c|/(x|y))/e'] + +console.log(braces('a/{x,{1..5},y}/c')); +//=> ['a/(x|([1-5])|y)/c'] +``` + +### Escaping + +**Escaping braces** + +A brace pattern will not be expanded or evaluted if _either the opening or closing brace is escaped_: + +```js +console.log(braces.expand('a\\{d,c,b}e')); +//=> ['a{d,c,b}e'] + +console.log(braces.expand('a{d,c,b\\}e')); +//=> ['a{d,c,b}e'] +``` + +**Escaping commas** + +Commas inside braces may also be escaped: + +```js +console.log(braces.expand('a{b\\,c}d')); +//=> ['a{b,c}d'] + +console.log(braces.expand('a{d\\,c,b}e')); +//=> ['ad,ce', 'abe'] +``` + +**Single items** + +Following bash conventions, a brace pattern is also not expanded when it contains a single character: + +```js +console.log(braces.expand('a{b}c')); +//=> ['a{b}c'] +``` + +## Options + +### options.maxLength + +**Type**: `Number` + +**Default**: `65,536` + +**Description**: Limit the length of the input string. Useful when the input string is generated or your application allows users to pass a string, et cetera. + +```js +console.log(braces('a/{b,c}/d', { maxLength: 3 })); //=> throws an error +``` + +### options.expand + +**Type**: `Boolean` + +**Default**: `undefined` + +**Description**: Generate an "expanded" brace pattern (alternatively you can use the `braces.expand()` method, which does the same thing). + +```js +console.log(braces('a/{b,c}/d', { expand: true })); +//=> [ 'a/b/d', 'a/c/d' ] +``` + +### options.nodupes + +**Type**: `Boolean` + +**Default**: `undefined` + +**Description**: Remove duplicates from the returned array. + +### options.rangeLimit + +**Type**: `Number` + +**Default**: `1000` + +**Description**: To prevent malicious patterns from being passed by users, an error is thrown when `braces.expand()` is used or `options.expand` is true and the generated range will exceed the `rangeLimit`. + +You can customize `options.rangeLimit` or set it to `Inifinity` to disable this altogether. + +**Examples** + +```js +// pattern exceeds the "rangeLimit", so it's optimized automatically +console.log(braces.expand('{1..1000}')); +//=> ['([1-9]|[1-9][0-9]{1,2}|1000)'] + +// pattern does not exceed "rangeLimit", so it's NOT optimized +console.log(braces.expand('{1..100}')); +//=> ['1', '2', '3', '4', '5', '6', '7', '8', '9', '10', '11', '12', '13', '14', '15', '16', '17', '18', '19', '20', '21', '22', '23', '24', '25', '26', '27', '28', '29', '30', '31', '32', '33', '34', '35', '36', '37', '38', '39', '40', '41', '42', '43', '44', '45', '46', '47', '48', '49', '50', '51', '52', '53', '54', '55', '56', '57', '58', '59', '60', '61', '62', '63', '64', '65', '66', '67', '68', '69', '70', '71', '72', '73', '74', '75', '76', '77', '78', '79', '80', '81', '82', '83', '84', '85', '86', '87', '88', '89', '90', '91', '92', '93', '94', '95', '96', '97', '98', '99', '100'] +``` + +### options.transform + +**Type**: `Function` + +**Default**: `undefined` + +**Description**: Customize range expansion. + +**Example: Transforming non-numeric values** + +```js +const alpha = braces.expand('x/{a..e}/y', { + transform(value, index) { + // When non-numeric values are passed, "value" is a character code. + return 'foo/' + String.fromCharCode(value) + '-' + index; + } +}); +console.log(alpha); +//=> [ 'x/foo/a-0/y', 'x/foo/b-1/y', 'x/foo/c-2/y', 'x/foo/d-3/y', 'x/foo/e-4/y' ] +``` + +**Example: Transforming numeric values** + +```js +const numeric = braces.expand('{1..5}', { + transform(value) { + // when numeric values are passed, "value" is a number + return 'foo/' + value * 2; + } +}); +console.log(numeric); +//=> [ 'foo/2', 'foo/4', 'foo/6', 'foo/8', 'foo/10' ] +``` + +### options.quantifiers + +**Type**: `Boolean` + +**Default**: `undefined` + +**Description**: In regular expressions, quanitifiers can be used to specify how many times a token can be repeated. For example, `a{1,3}` will match the letter `a` one to three times. + +Unfortunately, regex quantifiers happen to share the same syntax as [Bash lists](#lists) + +The `quantifiers` option tells braces to detect when [regex quantifiers](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/RegExp#quantifiers) are defined in the given pattern, and not to try to expand them as lists. + +**Examples** + +```js +const braces = require('braces'); +console.log(braces('a/b{1,3}/{x,y,z}')); +//=> [ 'a/b(1|3)/(x|y|z)' ] +console.log(braces('a/b{1,3}/{x,y,z}', {quantifiers: true})); +//=> [ 'a/b{1,3}/(x|y|z)' ] +console.log(braces('a/b{1,3}/{x,y,z}', {quantifiers: true, expand: true})); +//=> [ 'a/b{1,3}/x', 'a/b{1,3}/y', 'a/b{1,3}/z' ] +``` + +### options.unescape + +**Type**: `Boolean` + +**Default**: `undefined` + +**Description**: Strip backslashes that were used for escaping from the result. + +## What is "brace expansion"? + +Brace expansion is a type of parameter expansion that was made popular by unix shells for generating lists of strings, as well as regex-like matching when used alongside wildcards (globs). + +In addition to "expansion", braces are also used for matching. In other words: + +* [brace expansion](#brace-expansion) is for generating new lists +* [brace matching](#brace-matching) is for filtering existing lists + +
+More about brace expansion (click to expand) + +There are two main types of brace expansion: + +1. **lists**: which are defined using comma-separated values inside curly braces: `{a,b,c}` +2. **sequences**: which are defined using a starting value and an ending value, separated by two dots: `a{1..3}b`. Optionally, a third argument may be passed to define a "step" or increment to use: `a{1..100..10}b`. These are also sometimes referred to as "ranges". + +Here are some example brace patterns to illustrate how they work: + +**Sets** + +``` +{a,b,c} => a b c +{a,b,c}{1,2} => a1 a2 b1 b2 c1 c2 +``` + +**Sequences** + +``` +{1..9} => 1 2 3 4 5 6 7 8 9 +{4..-4} => 4 3 2 1 0 -1 -2 -3 -4 +{1..20..3} => 1 4 7 10 13 16 19 +{a..j} => a b c d e f g h i j +{j..a} => j i h g f e d c b a +{a..z..3} => a d g j m p s v y +``` + +**Combination** + +Sets and sequences can be mixed together or used along with any other strings. + +``` +{a,b,c}{1..3} => a1 a2 a3 b1 b2 b3 c1 c2 c3 +foo/{a,b,c}/bar => foo/a/bar foo/b/bar foo/c/bar +``` + +The fact that braces can be "expanded" from relatively simple patterns makes them ideal for quickly generating test fixtures, file paths, and similar use cases. + +## Brace matching + +In addition to _expansion_, brace patterns are also useful for performing regular-expression-like matching. + +For example, the pattern `foo/{1..3}/bar` would match any of following strings: + +``` +foo/1/bar +foo/2/bar +foo/3/bar +``` + +But not: + +``` +baz/1/qux +baz/2/qux +baz/3/qux +``` + +Braces can also be combined with [glob patterns](https://github.com/jonschlinkert/micromatch) to perform more advanced wildcard matching. For example, the pattern `*/{1..3}/*` would match any of following strings: + +``` +foo/1/bar +foo/2/bar +foo/3/bar +baz/1/qux +baz/2/qux +baz/3/qux +``` + +## Brace matching pitfalls + +Although brace patterns offer a user-friendly way of matching ranges or sets of strings, there are also some major disadvantages and potential risks you should be aware of. + +### tldr + +**"brace bombs"** + +* brace expansion can eat up a huge amount of processing resources +* as brace patterns increase _linearly in size_, the system resources required to expand the pattern increase exponentially +* users can accidentally (or intentially) exhaust your system's resources resulting in the equivalent of a DoS attack (bonus: no programming knowledge is required!) + +For a more detailed explanation with examples, see the [geometric complexity](#geometric-complexity) section. + +### The solution + +Jump to the [performance section](#performance) to see how Braces solves this problem in comparison to other libraries. + +### Geometric complexity + +At minimum, brace patterns with sets limited to two elements have quadradic or `O(n^2)` complexity. But the complexity of the algorithm increases exponentially as the number of sets, _and elements per set_, increases, which is `O(n^c)`. + +For example, the following sets demonstrate quadratic (`O(n^2)`) complexity: + +``` +{1,2}{3,4} => (2X2) => 13 14 23 24 +{1,2}{3,4}{5,6} => (2X2X2) => 135 136 145 146 235 236 245 246 +``` + +But add an element to a set, and we get a n-fold Cartesian product with `O(n^c)` complexity: + +``` +{1,2,3}{4,5,6}{7,8,9} => (3X3X3) => 147 148 149 157 158 159 167 168 169 247 248 + 249 257 258 259 267 268 269 347 348 349 357 + 358 359 367 368 369 +``` + +Now, imagine how this complexity grows given that each element is a n-tuple: + +``` +{1..100}{1..100} => (100X100) => 10,000 elements (38.4 kB) +{1..100}{1..100}{1..100} => (100X100X100) => 1,000,000 elements (5.76 MB) +``` + +Although these examples are clearly contrived, they demonstrate how brace patterns can quickly grow out of control. + +**More information** + +Interested in learning more about brace expansion? + +* [linuxjournal/bash-brace-expansion](http://www.linuxjournal.com/content/bash-brace-expansion) +* [rosettacode/Brace_expansion](https://rosettacode.org/wiki/Brace_expansion) +* [cartesian product](https://en.wikipedia.org/wiki/Cartesian_product) + +
+ +## Performance + +Braces is not only screaming fast, it's also more accurate the other brace expansion libraries. + +### Better algorithms + +Fortunately there is a solution to the ["brace bomb" problem](#brace-matching-pitfalls): _don't expand brace patterns into an array when they're used for matching_. + +Instead, convert the pattern into an optimized regular expression. This is easier said than done, and braces is the only library that does this currently. + +**The proof is in the numbers** + +Minimatch gets exponentially slower as patterns increase in complexity, braces does not. The following results were generated using `braces()` and `minimatch.braceExpand()`, respectively. + +| **Pattern** | **braces** | **[minimatch][]** | +| --- | --- | --- | +| `{1..9007199254740991}`[^1] | `298 B` (5ms 459μs)| N/A (freezes) | +| `{1..1000000000000000}` | `41 B` (1ms 15μs) | N/A (freezes) | +| `{1..100000000000000}` | `40 B` (890μs) | N/A (freezes) | +| `{1..10000000000000}` | `39 B` (2ms 49μs) | N/A (freezes) | +| `{1..1000000000000}` | `38 B` (608μs) | N/A (freezes) | +| `{1..100000000000}` | `37 B` (397μs) | N/A (freezes) | +| `{1..10000000000}` | `35 B` (983μs) | N/A (freezes) | +| `{1..1000000000}` | `34 B` (798μs) | N/A (freezes) | +| `{1..100000000}` | `33 B` (733μs) | N/A (freezes) | +| `{1..10000000}` | `32 B` (5ms 632μs) | `78.89 MB` (16s 388ms 569μs) | +| `{1..1000000}` | `31 B` (1ms 381μs) | `6.89 MB` (1s 496ms 887μs) | +| `{1..100000}` | `30 B` (950μs) | `588.89 kB` (146ms 921μs) | +| `{1..10000}` | `29 B` (1ms 114μs) | `48.89 kB` (14ms 187μs) | +| `{1..1000}` | `28 B` (760μs) | `3.89 kB` (1ms 453μs) | +| `{1..100}` | `22 B` (345μs) | `291 B` (196μs) | +| `{1..10}` | `10 B` (533μs) | `20 B` (37μs) | +| `{1..3}` | `7 B` (190μs) | `5 B` (27μs) | + +### Faster algorithms + +When you need expansion, braces is still much faster. + +_(the following results were generated using `braces.expand()` and `minimatch.braceExpand()`, respectively)_ + +| **Pattern** | **braces** | **[minimatch][]** | +| --- | --- | --- | +| `{1..10000000}` | `78.89 MB` (2s 698ms 642μs) | `78.89 MB` (18s 601ms 974μs) | +| `{1..1000000}` | `6.89 MB` (458ms 576μs) | `6.89 MB` (1s 491ms 621μs) | +| `{1..100000}` | `588.89 kB` (20ms 728μs) | `588.89 kB` (156ms 919μs) | +| `{1..10000}` | `48.89 kB` (2ms 202μs) | `48.89 kB` (13ms 641μs) | +| `{1..1000}` | `3.89 kB` (1ms 796μs) | `3.89 kB` (1ms 958μs) | +| `{1..100}` | `291 B` (424μs) | `291 B` (211μs) | +| `{1..10}` | `20 B` (487μs) | `20 B` (72μs) | +| `{1..3}` | `5 B` (166μs) | `5 B` (27μs) | + +If you'd like to run these comparisons yourself, see [test/support/generate.js](test/support/generate.js). + +## Benchmarks + +### Running benchmarks + +Install dev dependencies: + +```bash +npm i -d && npm benchmark +``` + +### Latest results + +Braces is more accurate, without sacrificing performance. + +```bash +# range (expanded) + braces x 29,040 ops/sec ±3.69% (91 runs sampled)) + minimatch x 4,735 ops/sec ±1.28% (90 runs sampled) + +# range (optimized for regex) + braces x 382,878 ops/sec ±0.56% (94 runs sampled) + minimatch x 1,040 ops/sec ±0.44% (93 runs sampled) + +# nested ranges (expanded) + braces x 19,744 ops/sec ±2.27% (92 runs sampled)) + minimatch x 4,579 ops/sec ±0.50% (93 runs sampled) + +# nested ranges (optimized for regex) + braces x 246,019 ops/sec ±2.02% (93 runs sampled) + minimatch x 1,028 ops/sec ±0.39% (94 runs sampled) + +# set (expanded) + braces x 138,641 ops/sec ±0.53% (95 runs sampled) + minimatch x 219,582 ops/sec ±0.98% (94 runs sampled) + +# set (optimized for regex) + braces x 388,408 ops/sec ±0.41% (95 runs sampled) + minimatch x 44,724 ops/sec ±0.91% (89 runs sampled) + +# nested sets (expanded) + braces x 84,966 ops/sec ±0.48% (94 runs sampled) + minimatch x 140,720 ops/sec ±0.37% (95 runs sampled) + +# nested sets (optimized for regex) + braces x 263,340 ops/sec ±2.06% (92 runs sampled) + minimatch x 28,714 ops/sec ±0.40% (90 runs sampled) +``` + +## About + +
+Contributing + +Pull requests and stars are always welcome. For bugs and feature requests, [please create an issue](../../issues/new). + +
+ +
+Running Tests + +Running and reviewing unit tests is a great way to get familiarized with a library and its API. You can install dependencies and run tests with the following command: + +```sh +$ npm install && npm test +``` + +
+ +
+Building docs + +_(This project's readme.md is generated by [verb](https://github.com/verbose/verb-generate-readme), please don't edit the readme directly. Any changes to the readme must be made in the [.verb.md](.verb.md) readme template.)_ + +To generate the readme, run the following command: + +```sh +$ npm install -g verbose/verb#dev verb-generate-readme && verb +``` + +
+ +### Contributors + +| **Commits** | **Contributor** | +| --- | --- | +| 197 | [jonschlinkert](https://github.com/jonschlinkert) | +| 4 | [doowb](https://github.com/doowb) | +| 1 | [es128](https://github.com/es128) | +| 1 | [eush77](https://github.com/eush77) | +| 1 | [hemanth](https://github.com/hemanth) | +| 1 | [wtgtybhertgeghgtwtg](https://github.com/wtgtybhertgeghgtwtg) | + +### Author + +**Jon Schlinkert** + +* [GitHub Profile](https://github.com/jonschlinkert) +* [Twitter Profile](https://twitter.com/jonschlinkert) +* [LinkedIn Profile](https://linkedin.com/in/jonschlinkert) + +### License + +Copyright © 2019, [Jon Schlinkert](https://github.com/jonschlinkert). +Released under the [MIT License](LICENSE). + +*** + +_This file was generated by [verb-generate-readme](https://github.com/verbose/verb-generate-readme), v0.8.0, on April 08, 2019._ \ No newline at end of file diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/braces/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/braces/index.js new file mode 100644 index 00000000..0eee0f56 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/braces/index.js @@ -0,0 +1,170 @@ +'use strict'; + +const stringify = require('./lib/stringify'); +const compile = require('./lib/compile'); +const expand = require('./lib/expand'); +const parse = require('./lib/parse'); + +/** + * Expand the given pattern or create a regex-compatible string. + * + * ```js + * const braces = require('braces'); + * console.log(braces('{a,b,c}', { compile: true })); //=> ['(a|b|c)'] + * console.log(braces('{a,b,c}')); //=> ['a', 'b', 'c'] + * ``` + * @param {String} `str` + * @param {Object} `options` + * @return {String} + * @api public + */ + +const braces = (input, options = {}) => { + let output = []; + + if (Array.isArray(input)) { + for (let pattern of input) { + let result = braces.create(pattern, options); + if (Array.isArray(result)) { + output.push(...result); + } else { + output.push(result); + } + } + } else { + output = [].concat(braces.create(input, options)); + } + + if (options && options.expand === true && options.nodupes === true) { + output = [...new Set(output)]; + } + return output; +}; + +/** + * Parse the given `str` with the given `options`. + * + * ```js + * // braces.parse(pattern, [, options]); + * const ast = braces.parse('a/{b,c}/d'); + * console.log(ast); + * ``` + * @param {String} pattern Brace pattern to parse + * @param {Object} options + * @return {Object} Returns an AST + * @api public + */ + +braces.parse = (input, options = {}) => parse(input, options); + +/** + * Creates a braces string from an AST, or an AST node. + * + * ```js + * const braces = require('braces'); + * let ast = braces.parse('foo/{a,b}/bar'); + * console.log(stringify(ast.nodes[2])); //=> '{a,b}' + * ``` + * @param {String} `input` Brace pattern or AST. + * @param {Object} `options` + * @return {Array} Returns an array of expanded values. + * @api public + */ + +braces.stringify = (input, options = {}) => { + if (typeof input === 'string') { + return stringify(braces.parse(input, options), options); + } + return stringify(input, options); +}; + +/** + * Compiles a brace pattern into a regex-compatible, optimized string. + * This method is called by the main [braces](#braces) function by default. + * + * ```js + * const braces = require('braces'); + * console.log(braces.compile('a/{b,c}/d')); + * //=> ['a/(b|c)/d'] + * ``` + * @param {String} `input` Brace pattern or AST. + * @param {Object} `options` + * @return {Array} Returns an array of expanded values. + * @api public + */ + +braces.compile = (input, options = {}) => { + if (typeof input === 'string') { + input = braces.parse(input, options); + } + return compile(input, options); +}; + +/** + * Expands a brace pattern into an array. This method is called by the + * main [braces](#braces) function when `options.expand` is true. Before + * using this method it's recommended that you read the [performance notes](#performance)) + * and advantages of using [.compile](#compile) instead. + * + * ```js + * const braces = require('braces'); + * console.log(braces.expand('a/{b,c}/d')); + * //=> ['a/b/d', 'a/c/d']; + * ``` + * @param {String} `pattern` Brace pattern + * @param {Object} `options` + * @return {Array} Returns an array of expanded values. + * @api public + */ + +braces.expand = (input, options = {}) => { + if (typeof input === 'string') { + input = braces.parse(input, options); + } + + let result = expand(input, options); + + // filter out empty strings if specified + if (options.noempty === true) { + result = result.filter(Boolean); + } + + // filter out duplicates if specified + if (options.nodupes === true) { + result = [...new Set(result)]; + } + + return result; +}; + +/** + * Processes a brace pattern and returns either an expanded array + * (if `options.expand` is true), a highly optimized regex-compatible string. + * This method is called by the main [braces](#braces) function. + * + * ```js + * const braces = require('braces'); + * console.log(braces.create('user-{200..300}/project-{a,b,c}-{1..10}')) + * //=> 'user-(20[0-9]|2[1-9][0-9]|300)/project-(a|b|c)-([1-9]|10)' + * ``` + * @param {String} `pattern` Brace pattern + * @param {Object} `options` + * @return {Array} Returns an array of expanded values. + * @api public + */ + +braces.create = (input, options = {}) => { + if (input === '' || input.length < 3) { + return [input]; + } + + return options.expand !== true + ? braces.compile(input, options) + : braces.expand(input, options); +}; + +/** + * Expose "braces" + */ + +module.exports = braces; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/braces/lib/compile.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/braces/lib/compile.js new file mode 100644 index 00000000..3e984a4b --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/braces/lib/compile.js @@ -0,0 +1,57 @@ +'use strict'; + +const fill = require('fill-range'); +const utils = require('./utils'); + +const compile = (ast, options = {}) => { + let walk = (node, parent = {}) => { + let invalidBlock = utils.isInvalidBrace(parent); + let invalidNode = node.invalid === true && options.escapeInvalid === true; + let invalid = invalidBlock === true || invalidNode === true; + let prefix = options.escapeInvalid === true ? '\\' : ''; + let output = ''; + + if (node.isOpen === true) { + return prefix + node.value; + } + if (node.isClose === true) { + return prefix + node.value; + } + + if (node.type === 'open') { + return invalid ? (prefix + node.value) : '('; + } + + if (node.type === 'close') { + return invalid ? (prefix + node.value) : ')'; + } + + if (node.type === 'comma') { + return node.prev.type === 'comma' ? '' : (invalid ? node.value : '|'); + } + + if (node.value) { + return node.value; + } + + if (node.nodes && node.ranges > 0) { + let args = utils.reduce(node.nodes); + let range = fill(...args, { ...options, wrap: false, toRegex: true }); + + if (range.length !== 0) { + return args.length > 1 && range.length > 1 ? `(${range})` : range; + } + } + + if (node.nodes) { + for (let child of node.nodes) { + output += walk(child, node); + } + } + return output; + }; + + return walk(ast); +}; + +module.exports = compile; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/braces/lib/constants.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/braces/lib/constants.js new file mode 100644 index 00000000..a9379436 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/braces/lib/constants.js @@ -0,0 +1,57 @@ +'use strict'; + +module.exports = { + MAX_LENGTH: 1024 * 64, + + // Digits + CHAR_0: '0', /* 0 */ + CHAR_9: '9', /* 9 */ + + // Alphabet chars. + CHAR_UPPERCASE_A: 'A', /* A */ + CHAR_LOWERCASE_A: 'a', /* a */ + CHAR_UPPERCASE_Z: 'Z', /* Z */ + CHAR_LOWERCASE_Z: 'z', /* z */ + + CHAR_LEFT_PARENTHESES: '(', /* ( */ + CHAR_RIGHT_PARENTHESES: ')', /* ) */ + + CHAR_ASTERISK: '*', /* * */ + + // Non-alphabetic chars. + CHAR_AMPERSAND: '&', /* & */ + CHAR_AT: '@', /* @ */ + CHAR_BACKSLASH: '\\', /* \ */ + CHAR_BACKTICK: '`', /* ` */ + CHAR_CARRIAGE_RETURN: '\r', /* \r */ + CHAR_CIRCUMFLEX_ACCENT: '^', /* ^ */ + CHAR_COLON: ':', /* : */ + CHAR_COMMA: ',', /* , */ + CHAR_DOLLAR: '$', /* . */ + CHAR_DOT: '.', /* . */ + CHAR_DOUBLE_QUOTE: '"', /* " */ + CHAR_EQUAL: '=', /* = */ + CHAR_EXCLAMATION_MARK: '!', /* ! */ + CHAR_FORM_FEED: '\f', /* \f */ + CHAR_FORWARD_SLASH: '/', /* / */ + CHAR_HASH: '#', /* # */ + CHAR_HYPHEN_MINUS: '-', /* - */ + CHAR_LEFT_ANGLE_BRACKET: '<', /* < */ + CHAR_LEFT_CURLY_BRACE: '{', /* { */ + CHAR_LEFT_SQUARE_BRACKET: '[', /* [ */ + CHAR_LINE_FEED: '\n', /* \n */ + CHAR_NO_BREAK_SPACE: '\u00A0', /* \u00A0 */ + CHAR_PERCENT: '%', /* % */ + CHAR_PLUS: '+', /* + */ + CHAR_QUESTION_MARK: '?', /* ? */ + CHAR_RIGHT_ANGLE_BRACKET: '>', /* > */ + CHAR_RIGHT_CURLY_BRACE: '}', /* } */ + CHAR_RIGHT_SQUARE_BRACKET: ']', /* ] */ + CHAR_SEMICOLON: ';', /* ; */ + CHAR_SINGLE_QUOTE: '\'', /* ' */ + CHAR_SPACE: ' ', /* */ + CHAR_TAB: '\t', /* \t */ + CHAR_UNDERSCORE: '_', /* _ */ + CHAR_VERTICAL_LINE: '|', /* | */ + CHAR_ZERO_WIDTH_NOBREAK_SPACE: '\uFEFF' /* \uFEFF */ +}; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/braces/lib/expand.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/braces/lib/expand.js new file mode 100644 index 00000000..376c748a --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/braces/lib/expand.js @@ -0,0 +1,113 @@ +'use strict'; + +const fill = require('fill-range'); +const stringify = require('./stringify'); +const utils = require('./utils'); + +const append = (queue = '', stash = '', enclose = false) => { + let result = []; + + queue = [].concat(queue); + stash = [].concat(stash); + + if (!stash.length) return queue; + if (!queue.length) { + return enclose ? utils.flatten(stash).map(ele => `{${ele}}`) : stash; + } + + for (let item of queue) { + if (Array.isArray(item)) { + for (let value of item) { + result.push(append(value, stash, enclose)); + } + } else { + for (let ele of stash) { + if (enclose === true && typeof ele === 'string') ele = `{${ele}}`; + result.push(Array.isArray(ele) ? append(item, ele, enclose) : (item + ele)); + } + } + } + return utils.flatten(result); +}; + +const expand = (ast, options = {}) => { + let rangeLimit = options.rangeLimit === void 0 ? 1000 : options.rangeLimit; + + let walk = (node, parent = {}) => { + node.queue = []; + + let p = parent; + let q = parent.queue; + + while (p.type !== 'brace' && p.type !== 'root' && p.parent) { + p = p.parent; + q = p.queue; + } + + if (node.invalid || node.dollar) { + q.push(append(q.pop(), stringify(node, options))); + return; + } + + if (node.type === 'brace' && node.invalid !== true && node.nodes.length === 2) { + q.push(append(q.pop(), ['{}'])); + return; + } + + if (node.nodes && node.ranges > 0) { + let args = utils.reduce(node.nodes); + + if (utils.exceedsLimit(...args, options.step, rangeLimit)) { + throw new RangeError('expanded array length exceeds range limit. Use options.rangeLimit to increase or disable the limit.'); + } + + let range = fill(...args, options); + if (range.length === 0) { + range = stringify(node, options); + } + + q.push(append(q.pop(), range)); + node.nodes = []; + return; + } + + let enclose = utils.encloseBrace(node); + let queue = node.queue; + let block = node; + + while (block.type !== 'brace' && block.type !== 'root' && block.parent) { + block = block.parent; + queue = block.queue; + } + + for (let i = 0; i < node.nodes.length; i++) { + let child = node.nodes[i]; + + if (child.type === 'comma' && node.type === 'brace') { + if (i === 1) queue.push(''); + queue.push(''); + continue; + } + + if (child.type === 'close') { + q.push(append(q.pop(), queue, enclose)); + continue; + } + + if (child.value && child.type !== 'open') { + queue.push(append(queue.pop(), child.value)); + continue; + } + + if (child.nodes) { + walk(child, node); + } + } + + return queue; + }; + + return utils.flatten(walk(ast)); +}; + +module.exports = expand; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/braces/lib/parse.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/braces/lib/parse.js new file mode 100644 index 00000000..145ea264 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/braces/lib/parse.js @@ -0,0 +1,333 @@ +'use strict'; + +const stringify = require('./stringify'); + +/** + * Constants + */ + +const { + MAX_LENGTH, + CHAR_BACKSLASH, /* \ */ + CHAR_BACKTICK, /* ` */ + CHAR_COMMA, /* , */ + CHAR_DOT, /* . */ + CHAR_LEFT_PARENTHESES, /* ( */ + CHAR_RIGHT_PARENTHESES, /* ) */ + CHAR_LEFT_CURLY_BRACE, /* { */ + CHAR_RIGHT_CURLY_BRACE, /* } */ + CHAR_LEFT_SQUARE_BRACKET, /* [ */ + CHAR_RIGHT_SQUARE_BRACKET, /* ] */ + CHAR_DOUBLE_QUOTE, /* " */ + CHAR_SINGLE_QUOTE, /* ' */ + CHAR_NO_BREAK_SPACE, + CHAR_ZERO_WIDTH_NOBREAK_SPACE +} = require('./constants'); + +/** + * parse + */ + +const parse = (input, options = {}) => { + if (typeof input !== 'string') { + throw new TypeError('Expected a string'); + } + + let opts = options || {}; + let max = typeof opts.maxLength === 'number' ? Math.min(MAX_LENGTH, opts.maxLength) : MAX_LENGTH; + if (input.length > max) { + throw new SyntaxError(`Input length (${input.length}), exceeds max characters (${max})`); + } + + let ast = { type: 'root', input, nodes: [] }; + let stack = [ast]; + let block = ast; + let prev = ast; + let brackets = 0; + let length = input.length; + let index = 0; + let depth = 0; + let value; + let memo = {}; + + /** + * Helpers + */ + + const advance = () => input[index++]; + const push = node => { + if (node.type === 'text' && prev.type === 'dot') { + prev.type = 'text'; + } + + if (prev && prev.type === 'text' && node.type === 'text') { + prev.value += node.value; + return; + } + + block.nodes.push(node); + node.parent = block; + node.prev = prev; + prev = node; + return node; + }; + + push({ type: 'bos' }); + + while (index < length) { + block = stack[stack.length - 1]; + value = advance(); + + /** + * Invalid chars + */ + + if (value === CHAR_ZERO_WIDTH_NOBREAK_SPACE || value === CHAR_NO_BREAK_SPACE) { + continue; + } + + /** + * Escaped chars + */ + + if (value === CHAR_BACKSLASH) { + push({ type: 'text', value: (options.keepEscaping ? value : '') + advance() }); + continue; + } + + /** + * Right square bracket (literal): ']' + */ + + if (value === CHAR_RIGHT_SQUARE_BRACKET) { + push({ type: 'text', value: '\\' + value }); + continue; + } + + /** + * Left square bracket: '[' + */ + + if (value === CHAR_LEFT_SQUARE_BRACKET) { + brackets++; + + let closed = true; + let next; + + while (index < length && (next = advance())) { + value += next; + + if (next === CHAR_LEFT_SQUARE_BRACKET) { + brackets++; + continue; + } + + if (next === CHAR_BACKSLASH) { + value += advance(); + continue; + } + + if (next === CHAR_RIGHT_SQUARE_BRACKET) { + brackets--; + + if (brackets === 0) { + break; + } + } + } + + push({ type: 'text', value }); + continue; + } + + /** + * Parentheses + */ + + if (value === CHAR_LEFT_PARENTHESES) { + block = push({ type: 'paren', nodes: [] }); + stack.push(block); + push({ type: 'text', value }); + continue; + } + + if (value === CHAR_RIGHT_PARENTHESES) { + if (block.type !== 'paren') { + push({ type: 'text', value }); + continue; + } + block = stack.pop(); + push({ type: 'text', value }); + block = stack[stack.length - 1]; + continue; + } + + /** + * Quotes: '|"|` + */ + + if (value === CHAR_DOUBLE_QUOTE || value === CHAR_SINGLE_QUOTE || value === CHAR_BACKTICK) { + let open = value; + let next; + + if (options.keepQuotes !== true) { + value = ''; + } + + while (index < length && (next = advance())) { + if (next === CHAR_BACKSLASH) { + value += next + advance(); + continue; + } + + if (next === open) { + if (options.keepQuotes === true) value += next; + break; + } + + value += next; + } + + push({ type: 'text', value }); + continue; + } + + /** + * Left curly brace: '{' + */ + + if (value === CHAR_LEFT_CURLY_BRACE) { + depth++; + + let dollar = prev.value && prev.value.slice(-1) === '$' || block.dollar === true; + let brace = { + type: 'brace', + open: true, + close: false, + dollar, + depth, + commas: 0, + ranges: 0, + nodes: [] + }; + + block = push(brace); + stack.push(block); + push({ type: 'open', value }); + continue; + } + + /** + * Right curly brace: '}' + */ + + if (value === CHAR_RIGHT_CURLY_BRACE) { + if (block.type !== 'brace') { + push({ type: 'text', value }); + continue; + } + + let type = 'close'; + block = stack.pop(); + block.close = true; + + push({ type, value }); + depth--; + + block = stack[stack.length - 1]; + continue; + } + + /** + * Comma: ',' + */ + + if (value === CHAR_COMMA && depth > 0) { + if (block.ranges > 0) { + block.ranges = 0; + let open = block.nodes.shift(); + block.nodes = [open, { type: 'text', value: stringify(block) }]; + } + + push({ type: 'comma', value }); + block.commas++; + continue; + } + + /** + * Dot: '.' + */ + + if (value === CHAR_DOT && depth > 0 && block.commas === 0) { + let siblings = block.nodes; + + if (depth === 0 || siblings.length === 0) { + push({ type: 'text', value }); + continue; + } + + if (prev.type === 'dot') { + block.range = []; + prev.value += value; + prev.type = 'range'; + + if (block.nodes.length !== 3 && block.nodes.length !== 5) { + block.invalid = true; + block.ranges = 0; + prev.type = 'text'; + continue; + } + + block.ranges++; + block.args = []; + continue; + } + + if (prev.type === 'range') { + siblings.pop(); + + let before = siblings[siblings.length - 1]; + before.value += prev.value + value; + prev = before; + block.ranges--; + continue; + } + + push({ type: 'dot', value }); + continue; + } + + /** + * Text + */ + + push({ type: 'text', value }); + } + + // Mark imbalanced braces and brackets as invalid + do { + block = stack.pop(); + + if (block.type !== 'root') { + block.nodes.forEach(node => { + if (!node.nodes) { + if (node.type === 'open') node.isOpen = true; + if (node.type === 'close') node.isClose = true; + if (!node.nodes) node.type = 'text'; + node.invalid = true; + } + }); + + // get the location of the block on parent.nodes (block's siblings) + let parent = stack[stack.length - 1]; + let index = parent.nodes.indexOf(block); + // replace the (invalid) block with it's nodes + parent.nodes.splice(index, 1, ...block.nodes); + } + } while (stack.length > 0); + + push({ type: 'eos' }); + return ast; +}; + +module.exports = parse; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/braces/lib/stringify.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/braces/lib/stringify.js new file mode 100644 index 00000000..414b7bcc --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/braces/lib/stringify.js @@ -0,0 +1,32 @@ +'use strict'; + +const utils = require('./utils'); + +module.exports = (ast, options = {}) => { + let stringify = (node, parent = {}) => { + let invalidBlock = options.escapeInvalid && utils.isInvalidBrace(parent); + let invalidNode = node.invalid === true && options.escapeInvalid === true; + let output = ''; + + if (node.value) { + if ((invalidBlock || invalidNode) && utils.isOpenOrClose(node)) { + return '\\' + node.value; + } + return node.value; + } + + if (node.value) { + return node.value; + } + + if (node.nodes) { + for (let child of node.nodes) { + output += stringify(child); + } + } + return output; + }; + + return stringify(ast); +}; + diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/braces/lib/utils.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/braces/lib/utils.js new file mode 100644 index 00000000..e3551a67 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/braces/lib/utils.js @@ -0,0 +1,112 @@ +'use strict'; + +exports.isInteger = num => { + if (typeof num === 'number') { + return Number.isInteger(num); + } + if (typeof num === 'string' && num.trim() !== '') { + return Number.isInteger(Number(num)); + } + return false; +}; + +/** + * Find a node of the given type + */ + +exports.find = (node, type) => node.nodes.find(node => node.type === type); + +/** + * Find a node of the given type + */ + +exports.exceedsLimit = (min, max, step = 1, limit) => { + if (limit === false) return false; + if (!exports.isInteger(min) || !exports.isInteger(max)) return false; + return ((Number(max) - Number(min)) / Number(step)) >= limit; +}; + +/** + * Escape the given node with '\\' before node.value + */ + +exports.escapeNode = (block, n = 0, type) => { + let node = block.nodes[n]; + if (!node) return; + + if ((type && node.type === type) || node.type === 'open' || node.type === 'close') { + if (node.escaped !== true) { + node.value = '\\' + node.value; + node.escaped = true; + } + } +}; + +/** + * Returns true if the given brace node should be enclosed in literal braces + */ + +exports.encloseBrace = node => { + if (node.type !== 'brace') return false; + if ((node.commas >> 0 + node.ranges >> 0) === 0) { + node.invalid = true; + return true; + } + return false; +}; + +/** + * Returns true if a brace node is invalid. + */ + +exports.isInvalidBrace = block => { + if (block.type !== 'brace') return false; + if (block.invalid === true || block.dollar) return true; + if ((block.commas >> 0 + block.ranges >> 0) === 0) { + block.invalid = true; + return true; + } + if (block.open !== true || block.close !== true) { + block.invalid = true; + return true; + } + return false; +}; + +/** + * Returns true if a node is an open or close node + */ + +exports.isOpenOrClose = node => { + if (node.type === 'open' || node.type === 'close') { + return true; + } + return node.open === true || node.close === true; +}; + +/** + * Reduce an array of text nodes. + */ + +exports.reduce = nodes => nodes.reduce((acc, node) => { + if (node.type === 'text') acc.push(node.value); + if (node.type === 'range') node.type = 'text'; + return acc; +}, []); + +/** + * Flatten an array + */ + +exports.flatten = (...args) => { + const result = []; + const flat = arr => { + for (let i = 0; i < arr.length; i++) { + let ele = arr[i]; + Array.isArray(ele) ? flat(ele, result) : ele !== void 0 && result.push(ele); + } + return result; + }; + flat(args); + return result; +}; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/braces/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/braces/package.json new file mode 100644 index 00000000..f321b63a --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/braces/package.json @@ -0,0 +1,123 @@ +{ + "_from": "braces@~3.0.2", + "_id": "braces@3.0.2", + "_inBundle": false, + "_integrity": "sha512-b8um+L1RzM3WDSzvhm6gIz1yfTbBt6YTlcEKAvsmqCZZFw46z626lVj9j1yEPW33H5H+lBQpZMP1k8l+78Ha0A==", + "_location": "/braces", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "braces@~3.0.2", + "name": "braces", + "escapedName": "braces", + "rawSpec": "~3.0.2", + "saveSpec": null, + "fetchSpec": "~3.0.2" + }, + "_requiredBy": [ + "/chokidar" + ], + "_resolved": "https://registry.npmjs.org/braces/-/braces-3.0.2.tgz", + "_shasum": "3454e1a462ee8d599e236df336cd9ea4f8afe107", + "_spec": "braces@~3.0.2", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\chokidar", + "author": { + "name": "Jon Schlinkert", + "url": "https://github.com/jonschlinkert" + }, + "bugs": { + "url": "https://github.com/micromatch/braces/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Brian Woodward", + "url": "https://twitter.com/doowb" + }, + { + "name": "Elan Shanker", + "url": "https://github.com/es128" + }, + { + "name": "Eugene Sharygin", + "url": "https://github.com/eush77" + }, + { + "name": "hemanth.hm", + "url": "http://h3manth.com" + }, + { + "name": "Jon Schlinkert", + "url": "http://twitter.com/jonschlinkert" + } + ], + "dependencies": { + "fill-range": "^7.0.1" + }, + "deprecated": false, + "description": "Bash-like brace expansion, implemented in JavaScript. Safer than other brace expansion libs, with complete support for the Bash 4.3 braces specification, without sacrificing speed.", + "devDependencies": { + "ansi-colors": "^3.2.4", + "bash-path": "^2.0.1", + "gulp-format-md": "^2.0.0", + "mocha": "^6.1.1" + }, + "engines": { + "node": ">=8" + }, + "files": [ + "index.js", + "lib" + ], + "homepage": "https://github.com/micromatch/braces", + "keywords": [ + "alpha", + "alphabetical", + "bash", + "brace", + "braces", + "expand", + "expansion", + "filepath", + "fill", + "fs", + "glob", + "globbing", + "letter", + "match", + "matches", + "matching", + "number", + "numerical", + "path", + "range", + "ranges", + "sh" + ], + "license": "MIT", + "main": "index.js", + "name": "braces", + "repository": { + "type": "git", + "url": "git+https://github.com/micromatch/braces.git" + }, + "scripts": { + "benchmark": "node benchmark", + "test": "mocha" + }, + "verb": { + "toc": false, + "layout": "default", + "tasks": [ + "readme" + ], + "lint": { + "reflinks": true + }, + "plugins": [ + "gulp-format-md" + ] + }, + "version": "3.0.2" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/bytes/History.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/bytes/History.md new file mode 100644 index 00000000..d60ce0e6 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/bytes/History.md @@ -0,0 +1,97 @@ +3.1.2 / 2022-01-27 +================== + + * Fix return value for un-parsable strings + +3.1.1 / 2021-11-15 +================== + + * Fix "thousandsSeparator" incorrecting formatting fractional part + +3.1.0 / 2019-01-22 +================== + + * Add petabyte (`pb`) support + +3.0.0 / 2017-08-31 +================== + + * Change "kB" to "KB" in format output + * Remove support for Node.js 0.6 + * Remove support for ComponentJS + +2.5.0 / 2017-03-24 +================== + + * Add option "unit" + +2.4.0 / 2016-06-01 +================== + + * Add option "unitSeparator" + +2.3.0 / 2016-02-15 +================== + + * Drop partial bytes on all parsed units + * Fix non-finite numbers to `.format` to return `null` + * Fix parsing byte string that looks like hex + * perf: hoist regular expressions + +2.2.0 / 2015-11-13 +================== + + * add option "decimalPlaces" + * add option "fixedDecimals" + +2.1.0 / 2015-05-21 +================== + + * add `.format` export + * add `.parse` export + +2.0.2 / 2015-05-20 +================== + + * remove map recreation + * remove unnecessary object construction + +2.0.1 / 2015-05-07 +================== + + * fix browserify require + * remove node.extend dependency + +2.0.0 / 2015-04-12 +================== + + * add option "case" + * add option "thousandsSeparator" + * return "null" on invalid parse input + * support proper round-trip: bytes(bytes(num)) === num + * units no longer case sensitive when parsing + +1.0.0 / 2014-05-05 +================== + + * add negative support. fixes #6 + +0.3.0 / 2014-03-19 +================== + + * added terabyte support + +0.2.1 / 2013-04-01 +================== + + * add .component + +0.2.0 / 2012-10-28 +================== + + * bytes(200).should.eql('200b') + +0.1.0 / 2012-07-04 +================== + + * add bytes to string conversion [yields] diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/bytes/LICENSE b/25_03_11/frontend_vizsgafeladat/backend/node_modules/bytes/LICENSE new file mode 100644 index 00000000..63e95a96 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/bytes/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2012-2014 TJ Holowaychuk +Copyright (c) 2015 Jed Watson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/bytes/Readme.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/bytes/Readme.md new file mode 100644 index 00000000..5790e23e --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/bytes/Readme.md @@ -0,0 +1,152 @@ +# Bytes utility + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Build Status][ci-image]][ci-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Utility to parse a string bytes (ex: `1TB`) to bytes (`1099511627776`) and vice-versa. + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```bash +$ npm install bytes +``` + +## Usage + +```js +var bytes = require('bytes'); +``` + +#### bytes(number｜string value, [options]): number｜string｜null + +Default export function. Delegates to either `bytes.format` or `bytes.parse` based on the type of `value`. + +**Arguments** + +| Name | Type | Description | +|---------|----------|--------------------| +| value | `number`｜`string` | Number value to format or string value to parse | +| options | `Object` | Conversion options for `format` | + +**Returns** + +| Name | Type | Description | +|---------|------------------|-------------------------------------------------| +| results | `string`｜`number`｜`null` | Return null upon error. Numeric value in bytes, or string value otherwise. | + +**Example** + +```js +bytes(1024); +// output: '1KB' + +bytes('1KB'); +// output: 1024 +``` + +#### bytes.format(number value, [options]): string｜null + +Format the given value in bytes into a string. If the value is negative, it is kept as such. If it is a float, it is + rounded. + +**Arguments** + +| Name | Type | Description | +|---------|----------|--------------------| +| value | `number` | Value in bytes | +| options | `Object` | Conversion options | + +**Options** + +| Property | Type | Description | +|-------------------|--------|-----------------------------------------------------------------------------------------| +| decimalPlaces | `number`｜`null` | Maximum number of decimal places to include in output. Default value to `2`. | +| fixedDecimals | `boolean`｜`null` | Whether to always display the maximum number of decimal places. Default value to `false` | +| thousandsSeparator | `string`｜`null` | Example of values: `' '`, `','` and `'.'`... Default value to `''`. | +| unit | `string`｜`null` | The unit in which the result will be returned (B/KB/MB/GB/TB). Default value to `''` (which means auto detect). | +| unitSeparator | `string`｜`null` | Separator to use between number and unit. Default value to `''`. | + +**Returns** + +| Name | Type | Description | +|---------|------------------|-------------------------------------------------| +| results | `string`｜`null` | Return null upon error. String value otherwise. | + +**Example** + +```js +bytes.format(1024); +// output: '1KB' + +bytes.format(1000); +// output: '1000B' + +bytes.format(1000, {thousandsSeparator: ' '}); +// output: '1 000B' + +bytes.format(1024 * 1.7, {decimalPlaces: 0}); +// output: '2KB' + +bytes.format(1024, {unitSeparator: ' '}); +// output: '1 KB' +``` + +#### bytes.parse(string｜number value): number｜null + +Parse the string value into an integer in bytes. If no unit is given, or `value` +is a number, it is assumed the value is in bytes. + +Supported units and abbreviations are as follows and are case-insensitive: + + * `b` for bytes + * `kb` for kilobytes + * `mb` for megabytes + * `gb` for gigabytes + * `tb` for terabytes + * `pb` for petabytes + +The units are in powers of two, not ten. This means 1kb = 1024b according to this parser. + +**Arguments** + +| Name | Type | Description | +|---------------|--------|--------------------| +| value | `string`｜`number` | String to parse, or number in bytes. | + +**Returns** + +| Name | Type | Description | +|---------|-------------|-------------------------| +| results | `number`｜`null` | Return null upon error. Value in bytes otherwise. | + +**Example** + +```js +bytes.parse('1KB'); +// output: 1024 + +bytes.parse('1024'); +// output: 1024 + +bytes.parse(1024); +// output: 1024 +``` + +## License + +[MIT](LICENSE) + +[ci-image]: https://badgen.net/github/checks/visionmedia/bytes.js/master?label=ci +[ci-url]: https://github.com/visionmedia/bytes.js/actions?query=workflow%3Aci +[coveralls-image]: https://badgen.net/coveralls/c/github/visionmedia/bytes.js/master +[coveralls-url]: https://coveralls.io/r/visionmedia/bytes.js?branch=master +[downloads-image]: https://badgen.net/npm/dm/bytes +[downloads-url]: https://npmjs.org/package/bytes +[npm-image]: https://badgen.net/npm/v/bytes +[npm-url]: https://npmjs.org/package/bytes diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/bytes/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/bytes/index.js new file mode 100644 index 00000000..6f2d0f89 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/bytes/index.js @@ -0,0 +1,170 @@ +/*! + * bytes + * Copyright(c) 2012-2014 TJ Holowaychuk + * Copyright(c) 2015 Jed Watson + * MIT Licensed + */ + +'use strict'; + +/** + * Module exports. + * @public + */ + +module.exports = bytes; +module.exports.format = format; +module.exports.parse = parse; + +/** + * Module variables. + * @private + */ + +var formatThousandsRegExp = /\B(?=(\d{3})+(?!\d))/g; + +var formatDecimalsRegExp = /(?:\.0*|(\.[^0]+)0+)$/; + +var map = { + b: 1, + kb: 1 << 10, + mb: 1 << 20, + gb: 1 << 30, + tb: Math.pow(1024, 4), + pb: Math.pow(1024, 5), +}; + +var parseRegExp = /^((-|\+)?(\d+(?:\.\d+)?)) *(kb|mb|gb|tb|pb)$/i; + +/** + * Convert the given value in bytes into a string or parse to string to an integer in bytes. + * + * @param {string|number} value + * @param {{ + * case: [string], + * decimalPlaces: [number] + * fixedDecimals: [boolean] + * thousandsSeparator: [string] + * unitSeparator: [string] + * }} [options] bytes options. + * + * @returns {string|number|null} + */ + +function bytes(value, options) { + if (typeof value === 'string') { + return parse(value); + } + + if (typeof value === 'number') { + return format(value, options); + } + + return null; +} + +/** + * Format the given value in bytes into a string. + * + * If the value is negative, it is kept as such. If it is a float, + * it is rounded. + * + * @param {number} value + * @param {object} [options] + * @param {number} [options.decimalPlaces=2] + * @param {number} [options.fixedDecimals=false] + * @param {string} [options.thousandsSeparator=] + * @param {string} [options.unit=] + * @param {string} [options.unitSeparator=] + * + * @returns {string|null} + * @public + */ + +function format(value, options) { + if (!Number.isFinite(value)) { + return null; + } + + var mag = Math.abs(value); + var thousandsSeparator = (options && options.thousandsSeparator) || ''; + var unitSeparator = (options && options.unitSeparator) || ''; + var decimalPlaces = (options && options.decimalPlaces !== undefined) ? options.decimalPlaces : 2; + var fixedDecimals = Boolean(options && options.fixedDecimals); + var unit = (options && options.unit) || ''; + + if (!unit || !map[unit.toLowerCase()]) { + if (mag >= map.pb) { + unit = 'PB'; + } else if (mag >= map.tb) { + unit = 'TB'; + } else if (mag >= map.gb) { + unit = 'GB'; + } else if (mag >= map.mb) { + unit = 'MB'; + } else if (mag >= map.kb) { + unit = 'KB'; + } else { + unit = 'B'; + } + } + + var val = value / map[unit.toLowerCase()]; + var str = val.toFixed(decimalPlaces); + + if (!fixedDecimals) { + str = str.replace(formatDecimalsRegExp, '$1'); + } + + if (thousandsSeparator) { + str = str.split('.').map(function (s, i) { + return i === 0 + ? s.replace(formatThousandsRegExp, thousandsSeparator) + : s + }).join('.'); + } + + return str + unitSeparator + unit; +} + +/** + * Parse the string value into an integer in bytes. + * + * If no unit is given, it is assumed the value is in bytes. + * + * @param {number|string} val + * + * @returns {number|null} + * @public + */ + +function parse(val) { + if (typeof val === 'number' && !isNaN(val)) { + return val; + } + + if (typeof val !== 'string') { + return null; + } + + // Test if the string passed is valid + var results = parseRegExp.exec(val); + var floatValue; + var unit = 'b'; + + if (!results) { + // Nothing could be extracted from the given string + floatValue = parseInt(val, 10); + unit = 'b' + } else { + // Retrieve the value and the unit + floatValue = parseFloat(results[1]); + unit = results[4].toLowerCase(); + } + + if (isNaN(floatValue)) { + return null; + } + + return Math.floor(map[unit] * floatValue); +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/bytes/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/bytes/package.json new file mode 100644 index 00000000..6639a041 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/bytes/package.json @@ -0,0 +1,85 @@ +{ + "_from": "bytes@3.1.2", + "_id": "bytes@3.1.2", + "_inBundle": false, + "_integrity": "sha512-/Nf7TyzTx6S3yRJObOAV7956r8cr2+Oj8AC5dt8wSP3BQAoeX58NoHyCU8P8zGkNXStjTSi6fzO6F0pBdcYbEg==", + "_location": "/bytes", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "bytes@3.1.2", + "name": "bytes", + "escapedName": "bytes", + "rawSpec": "3.1.2", + "saveSpec": null, + "fetchSpec": "3.1.2" + }, + "_requiredBy": [ + "/body-parser", + "/raw-body" + ], + "_resolved": "https://registry.npmjs.org/bytes/-/bytes-3.1.2.tgz", + "_shasum": "8b0beeb98605adf1b128fa4386403c009e0221a5", + "_spec": "bytes@3.1.2", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\body-parser", + "author": { + "name": "TJ Holowaychuk", + "email": "tj@vision-media.ca", + "url": "http://tjholowaychuk.com" + }, + "bugs": { + "url": "https://github.com/visionmedia/bytes.js/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Jed Watson", + "email": "jed.watson@me.com" + }, + { + "name": "Théo FIDRY", + "email": "theo.fidry@gmail.com" + } + ], + "deprecated": false, + "description": "Utility to parse a string bytes to bytes and vice-versa", + "devDependencies": { + "eslint": "7.32.0", + "eslint-plugin-markdown": "2.2.1", + "mocha": "9.2.0", + "nyc": "15.1.0" + }, + "engines": { + "node": ">= 0.8" + }, + "files": [ + "History.md", + "LICENSE", + "Readme.md", + "index.js" + ], + "homepage": "https://github.com/visionmedia/bytes.js#readme", + "keywords": [ + "byte", + "bytes", + "utility", + "parse", + "parser", + "convert", + "converter" + ], + "license": "MIT", + "name": "bytes", + "repository": { + "type": "git", + "url": "git+https://github.com/visionmedia/bytes.js.git" + }, + "scripts": { + "lint": "eslint .", + "test": "mocha --check-leaks --reporter spec", + "test-ci": "nyc --reporter=lcov --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test" + }, + "version": "3.1.2" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/LICENSE.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/LICENSE.md new file mode 100644 index 00000000..8d28acf8 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/LICENSE.md @@ -0,0 +1,16 @@ +ISC License + +Copyright (c) npm, Inc. + +Permission to use, copy, modify, and/or distribute this software for +any purpose with or without fee is hereby granted, provided that the +above copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE COPYRIGHT HOLDER DISCLAIMS +ALL WARRANTIES WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED +WARRANTIES OF MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE +COPYRIGHT HOLDER BE LIABLE FOR ANY SPECIAL, DIRECT, INDIRECT, OR +CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS +OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE +OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE +USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/README.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/README.md new file mode 100644 index 00000000..6dc11bab --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/README.md @@ -0,0 +1,703 @@ +# cacache [![npm version](https://img.shields.io/npm/v/cacache.svg)](https://npm.im/cacache) [![license](https://img.shields.io/npm/l/cacache.svg)](https://npm.im/cacache) [![Travis](https://img.shields.io/travis/npm/cacache.svg)](https://travis-ci.org/npm/cacache) [![AppVeyor](https://ci.appveyor.com/api/projects/status/github/npm/cacache?svg=true)](https://ci.appveyor.com/project/npm/cacache) [![Coverage Status](https://coveralls.io/repos/github/npm/cacache/badge.svg?branch=latest)](https://coveralls.io/github/npm/cacache?branch=latest) + +[`cacache`](https://github.com/npm/cacache) is a Node.js library for managing +local key and content address caches. It's really fast, really good at +concurrency, and it will never give you corrupted data, even if cache files +get corrupted or manipulated. + +On systems that support user and group settings on files, cacache will +match the `uid` and `gid` values to the folder where the cache lives, even +when running as `root`. + +It was written to be used as [npm](https://npm.im)'s local cache, but can +just as easily be used on its own. + +## Install + +`$ npm install --save cacache` + +## Table of Contents + +* [Example](#example) +* [Features](#features) +* [Contributing](#contributing) +* [API](#api) + * [Using localized APIs](#localized-api) + * Reading + * [`ls`](#ls) + * [`ls.stream`](#ls-stream) + * [`get`](#get-data) + * [`get.stream`](#get-stream) + * [`get.info`](#get-info) + * [`get.hasContent`](#get-hasContent) + * Writing + * [`put`](#put-data) + * [`put.stream`](#put-stream) + * [`rm.all`](#rm-all) + * [`rm.entry`](#rm-entry) + * [`rm.content`](#rm-content) + * [`index.compact`](#index-compact) + * [`index.insert`](#index-insert) + * Utilities + * [`clearMemoized`](#clear-memoized) + * [`tmp.mkdir`](#tmp-mkdir) + * [`tmp.withTmp`](#with-tmp) + * Integrity + * [Subresource Integrity](#integrity) + * [`verify`](#verify) + * [`verify.lastRun`](#verify-last-run) + +### Example + +```javascript +const cacache = require('cacache') +const fs = require('fs') + +const tarball = '/path/to/mytar.tgz' +const cachePath = '/tmp/my-toy-cache' +const key = 'my-unique-key-1234' + +// Cache it! Use `cachePath` as the root of the content cache +cacache.put(cachePath, key, '10293801983029384').then(integrity => { + console.log(`Saved content to ${cachePath}.`) +}) + +const destination = '/tmp/mytar.tgz' + +// Copy the contents out of the cache and into their destination! +// But this time, use stream instead! +cacache.get.stream( + cachePath, key +).pipe( + fs.createWriteStream(destination) +).on('finish', () => { + console.log('done extracting!') +}) + +// The same thing, but skip the key index. +cacache.get.byDigest(cachePath, integrityHash).then(data => { + fs.writeFile(destination, data, err => { + console.log('tarball data fetched based on its sha512sum and written out!') + }) +}) +``` + +### Features + +* Extraction by key or by content address (shasum, etc) +* [Subresource Integrity](#integrity) web standard support +* Multi-hash support - safely host sha1, sha512, etc, in a single cache +* Automatic content deduplication +* Fault tolerance (immune to corruption, partial writes, process races, etc) +* Consistency guarantees on read and write (full data verification) +* Lockless, high-concurrency cache access +* Streaming support +* Promise support +* Fast -- sub-millisecond reads and writes including verification +* Arbitrary metadata storage +* Garbage collection and additional offline verification +* Thorough test coverage +* There's probably a bloom filter in there somewhere. Those are cool, right? 🤔 + +### Contributing + +The cacache team enthusiastically welcomes contributions and project participation! There's a bunch of things you can do if you want to contribute! The [Contributor Guide](CONTRIBUTING.md) has all the information you need for everything from reporting bugs to contributing entire new features. Please don't hesitate to jump in if you'd like to, or even ask us questions if something isn't clear. + +All participants and maintainers in this project are expected to follow [Code of Conduct](CODE_OF_CONDUCT.md), and just generally be excellent to each other. + +Please refer to the [Changelog](CHANGELOG.md) for project history details, too. + +Happy hacking! + +### API + +#### `> cacache.ls(cache) -> Promise` + +Lists info for all entries currently in the cache as a single large object. Each +entry in the object will be keyed by the unique index key, with corresponding +[`get.info`](#get-info) objects as the values. + +##### Example + +```javascript +cacache.ls(cachePath).then(console.log) +// Output +{ + 'my-thing': { + key: 'my-thing', + integrity: 'sha512-BaSe64/EnCoDED+HAsh==' + path: '.testcache/content/deadbeef', // joined with `cachePath` + time: 12345698490, + size: 4023948, + metadata: { + name: 'blah', + version: '1.2.3', + description: 'this was once a package but now it is my-thing' + } + }, + 'other-thing': { + key: 'other-thing', + integrity: 'sha1-ANothER+hasH=', + path: '.testcache/content/bada55', + time: 11992309289, + size: 111112 + } +} +``` + +#### `> cacache.ls.stream(cache) -> Readable` + +Lists info for all entries currently in the cache as a single large object. + +This works just like [`ls`](#ls), except [`get.info`](#get-info) entries are +returned as `'data'` events on the returned stream. + +##### Example + +```javascript +cacache.ls.stream(cachePath).on('data', console.log) +// Output +{ + key: 'my-thing', + integrity: 'sha512-BaSe64HaSh', + path: '.testcache/content/deadbeef', // joined with `cachePath` + time: 12345698490, + size: 13423, + metadata: { + name: 'blah', + version: '1.2.3', + description: 'this was once a package but now it is my-thing' + } +} + +{ + key: 'other-thing', + integrity: 'whirlpool-WoWSoMuchSupport', + path: '.testcache/content/bada55', + time: 11992309289, + size: 498023984029 +} + +{ + ... +} +``` + +#### `> cacache.get(cache, key, [opts]) -> Promise({data, metadata, integrity})` + +Returns an object with the cached data, digest, and metadata identified by +`key`. The `data` property of this object will be a `Buffer` instance that +presumably holds some data that means something to you. I'm sure you know what +to do with it! cacache just won't care. + +`integrity` is a [Subresource +Integrity](#integrity) +string. That is, a string that can be used to verify `data`, which looks like +`-`. + +If there is no content identified by `key`, or if the locally-stored data does +not pass the validity checksum, the promise will be rejected. + +A sub-function, `get.byDigest` may be used for identical behavior, except lookup +will happen by integrity hash, bypassing the index entirely. This version of the +function *only* returns `data` itself, without any wrapper. + +See: [options](#get-options) + +##### Note + +This function loads the entire cache entry into memory before returning it. If +you're dealing with Very Large data, consider using [`get.stream`](#get-stream) +instead. + +##### Example + +```javascript +// Look up by key +cache.get(cachePath, 'my-thing').then(console.log) +// Output: +{ + metadata: { + thingName: 'my' + }, + integrity: 'sha512-BaSe64HaSh', + data: Buffer#, + size: 9320 +} + +// Look up by digest +cache.get.byDigest(cachePath, 'sha512-BaSe64HaSh').then(console.log) +// Output: +Buffer# +``` + +#### `> cacache.get.stream(cache, key, [opts]) -> Readable` + +Returns a [Readable Stream](https://nodejs.org/api/stream.html#stream_readable_streams) of the cached data identified by `key`. + +If there is no content identified by `key`, or if the locally-stored data does +not pass the validity checksum, an error will be emitted. + +`metadata` and `integrity` events will be emitted before the stream closes, if +you need to collect that extra data about the cached entry. + +A sub-function, `get.stream.byDigest` may be used for identical behavior, +except lookup will happen by integrity hash, bypassing the index entirely. This +version does not emit the `metadata` and `integrity` events at all. + +See: [options](#get-options) + +##### Example + +```javascript +// Look up by key +cache.get.stream( + cachePath, 'my-thing' +).on('metadata', metadata => { + console.log('metadata:', metadata) +}).on('integrity', integrity => { + console.log('integrity:', integrity) +}).pipe( + fs.createWriteStream('./x.tgz') +) +// Outputs: +metadata: { ... } +integrity: 'sha512-SoMeDIGest+64==' + +// Look up by digest +cache.get.stream.byDigest( + cachePath, 'sha512-SoMeDIGest+64==' +).pipe( + fs.createWriteStream('./x.tgz') +) +``` + +#### `> cacache.get.info(cache, key) -> Promise` + +Looks up `key` in the cache index, returning information about the entry if +one exists. + +##### Fields + +* `key` - Key the entry was looked up under. Matches the `key` argument. +* `integrity` - [Subresource Integrity hash](#integrity) for the content this entry refers to. +* `path` - Filesystem path where content is stored, joined with `cache` argument. +* `time` - Timestamp the entry was first added on. +* `metadata` - User-assigned metadata associated with the entry/content. + +##### Example + +```javascript +cacache.get.info(cachePath, 'my-thing').then(console.log) + +// Output +{ + key: 'my-thing', + integrity: 'sha256-MUSTVERIFY+ALL/THINGS==' + path: '.testcache/content/deadbeef', + time: 12345698490, + size: 849234, + metadata: { + name: 'blah', + version: '1.2.3', + description: 'this was once a package but now it is my-thing' + } +} +``` + +#### `> cacache.get.hasContent(cache, integrity) -> Promise` + +Looks up a [Subresource Integrity hash](#integrity) in the cache. If content +exists for this `integrity`, it will return an object, with the specific single integrity hash +that was found in `sri` key, and the size of the found content as `size`. If no content exists for this integrity, it will return `false`. + +##### Example + +```javascript +cacache.get.hasContent(cachePath, 'sha256-MUSTVERIFY+ALL/THINGS==').then(console.log) + +// Output +{ + sri: { + source: 'sha256-MUSTVERIFY+ALL/THINGS==', + algorithm: 'sha256', + digest: 'MUSTVERIFY+ALL/THINGS==', + options: [] + }, + size: 9001 +} + +cacache.get.hasContent(cachePath, 'sha521-NOT+IN/CACHE==').then(console.log) + +// Output +false +``` + +##### Options + +##### `opts.integrity` +If present, the pre-calculated digest for the inserted content. If this option +is provided and does not match the post-insertion digest, insertion will fail +with an `EINTEGRITY` error. + +##### `opts.memoize` + +Default: null + +If explicitly truthy, cacache will read from memory and memoize data on bulk read. If `false`, cacache will read from disk data. Reader functions by default read from in-memory cache. + +##### `opts.size` +If provided, the data stream will be verified to check that enough data was +passed through. If there's more or less data than expected, insertion will fail +with an `EBADSIZE` error. + + +#### `> cacache.put(cache, key, data, [opts]) -> Promise` + +Inserts data passed to it into the cache. The returned Promise resolves with a +digest (generated according to [`opts.algorithms`](#optsalgorithms)) after the +cache entry has been successfully written. + +See: [options](#put-options) + +##### Example + +```javascript +fetch( + 'https://registry.npmjs.org/cacache/-/cacache-1.0.0.tgz' +).then(data => { + return cacache.put(cachePath, 'registry.npmjs.org|cacache@1.0.0', data) +}).then(integrity => { + console.log('integrity hash is', integrity) +}) +``` + +#### `> cacache.put.stream(cache, key, [opts]) -> Writable` + +Returns a [Writable +Stream](https://nodejs.org/api/stream.html#stream_writable_streams) that inserts +data written to it into the cache. Emits an `integrity` event with the digest of +written contents when it succeeds. + +See: [options](#put-options) + +##### Example + +```javascript +request.get( + 'https://registry.npmjs.org/cacache/-/cacache-1.0.0.tgz' +).pipe( + cacache.put.stream( + cachePath, 'registry.npmjs.org|cacache@1.0.0' + ).on('integrity', d => console.log(`integrity digest is ${d}`)) +) +``` + +##### Options + +##### `opts.metadata` + +Arbitrary metadata to be attached to the inserted key. + +##### `opts.size` + +If provided, the data stream will be verified to check that enough data was +passed through. If there's more or less data than expected, insertion will fail +with an `EBADSIZE` error. + +##### `opts.integrity` + +If present, the pre-calculated digest for the inserted content. If this option +is provided and does not match the post-insertion digest, insertion will fail +with an `EINTEGRITY` error. + +`algorithms` has no effect if this option is present. + +##### `opts.algorithms` + +Default: ['sha512'] + +Hashing algorithms to use when calculating the [subresource integrity +digest](#integrity) +for inserted data. Can use any algorithm listed in `crypto.getHashes()` or +`'omakase'`/`'お任せします'` to pick a random hash algorithm on each insertion. You +may also use any anagram of `'modnar'` to use this feature. + +Currently only supports one algorithm at a time (i.e., an array length of +exactly `1`). Has no effect if `opts.integrity` is present. + +##### `opts.memoize` + +Default: null + +If provided, cacache will memoize the given cache insertion in memory, bypassing +any filesystem checks for that key or digest in future cache fetches. Nothing +will be written to the in-memory cache unless this option is explicitly truthy. + +If `opts.memoize` is an object or a `Map`-like (that is, an object with `get` +and `set` methods), it will be written to instead of the global memoization +cache. + +Reading from disk data can be forced by explicitly passing `memoize: false` to +the reader functions, but their default will be to read from memory. + +##### `opts.tmpPrefix` +Default: null + +Prefix to append on the temporary directory name inside the cache's tmp dir. + +#### `> cacache.rm.all(cache) -> Promise` + +Clears the entire cache. Mainly by blowing away the cache directory itself. + +##### Example + +```javascript +cacache.rm.all(cachePath).then(() => { + console.log('THE APOCALYPSE IS UPON US 😱') +}) +``` + +#### `> cacache.rm.entry(cache, key, [opts]) -> Promise` + +Alias: `cacache.rm` + +Removes the index entry for `key`. Content will still be accessible if +requested directly by content address ([`get.stream.byDigest`](#get-stream)). + +By default, this appends a new entry to the index with an integrity of `null`. +If `opts.removeFully` is set to `true` then the index file itself will be +physically deleted rather than appending a `null`. + +To remove the content itself (which might still be used by other entries), use +[`rm.content`](#rm-content). Or, to safely vacuum any unused content, use +[`verify`](#verify). + +##### Example + +```javascript +cacache.rm.entry(cachePath, 'my-thing').then(() => { + console.log('I did not like it anyway') +}) +``` + +#### `> cacache.rm.content(cache, integrity) -> Promise` + +Removes the content identified by `integrity`. Any index entries referring to it +will not be usable again until the content is re-added to the cache with an +identical digest. + +##### Example + +```javascript +cacache.rm.content(cachePath, 'sha512-SoMeDIGest/IN+BaSE64==').then(() => { + console.log('data for my-thing is gone!') +}) +``` + +#### `> cacache.index.compact(cache, key, matchFn, [opts]) -> Promise` + +Uses `matchFn`, which must be a synchronous function that accepts two entries +and returns a boolean indicating whether or not the two entries match, to +deduplicate all entries in the cache for the given `key`. + +If `opts.validateEntry` is provided, it will be called as a function with the +only parameter being a single index entry. The function must return a Boolean, +if it returns `true` the entry is considered valid and will be kept in the index, +if it returns `false` the entry will be removed from the index. + +If `opts.validateEntry` is not provided, however, every entry in the index will +be deduplicated and kept until the first `null` integrity is reached, removing +all entries that were written before the `null`. + +The deduplicated list of entries is both written to the index, replacing the +existing content, and returned in the Promise. + +#### `> cacache.index.insert(cache, key, integrity, opts) -> Promise` + +Writes an index entry to the cache for the given `key` without writing content. + +It is assumed if you are using this method, you have already stored the content +some other way and you only wish to add a new index to that content. The `metadata` +and `size` properties are read from `opts` and used as part of the index entry. + +Returns a Promise resolving to the newly added entry. + +#### `> cacache.clearMemoized()` + +Completely resets the in-memory entry cache. + +#### `> tmp.mkdir(cache, opts) -> Promise` + +Returns a unique temporary directory inside the cache's `tmp` dir. This +directory will use the same safe user assignment that all the other stuff use. + +Once the directory is made, it's the user's responsibility that all files +within are given the appropriate `gid`/`uid` ownership settings to match +the rest of the cache. If not, you can ask cacache to do it for you by +calling [`tmp.fix()`](#tmp-fix), which will fix all tmp directory +permissions. + +If you want automatic cleanup of this directory, use +[`tmp.withTmp()`](#with-tpm) + +See: [options](#tmp-options) + +##### Example + +```javascript +cacache.tmp.mkdir(cache).then(dir => { + fs.writeFile(path.join(dir, 'blablabla'), Buffer#<1234>, ...) +}) +``` + +#### `> tmp.fix(cache) -> Promise` + +Sets the `uid` and `gid` properties on all files and folders within the tmp +folder to match the rest of the cache. + +Use this after manually writing files into [`tmp.mkdir`](#tmp-mkdir) or +[`tmp.withTmp`](#with-tmp). + +##### Example + +```javascript +cacache.tmp.mkdir(cache).then(dir => { + writeFile(path.join(dir, 'file'), someData).then(() => { + // make sure we didn't just put a root-owned file in the cache + cacache.tmp.fix().then(() => { + // all uids and gids match now + }) + }) +}) +``` + +#### `> tmp.withTmp(cache, opts, cb) -> Promise` + +Creates a temporary directory with [`tmp.mkdir()`](#tmp-mkdir) and calls `cb` +with it. The created temporary directory will be removed when the return value +of `cb()` resolves, the tmp directory will be automatically deleted once that +promise completes. + +The same caveats apply when it comes to managing permissions for the tmp dir's +contents. + +See: [options](#tmp-options) + +##### Example + +```javascript +cacache.tmp.withTmp(cache, dir => { + return fs.writeFileAsync(path.join(dir, 'blablabla'), Buffer#<1234>, ...) +}).then(() => { + // `dir` no longer exists +}) +``` + +##### Options + +##### `opts.tmpPrefix` +Default: null + +Prefix to append on the temporary directory name inside the cache's tmp dir. + +#### Subresource Integrity Digests + +For content verification and addressing, cacache uses strings following the +[Subresource +Integrity spec](https://developer.mozilla.org/en-US/docs/Web/Security/Subresource_Integrity). +That is, any time cacache expects an `integrity` argument or option, it +should be in the format `-`. + +One deviation from the current spec is that cacache will support any hash +algorithms supported by the underlying Node.js process. You can use +`crypto.getHashes()` to see which ones you can use. + +##### Generating Digests Yourself + +If you have an existing content shasum, they are generally formatted as a +hexadecimal string (that is, a sha1 would look like: +`5f5513f8822fdbe5145af33b64d8d970dcf95c6e`). In order to be compatible with +cacache, you'll need to convert this to an equivalent subresource integrity +string. For this example, the corresponding hash would be: +`sha1-X1UT+IIv2+UUWvM7ZNjZcNz5XG4=`. + +If you want to generate an integrity string yourself for existing data, you can +use something like this: + +```javascript +const crypto = require('crypto') +const hashAlgorithm = 'sha512' +const data = 'foobarbaz' + +const integrity = ( + hashAlgorithm + + '-' + + crypto.createHash(hashAlgorithm).update(data).digest('base64') +) +``` + +You can also use [`ssri`](https://npm.im/ssri) to have a richer set of functionality +around SRI strings, including generation, parsing, and translating from existing +hex-formatted strings. + +#### `> cacache.verify(cache, opts) -> Promise` + +Checks out and fixes up your cache: + +* Cleans up corrupted or invalid index entries. +* Custom entry filtering options. +* Garbage collects any content entries not referenced by the index. +* Checks integrity for all content entries and removes invalid content. +* Fixes cache ownership. +* Removes the `tmp` directory in the cache and all its contents. + +When it's done, it'll return an object with various stats about the verification +process, including amount of storage reclaimed, number of valid entries, number +of entries removed, etc. + +##### Options + +##### `opts.concurrency` + +Default: 20 + +Number of concurrently read files in the filesystem while doing clean up. + +##### `opts.filter` +Receives a formatted entry. Return false to remove it. +Note: might be called more than once on the same entry. + +##### `opts.log` +Custom logger function: +``` + log: { silly () {} } + log.silly('verify', 'verifying cache at', cache) +``` + +##### Example + +```sh +echo somegarbage >> $CACHEPATH/content/deadbeef +``` + +```javascript +cacache.verify(cachePath).then(stats => { + // deadbeef collected, because of invalid checksum. + console.log('cache is much nicer now! stats:', stats) +}) +``` + +#### `> cacache.verify.lastRun(cache) -> Promise` + +Returns a `Date` representing the last time `cacache.verify` was run on `cache`. + +##### Example + +```javascript +cacache.verify(cachePath).then(() => { + cacache.verify.lastRun(cachePath).then(lastTime => { + console.log('cacache.verify was last called on' + lastTime) + }) +}) +``` diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/get.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/get.js new file mode 100644 index 00000000..4e905e7c --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/get.js @@ -0,0 +1,237 @@ +'use strict' + +const Collect = require('minipass-collect') +const Minipass = require('minipass') +const Pipeline = require('minipass-pipeline') +const fs = require('fs') +const util = require('util') + +const index = require('./lib/entry-index') +const memo = require('./lib/memoization') +const read = require('./lib/content/read') + +const writeFile = util.promisify(fs.writeFile) + +function getData (cache, key, opts = {}) { + const { integrity, memoize, size } = opts + const memoized = memo.get(cache, key, opts) + if (memoized && memoize !== false) { + return Promise.resolve({ + metadata: memoized.entry.metadata, + data: memoized.data, + integrity: memoized.entry.integrity, + size: memoized.entry.size, + }) + } + + return index.find(cache, key, opts).then((entry) => { + if (!entry) + throw new index.NotFoundError(cache, key) + + return read(cache, entry.integrity, { integrity, size }).then((data) => { + if (memoize) + memo.put(cache, entry, data, opts) + + return { + data, + metadata: entry.metadata, + size: entry.size, + integrity: entry.integrity, + } + }) + }) +} +module.exports = getData + +function getDataByDigest (cache, key, opts = {}) { + const { integrity, memoize, size } = opts + const memoized = memo.get.byDigest(cache, key, opts) + if (memoized && memoize !== false) + return Promise.resolve(memoized) + + return read(cache, key, { integrity, size }).then((res) => { + if (memoize) + memo.put.byDigest(cache, key, res, opts) + return res + }) +} +module.exports.byDigest = getDataByDigest + +function getDataSync (cache, key, opts = {}) { + const { integrity, memoize, size } = opts + const memoized = memo.get(cache, key, opts) + + if (memoized && memoize !== false) { + return { + metadata: memoized.entry.metadata, + data: memoized.data, + integrity: memoized.entry.integrity, + size: memoized.entry.size, + } + } + const entry = index.find.sync(cache, key, opts) + if (!entry) + throw new index.NotFoundError(cache, key) + const data = read.sync(cache, entry.integrity, { + integrity: integrity, + size: size, + }) + const res = { + metadata: entry.metadata, + data: data, + size: entry.size, + integrity: entry.integrity, + } + if (memoize) + memo.put(cache, entry, res.data, opts) + + return res +} + +module.exports.sync = getDataSync + +function getDataByDigestSync (cache, digest, opts = {}) { + const { integrity, memoize, size } = opts + const memoized = memo.get.byDigest(cache, digest, opts) + + if (memoized && memoize !== false) + return memoized + + const res = read.sync(cache, digest, { + integrity: integrity, + size: size, + }) + if (memoize) + memo.put.byDigest(cache, digest, res, opts) + + return res +} +module.exports.sync.byDigest = getDataByDigestSync + +const getMemoizedStream = (memoized) => { + const stream = new Minipass() + stream.on('newListener', function (ev, cb) { + ev === 'metadata' && cb(memoized.entry.metadata) + ev === 'integrity' && cb(memoized.entry.integrity) + ev === 'size' && cb(memoized.entry.size) + }) + stream.end(memoized.data) + return stream +} + +function getStream (cache, key, opts = {}) { + const { memoize, size } = opts + const memoized = memo.get(cache, key, opts) + if (memoized && memoize !== false) + return getMemoizedStream(memoized) + + const stream = new Pipeline() + index + .find(cache, key) + .then((entry) => { + if (!entry) + throw new index.NotFoundError(cache, key) + + stream.emit('metadata', entry.metadata) + stream.emit('integrity', entry.integrity) + stream.emit('size', entry.size) + stream.on('newListener', function (ev, cb) { + ev === 'metadata' && cb(entry.metadata) + ev === 'integrity' && cb(entry.integrity) + ev === 'size' && cb(entry.size) + }) + + const src = read.readStream( + cache, + entry.integrity, + { ...opts, size: typeof size !== 'number' ? entry.size : size } + ) + + if (memoize) { + const memoStream = new Collect.PassThrough() + memoStream.on('collect', data => memo.put(cache, entry, data, opts)) + stream.unshift(memoStream) + } + stream.unshift(src) + }) + .catch((err) => stream.emit('error', err)) + + return stream +} + +module.exports.stream = getStream + +function getStreamDigest (cache, integrity, opts = {}) { + const { memoize } = opts + const memoized = memo.get.byDigest(cache, integrity, opts) + if (memoized && memoize !== false) { + const stream = new Minipass() + stream.end(memoized) + return stream + } else { + const stream = read.readStream(cache, integrity, opts) + if (!memoize) + return stream + + const memoStream = new Collect.PassThrough() + memoStream.on('collect', data => memo.put.byDigest( + cache, + integrity, + data, + opts + )) + return new Pipeline(stream, memoStream) + } +} + +module.exports.stream.byDigest = getStreamDigest + +function info (cache, key, opts = {}) { + const { memoize } = opts + const memoized = memo.get(cache, key, opts) + if (memoized && memoize !== false) + return Promise.resolve(memoized.entry) + else + return index.find(cache, key) +} +module.exports.info = info + +function copy (cache, key, dest, opts = {}) { + if (read.copy) { + return index.find(cache, key, opts).then((entry) => { + if (!entry) + throw new index.NotFoundError(cache, key) + return read.copy(cache, entry.integrity, dest, opts) + .then(() => { + return { + metadata: entry.metadata, + size: entry.size, + integrity: entry.integrity, + } + }) + }) + } + + return getData(cache, key, opts).then((res) => { + return writeFile(dest, res.data).then(() => { + return { + metadata: res.metadata, + size: res.size, + integrity: res.integrity, + } + }) + }) +} +module.exports.copy = copy + +function copyByDigest (cache, key, dest, opts = {}) { + if (read.copy) + return read.copy(cache, key, dest, opts).then(() => key) + + return getDataByDigest(cache, key, opts).then((res) => { + return writeFile(dest, res).then(() => key) + }) +} +module.exports.copy.byDigest = copyByDigest + +module.exports.hasContent = read.hasContent diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/index.js new file mode 100644 index 00000000..c8c52b04 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/index.js @@ -0,0 +1,46 @@ +'use strict' + +const ls = require('./ls.js') +const get = require('./get.js') +const put = require('./put.js') +const rm = require('./rm.js') +const verify = require('./verify.js') +const { clearMemoized } = require('./lib/memoization.js') +const tmp = require('./lib/util/tmp.js') +const index = require('./lib/entry-index.js') + +module.exports.index = {} +module.exports.index.compact = index.compact +module.exports.index.insert = index.insert + +module.exports.ls = ls +module.exports.ls.stream = ls.stream + +module.exports.get = get +module.exports.get.byDigest = get.byDigest +module.exports.get.sync = get.sync +module.exports.get.sync.byDigest = get.sync.byDigest +module.exports.get.stream = get.stream +module.exports.get.stream.byDigest = get.stream.byDigest +module.exports.get.copy = get.copy +module.exports.get.copy.byDigest = get.copy.byDigest +module.exports.get.info = get.info +module.exports.get.hasContent = get.hasContent +module.exports.get.hasContent.sync = get.hasContent.sync + +module.exports.put = put +module.exports.put.stream = put.stream + +module.exports.rm = rm.entry +module.exports.rm.all = rm.all +module.exports.rm.entry = module.exports.rm +module.exports.rm.content = rm.content + +module.exports.clearMemoized = clearMemoized + +module.exports.tmp = {} +module.exports.tmp.mkdir = tmp.mkdir +module.exports.tmp.withTmp = tmp.withTmp + +module.exports.verify = verify +module.exports.verify.lastRun = verify.lastRun diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/lib/content/path.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/lib/content/path.js new file mode 100644 index 00000000..ad5a76a4 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/lib/content/path.js @@ -0,0 +1,29 @@ +'use strict' + +const contentVer = require('../../package.json')['cache-version'].content +const hashToSegments = require('../util/hash-to-segments') +const path = require('path') +const ssri = require('ssri') + +// Current format of content file path: +// +// sha512-BaSE64Hex= -> +// ~/.my-cache/content-v2/sha512/ba/da/55deadbeefc0ffee +// +module.exports = contentPath + +function contentPath (cache, integrity) { + const sri = ssri.parse(integrity, { single: true }) + // contentPath is the *strongest* algo given + return path.join( + contentDir(cache), + sri.algorithm, + ...hashToSegments(sri.hexDigest()) + ) +} + +module.exports.contentDir = contentDir + +function contentDir (cache) { + return path.join(cache, `content-v${contentVer}`) +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/lib/content/read.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/lib/content/read.js new file mode 100644 index 00000000..034e8eee --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/lib/content/read.js @@ -0,0 +1,244 @@ +'use strict' + +const util = require('util') + +const fs = require('fs') +const fsm = require('fs-minipass') +const ssri = require('ssri') +const contentPath = require('./path') +const Pipeline = require('minipass-pipeline') + +const lstat = util.promisify(fs.lstat) +const readFile = util.promisify(fs.readFile) + +module.exports = read + +const MAX_SINGLE_READ_SIZE = 64 * 1024 * 1024 +function read (cache, integrity, opts = {}) { + const { size } = opts + return withContentSri(cache, integrity, (cpath, sri) => { + // get size + return lstat(cpath).then(stat => ({ stat, cpath, sri })) + }).then(({ stat, cpath, sri }) => { + if (typeof size === 'number' && stat.size !== size) + throw sizeError(size, stat.size) + + if (stat.size > MAX_SINGLE_READ_SIZE) + return readPipeline(cpath, stat.size, sri, new Pipeline()).concat() + + return readFile(cpath, null).then((data) => { + if (!ssri.checkData(data, sri)) + throw integrityError(sri, cpath) + + return data + }) + }) +} + +const readPipeline = (cpath, size, sri, stream) => { + stream.push( + new fsm.ReadStream(cpath, { + size, + readSize: MAX_SINGLE_READ_SIZE, + }), + ssri.integrityStream({ + integrity: sri, + size, + }) + ) + return stream +} + +module.exports.sync = readSync + +function readSync (cache, integrity, opts = {}) { + const { size } = opts + return withContentSriSync(cache, integrity, (cpath, sri) => { + const data = fs.readFileSync(cpath) + if (typeof size === 'number' && size !== data.length) + throw sizeError(size, data.length) + + if (ssri.checkData(data, sri)) + return data + + throw integrityError(sri, cpath) + }) +} + +module.exports.stream = readStream +module.exports.readStream = readStream + +function readStream (cache, integrity, opts = {}) { + const { size } = opts + const stream = new Pipeline() + withContentSri(cache, integrity, (cpath, sri) => { + // just lstat to ensure it exists + return lstat(cpath).then((stat) => ({ stat, cpath, sri })) + }).then(({ stat, cpath, sri }) => { + if (typeof size === 'number' && size !== stat.size) + return stream.emit('error', sizeError(size, stat.size)) + + readPipeline(cpath, stat.size, sri, stream) + }, er => stream.emit('error', er)) + + return stream +} + +let copyFile +if (fs.copyFile) { + module.exports.copy = copy + module.exports.copy.sync = copySync + copyFile = util.promisify(fs.copyFile) +} + +function copy (cache, integrity, dest) { + return withContentSri(cache, integrity, (cpath, sri) => { + return copyFile(cpath, dest) + }) +} + +function copySync (cache, integrity, dest) { + return withContentSriSync(cache, integrity, (cpath, sri) => { + return fs.copyFileSync(cpath, dest) + }) +} + +module.exports.hasContent = hasContent + +function hasContent (cache, integrity) { + if (!integrity) + return Promise.resolve(false) + + return withContentSri(cache, integrity, (cpath, sri) => { + return lstat(cpath).then((stat) => ({ size: stat.size, sri, stat })) + }).catch((err) => { + if (err.code === 'ENOENT') + return false + + if (err.code === 'EPERM') { + /* istanbul ignore else */ + if (process.platform !== 'win32') + throw err + else + return false + } + }) +} + +module.exports.hasContent.sync = hasContentSync + +function hasContentSync (cache, integrity) { + if (!integrity) + return false + + return withContentSriSync(cache, integrity, (cpath, sri) => { + try { + const stat = fs.lstatSync(cpath) + return { size: stat.size, sri, stat } + } catch (err) { + if (err.code === 'ENOENT') + return false + + if (err.code === 'EPERM') { + /* istanbul ignore else */ + if (process.platform !== 'win32') + throw err + else + return false + } + } + }) +} + +function withContentSri (cache, integrity, fn) { + const tryFn = () => { + const sri = ssri.parse(integrity) + // If `integrity` has multiple entries, pick the first digest + // with available local data. + const algo = sri.pickAlgorithm() + const digests = sri[algo] + + if (digests.length <= 1) { + const cpath = contentPath(cache, digests[0]) + return fn(cpath, digests[0]) + } else { + // Can't use race here because a generic error can happen before + // a ENOENT error, and can happen before a valid result + return Promise + .all(digests.map((meta) => { + return withContentSri(cache, meta, fn) + .catch((err) => { + if (err.code === 'ENOENT') { + return Object.assign( + new Error('No matching content found for ' + sri.toString()), + { code: 'ENOENT' } + ) + } + return err + }) + })) + .then((results) => { + // Return the first non error if it is found + const result = results.find((r) => !(r instanceof Error)) + if (result) + return result + + // Throw the No matching content found error + const enoentError = results.find((r) => r.code === 'ENOENT') + if (enoentError) + throw enoentError + + // Throw generic error + throw results.find((r) => r instanceof Error) + }) + } + } + + return new Promise((resolve, reject) => { + try { + tryFn() + .then(resolve) + .catch(reject) + } catch (err) { + reject(err) + } + }) +} + +function withContentSriSync (cache, integrity, fn) { + const sri = ssri.parse(integrity) + // If `integrity` has multiple entries, pick the first digest + // with available local data. + const algo = sri.pickAlgorithm() + const digests = sri[algo] + if (digests.length <= 1) { + const cpath = contentPath(cache, digests[0]) + return fn(cpath, digests[0]) + } else { + let lastErr = null + for (const meta of digests) { + try { + return withContentSriSync(cache, meta, fn) + } catch (err) { + lastErr = err + } + } + throw lastErr + } +} + +function sizeError (expected, found) { + const err = new Error(`Bad data size: expected inserted data to be ${expected} bytes, but got ${found} instead`) + err.expected = expected + err.found = found + err.code = 'EBADSIZE' + return err +} + +function integrityError (sri, path) { + const err = new Error(`Integrity verification failed for ${sri} (${path})`) + err.code = 'EINTEGRITY' + err.sri = sri + err.path = path + return err +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/lib/content/rm.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/lib/content/rm.js new file mode 100644 index 00000000..6a3d1a3d --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/lib/content/rm.js @@ -0,0 +1,19 @@ +'use strict' + +const util = require('util') + +const contentPath = require('./path') +const { hasContent } = require('./read') +const rimraf = util.promisify(require('rimraf')) + +module.exports = rm + +function rm (cache, integrity) { + return hasContent(cache, integrity).then((content) => { + // ~pretty~ sure we can't end up with a content lacking sri, but be safe + if (content && content.sri) + return rimraf(contentPath(cache, content.sri)).then(() => true) + else + return false + }) +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/lib/content/write.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/lib/content/write.js new file mode 100644 index 00000000..dde1bd1d --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/lib/content/write.js @@ -0,0 +1,189 @@ +'use strict' + +const util = require('util') + +const contentPath = require('./path') +const fixOwner = require('../util/fix-owner') +const fs = require('fs') +const moveFile = require('../util/move-file') +const Minipass = require('minipass') +const Pipeline = require('minipass-pipeline') +const Flush = require('minipass-flush') +const path = require('path') +const rimraf = util.promisify(require('rimraf')) +const ssri = require('ssri') +const uniqueFilename = require('unique-filename') +const { disposer } = require('./../util/disposer') +const fsm = require('fs-minipass') + +const writeFile = util.promisify(fs.writeFile) + +module.exports = write + +function write (cache, data, opts = {}) { + const { algorithms, size, integrity } = opts + if (algorithms && algorithms.length > 1) + throw new Error('opts.algorithms only supports a single algorithm for now') + + if (typeof size === 'number' && data.length !== size) + return Promise.reject(sizeError(size, data.length)) + + const sri = ssri.fromData(data, algorithms ? { algorithms } : {}) + if (integrity && !ssri.checkData(data, integrity, opts)) + return Promise.reject(checksumError(integrity, sri)) + + return disposer(makeTmp(cache, opts), makeTmpDisposer, + (tmp) => { + return writeFile(tmp.target, data, { flag: 'wx' }) + .then(() => moveToDestination(tmp, cache, sri, opts)) + }) + .then(() => ({ integrity: sri, size: data.length })) +} + +module.exports.stream = writeStream + +// writes proxied to the 'inputStream' that is passed to the Promise +// 'end' is deferred until content is handled. +class CacacheWriteStream extends Flush { + constructor (cache, opts) { + super() + this.opts = opts + this.cache = cache + this.inputStream = new Minipass() + this.inputStream.on('error', er => this.emit('error', er)) + this.inputStream.on('drain', () => this.emit('drain')) + this.handleContentP = null + } + + write (chunk, encoding, cb) { + if (!this.handleContentP) { + this.handleContentP = handleContent( + this.inputStream, + this.cache, + this.opts + ) + } + return this.inputStream.write(chunk, encoding, cb) + } + + flush (cb) { + this.inputStream.end(() => { + if (!this.handleContentP) { + const e = new Error('Cache input stream was empty') + e.code = 'ENODATA' + // empty streams are probably emitting end right away. + // defer this one tick by rejecting a promise on it. + return Promise.reject(e).catch(cb) + } + this.handleContentP.then( + (res) => { + res.integrity && this.emit('integrity', res.integrity) + res.size !== null && this.emit('size', res.size) + cb() + }, + (er) => cb(er) + ) + }) + } +} + +function writeStream (cache, opts = {}) { + return new CacacheWriteStream(cache, opts) +} + +function handleContent (inputStream, cache, opts) { + return disposer(makeTmp(cache, opts), makeTmpDisposer, (tmp) => { + return pipeToTmp(inputStream, cache, tmp.target, opts) + .then((res) => { + return moveToDestination( + tmp, + cache, + res.integrity, + opts + ).then(() => res) + }) + }) +} + +function pipeToTmp (inputStream, cache, tmpTarget, opts) { + let integrity + let size + const hashStream = ssri.integrityStream({ + integrity: opts.integrity, + algorithms: opts.algorithms, + size: opts.size, + }) + hashStream.on('integrity', i => { + integrity = i + }) + hashStream.on('size', s => { + size = s + }) + + const outStream = new fsm.WriteStream(tmpTarget, { + flags: 'wx', + }) + + // NB: this can throw if the hashStream has a problem with + // it, and the data is fully written. but pipeToTmp is only + // called in promisory contexts where that is handled. + const pipeline = new Pipeline( + inputStream, + hashStream, + outStream + ) + + return pipeline.promise() + .then(() => ({ integrity, size })) + .catch(er => rimraf(tmpTarget).then(() => { + throw er + })) +} + +function makeTmp (cache, opts) { + const tmpTarget = uniqueFilename(path.join(cache, 'tmp'), opts.tmpPrefix) + return fixOwner.mkdirfix(cache, path.dirname(tmpTarget)).then(() => ({ + target: tmpTarget, + moved: false, + })) +} + +function makeTmpDisposer (tmp) { + if (tmp.moved) + return Promise.resolve() + + return rimraf(tmp.target) +} + +function moveToDestination (tmp, cache, sri, opts) { + const destination = contentPath(cache, sri) + const destDir = path.dirname(destination) + + return fixOwner + .mkdirfix(cache, destDir) + .then(() => { + return moveFile(tmp.target, destination) + }) + .then(() => { + tmp.moved = true + return fixOwner.chownr(cache, destination) + }) +} + +function sizeError (expected, found) { + const err = new Error(`Bad data size: expected inserted data to be ${expected} bytes, but got ${found} instead`) + err.expected = expected + err.found = found + err.code = 'EBADSIZE' + return err +} + +function checksumError (expected, found) { + const err = new Error(`Integrity check failed: + Wanted: ${expected} + Found: ${found}`) + err.code = 'EINTEGRITY' + err.expected = expected + err.found = found + return err +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/lib/entry-index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/lib/entry-index.js new file mode 100644 index 00000000..71aac5ed --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/lib/entry-index.js @@ -0,0 +1,394 @@ +'use strict' + +const util = require('util') +const crypto = require('crypto') +const fs = require('fs') +const Minipass = require('minipass') +const path = require('path') +const ssri = require('ssri') +const uniqueFilename = require('unique-filename') + +const { disposer } = require('./util/disposer') +const contentPath = require('./content/path') +const fixOwner = require('./util/fix-owner') +const hashToSegments = require('./util/hash-to-segments') +const indexV = require('../package.json')['cache-version'].index +const moveFile = require('@npmcli/move-file') +const _rimraf = require('rimraf') +const rimraf = util.promisify(_rimraf) +rimraf.sync = _rimraf.sync + +const appendFile = util.promisify(fs.appendFile) +const readFile = util.promisify(fs.readFile) +const readdir = util.promisify(fs.readdir) +const writeFile = util.promisify(fs.writeFile) + +module.exports.NotFoundError = class NotFoundError extends Error { + constructor (cache, key) { + super(`No cache entry for ${key} found in ${cache}`) + this.code = 'ENOENT' + this.cache = cache + this.key = key + } +} + +module.exports.compact = compact + +async function compact (cache, key, matchFn, opts = {}) { + const bucket = bucketPath(cache, key) + const entries = await bucketEntries(bucket) + const newEntries = [] + // we loop backwards because the bottom-most result is the newest + // since we add new entries with appendFile + for (let i = entries.length - 1; i >= 0; --i) { + const entry = entries[i] + // a null integrity could mean either a delete was appended + // or the user has simply stored an index that does not map + // to any content. we determine if the user wants to keep the + // null integrity based on the validateEntry function passed in options. + // if the integrity is null and no validateEntry is provided, we break + // as we consider the null integrity to be a deletion of everything + // that came before it. + if (entry.integrity === null && !opts.validateEntry) + break + + // if this entry is valid, and it is either the first entry or + // the newEntries array doesn't already include an entry that + // matches this one based on the provided matchFn, then we add + // it to the beginning of our list + if ((!opts.validateEntry || opts.validateEntry(entry) === true) && + (newEntries.length === 0 || + !newEntries.find((oldEntry) => matchFn(oldEntry, entry)))) + newEntries.unshift(entry) + } + + const newIndex = '\n' + newEntries.map((entry) => { + const stringified = JSON.stringify(entry) + const hash = hashEntry(stringified) + return `${hash}\t${stringified}` + }).join('\n') + + const setup = async () => { + const target = uniqueFilename(path.join(cache, 'tmp'), opts.tmpPrefix) + await fixOwner.mkdirfix(cache, path.dirname(target)) + return { + target, + moved: false, + } + } + + const teardown = async (tmp) => { + if (!tmp.moved) + return rimraf(tmp.target) + } + + const write = async (tmp) => { + await writeFile(tmp.target, newIndex, { flag: 'wx' }) + await fixOwner.mkdirfix(cache, path.dirname(bucket)) + // we use @npmcli/move-file directly here because we + // want to overwrite the existing file + await moveFile(tmp.target, bucket) + tmp.moved = true + try { + await fixOwner.chownr(cache, bucket) + } catch (err) { + if (err.code !== 'ENOENT') + throw err + } + } + + // write the file atomically + await disposer(setup(), teardown, write) + + // we reverse the list we generated such that the newest + // entries come first in order to make looping through them easier + // the true passed to formatEntry tells it to keep null + // integrity values, if they made it this far it's because + // validateEntry returned true, and as such we should return it + return newEntries.reverse().map((entry) => formatEntry(cache, entry, true)) +} + +module.exports.insert = insert + +function insert (cache, key, integrity, opts = {}) { + const { metadata, size } = opts + const bucket = bucketPath(cache, key) + const entry = { + key, + integrity: integrity && ssri.stringify(integrity), + time: Date.now(), + size, + metadata, + } + return fixOwner + .mkdirfix(cache, path.dirname(bucket)) + .then(() => { + const stringified = JSON.stringify(entry) + // NOTE - Cleverness ahoy! + // + // This works because it's tremendously unlikely for an entry to corrupt + // another while still preserving the string length of the JSON in + // question. So, we just slap the length in there and verify it on read. + // + // Thanks to @isaacs for the whiteboarding session that ended up with + // this. + return appendFile(bucket, `\n${hashEntry(stringified)}\t${stringified}`) + }) + .then(() => fixOwner.chownr(cache, bucket)) + .catch((err) => { + if (err.code === 'ENOENT') + return undefined + + throw err + // There's a class of race conditions that happen when things get deleted + // during fixOwner, or between the two mkdirfix/chownr calls. + // + // It's perfectly fine to just not bother in those cases and lie + // that the index entry was written. Because it's a cache. + }) + .then(() => { + return formatEntry(cache, entry) + }) +} + +module.exports.insert.sync = insertSync + +function insertSync (cache, key, integrity, opts = {}) { + const { metadata, size } = opts + const bucket = bucketPath(cache, key) + const entry = { + key, + integrity: integrity && ssri.stringify(integrity), + time: Date.now(), + size, + metadata, + } + fixOwner.mkdirfix.sync(cache, path.dirname(bucket)) + const stringified = JSON.stringify(entry) + fs.appendFileSync(bucket, `\n${hashEntry(stringified)}\t${stringified}`) + try { + fixOwner.chownr.sync(cache, bucket) + } catch (err) { + if (err.code !== 'ENOENT') + throw err + } + return formatEntry(cache, entry) +} + +module.exports.find = find + +function find (cache, key) { + const bucket = bucketPath(cache, key) + return bucketEntries(bucket) + .then((entries) => { + return entries.reduce((latest, next) => { + if (next && next.key === key) + return formatEntry(cache, next) + else + return latest + }, null) + }) + .catch((err) => { + if (err.code === 'ENOENT') + return null + else + throw err + }) +} + +module.exports.find.sync = findSync + +function findSync (cache, key) { + const bucket = bucketPath(cache, key) + try { + return bucketEntriesSync(bucket).reduce((latest, next) => { + if (next && next.key === key) + return formatEntry(cache, next) + else + return latest + }, null) + } catch (err) { + if (err.code === 'ENOENT') + return null + else + throw err + } +} + +module.exports.delete = del + +function del (cache, key, opts = {}) { + if (!opts.removeFully) + return insert(cache, key, null, opts) + + const bucket = bucketPath(cache, key) + return rimraf(bucket) +} + +module.exports.delete.sync = delSync + +function delSync (cache, key, opts = {}) { + if (!opts.removeFully) + return insertSync(cache, key, null, opts) + + const bucket = bucketPath(cache, key) + return rimraf.sync(bucket) +} + +module.exports.lsStream = lsStream + +function lsStream (cache) { + const indexDir = bucketDir(cache) + const stream = new Minipass({ objectMode: true }) + + readdirOrEmpty(indexDir).then(buckets => Promise.all( + buckets.map(bucket => { + const bucketPath = path.join(indexDir, bucket) + return readdirOrEmpty(bucketPath).then(subbuckets => Promise.all( + subbuckets.map(subbucket => { + const subbucketPath = path.join(bucketPath, subbucket) + + // "/cachename//./*" + return readdirOrEmpty(subbucketPath).then(entries => Promise.all( + entries.map(entry => { + const entryPath = path.join(subbucketPath, entry) + return bucketEntries(entryPath).then(entries => + // using a Map here prevents duplicate keys from + // showing up twice, I guess? + entries.reduce((acc, entry) => { + acc.set(entry.key, entry) + return acc + }, new Map()) + ).then(reduced => { + // reduced is a map of key => entry + for (const entry of reduced.values()) { + const formatted = formatEntry(cache, entry) + if (formatted) + stream.write(formatted) + } + }).catch(err => { + if (err.code === 'ENOENT') + return undefined + throw err + }) + }) + )) + }) + )) + }) + )) + .then( + () => stream.end(), + err => stream.emit('error', err) + ) + + return stream +} + +module.exports.ls = ls + +function ls (cache) { + return lsStream(cache).collect().then(entries => + entries.reduce((acc, xs) => { + acc[xs.key] = xs + return acc + }, {}) + ) +} + +module.exports.bucketEntries = bucketEntries + +function bucketEntries (bucket, filter) { + return readFile(bucket, 'utf8').then((data) => _bucketEntries(data, filter)) +} + +module.exports.bucketEntries.sync = bucketEntriesSync + +function bucketEntriesSync (bucket, filter) { + const data = fs.readFileSync(bucket, 'utf8') + return _bucketEntries(data, filter) +} + +function _bucketEntries (data, filter) { + const entries = [] + data.split('\n').forEach((entry) => { + if (!entry) + return + + const pieces = entry.split('\t') + if (!pieces[1] || hashEntry(pieces[1]) !== pieces[0]) { + // Hash is no good! Corruption or malice? Doesn't matter! + // EJECT EJECT + return + } + let obj + try { + obj = JSON.parse(pieces[1]) + } catch (e) { + // Entry is corrupted! + return + } + if (obj) + entries.push(obj) + }) + return entries +} + +module.exports.bucketDir = bucketDir + +function bucketDir (cache) { + return path.join(cache, `index-v${indexV}`) +} + +module.exports.bucketPath = bucketPath + +function bucketPath (cache, key) { + const hashed = hashKey(key) + return path.join.apply( + path, + [bucketDir(cache)].concat(hashToSegments(hashed)) + ) +} + +module.exports.hashKey = hashKey + +function hashKey (key) { + return hash(key, 'sha256') +} + +module.exports.hashEntry = hashEntry + +function hashEntry (str) { + return hash(str, 'sha1') +} + +function hash (str, digest) { + return crypto + .createHash(digest) + .update(str) + .digest('hex') +} + +function formatEntry (cache, entry, keepAll) { + // Treat null digests as deletions. They'll shadow any previous entries. + if (!entry.integrity && !keepAll) + return null + + return { + key: entry.key, + integrity: entry.integrity, + path: entry.integrity ? contentPath(cache, entry.integrity) : undefined, + size: entry.size, + time: entry.time, + metadata: entry.metadata, + } +} + +function readdirOrEmpty (dir) { + return readdir(dir).catch((err) => { + if (err.code === 'ENOENT' || err.code === 'ENOTDIR') + return [] + + throw err + }) +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/lib/memoization.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/lib/memoization.js new file mode 100644 index 00000000..d5465f39 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/lib/memoization.js @@ -0,0 +1,73 @@ +'use strict' + +const LRU = require('lru-cache') + +const MAX_SIZE = 50 * 1024 * 1024 // 50MB +const MAX_AGE = 3 * 60 * 1000 + +const MEMOIZED = new LRU({ + max: MAX_SIZE, + maxAge: MAX_AGE, + length: (entry, key) => key.startsWith('key:') ? entry.data.length : entry.length, +}) + +module.exports.clearMemoized = clearMemoized + +function clearMemoized () { + const old = {} + MEMOIZED.forEach((v, k) => { + old[k] = v + }) + MEMOIZED.reset() + return old +} + +module.exports.put = put + +function put (cache, entry, data, opts) { + pickMem(opts).set(`key:${cache}:${entry.key}`, { entry, data }) + putDigest(cache, entry.integrity, data, opts) +} + +module.exports.put.byDigest = putDigest + +function putDigest (cache, integrity, data, opts) { + pickMem(opts).set(`digest:${cache}:${integrity}`, data) +} + +module.exports.get = get + +function get (cache, key, opts) { + return pickMem(opts).get(`key:${cache}:${key}`) +} + +module.exports.get.byDigest = getDigest + +function getDigest (cache, integrity, opts) { + return pickMem(opts).get(`digest:${cache}:${integrity}`) +} + +class ObjProxy { + constructor (obj) { + this.obj = obj + } + + get (key) { + return this.obj[key] + } + + set (key, val) { + this.obj[key] = val + } +} + +function pickMem (opts) { + if (!opts || !opts.memoize) + return MEMOIZED + else if (opts.memoize.get && opts.memoize.set) + return opts.memoize + else if (typeof opts.memoize === 'object') + return new ObjProxy(opts.memoize) + else + return MEMOIZED +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/lib/util/disposer.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/lib/util/disposer.js new file mode 100644 index 00000000..aa8aed54 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/lib/util/disposer.js @@ -0,0 +1,30 @@ +'use strict' + +module.exports.disposer = disposer + +function disposer (creatorFn, disposerFn, fn) { + const runDisposer = (resource, result, shouldThrow = false) => { + return disposerFn(resource) + .then( + // disposer resolved, do something with original fn's promise + () => { + if (shouldThrow) + throw result + + return result + }, + // Disposer fn failed, crash process + (err) => { + throw err + // Or process.exit? + }) + } + + return creatorFn + .then((resource) => { + // fn(resource) can throw, so wrap in a promise here + return Promise.resolve().then(() => fn(resource)) + .then((result) => runDisposer(resource, result)) + .catch((err) => runDisposer(resource, err, true)) + }) +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/lib/util/fix-owner.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/lib/util/fix-owner.js new file mode 100644 index 00000000..90ffece5 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/lib/util/fix-owner.js @@ -0,0 +1,142 @@ +'use strict' + +const util = require('util') + +const chownr = util.promisify(require('chownr')) +const mkdirp = require('mkdirp') +const inflight = require('promise-inflight') +const inferOwner = require('infer-owner') + +// Memoize getuid()/getgid() calls. +// patch process.setuid/setgid to invalidate cached value on change +const self = { uid: null, gid: null } +const getSelf = () => { + if (typeof self.uid !== 'number') { + self.uid = process.getuid() + const setuid = process.setuid + process.setuid = (uid) => { + self.uid = null + process.setuid = setuid + return process.setuid(uid) + } + } + if (typeof self.gid !== 'number') { + self.gid = process.getgid() + const setgid = process.setgid + process.setgid = (gid) => { + self.gid = null + process.setgid = setgid + return process.setgid(gid) + } + } +} + +module.exports.chownr = fixOwner + +function fixOwner (cache, filepath) { + if (!process.getuid) { + // This platform doesn't need ownership fixing + return Promise.resolve() + } + + getSelf() + if (self.uid !== 0) { + // almost certainly can't chown anyway + return Promise.resolve() + } + + return Promise.resolve(inferOwner(cache)).then((owner) => { + const { uid, gid } = owner + + // No need to override if it's already what we used. + if (self.uid === uid && self.gid === gid) + return + + return inflight('fixOwner: fixing ownership on ' + filepath, () => + chownr( + filepath, + typeof uid === 'number' ? uid : self.uid, + typeof gid === 'number' ? gid : self.gid + ).catch((err) => { + if (err.code === 'ENOENT') + return null + + throw err + }) + ) + }) +} + +module.exports.chownr.sync = fixOwnerSync + +function fixOwnerSync (cache, filepath) { + if (!process.getuid) { + // This platform doesn't need ownership fixing + return + } + const { uid, gid } = inferOwner.sync(cache) + getSelf() + if (self.uid !== 0) { + // almost certainly can't chown anyway + return + } + + if (self.uid === uid && self.gid === gid) { + // No need to override if it's already what we used. + return + } + try { + chownr.sync( + filepath, + typeof uid === 'number' ? uid : self.uid, + typeof gid === 'number' ? gid : self.gid + ) + } catch (err) { + // only catch ENOENT, any other error is a problem. + if (err.code === 'ENOENT') + return null + + throw err + } +} + +module.exports.mkdirfix = mkdirfix + +function mkdirfix (cache, p, cb) { + // we have to infer the owner _before_ making the directory, even though + // we aren't going to use the results, since the cache itself might not + // exist yet. If we mkdirp it, then our current uid/gid will be assumed + // to be correct if it creates the cache folder in the process. + return Promise.resolve(inferOwner(cache)).then(() => { + return mkdirp(p) + .then((made) => { + if (made) + return fixOwner(cache, made).then(() => made) + }) + .catch((err) => { + if (err.code === 'EEXIST') + return fixOwner(cache, p).then(() => null) + + throw err + }) + }) +} + +module.exports.mkdirfix.sync = mkdirfixSync + +function mkdirfixSync (cache, p) { + try { + inferOwner.sync(cache) + const made = mkdirp.sync(p) + if (made) { + fixOwnerSync(cache, made) + return made + } + } catch (err) { + if (err.code === 'EEXIST') { + fixOwnerSync(cache, p) + return null + } else + throw err + } +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/lib/util/hash-to-segments.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/lib/util/hash-to-segments.js new file mode 100644 index 00000000..445599b5 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/lib/util/hash-to-segments.js @@ -0,0 +1,7 @@ +'use strict' + +module.exports = hashToSegments + +function hashToSegments (hash) { + return [hash.slice(0, 2), hash.slice(2, 4), hash.slice(4)] +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/lib/util/move-file.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/lib/util/move-file.js new file mode 100644 index 00000000..c3f9e35e --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/lib/util/move-file.js @@ -0,0 +1,67 @@ +'use strict' + +const fs = require('fs') +const util = require('util') +const chmod = util.promisify(fs.chmod) +const unlink = util.promisify(fs.unlink) +const stat = util.promisify(fs.stat) +const move = require('@npmcli/move-file') +const pinflight = require('promise-inflight') + +module.exports = moveFile + +function moveFile (src, dest) { + const isWindows = global.__CACACHE_TEST_FAKE_WINDOWS__ || + process.platform === 'win32' + + // This isn't quite an fs.rename -- the assumption is that + // if `dest` already exists, and we get certain errors while + // trying to move it, we should just not bother. + // + // In the case of cache corruption, users will receive an + // EINTEGRITY error elsewhere, and can remove the offending + // content their own way. + // + // Note that, as the name suggests, this strictly only supports file moves. + return new Promise((resolve, reject) => { + fs.link(src, dest, (err) => { + if (err) { + if (isWindows && err.code === 'EPERM') { + // XXX This is a really weird way to handle this situation, as it + // results in the src file being deleted even though the dest + // might not exist. Since we pretty much always write files to + // deterministic locations based on content hash, this is likely + // ok (or at worst, just ends in a future cache miss). But it would + // be worth investigating at some time in the future if this is + // really what we want to do here. + return resolve() + } else if (err.code === 'EEXIST' || err.code === 'EBUSY') { + // file already exists, so whatever + return resolve() + } else + return reject(err) + } else + return resolve() + }) + }) + .then(() => { + // content should never change for any reason, so make it read-only + return Promise.all([ + unlink(src), + !isWindows && chmod(dest, '0444'), + ]) + }) + .catch(() => { + return pinflight('cacache-move-file:' + dest, () => { + return stat(dest).catch((err) => { + if (err.code !== 'ENOENT') { + // Something else is wrong here. Bail bail bail + throw err + } + // file doesn't already exist! let's try a rename -> copy fallback + // only delete if it successfully copies + return move(src, dest) + }) + }) + }) +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/lib/util/tmp.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/lib/util/tmp.js new file mode 100644 index 00000000..0a5a50eb --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/lib/util/tmp.js @@ -0,0 +1,35 @@ +'use strict' + +const fs = require('@npmcli/fs') + +const fixOwner = require('./fix-owner') +const path = require('path') + +module.exports.mkdir = mktmpdir + +function mktmpdir (cache, opts = {}) { + const { tmpPrefix } = opts + const tmpDir = path.join(cache, 'tmp') + return fs.mkdir(tmpDir, { recursive: true, owner: 'inherit' }) + .then(() => { + // do not use path.join(), it drops the trailing / if tmpPrefix is unset + const target = `${tmpDir}${path.sep}${tmpPrefix || ''}` + return fs.mkdtemp(target, { owner: 'inherit' }) + }) +} + +module.exports.withTmp = withTmp + +function withTmp (cache, opts, cb) { + if (!cb) { + cb = opts + opts = {} + } + return fs.withTempDir(path.join(cache, 'tmp'), cb, opts) +} + +module.exports.fix = fixtmpdir + +function fixtmpdir (cache) { + return fixOwner(cache, path.join(cache, 'tmp')) +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/lib/verify.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/lib/verify.js new file mode 100644 index 00000000..e9d679ec --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/lib/verify.js @@ -0,0 +1,287 @@ +'use strict' + +const util = require('util') + +const pMap = require('p-map') +const contentPath = require('./content/path') +const fixOwner = require('./util/fix-owner') +const fs = require('fs') +const fsm = require('fs-minipass') +const glob = util.promisify(require('glob')) +const index = require('./entry-index') +const path = require('path') +const rimraf = util.promisify(require('rimraf')) +const ssri = require('ssri') + +const hasOwnProperty = (obj, key) => + Object.prototype.hasOwnProperty.call(obj, key) + +const stat = util.promisify(fs.stat) +const truncate = util.promisify(fs.truncate) +const writeFile = util.promisify(fs.writeFile) +const readFile = util.promisify(fs.readFile) + +const verifyOpts = (opts) => ({ + concurrency: 20, + log: { silly () {} }, + ...opts, +}) + +module.exports = verify + +function verify (cache, opts) { + opts = verifyOpts(opts) + opts.log.silly('verify', 'verifying cache at', cache) + + const steps = [ + markStartTime, + fixPerms, + garbageCollect, + rebuildIndex, + cleanTmp, + writeVerifile, + markEndTime, + ] + + return steps + .reduce((promise, step, i) => { + const label = step.name + const start = new Date() + return promise.then((stats) => { + return step(cache, opts).then((s) => { + s && + Object.keys(s).forEach((k) => { + stats[k] = s[k] + }) + const end = new Date() + if (!stats.runTime) + stats.runTime = {} + + stats.runTime[label] = end - start + return Promise.resolve(stats) + }) + }) + }, Promise.resolve({})) + .then((stats) => { + stats.runTime.total = stats.endTime - stats.startTime + opts.log.silly( + 'verify', + 'verification finished for', + cache, + 'in', + `${stats.runTime.total}ms` + ) + return stats + }) +} + +function markStartTime (cache, opts) { + return Promise.resolve({ startTime: new Date() }) +} + +function markEndTime (cache, opts) { + return Promise.resolve({ endTime: new Date() }) +} + +function fixPerms (cache, opts) { + opts.log.silly('verify', 'fixing cache permissions') + return fixOwner + .mkdirfix(cache, cache) + .then(() => { + // TODO - fix file permissions too + return fixOwner.chownr(cache, cache) + }) + .then(() => null) +} + +// Implements a naive mark-and-sweep tracing garbage collector. +// +// The algorithm is basically as follows: +// 1. Read (and filter) all index entries ("pointers") +// 2. Mark each integrity value as "live" +// 3. Read entire filesystem tree in `content-vX/` dir +// 4. If content is live, verify its checksum and delete it if it fails +// 5. If content is not marked as live, rimraf it. +// +function garbageCollect (cache, opts) { + opts.log.silly('verify', 'garbage collecting content') + const indexStream = index.lsStream(cache) + const liveContent = new Set() + indexStream.on('data', (entry) => { + if (opts.filter && !opts.filter(entry)) + return + + liveContent.add(entry.integrity.toString()) + }) + return new Promise((resolve, reject) => { + indexStream.on('end', resolve).on('error', reject) + }).then(() => { + const contentDir = contentPath.contentDir(cache) + return glob(path.join(contentDir, '**'), { + follow: false, + nodir: true, + nosort: true, + }).then((files) => { + return Promise.resolve({ + verifiedContent: 0, + reclaimedCount: 0, + reclaimedSize: 0, + badContentCount: 0, + keptSize: 0, + }).then((stats) => + pMap( + files, + (f) => { + const split = f.split(/[/\\]/) + const digest = split.slice(split.length - 3).join('') + const algo = split[split.length - 4] + const integrity = ssri.fromHex(digest, algo) + if (liveContent.has(integrity.toString())) { + return verifyContent(f, integrity).then((info) => { + if (!info.valid) { + stats.reclaimedCount++ + stats.badContentCount++ + stats.reclaimedSize += info.size + } else { + stats.verifiedContent++ + stats.keptSize += info.size + } + return stats + }) + } else { + // No entries refer to this content. We can delete. + stats.reclaimedCount++ + return stat(f).then((s) => { + return rimraf(f).then(() => { + stats.reclaimedSize += s.size + return stats + }) + }) + } + }, + { concurrency: opts.concurrency } + ).then(() => stats) + ) + }) + }) +} + +function verifyContent (filepath, sri) { + return stat(filepath) + .then((s) => { + const contentInfo = { + size: s.size, + valid: true, + } + return ssri + .checkStream(new fsm.ReadStream(filepath), sri) + .catch((err) => { + if (err.code !== 'EINTEGRITY') + throw err + + return rimraf(filepath).then(() => { + contentInfo.valid = false + }) + }) + .then(() => contentInfo) + }) + .catch((err) => { + if (err.code === 'ENOENT') + return { size: 0, valid: false } + + throw err + }) +} + +function rebuildIndex (cache, opts) { + opts.log.silly('verify', 'rebuilding index') + return index.ls(cache).then((entries) => { + const stats = { + missingContent: 0, + rejectedEntries: 0, + totalEntries: 0, + } + const buckets = {} + for (const k in entries) { + /* istanbul ignore else */ + if (hasOwnProperty(entries, k)) { + const hashed = index.hashKey(k) + const entry = entries[k] + const excluded = opts.filter && !opts.filter(entry) + excluded && stats.rejectedEntries++ + if (buckets[hashed] && !excluded) + buckets[hashed].push(entry) + else if (buckets[hashed] && excluded) { + // skip + } else if (excluded) { + buckets[hashed] = [] + buckets[hashed]._path = index.bucketPath(cache, k) + } else { + buckets[hashed] = [entry] + buckets[hashed]._path = index.bucketPath(cache, k) + } + } + } + return pMap( + Object.keys(buckets), + (key) => { + return rebuildBucket(cache, buckets[key], stats, opts) + }, + { concurrency: opts.concurrency } + ).then(() => stats) + }) +} + +function rebuildBucket (cache, bucket, stats, opts) { + return truncate(bucket._path).then(() => { + // This needs to be serialized because cacache explicitly + // lets very racy bucket conflicts clobber each other. + return bucket.reduce((promise, entry) => { + return promise.then(() => { + const content = contentPath(cache, entry.integrity) + return stat(content) + .then(() => { + return index + .insert(cache, entry.key, entry.integrity, { + metadata: entry.metadata, + size: entry.size, + }) + .then(() => { + stats.totalEntries++ + }) + }) + .catch((err) => { + if (err.code === 'ENOENT') { + stats.rejectedEntries++ + stats.missingContent++ + return + } + throw err + }) + }) + }, Promise.resolve()) + }) +} + +function cleanTmp (cache, opts) { + opts.log.silly('verify', 'cleaning tmp directory') + return rimraf(path.join(cache, 'tmp')) +} + +function writeVerifile (cache, opts) { + const verifile = path.join(cache, '_lastverified') + opts.log.silly('verify', 'writing verifile to ' + verifile) + try { + return writeFile(verifile, '' + +new Date()) + } finally { + fixOwner.chownr.sync(cache, verifile) + } +} + +module.exports.lastRun = lastRun + +function lastRun (cache) { + return readFile(path.join(cache, '_lastverified'), 'utf8').then( + (data) => new Date(+data) + ) +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/ls.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/ls.js new file mode 100644 index 00000000..6006c99e --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/ls.js @@ -0,0 +1,6 @@ +'use strict' + +const index = require('./lib/entry-index') + +module.exports = index.ls +module.exports.stream = index.lsStream diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/package.json new file mode 100644 index 00000000..c35f47da --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/package.json @@ -0,0 +1,112 @@ +{ + "_from": "cacache@^15.2.0", + "_id": "cacache@15.3.0", + "_inBundle": false, + "_integrity": "sha512-VVdYzXEn+cnbXpFgWs5hTT7OScegHVmLhJIR8Ufqk3iFD6A6j5iSX1KuBTfNEv4tdJWE2PzA6IVFtcLC7fN9wQ==", + "_location": "/cacache", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "cacache@^15.2.0", + "name": "cacache", + "escapedName": "cacache", + "rawSpec": "^15.2.0", + "saveSpec": null, + "fetchSpec": "^15.2.0" + }, + "_requiredBy": [ + "/make-fetch-happen" + ], + "_resolved": "https://registry.npmjs.org/cacache/-/cacache-15.3.0.tgz", + "_shasum": "dc85380fb2f556fe3dda4c719bfa0ec875a7f1eb", + "_spec": "cacache@^15.2.0", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\make-fetch-happen", + "bugs": { + "url": "https://github.com/npm/cacache/issues" + }, + "bundleDependencies": false, + "cache-version": { + "content": "2", + "index": "5" + }, + "dependencies": { + "@npmcli/fs": "^1.0.0", + "@npmcli/move-file": "^1.0.1", + "chownr": "^2.0.0", + "fs-minipass": "^2.0.0", + "glob": "^7.1.4", + "infer-owner": "^1.0.4", + "lru-cache": "^6.0.0", + "minipass": "^3.1.1", + "minipass-collect": "^1.0.2", + "minipass-flush": "^1.0.5", + "minipass-pipeline": "^1.2.2", + "mkdirp": "^1.0.3", + "p-map": "^4.0.0", + "promise-inflight": "^1.0.1", + "rimraf": "^3.0.2", + "ssri": "^8.0.1", + "tar": "^6.0.2", + "unique-filename": "^1.1.1" + }, + "deprecated": false, + "description": "Fast, fault-tolerant, cross-platform, disk-based, data-agnostic, content-addressable cache.", + "devDependencies": { + "@npmcli/lint": "^1.0.1", + "benchmark": "^2.1.4", + "chalk": "^4.0.0", + "require-inject": "^1.4.4", + "tacks": "^1.3.0", + "tap": "^15.0.9" + }, + "engines": { + "node": ">= 10" + }, + "files": [ + "*.js", + "lib" + ], + "homepage": "https://github.com/npm/cacache#readme", + "keywords": [ + "cache", + "caching", + "content-addressable", + "sri", + "sri hash", + "subresource integrity", + "cache", + "storage", + "store", + "file store", + "filesystem", + "disk cache", + "disk storage" + ], + "license": "ISC", + "main": "index.js", + "name": "cacache", + "repository": { + "type": "git", + "url": "git+https://github.com/npm/cacache.git" + }, + "scripts": { + "benchmarks": "node test/benchmarks", + "coverage": "tap", + "lint": "npm run npmclilint -- \"*.*js\" \"lib/**/*.*js\" \"test/**/*.*js\"", + "lintfix": "npm run lint -- --fix", + "npmclilint": "npmcli-lint", + "postsnap": "npm run lintfix --", + "postversion": "npm publish", + "prepublishOnly": "git push origin --follow-tags", + "preversion": "npm test", + "snap": "tap", + "test": "tap", + "test-docker": "docker run -it --rm --name pacotest -v \"$PWD\":/tmp -w /tmp node:latest npm test" + }, + "tap": { + "100": true, + "test-regex": "test/[^/]*.js" + }, + "version": "15.3.0" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/put.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/put.js new file mode 100644 index 00000000..84e9562b --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/put.js @@ -0,0 +1,83 @@ +'use strict' + +const index = require('./lib/entry-index') +const memo = require('./lib/memoization') +const write = require('./lib/content/write') +const Flush = require('minipass-flush') +const { PassThrough } = require('minipass-collect') +const Pipeline = require('minipass-pipeline') + +const putOpts = (opts) => ({ + algorithms: ['sha512'], + ...opts, +}) + +module.exports = putData + +function putData (cache, key, data, opts = {}) { + const { memoize } = opts + opts = putOpts(opts) + return write(cache, data, opts).then((res) => { + return index + .insert(cache, key, res.integrity, { ...opts, size: res.size }) + .then((entry) => { + if (memoize) + memo.put(cache, entry, data, opts) + + return res.integrity + }) + }) +} + +module.exports.stream = putStream + +function putStream (cache, key, opts = {}) { + const { memoize } = opts + opts = putOpts(opts) + let integrity + let size + + let memoData + const pipeline = new Pipeline() + // first item in the pipeline is the memoizer, because we need + // that to end first and get the collected data. + if (memoize) { + const memoizer = new PassThrough().on('collect', data => { + memoData = data + }) + pipeline.push(memoizer) + } + + // contentStream is a write-only, not a passthrough + // no data comes out of it. + const contentStream = write.stream(cache, opts) + .on('integrity', (int) => { + integrity = int + }) + .on('size', (s) => { + size = s + }) + + pipeline.push(contentStream) + + // last but not least, we write the index and emit hash and size, + // and memoize if we're doing that + pipeline.push(new Flush({ + flush () { + return index + .insert(cache, key, integrity, { ...opts, size }) + .then((entry) => { + if (memoize && memoData) + memo.put(cache, entry, memoData, opts) + + if (integrity) + pipeline.emit('integrity', integrity) + + if (size) + pipeline.emit('size', size) + }) + }, + })) + + return pipeline +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/rm.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/rm.js new file mode 100644 index 00000000..f2ef6b19 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/rm.js @@ -0,0 +1,31 @@ +'use strict' + +const util = require('util') + +const index = require('./lib/entry-index') +const memo = require('./lib/memoization') +const path = require('path') +const rimraf = util.promisify(require('rimraf')) +const rmContent = require('./lib/content/rm') + +module.exports = entry +module.exports.entry = entry + +function entry (cache, key, opts) { + memo.clearMemoized() + return index.delete(cache, key, opts) +} + +module.exports.content = content + +function content (cache, integrity) { + memo.clearMemoized() + return rmContent(cache, integrity) +} + +module.exports.all = all + +function all (cache) { + memo.clearMemoized() + return rimraf(path.join(cache, '*(content-*|index-*)')) +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/verify.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/verify.js new file mode 100644 index 00000000..db7763d7 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacache/verify.js @@ -0,0 +1,3 @@ +'use strict' + +module.exports = require('./lib/verify') diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/LICENSE b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/LICENSE new file mode 100644 index 00000000..f27ee9b4 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/LICENSE @@ -0,0 +1,21 @@ +MIT License + +Copyright (c) 2017 Luke Childs + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/README.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/README.md new file mode 100644 index 00000000..725e7e0d --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/README.md @@ -0,0 +1,206 @@ +# cacheable-request + +> Wrap native HTTP requests with RFC compliant cache support + +[![Build Status](https://travis-ci.org/lukechilds/cacheable-request.svg?branch=master)](https://travis-ci.org/lukechilds/cacheable-request) +[![Coverage Status](https://coveralls.io/repos/github/lukechilds/cacheable-request/badge.svg?branch=master)](https://coveralls.io/github/lukechilds/cacheable-request?branch=master) +[![npm](https://img.shields.io/npm/dm/cacheable-request.svg)](https://www.npmjs.com/package/cacheable-request) +[![npm](https://img.shields.io/npm/v/cacheable-request.svg)](https://www.npmjs.com/package/cacheable-request) + +[RFC 7234](http://httpwg.org/specs/rfc7234.html) compliant HTTP caching for native Node.js HTTP/HTTPS requests. Caching works out of the box in memory or is easily pluggable with a wide range of storage adapters. + +**Note:** This is a low level wrapper around the core HTTP modules, it's not a high level request library. + +## Features + +- Only stores cacheable responses as defined by RFC 7234 +- Fresh cache entries are served directly from cache +- Stale cache entries are revalidated with `If-None-Match`/`If-Modified-Since` headers +- 304 responses from revalidation requests use cached body +- Updates `Age` header on cached responses +- Can completely bypass cache on a per request basis +- In memory cache by default +- Official support for Redis, MongoDB, SQLite, PostgreSQL and MySQL storage adapters +- Easily plug in your own or third-party storage adapters +- If DB connection fails, cache is automatically bypassed ([disabled by default](#optsautomaticfailover)) +- Adds cache support to any existing HTTP code with minimal changes +- Uses [http-cache-semantics](https://github.com/pornel/http-cache-semantics) internally for HTTP RFC 7234 compliance + +## Install + +```shell +npm install cacheable-request +``` + +## Usage + +```js +const http = require('http'); +const CacheableRequest = require('cacheable-request'); + +// Then instead of +const req = http.request('http://example.com', cb); +req.end(); + +// You can do +const cacheableRequest = new CacheableRequest(http.request); +const cacheReq = cacheableRequest('http://example.com', cb); +cacheReq.on('request', req => req.end()); +// Future requests to 'example.com' will be returned from cache if still valid + +// You pass in any other http.request API compatible method to be wrapped with cache support: +const cacheableRequest = new CacheableRequest(https.request); +const cacheableRequest = new CacheableRequest(electron.net); +``` + +## Storage Adapters + +`cacheable-request` uses [Keyv](https://github.com/lukechilds/keyv) to support a wide range of storage adapters. + +For example, to use Redis as a cache backend, you just need to install the official Redis Keyv storage adapter: + +``` +npm install @keyv/redis +``` + +And then you can pass `CacheableRequest` your connection string: + +```js +const cacheableRequest = new CacheableRequest(http.request, 'redis://user:pass@localhost:6379'); +``` + +[View all official Keyv storage adapters.](https://github.com/lukechilds/keyv#official-storage-adapters) + +Keyv also supports anything that follows the Map API so it's easy to write your own storage adapter or use a third-party solution. + +e.g The following are all valid storage adapters + +```js +const storageAdapter = new Map(); +// or +const storageAdapter = require('./my-storage-adapter'); +// or +const QuickLRU = require('quick-lru'); +const storageAdapter = new QuickLRU({ maxSize: 1000 }); + +const cacheableRequest = new CacheableRequest(http.request, storageAdapter); +``` + +View the [Keyv docs](https://github.com/lukechilds/keyv) for more information on how to use storage adapters. + +## API + +### new cacheableRequest(request, [storageAdapter]) + +Returns the provided request function wrapped with cache support. + +#### request + +Type: `function` + +Request function to wrap with cache support. Should be [`http.request`](https://nodejs.org/api/http.html#http_http_request_options_callback) or a similar API compatible request function. + +#### storageAdapter + +Type: `Keyv storage adapter`
+Default: `new Map()` + +A [Keyv](https://github.com/lukechilds/keyv) storage adapter instance, or connection string if using with an official Keyv storage adapter. + +### Instance + +#### cacheableRequest(opts, [cb]) + +Returns an event emitter. + +##### opts + +Type: `object`, `string` + +- Any of the default request functions options. +- Any [`http-cache-semantics`](https://github.com/kornelski/http-cache-semantics#constructor-options) options. +- Any of the following: + +###### opts.cache + +Type: `boolean`
+Default: `true` + +If the cache should be used. Setting this to false will completely bypass the cache for the current request. + +###### opts.strictTtl + +Type: `boolean`
+Default: `false` + +If set to `true` once a cached resource has expired it is deleted and will have to be re-requested. + +If set to `false` (default), after a cached resource's TTL expires it is kept in the cache and will be revalidated on the next request with `If-None-Match`/`If-Modified-Since` headers. + +###### opts.maxTtl + +Type: `number`
+Default: `undefined` + +Limits TTL. The `number` represents milliseconds. + +###### opts.automaticFailover + +Type: `boolean`
+Default: `false` + +When set to `true`, if the DB connection fails we will automatically fallback to a network request. DB errors will still be emitted to notify you of the problem even though the request callback may succeed. + +###### opts.forceRefresh + +Type: `boolean`
+Default: `false` + +Forces refreshing the cache. If the response could be retrieved from the cache, it will perform a new request and override the cache instead. + +##### cb + +Type: `function` + +The callback function which will receive the response as an argument. + +The response can be either a [Node.js HTTP response stream](https://nodejs.org/api/http.html#http_class_http_incomingmessage) or a [responselike object](https://github.com/lukechilds/responselike). The response will also have a `fromCache` property set with a boolean value. + +##### .on('request', request) + +`request` event to get the request object of the request. + +**Note:** This event will only fire if an HTTP request is actually made, not when a response is retrieved from cache. However, you should always handle the `request` event to end the request and handle any potential request errors. + +##### .on('response', response) + +`response` event to get the response object from the HTTP request or cache. + +##### .on('error', error) + +`error` event emitted in case of an error with the cache. + +Errors emitted here will be an instance of `CacheableRequest.RequestError` or `CacheableRequest.CacheError`. You will only ever receive a `RequestError` if the request function throws (normally caused by invalid user input). Normal request errors should be handled inside the `request` event. + +To properly handle all error scenarios you should use the following pattern: + +```js +cacheableRequest('example.com', cb) + .on('error', err => { + if (err instanceof CacheableRequest.CacheError) { + handleCacheError(err); // Cache error + } else if (err instanceof CacheableRequest.RequestError) { + handleRequestError(err); // Request function thrown + } + }) + .on('request', req => { + req.on('error', handleRequestError); // Request error emitted + req.end(); + }); +``` + +**Note:** Database connection errors are emitted here, however `cacheable-request` will attempt to re-request the resource and bypass the cache on a connection error. Therefore a database connection error doesn't necessarily mean the request won't be fulfilled. + +## License + +MIT © Luke Childs diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/node_modules/get-stream/buffer-stream.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/node_modules/get-stream/buffer-stream.js new file mode 100644 index 00000000..2dd75745 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/node_modules/get-stream/buffer-stream.js @@ -0,0 +1,52 @@ +'use strict'; +const {PassThrough: PassThroughStream} = require('stream'); + +module.exports = options => { + options = {...options}; + + const {array} = options; + let {encoding} = options; + const isBuffer = encoding === 'buffer'; + let objectMode = false; + + if (array) { + objectMode = !(encoding || isBuffer); + } else { + encoding = encoding || 'utf8'; + } + + if (isBuffer) { + encoding = null; + } + + const stream = new PassThroughStream({objectMode}); + + if (encoding) { + stream.setEncoding(encoding); + } + + let length = 0; + const chunks = []; + + stream.on('data', chunk => { + chunks.push(chunk); + + if (objectMode) { + length = chunks.length; + } else { + length += chunk.length; + } + }); + + stream.getBufferedValue = () => { + if (array) { + return chunks; + } + + return isBuffer ? Buffer.concat(chunks, length) : chunks.join(''); + }; + + stream.getBufferedLength = () => length; + + return stream; +}; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/node_modules/get-stream/index.d.ts b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/node_modules/get-stream/index.d.ts new file mode 100644 index 00000000..7b98134d --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/node_modules/get-stream/index.d.ts @@ -0,0 +1,108 @@ +/// +import {Stream} from 'stream'; + +declare class MaxBufferErrorClass extends Error { + readonly name: 'MaxBufferError'; + constructor(); +} + +declare namespace getStream { + interface Options { + /** + Maximum length of the returned string. If it exceeds this value before the stream ends, the promise will be rejected with a `MaxBufferError` error. + + @default Infinity + */ + readonly maxBuffer?: number; + } + + interface OptionsWithEncoding extends Options { + /** + [Encoding](https://nodejs.org/api/buffer.html#buffer_buffer) of the incoming stream. + + @default 'utf8' + */ + readonly encoding?: EncodingType; + } + + type MaxBufferError = MaxBufferErrorClass; +} + +declare const getStream: { + /** + Get the `stream` as a string. + + @returns A promise that resolves when the end event fires on the stream, indicating that there is no more data to be read. The stream is switched to flowing mode. + + @example + ``` + import * as fs from 'fs'; + import getStream = require('get-stream'); + + (async () => { + const stream = fs.createReadStream('unicorn.txt'); + + console.log(await getStream(stream)); + // ,,))))))));, + // __)))))))))))))), + // \|/ -\(((((''''((((((((. + // -*-==//////(('' . `)))))), + // /|\ ))| o ;-. '((((( ,(, + // ( `| / ) ;))))' ,_))^;(~ + // | | | ,))((((_ _____------~~~-. %,;(;(>';'~ + // o_); ; )))(((` ~---~ `:: \ %%~~)(v;(`('~ + // ; ''''```` `: `:::|\,__,%% );`'; ~ + // | _ ) / `:|`----' `-' + // ______/\/~ | / / + // /~;;.____/;;' / ___--,-( `;;;/ + // / // _;______;'------~~~~~ /;;/\ / + // // | | / ; \;;,\ + // (<_ | ; /',/-----' _> + // \_| ||_ //~;~~~~~~~~~ + // `\_| (,~~ + // \~\ + // ~~ + })(); + ``` + */ + (stream: Stream, options?: getStream.OptionsWithEncoding): Promise; + + /** + Get the `stream` as a buffer. + + It honors the `maxBuffer` option as above, but it refers to byte length rather than string length. + */ + buffer( + stream: Stream, + options?: getStream.OptionsWithEncoding + ): Promise; + + /** + Get the `stream` as an array of values. + + It honors both the `maxBuffer` and `encoding` options. The behavior changes slightly based on the encoding chosen: + + - When `encoding` is unset, it assumes an [object mode stream](https://nodesource.com/blog/understanding-object-streams/) and collects values emitted from `stream` unmodified. In this case `maxBuffer` refers to the number of items in the array (not the sum of their sizes). + - When `encoding` is set to `buffer`, it collects an array of buffers. `maxBuffer` refers to the summed byte lengths of every buffer in the array. + - When `encoding` is set to anything else, it collects an array of strings. `maxBuffer` refers to the summed character lengths of every string in the array. + */ + array( + stream: Stream, + options?: getStream.Options + ): Promise; + array( + stream: Stream, + options: getStream.OptionsWithEncoding<'buffer'> + ): Promise; + array( + stream: Stream, + options: getStream.OptionsWithEncoding + ): Promise; + + MaxBufferError: typeof MaxBufferErrorClass; + + // TODO: Remove this for the next major release + default: typeof getStream; +}; + +export = getStream; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/node_modules/get-stream/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/node_modules/get-stream/index.js new file mode 100644 index 00000000..71f39919 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/node_modules/get-stream/index.js @@ -0,0 +1,60 @@ +'use strict'; +const {constants: BufferConstants} = require('buffer'); +const pump = require('pump'); +const bufferStream = require('./buffer-stream'); + +class MaxBufferError extends Error { + constructor() { + super('maxBuffer exceeded'); + this.name = 'MaxBufferError'; + } +} + +async function getStream(inputStream, options) { + if (!inputStream) { + return Promise.reject(new Error('Expected a stream')); + } + + options = { + maxBuffer: Infinity, + ...options + }; + + const {maxBuffer} = options; + + let stream; + await new Promise((resolve, reject) => { + const rejectPromise = error => { + // Don't retrieve an oversized buffer. + if (error && stream.getBufferedLength() <= BufferConstants.MAX_LENGTH) { + error.bufferedData = stream.getBufferedValue(); + } + + reject(error); + }; + + stream = pump(inputStream, bufferStream(options), error => { + if (error) { + rejectPromise(error); + return; + } + + resolve(); + }); + + stream.on('data', () => { + if (stream.getBufferedLength() > maxBuffer) { + rejectPromise(new MaxBufferError()); + } + }); + }); + + return stream.getBufferedValue(); +} + +module.exports = getStream; +// TODO: Remove this for the next major release +module.exports.default = getStream; +module.exports.buffer = (stream, options) => getStream(stream, {...options, encoding: 'buffer'}); +module.exports.array = (stream, options) => getStream(stream, {...options, array: true}); +module.exports.MaxBufferError = MaxBufferError; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/node_modules/get-stream/license b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/node_modules/get-stream/license new file mode 100644 index 00000000..fa7ceba3 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/node_modules/get-stream/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus (https://sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/node_modules/get-stream/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/node_modules/get-stream/package.json new file mode 100644 index 00000000..fbcf3d21 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/node_modules/get-stream/package.json @@ -0,0 +1,82 @@ +{ + "_from": "get-stream@^5.1.0", + "_id": "get-stream@5.2.0", + "_inBundle": false, + "_integrity": "sha512-nBF+F1rAZVCu/p7rjzgA+Yb4lfYXrpl7a6VmJrU8wF9I1CKvP/QwPNZHnOlwbTkY6dvtFIzFMSyQXbLoTQPRpA==", + "_location": "/cacheable-request/get-stream", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "get-stream@^5.1.0", + "name": "get-stream", + "escapedName": "get-stream", + "rawSpec": "^5.1.0", + "saveSpec": null, + "fetchSpec": "^5.1.0" + }, + "_requiredBy": [ + "/cacheable-request" + ], + "_resolved": "https://registry.npmjs.org/get-stream/-/get-stream-5.2.0.tgz", + "_shasum": "4966a1795ee5ace65e706c4b7beb71257d6e22d3", + "_spec": "get-stream@^5.1.0", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\cacheable-request", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "https://sindresorhus.com" + }, + "bugs": { + "url": "https://github.com/sindresorhus/get-stream/issues" + }, + "bundleDependencies": false, + "dependencies": { + "pump": "^3.0.0" + }, + "deprecated": false, + "description": "Get a stream as a string, buffer, or array", + "devDependencies": { + "@types/node": "^12.0.7", + "ava": "^2.0.0", + "into-stream": "^5.0.0", + "tsd": "^0.7.2", + "xo": "^0.24.0" + }, + "engines": { + "node": ">=8" + }, + "files": [ + "index.js", + "index.d.ts", + "buffer-stream.js" + ], + "funding": "https://github.com/sponsors/sindresorhus", + "homepage": "https://github.com/sindresorhus/get-stream#readme", + "keywords": [ + "get", + "stream", + "promise", + "concat", + "string", + "text", + "buffer", + "read", + "data", + "consume", + "readable", + "readablestream", + "array", + "object" + ], + "license": "MIT", + "name": "get-stream", + "repository": { + "type": "git", + "url": "git+https://github.com/sindresorhus/get-stream.git" + }, + "scripts": { + "test": "xo && ava && tsd" + }, + "version": "5.2.0" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/node_modules/get-stream/readme.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/node_modules/get-stream/readme.md new file mode 100644 index 00000000..7d7565dc --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/node_modules/get-stream/readme.md @@ -0,0 +1,124 @@ +# get-stream [![Build Status](https://travis-ci.com/sindresorhus/get-stream.svg?branch=master)](https://travis-ci.com/github/sindresorhus/get-stream) + +> Get a stream as a string, buffer, or array + +## Install + +``` +$ npm install get-stream +``` + +## Usage + +```js +const fs = require('fs'); +const getStream = require('get-stream'); + +(async () => { + const stream = fs.createReadStream('unicorn.txt'); + + console.log(await getStream(stream)); + /* + ,,))))))));, + __)))))))))))))), + \|/ -\(((((''''((((((((. + -*-==//////(('' . `)))))), + /|\ ))| o ;-. '((((( ,(, + ( `| / ) ;))))' ,_))^;(~ + | | | ,))((((_ _____------~~~-. %,;(;(>';'~ + o_); ; )))(((` ~---~ `:: \ %%~~)(v;(`('~ + ; ''''```` `: `:::|\,__,%% );`'; ~ + | _ ) / `:|`----' `-' + ______/\/~ | / / + /~;;.____/;;' / ___--,-( `;;;/ + / // _;______;'------~~~~~ /;;/\ / + // | | / ; \;;,\ + (<_ | ; /',/-----' _> + \_| ||_ //~;~~~~~~~~~ + `\_| (,~~ + \~\ + ~~ + */ +})(); +``` + +## API + +The methods returns a promise that resolves when the `end` event fires on the stream, indicating that there is no more data to be read. The stream is switched to flowing mode. + +### getStream(stream, options?) + +Get the `stream` as a string. + +#### options + +Type: `object` + +##### encoding + +Type: `string`\ +Default: `'utf8'` + +[Encoding](https://nodejs.org/api/buffer.html#buffer_buffer) of the incoming stream. + +##### maxBuffer + +Type: `number`\ +Default: `Infinity` + +Maximum length of the returned string. If it exceeds this value before the stream ends, the promise will be rejected with a `getStream.MaxBufferError` error. + +### getStream.buffer(stream, options?) + +Get the `stream` as a buffer. + +It honors the `maxBuffer` option as above, but it refers to byte length rather than string length. + +### getStream.array(stream, options?) + +Get the `stream` as an array of values. + +It honors both the `maxBuffer` and `encoding` options. The behavior changes slightly based on the encoding chosen: + +- When `encoding` is unset, it assumes an [object mode stream](https://nodesource.com/blog/understanding-object-streams/) and collects values emitted from `stream` unmodified. In this case `maxBuffer` refers to the number of items in the array (not the sum of their sizes). + +- When `encoding` is set to `buffer`, it collects an array of buffers. `maxBuffer` refers to the summed byte lengths of every buffer in the array. + +- When `encoding` is set to anything else, it collects an array of strings. `maxBuffer` refers to the summed character lengths of every string in the array. + +## Errors + +If the input stream emits an `error` event, the promise will be rejected with the error. The buffered data will be attached to the `bufferedData` property of the error. + +```js +(async () => { + try { + await getStream(streamThatErrorsAtTheEnd('unicorn')); + } catch (error) { + console.log(error.bufferedData); + //=> 'unicorn' + } +})() +``` + +## FAQ + +### How is this different from [`concat-stream`](https://github.com/maxogden/concat-stream)? + +This module accepts a stream instead of being one and returns a promise instead of using a callback. The API is simpler and it only supports returning a string, buffer, or array. It doesn't have a fragile type inference. You explicitly choose what you want. And it doesn't depend on the huge `readable-stream` package. + +## Related + +- [get-stdin](https://github.com/sindresorhus/get-stdin) - Get stdin as a string or buffer + +--- + +
+ + Get professional support for this package with a Tidelift subscription + +
+ + Tidelift helps make open source sustainable for maintainers while giving companies
assurances about security, maintenance, and licensing for their dependencies. + +
diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/node_modules/lowercase-keys/index.d.ts b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/node_modules/lowercase-keys/index.d.ts new file mode 100644 index 00000000..dc90a751 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/node_modules/lowercase-keys/index.d.ts @@ -0,0 +1,16 @@ +/** +Lowercase the keys of an object. + +@returns A new object with the keys lowercased. + +@example +``` +import lowercaseKeys = require('lowercase-keys'); + +lowercaseKeys({FOO: true, bAr: false}); +//=> {foo: true, bar: false} +``` +*/ +declare function lowercaseKeys(object: {[key: string]: T}): {[key: string]: T}; + +export = lowercaseKeys; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/node_modules/lowercase-keys/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/node_modules/lowercase-keys/index.js new file mode 100644 index 00000000..357fb8f4 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/node_modules/lowercase-keys/index.js @@ -0,0 +1,10 @@ +'use strict'; +module.exports = object => { + const result = {}; + + for (const [key, value] of Object.entries(object)) { + result[key.toLowerCase()] = value; + } + + return result; +}; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/node_modules/lowercase-keys/license b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/node_modules/lowercase-keys/license new file mode 100644 index 00000000..e7af2f77 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/node_modules/lowercase-keys/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/node_modules/lowercase-keys/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/node_modules/lowercase-keys/package.json new file mode 100644 index 00000000..622cfa21 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/node_modules/lowercase-keys/package.json @@ -0,0 +1,70 @@ +{ + "_from": "lowercase-keys@^2.0.0", + "_id": "lowercase-keys@2.0.0", + "_inBundle": false, + "_integrity": "sha512-tqNXrS78oMOE73NMxK4EMLQsQowWf8jKooH9g7xPavRT706R6bkQJ6DY2Te7QukaZsulxa30wQ7bk0pm4XiHmA==", + "_location": "/cacheable-request/lowercase-keys", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "lowercase-keys@^2.0.0", + "name": "lowercase-keys", + "escapedName": "lowercase-keys", + "rawSpec": "^2.0.0", + "saveSpec": null, + "fetchSpec": "^2.0.0" + }, + "_requiredBy": [ + "/cacheable-request" + ], + "_resolved": "https://registry.npmjs.org/lowercase-keys/-/lowercase-keys-2.0.0.tgz", + "_shasum": "2603e78b7b4b0006cbca2fbcc8a3202558ac9479", + "_spec": "lowercase-keys@^2.0.0", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\cacheable-request", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "sindresorhus.com" + }, + "bugs": { + "url": "https://github.com/sindresorhus/lowercase-keys/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Lowercase the keys of an object", + "devDependencies": { + "ava": "^1.4.1", + "tsd": "^0.7.2", + "xo": "^0.24.0" + }, + "engines": { + "node": ">=8" + }, + "files": [ + "index.js", + "index.d.ts" + ], + "homepage": "https://github.com/sindresorhus/lowercase-keys#readme", + "keywords": [ + "object", + "assign", + "extend", + "properties", + "lowercase", + "lower-case", + "case", + "keys", + "key" + ], + "license": "MIT", + "name": "lowercase-keys", + "repository": { + "type": "git", + "url": "git+https://github.com/sindresorhus/lowercase-keys.git" + }, + "scripts": { + "test": "xo && ava && tsd" + }, + "version": "2.0.0" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/node_modules/lowercase-keys/readme.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/node_modules/lowercase-keys/readme.md new file mode 100644 index 00000000..b1ed0610 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/node_modules/lowercase-keys/readme.md @@ -0,0 +1,32 @@ +# lowercase-keys [![Build Status](https://travis-ci.org/sindresorhus/lowercase-keys.svg?branch=master)](https://travis-ci.org/sindresorhus/lowercase-keys) + +> Lowercase the keys of an object + + +## Install + +``` +$ npm install lowercase-keys +``` + + +## Usage + +```js +const lowercaseKeys = require('lowercase-keys'); + +lowercaseKeys({FOO: true, bAr: false}); +//=> {foo: true, bar: false} +``` + + +## API + +### lowercaseKeys(object) + +Returns a new object with the keys lowercased. + + +## License + +MIT © [Sindre Sorhus](https://sindresorhus.com) diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/package.json new file mode 100644 index 00000000..36532ec2 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/package.json @@ -0,0 +1,94 @@ +{ + "_from": "cacheable-request@^6.0.0", + "_id": "cacheable-request@6.1.0", + "_inBundle": false, + "_integrity": "sha512-Oj3cAGPCqOZX7Rz64Uny2GYAZNliQSqfbePrgAQ1wKAihYmCUnraBtJtKcGR4xz7wF+LoJC+ssFZvv5BgF9Igg==", + "_location": "/cacheable-request", + "_phantomChildren": { + "pump": "3.0.0" + }, + "_requested": { + "type": "range", + "registry": true, + "raw": "cacheable-request@^6.0.0", + "name": "cacheable-request", + "escapedName": "cacheable-request", + "rawSpec": "^6.0.0", + "saveSpec": null, + "fetchSpec": "^6.0.0" + }, + "_requiredBy": [ + "/got" + ], + "_resolved": "https://registry.npmjs.org/cacheable-request/-/cacheable-request-6.1.0.tgz", + "_shasum": "20ffb8bd162ba4be11e9567d823db651052ca912", + "_spec": "cacheable-request@^6.0.0", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\got", + "author": { + "name": "Luke Childs", + "email": "lukechilds123@gmail.com", + "url": "http://lukechilds.co.uk" + }, + "bugs": { + "url": "https://github.com/lukechilds/cacheable-request/issues" + }, + "bundleDependencies": false, + "dependencies": { + "clone-response": "^1.0.2", + "get-stream": "^5.1.0", + "http-cache-semantics": "^4.0.0", + "keyv": "^3.0.0", + "lowercase-keys": "^2.0.0", + "normalize-url": "^4.1.0", + "responselike": "^1.0.2" + }, + "deprecated": false, + "description": "Wrap native HTTP requests with RFC compliant cache support", + "devDependencies": { + "@keyv/sqlite": "^2.0.0", + "ava": "^1.1.0", + "coveralls": "^3.0.0", + "create-test-server": "3.0.0", + "delay": "^4.0.0", + "eslint-config-xo-lukechilds": "^1.0.0", + "nyc": "^14.1.1", + "pify": "^4.0.0", + "sqlite3": "^4.0.2", + "this": "^1.0.2", + "xo": "^0.23.0" + }, + "engines": { + "node": ">=8" + }, + "files": [ + "src" + ], + "homepage": "https://github.com/lukechilds/cacheable-request#readme", + "keywords": [ + "HTTP", + "HTTPS", + "cache", + "caching", + "layer", + "cacheable", + "RFC 7234", + "RFC", + "7234", + "compliant" + ], + "license": "MIT", + "main": "src/index.js", + "name": "cacheable-request", + "repository": { + "type": "git", + "url": "git+https://github.com/lukechilds/cacheable-request.git" + }, + "scripts": { + "coverage": "nyc report --reporter=text-lcov | coveralls", + "test": "xo && nyc ava" + }, + "version": "6.1.0", + "xo": { + "extends": "xo-lukechilds" + } +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/src/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/src/index.js new file mode 100644 index 00000000..3fcea3f9 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/cacheable-request/src/index.js @@ -0,0 +1,251 @@ +'use strict'; + +const EventEmitter = require('events'); +const urlLib = require('url'); +const normalizeUrl = require('normalize-url'); +const getStream = require('get-stream'); +const CachePolicy = require('http-cache-semantics'); +const Response = require('responselike'); +const lowercaseKeys = require('lowercase-keys'); +const cloneResponse = require('clone-response'); +const Keyv = require('keyv'); + +class CacheableRequest { + constructor(request, cacheAdapter) { + if (typeof request !== 'function') { + throw new TypeError('Parameter `request` must be a function'); + } + + this.cache = new Keyv({ + uri: typeof cacheAdapter === 'string' && cacheAdapter, + store: typeof cacheAdapter !== 'string' && cacheAdapter, + namespace: 'cacheable-request' + }); + + return this.createCacheableRequest(request); + } + + createCacheableRequest(request) { + return (opts, cb) => { + let url; + if (typeof opts === 'string') { + url = normalizeUrlObject(urlLib.parse(opts)); + opts = {}; + } else if (opts instanceof urlLib.URL) { + url = normalizeUrlObject(urlLib.parse(opts.toString())); + opts = {}; + } else { + const [pathname, ...searchParts] = (opts.path || '').split('?'); + const search = searchParts.length > 0 ? + `?${searchParts.join('?')}` : + ''; + url = normalizeUrlObject({ ...opts, pathname, search }); + } + + opts = { + headers: {}, + method: 'GET', + cache: true, + strictTtl: false, + automaticFailover: false, + ...opts, + ...urlObjectToRequestOptions(url) + }; + opts.headers = lowercaseKeys(opts.headers); + + const ee = new EventEmitter(); + const normalizedUrlString = normalizeUrl( + urlLib.format(url), + { + stripWWW: false, + removeTrailingSlash: false, + stripAuthentication: false + } + ); + const key = `${opts.method}:${normalizedUrlString}`; + let revalidate = false; + let madeRequest = false; + + const makeRequest = opts => { + madeRequest = true; + let requestErrored = false; + let requestErrorCallback; + + const requestErrorPromise = new Promise(resolve => { + requestErrorCallback = () => { + if (!requestErrored) { + requestErrored = true; + resolve(); + } + }; + }); + + const handler = response => { + if (revalidate && !opts.forceRefresh) { + response.status = response.statusCode; + const revalidatedPolicy = CachePolicy.fromObject(revalidate.cachePolicy).revalidatedPolicy(opts, response); + if (!revalidatedPolicy.modified) { + const headers = revalidatedPolicy.policy.responseHeaders(); + response = new Response(revalidate.statusCode, headers, revalidate.body, revalidate.url); + response.cachePolicy = revalidatedPolicy.policy; + response.fromCache = true; + } + } + + if (!response.fromCache) { + response.cachePolicy = new CachePolicy(opts, response, opts); + response.fromCache = false; + } + + let clonedResponse; + if (opts.cache && response.cachePolicy.storable()) { + clonedResponse = cloneResponse(response); + + (async () => { + try { + const bodyPromise = getStream.buffer(response); + + await Promise.race([ + requestErrorPromise, + new Promise(resolve => response.once('end', resolve)) + ]); + + if (requestErrored) { + return; + } + + const body = await bodyPromise; + + const value = { + cachePolicy: response.cachePolicy.toObject(), + url: response.url, + statusCode: response.fromCache ? revalidate.statusCode : response.statusCode, + body + }; + + let ttl = opts.strictTtl ? response.cachePolicy.timeToLive() : undefined; + if (opts.maxTtl) { + ttl = ttl ? Math.min(ttl, opts.maxTtl) : opts.maxTtl; + } + + await this.cache.set(key, value, ttl); + } catch (error) { + ee.emit('error', new CacheableRequest.CacheError(error)); + } + })(); + } else if (opts.cache && revalidate) { + (async () => { + try { + await this.cache.delete(key); + } catch (error) { + ee.emit('error', new CacheableRequest.CacheError(error)); + } + })(); + } + + ee.emit('response', clonedResponse || response); + if (typeof cb === 'function') { + cb(clonedResponse || response); + } + }; + + try { + const req = request(opts, handler); + req.once('error', requestErrorCallback); + req.once('abort', requestErrorCallback); + ee.emit('request', req); + } catch (error) { + ee.emit('error', new CacheableRequest.RequestError(error)); + } + }; + + (async () => { + const get = async opts => { + await Promise.resolve(); + + const cacheEntry = opts.cache ? await this.cache.get(key) : undefined; + if (typeof cacheEntry === 'undefined') { + return makeRequest(opts); + } + + const policy = CachePolicy.fromObject(cacheEntry.cachePolicy); + if (policy.satisfiesWithoutRevalidation(opts) && !opts.forceRefresh) { + const headers = policy.responseHeaders(); + const response = new Response(cacheEntry.statusCode, headers, cacheEntry.body, cacheEntry.url); + response.cachePolicy = policy; + response.fromCache = true; + + ee.emit('response', response); + if (typeof cb === 'function') { + cb(response); + } + } else { + revalidate = cacheEntry; + opts.headers = policy.revalidationHeaders(opts); + makeRequest(opts); + } + }; + + const errorHandler = error => ee.emit('error', new CacheableRequest.CacheError(error)); + this.cache.once('error', errorHandler); + ee.on('response', () => this.cache.removeListener('error', errorHandler)); + + try { + await get(opts); + } catch (error) { + if (opts.automaticFailover && !madeRequest) { + makeRequest(opts); + } + + ee.emit('error', new CacheableRequest.CacheError(error)); + } + })(); + + return ee; + }; + } +} + +function urlObjectToRequestOptions(url) { + const options = { ...url }; + options.path = `${url.pathname || '/'}${url.search || ''}`; + delete options.pathname; + delete options.search; + return options; +} + +function normalizeUrlObject(url) { + // If url was parsed by url.parse or new URL: + // - hostname will be set + // - host will be hostname[:port] + // - port will be set if it was explicit in the parsed string + // Otherwise, url was from request options: + // - hostname or host may be set + // - host shall not have port encoded + return { + protocol: url.protocol, + auth: url.auth, + hostname: url.hostname || url.host || 'localhost', + port: url.port, + pathname: url.pathname, + search: url.search + }; +} + +CacheableRequest.RequestError = class extends Error { + constructor(error) { + super(error.message); + this.name = 'RequestError'; + Object.assign(this, error); + } +}; + +CacheableRequest.CacheError = class extends Error { + constructor(error) { + super(error.message); + this.name = 'CacheError'; + Object.assign(this, error); + } +}; + +module.exports = CacheableRequest; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/call-bind/.eslintignore b/25_03_11/frontend_vizsgafeladat/backend/node_modules/call-bind/.eslintignore new file mode 100644 index 00000000..404abb22 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/call-bind/.eslintignore @@ -0,0 +1 @@ +coverage/ diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/call-bind/.eslintrc b/25_03_11/frontend_vizsgafeladat/backend/node_modules/call-bind/.eslintrc new file mode 100644 index 00000000..e5d3c9a9 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/call-bind/.eslintrc @@ -0,0 +1,17 @@ +{ + "root": true, + + "extends": "@ljharb", + + "rules": { + "func-name-matching": 0, + "id-length": 0, + "new-cap": [2, { + "capIsNewExceptions": [ + "GetIntrinsic", + ], + }], + "no-magic-numbers": 0, + "operator-linebreak": [2, "before"], + }, +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/call-bind/.github/FUNDING.yml b/25_03_11/frontend_vizsgafeladat/backend/node_modules/call-bind/.github/FUNDING.yml new file mode 100644 index 00000000..c70c2ecd --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/call-bind/.github/FUNDING.yml @@ -0,0 +1,12 @@ +# These are supported funding model platforms + +github: [ljharb] +patreon: # Replace with a single Patreon username +open_collective: # Replace with a single Open Collective username +ko_fi: # Replace with a single Ko-fi username +tidelift: npm/call-bind +community_bridge: # Replace with a single Community Bridge project-name e.g., cloud-foundry +liberapay: # Replace with a single Liberapay username +issuehunt: # Replace with a single IssueHunt username +otechie: # Replace with a single Otechie username +custom: # Replace with up to 4 custom sponsorship URLs e.g., ['link1', 'link2'] diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/call-bind/.nycrc b/25_03_11/frontend_vizsgafeladat/backend/node_modules/call-bind/.nycrc new file mode 100644 index 00000000..1826526e --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/call-bind/.nycrc @@ -0,0 +1,13 @@ +{ + "all": true, + "check-coverage": false, + "reporter": ["text-summary", "text", "html", "json"], + "lines": 86, + "statements": 85.93, + "functions": 82.43, + "branches": 76.06, + "exclude": [ + "coverage", + "test" + ] +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/call-bind/CHANGELOG.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/call-bind/CHANGELOG.md new file mode 100644 index 00000000..62a37279 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/call-bind/CHANGELOG.md @@ -0,0 +1,42 @@ +# Changelog + +All notable changes to this project will be documented in this file. + +The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/) +and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html). + +## [v1.0.2](https://github.com/ljharb/call-bind/compare/v1.0.1...v1.0.2) - 2021-01-11 + +### Commits + +- [Fix] properly include the receiver in the bound length [`dbae7bc`](https://github.com/ljharb/call-bind/commit/dbae7bc676c079a0d33c0a43e9ef92cb7b01345d) + +## [v1.0.1](https://github.com/ljharb/call-bind/compare/v1.0.0...v1.0.1) - 2021-01-08 + +### Commits + +- [Tests] migrate tests to Github Actions [`b6db284`](https://github.com/ljharb/call-bind/commit/b6db284c36f8ccd195b88a6764fe84b7223a0da1) +- [meta] do not publish github action workflow files [`ec7fe46`](https://github.com/ljharb/call-bind/commit/ec7fe46e60cfa4764ee943d2755f5e5a366e578e) +- [Fix] preserve original function’s length when possible [`adbceaa`](https://github.com/ljharb/call-bind/commit/adbceaa3cac4b41ea78bb19d7ccdbaaf7e0bdadb) +- [Tests] gather coverage data on every job [`d69e23c`](https://github.com/ljharb/call-bind/commit/d69e23cc65f101ba1d4c19bb07fa8eb0ec624be8) +- [Dev Deps] update `eslint`, `@ljharb/eslint-config`, `aud`, `tape` [`2fd3586`](https://github.com/ljharb/call-bind/commit/2fd3586c5d47b335364c14293114c6b625ae1f71) +- [Deps] update `get-intrinsic` [`f23e931`](https://github.com/ljharb/call-bind/commit/f23e9318cc271c2add8bb38cfded85ee7baf8eee) +- [Deps] update `get-intrinsic` [`72d9f44`](https://github.com/ljharb/call-bind/commit/72d9f44e184465ba8dd3fb48260bbcff234985f2) +- [meta] fix FUNDING.yml [`e723573`](https://github.com/ljharb/call-bind/commit/e723573438c5a68dcec31fb5d96ea6b7e4a93be8) +- [eslint] ignore coverage output [`15e76d2`](https://github.com/ljharb/call-bind/commit/15e76d28a5f43e504696401e5b31ebb78ee1b532) +- [meta] add Automatic Rebase and Require Allow Edits workflows [`8fa4dab`](https://github.com/ljharb/call-bind/commit/8fa4dabb23ba3dd7bb92c9571c1241c08b56e4b6) + +## v1.0.0 - 2020-10-30 + +### Commits + +- Initial commit [`306cf98`](https://github.com/ljharb/call-bind/commit/306cf98c7ec9e7ef66b653ec152277ac1381eb50) +- Tests [`e10d0bb`](https://github.com/ljharb/call-bind/commit/e10d0bbdadc7a10ecedc9a1c035112d3e368b8df) +- Implementation [`43852ed`](https://github.com/ljharb/call-bind/commit/43852eda0f187327b7fad2423ca972149a52bd65) +- npm init [`408f860`](https://github.com/ljharb/call-bind/commit/408f860b773a2f610805fd3613d0d71bac1b6249) +- [meta] add Automatic Rebase and Require Allow Edits workflows [`fb349b2`](https://github.com/ljharb/call-bind/commit/fb349b2e48defbec8b5ec8a8395cc8f69f220b13) +- [meta] add `auto-changelog` [`c4001fc`](https://github.com/ljharb/call-bind/commit/c4001fc43031799ef908211c98d3b0fb2b60fde4) +- [meta] add "funding"; create `FUNDING.yml` [`d4d6d29`](https://github.com/ljharb/call-bind/commit/d4d6d2974a14bc2e98830468eda7fe6d6a776717) +- [Tests] add `npm run lint` [`dedfb98`](https://github.com/ljharb/call-bind/commit/dedfb98bd0ecefb08ddb9a94061bd10cde4332af) +- Only apps should have lockfiles [`54ac776`](https://github.com/ljharb/call-bind/commit/54ac77653db45a7361dc153d2f478e743f110650) +- [meta] add `safe-publish-latest` [`9ea8e43`](https://github.com/ljharb/call-bind/commit/9ea8e435b950ce9b705559cd651039f9bf40140f) diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/call-bind/LICENSE b/25_03_11/frontend_vizsgafeladat/backend/node_modules/call-bind/LICENSE new file mode 100644 index 00000000..48f05d01 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/call-bind/LICENSE @@ -0,0 +1,21 @@ +MIT License + +Copyright (c) 2020 Jordan Harband + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/call-bind/README.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/call-bind/README.md new file mode 100644 index 00000000..53649eb4 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/call-bind/README.md @@ -0,0 +1,2 @@ +# call-bind +Robustly `.call.bind()` a function. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/call-bind/callBound.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/call-bind/callBound.js new file mode 100644 index 00000000..8374adfd --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/call-bind/callBound.js @@ -0,0 +1,15 @@ +'use strict'; + +var GetIntrinsic = require('get-intrinsic'); + +var callBind = require('./'); + +var $indexOf = callBind(GetIntrinsic('String.prototype.indexOf')); + +module.exports = function callBoundIntrinsic(name, allowMissing) { + var intrinsic = GetIntrinsic(name, !!allowMissing); + if (typeof intrinsic === 'function' && $indexOf(name, '.prototype.') > -1) { + return callBind(intrinsic); + } + return intrinsic; +}; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/call-bind/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/call-bind/index.js new file mode 100644 index 00000000..6fa3e4af --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/call-bind/index.js @@ -0,0 +1,47 @@ +'use strict'; + +var bind = require('function-bind'); +var GetIntrinsic = require('get-intrinsic'); + +var $apply = GetIntrinsic('%Function.prototype.apply%'); +var $call = GetIntrinsic('%Function.prototype.call%'); +var $reflectApply = GetIntrinsic('%Reflect.apply%', true) || bind.call($call, $apply); + +var $gOPD = GetIntrinsic('%Object.getOwnPropertyDescriptor%', true); +var $defineProperty = GetIntrinsic('%Object.defineProperty%', true); +var $max = GetIntrinsic('%Math.max%'); + +if ($defineProperty) { + try { + $defineProperty({}, 'a', { value: 1 }); + } catch (e) { + // IE 8 has a broken defineProperty + $defineProperty = null; + } +} + +module.exports = function callBind(originalFunction) { + var func = $reflectApply(bind, $call, arguments); + if ($gOPD && $defineProperty) { + var desc = $gOPD(func, 'length'); + if (desc.configurable) { + // original length, plus the receiver, minus any additional arguments (after the receiver) + $defineProperty( + func, + 'length', + { value: 1 + $max(0, originalFunction.length - (arguments.length - 1)) } + ); + } + } + return func; +}; + +var applyBind = function applyBind() { + return $reflectApply(bind, $apply, arguments); +}; + +if ($defineProperty) { + $defineProperty(module.exports, 'apply', { value: applyBind }); +} else { + module.exports.apply = applyBind; +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/call-bind/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/call-bind/package.json new file mode 100644 index 00000000..fa95a824 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/call-bind/package.json @@ -0,0 +1,108 @@ +{ + "_from": "call-bind@^1.0.0", + "_id": "call-bind@1.0.2", + "_inBundle": false, + "_integrity": "sha512-7O+FbCihrB5WGbFYesctwmTKae6rOiIzmz1icreWJ+0aA7LJfuqhEso2T9ncpcFtzMQtzXf2QGGueWJGTYsqrA==", + "_location": "/call-bind", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "call-bind@^1.0.0", + "name": "call-bind", + "escapedName": "call-bind", + "rawSpec": "^1.0.0", + "saveSpec": null, + "fetchSpec": "^1.0.0" + }, + "_requiredBy": [ + "/side-channel" + ], + "_resolved": "https://registry.npmjs.org/call-bind/-/call-bind-1.0.2.tgz", + "_shasum": "b1d4e89e688119c3c9a903ad30abb2f6a919be3c", + "_spec": "call-bind@^1.0.0", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\side-channel", + "author": { + "name": "Jordan Harband", + "email": "ljharb@gmail.com" + }, + "auto-changelog": { + "output": "CHANGELOG.md", + "template": "keepachangelog", + "unreleased": false, + "commitLimit": false, + "backfillLimit": false, + "hideCredit": true + }, + "bugs": { + "url": "https://github.com/ljharb/call-bind/issues" + }, + "bundleDependencies": false, + "dependencies": { + "function-bind": "^1.1.1", + "get-intrinsic": "^1.0.2" + }, + "deprecated": false, + "description": "Robustly `.call.bind()` a function", + "devDependencies": { + "@ljharb/eslint-config": "^17.3.0", + "aud": "^1.1.3", + "auto-changelog": "^2.2.1", + "eslint": "^7.17.0", + "nyc": "^10.3.2", + "safe-publish-latest": "^1.1.4", + "tape": "^5.1.1" + }, + "exports": { + ".": [ + { + "default": "./index.js" + }, + "./index.js" + ], + "./callBound": [ + { + "default": "./callBound.js" + }, + "./callBound.js" + ], + "./package.json": "./package.json" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + }, + "homepage": "https://github.com/ljharb/call-bind#readme", + "keywords": [ + "javascript", + "ecmascript", + "es", + "js", + "callbind", + "callbound", + "call", + "bind", + "bound", + "call-bind", + "call-bound", + "function", + "es-abstract" + ], + "license": "MIT", + "main": "index.js", + "name": "call-bind", + "repository": { + "type": "git", + "url": "git+https://github.com/ljharb/call-bind.git" + }, + "scripts": { + "lint": "eslint --ext=.js,.mjs .", + "posttest": "aud --production", + "postversion": "auto-changelog && git add CHANGELOG.md && git commit --no-edit --amend && git tag -f \"v$(node -e \"console.log(require('./package.json').version)\")\"", + "prepublish": "safe-publish-latest", + "pretest": "npm run lint", + "test": "npm run tests-only", + "tests-only": "nyc tape 'test/*'", + "version": "auto-changelog && git add CHANGELOG.md" + }, + "version": "1.0.2" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/call-bind/test/callBound.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/call-bind/test/callBound.js new file mode 100644 index 00000000..209ce3cc --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/call-bind/test/callBound.js @@ -0,0 +1,55 @@ +'use strict'; + +var test = require('tape'); + +var callBound = require('../callBound'); + +test('callBound', function (t) { + // static primitive + t.equal(callBound('Array.length'), Array.length, 'Array.length yields itself'); + t.equal(callBound('%Array.length%'), Array.length, '%Array.length% yields itself'); + + // static non-function object + t.equal(callBound('Array.prototype'), Array.prototype, 'Array.prototype yields itself'); + t.equal(callBound('%Array.prototype%'), Array.prototype, '%Array.prototype% yields itself'); + t.equal(callBound('Array.constructor'), Array.constructor, 'Array.constructor yields itself'); + t.equal(callBound('%Array.constructor%'), Array.constructor, '%Array.constructor% yields itself'); + + // static function + t.equal(callBound('Date.parse'), Date.parse, 'Date.parse yields itself'); + t.equal(callBound('%Date.parse%'), Date.parse, '%Date.parse% yields itself'); + + // prototype primitive + t.equal(callBound('Error.prototype.message'), Error.prototype.message, 'Error.prototype.message yields itself'); + t.equal(callBound('%Error.prototype.message%'), Error.prototype.message, '%Error.prototype.message% yields itself'); + + // prototype function + t.notEqual(callBound('Object.prototype.toString'), Object.prototype.toString, 'Object.prototype.toString does not yield itself'); + t.notEqual(callBound('%Object.prototype.toString%'), Object.prototype.toString, '%Object.prototype.toString% does not yield itself'); + t.equal(callBound('Object.prototype.toString')(true), Object.prototype.toString.call(true), 'call-bound Object.prototype.toString calls into the original'); + t.equal(callBound('%Object.prototype.toString%')(true), Object.prototype.toString.call(true), 'call-bound %Object.prototype.toString% calls into the original'); + + t['throws']( + function () { callBound('does not exist'); }, + SyntaxError, + 'nonexistent intrinsic throws' + ); + t['throws']( + function () { callBound('does not exist', true); }, + SyntaxError, + 'allowMissing arg still throws for unknown intrinsic' + ); + + /* globals WeakRef: false */ + t.test('real but absent intrinsic', { skip: typeof WeakRef !== 'undefined' }, function (st) { + st['throws']( + function () { callBound('WeakRef'); }, + TypeError, + 'real but absent intrinsic throws' + ); + st.equal(callBound('WeakRef', true), undefined, 'allowMissing arg avoids exception'); + st.end(); + }); + + t.end(); +}); diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/call-bind/test/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/call-bind/test/index.js new file mode 100644 index 00000000..bf6769c7 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/call-bind/test/index.js @@ -0,0 +1,66 @@ +'use strict'; + +var callBind = require('../'); +var bind = require('function-bind'); + +var test = require('tape'); + +/* + * older engines have length nonconfigurable + * in io.js v3, it is configurable except on bound functions, hence the .bind() + */ +var functionsHaveConfigurableLengths = !!( + Object.getOwnPropertyDescriptor + && Object.getOwnPropertyDescriptor(bind.call(function () {}), 'length').configurable +); + +test('callBind', function (t) { + var sentinel = { sentinel: true }; + var func = function (a, b) { + // eslint-disable-next-line no-invalid-this + return [this, a, b]; + }; + t.equal(func.length, 2, 'original function length is 2'); + t.deepEqual(func(), [undefined, undefined, undefined], 'unbound func with too few args'); + t.deepEqual(func(1, 2), [undefined, 1, 2], 'unbound func with right args'); + t.deepEqual(func(1, 2, 3), [undefined, 1, 2], 'unbound func with too many args'); + + var bound = callBind(func); + t.equal(bound.length, func.length + 1, 'function length is preserved', { skip: !functionsHaveConfigurableLengths }); + t.deepEqual(bound(), [undefined, undefined, undefined], 'bound func with too few args'); + t.deepEqual(bound(1, 2), [1, 2, undefined], 'bound func with right args'); + t.deepEqual(bound(1, 2, 3), [1, 2, 3], 'bound func with too many args'); + + var boundR = callBind(func, sentinel); + t.equal(boundR.length, func.length, 'function length is preserved', { skip: !functionsHaveConfigurableLengths }); + t.deepEqual(boundR(), [sentinel, undefined, undefined], 'bound func with receiver, with too few args'); + t.deepEqual(boundR(1, 2), [sentinel, 1, 2], 'bound func with receiver, with right args'); + t.deepEqual(boundR(1, 2, 3), [sentinel, 1, 2], 'bound func with receiver, with too many args'); + + var boundArg = callBind(func, sentinel, 1); + t.equal(boundArg.length, func.length - 1, 'function length is preserved', { skip: !functionsHaveConfigurableLengths }); + t.deepEqual(boundArg(), [sentinel, 1, undefined], 'bound func with receiver and arg, with too few args'); + t.deepEqual(boundArg(2), [sentinel, 1, 2], 'bound func with receiver and arg, with right arg'); + t.deepEqual(boundArg(2, 3), [sentinel, 1, 2], 'bound func with receiver and arg, with too many args'); + + t.test('callBind.apply', function (st) { + var aBound = callBind.apply(func); + st.deepEqual(aBound(sentinel), [sentinel, undefined, undefined], 'apply-bound func with no args'); + st.deepEqual(aBound(sentinel, [1], 4), [sentinel, 1, undefined], 'apply-bound func with too few args'); + st.deepEqual(aBound(sentinel, [1, 2], 4), [sentinel, 1, 2], 'apply-bound func with right args'); + + var aBoundArg = callBind.apply(func); + st.deepEqual(aBoundArg(sentinel, [1, 2, 3], 4), [sentinel, 1, 2], 'apply-bound func with too many args'); + st.deepEqual(aBoundArg(sentinel, [1, 2], 4), [sentinel, 1, 2], 'apply-bound func with right args'); + st.deepEqual(aBoundArg(sentinel, [1], 4), [sentinel, 1, undefined], 'apply-bound func with too few args'); + + var aBoundR = callBind.apply(func, sentinel); + st.deepEqual(aBoundR([1, 2, 3], 4), [sentinel, 1, 2], 'apply-bound func with receiver and too many args'); + st.deepEqual(aBoundR([1, 2], 4), [sentinel, 1, 2], 'apply-bound func with receiver and right args'); + st.deepEqual(aBoundR([1], 4), [sentinel, 1, undefined], 'apply-bound func with receiver and too few args'); + + st.end(); + }); + + t.end(); +}); diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/camelcase/index.d.ts b/25_03_11/frontend_vizsgafeladat/backend/node_modules/camelcase/index.d.ts new file mode 100644 index 00000000..9db94e53 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/camelcase/index.d.ts @@ -0,0 +1,103 @@ +declare namespace camelcase { + interface Options { + /** + Uppercase the first character: `foo-bar` → `FooBar`. + + @default false + */ + readonly pascalCase?: boolean; + + /** + Preserve the consecutive uppercase characters: `foo-BAR` → `FooBAR`. + + @default false + */ + readonly preserveConsecutiveUppercase?: boolean; + + /** + The locale parameter indicates the locale to be used to convert to upper/lower case according to any locale-specific case mappings. If multiple locales are given in an array, the best available locale is used. + + Setting `locale: false` ignores the platform locale and uses the [Unicode Default Case Conversion](https://unicode-org.github.io/icu/userguide/transforms/casemappings.html#simple-single-character-case-mapping) algorithm. + + Default: The host environment’s current locale. + + @example + ``` + import camelCase = require('camelcase'); + + camelCase('lorem-ipsum', {locale: 'en-US'}); + //=> 'loremIpsum' + camelCase('lorem-ipsum', {locale: 'tr-TR'}); + //=> 'loremİpsum' + camelCase('lorem-ipsum', {locale: ['en-US', 'en-GB']}); + //=> 'loremIpsum' + camelCase('lorem-ipsum', {locale: ['tr', 'TR', 'tr-TR']}); + //=> 'loremİpsum' + ``` + */ + readonly locale?: false | string | readonly string[]; + } +} + +/** +Convert a dash/dot/underscore/space separated string to camelCase or PascalCase: `foo-bar` → `fooBar`. + +Correctly handles Unicode strings. + +@param input - String to convert to camel case. + +@example +``` +import camelCase = require('camelcase'); + +camelCase('foo-bar'); +//=> 'fooBar' + +camelCase('foo_bar'); +//=> 'fooBar' + +camelCase('Foo-Bar'); +//=> 'fooBar' + +camelCase('розовый_пушистый_единорог'); +//=> 'розовыйПушистыйЕдинорог' + +camelCase('Foo-Bar', {pascalCase: true}); +//=> 'FooBar' + +camelCase('--foo.bar', {pascalCase: false}); +//=> 'fooBar' + +camelCase('Foo-BAR', {preserveConsecutiveUppercase: true}); +//=> 'fooBAR' + +camelCase('fooBAR', {pascalCase: true, preserveConsecutiveUppercase: true})); +//=> 'FooBAR' + +camelCase('foo bar'); +//=> 'fooBar' + +console.log(process.argv[3]); +//=> '--foo-bar' +camelCase(process.argv[3]); +//=> 'fooBar' + +camelCase(['foo', 'bar']); +//=> 'fooBar' + +camelCase(['__foo__', '--bar'], {pascalCase: true}); +//=> 'FooBar' + +camelCase(['foo', 'BAR'], {pascalCase: true, preserveConsecutiveUppercase: true}) +//=> 'FooBAR' + +camelCase('lorem-ipsum', {locale: 'en-US'}); +//=> 'loremIpsum' +``` +*/ +declare function camelcase( + input: string | readonly string[], + options?: camelcase.Options +): string; + +export = camelcase; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/camelcase/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/camelcase/index.js new file mode 100644 index 00000000..6ff4ee85 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/camelcase/index.js @@ -0,0 +1,113 @@ +'use strict'; + +const UPPERCASE = /[\p{Lu}]/u; +const LOWERCASE = /[\p{Ll}]/u; +const LEADING_CAPITAL = /^[\p{Lu}](?![\p{Lu}])/gu; +const IDENTIFIER = /([\p{Alpha}\p{N}_]|$)/u; +const SEPARATORS = /[_.\- ]+/; + +const LEADING_SEPARATORS = new RegExp('^' + SEPARATORS.source); +const SEPARATORS_AND_IDENTIFIER = new RegExp(SEPARATORS.source + IDENTIFIER.source, 'gu'); +const NUMBERS_AND_IDENTIFIER = new RegExp('\\d+' + IDENTIFIER.source, 'gu'); + +const preserveCamelCase = (string, toLowerCase, toUpperCase) => { + let isLastCharLower = false; + let isLastCharUpper = false; + let isLastLastCharUpper = false; + + for (let i = 0; i < string.length; i++) { + const character = string[i]; + + if (isLastCharLower && UPPERCASE.test(character)) { + string = string.slice(0, i) + '-' + string.slice(i); + isLastCharLower = false; + isLastLastCharUpper = isLastCharUpper; + isLastCharUpper = true; + i++; + } else if (isLastCharUpper && isLastLastCharUpper && LOWERCASE.test(character)) { + string = string.slice(0, i - 1) + '-' + string.slice(i - 1); + isLastLastCharUpper = isLastCharUpper; + isLastCharUpper = false; + isLastCharLower = true; + } else { + isLastCharLower = toLowerCase(character) === character && toUpperCase(character) !== character; + isLastLastCharUpper = isLastCharUpper; + isLastCharUpper = toUpperCase(character) === character && toLowerCase(character) !== character; + } + } + + return string; +}; + +const preserveConsecutiveUppercase = (input, toLowerCase) => { + LEADING_CAPITAL.lastIndex = 0; + + return input.replace(LEADING_CAPITAL, m1 => toLowerCase(m1)); +}; + +const postProcess = (input, toUpperCase) => { + SEPARATORS_AND_IDENTIFIER.lastIndex = 0; + NUMBERS_AND_IDENTIFIER.lastIndex = 0; + + return input.replace(SEPARATORS_AND_IDENTIFIER, (_, identifier) => toUpperCase(identifier)) + .replace(NUMBERS_AND_IDENTIFIER, m => toUpperCase(m)); +}; + +const camelCase = (input, options) => { + if (!(typeof input === 'string' || Array.isArray(input))) { + throw new TypeError('Expected the input to be `string | string[]`'); + } + + options = { + pascalCase: false, + preserveConsecutiveUppercase: false, + ...options + }; + + if (Array.isArray(input)) { + input = input.map(x => x.trim()) + .filter(x => x.length) + .join('-'); + } else { + input = input.trim(); + } + + if (input.length === 0) { + return ''; + } + + const toLowerCase = options.locale === false ? + string => string.toLowerCase() : + string => string.toLocaleLowerCase(options.locale); + const toUpperCase = options.locale === false ? + string => string.toUpperCase() : + string => string.toLocaleUpperCase(options.locale); + + if (input.length === 1) { + return options.pascalCase ? toUpperCase(input) : toLowerCase(input); + } + + const hasUpperCase = input !== toLowerCase(input); + + if (hasUpperCase) { + input = preserveCamelCase(input, toLowerCase, toUpperCase); + } + + input = input.replace(LEADING_SEPARATORS, ''); + + if (options.preserveConsecutiveUppercase) { + input = preserveConsecutiveUppercase(input, toLowerCase); + } else { + input = toLowerCase(input); + } + + if (options.pascalCase) { + input = toUpperCase(input.charAt(0)) + input.slice(1); + } + + return postProcess(input, toUpperCase); +}; + +module.exports = camelCase; +// TODO: Remove this for the next major release +module.exports.default = camelCase; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/camelcase/license b/25_03_11/frontend_vizsgafeladat/backend/node_modules/camelcase/license new file mode 100644 index 00000000..fa7ceba3 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/camelcase/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus (https://sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/camelcase/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/camelcase/package.json new file mode 100644 index 00000000..03114127 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/camelcase/package.json @@ -0,0 +1,76 @@ +{ + "_from": "camelcase@^6.2.0", + "_id": "camelcase@6.3.0", + "_inBundle": false, + "_integrity": "sha512-Gmy6FhYlCY7uOElZUSbxo2UCDH8owEk996gkbrpsgGtrJLM3J7jGxl9Ic7Qwwj4ivOE5AWZWRMecDdF7hqGjFA==", + "_location": "/camelcase", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "camelcase@^6.2.0", + "name": "camelcase", + "escapedName": "camelcase", + "rawSpec": "^6.2.0", + "saveSpec": null, + "fetchSpec": "^6.2.0" + }, + "_requiredBy": [ + "/boxen" + ], + "_resolved": "https://registry.npmjs.org/camelcase/-/camelcase-6.3.0.tgz", + "_shasum": "5685b95eb209ac9c0c177467778c9c84df58ba9a", + "_spec": "camelcase@^6.2.0", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\boxen", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "https://sindresorhus.com" + }, + "bugs": { + "url": "https://github.com/sindresorhus/camelcase/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Convert a dash/dot/underscore/space separated string to camelCase or PascalCase: `foo-bar` → `fooBar`", + "devDependencies": { + "ava": "^1.4.1", + "tsd": "^0.11.0", + "xo": "^0.28.3" + }, + "engines": { + "node": ">=10" + }, + "files": [ + "index.js", + "index.d.ts" + ], + "funding": "https://github.com/sponsors/sindresorhus", + "homepage": "https://github.com/sindresorhus/camelcase#readme", + "keywords": [ + "camelcase", + "camel-case", + "camel", + "case", + "dash", + "hyphen", + "dot", + "underscore", + "separator", + "string", + "text", + "convert", + "pascalcase", + "pascal-case" + ], + "license": "MIT", + "name": "camelcase", + "repository": { + "type": "git", + "url": "git+https://github.com/sindresorhus/camelcase.git" + }, + "scripts": { + "test": "xo && ava && tsd" + }, + "version": "6.3.0" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/camelcase/readme.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/camelcase/readme.md new file mode 100644 index 00000000..0ff8f9e1 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/camelcase/readme.md @@ -0,0 +1,144 @@ +# camelcase + +> Convert a dash/dot/underscore/space separated string to camelCase or PascalCase: `foo-bar` → `fooBar` + +Correctly handles Unicode strings. + +If you use this on untrusted user input, don't forget to limit the length to something reasonable. + +## Install + +``` +$ npm install camelcase +``` + +*If you need to support Firefox < 78, stay on version 5 as version 6 uses regex features not available in Firefox < 78.* + +## Usage + +```js +const camelCase = require('camelcase'); + +camelCase('foo-bar'); +//=> 'fooBar' + +camelCase('foo_bar'); +//=> 'fooBar' + +camelCase('Foo-Bar'); +//=> 'fooBar' + +camelCase('розовый_пушистый_единорог'); +//=> 'розовыйПушистыйЕдинорог' + +camelCase('Foo-Bar', {pascalCase: true}); +//=> 'FooBar' + +camelCase('--foo.bar', {pascalCase: false}); +//=> 'fooBar' + +camelCase('Foo-BAR', {preserveConsecutiveUppercase: true}); +//=> 'fooBAR' + +camelCase('fooBAR', {pascalCase: true, preserveConsecutiveUppercase: true})); +//=> 'FooBAR' + +camelCase('foo bar'); +//=> 'fooBar' + +console.log(process.argv[3]); +//=> '--foo-bar' +camelCase(process.argv[3]); +//=> 'fooBar' + +camelCase(['foo', 'bar']); +//=> 'fooBar' + +camelCase(['__foo__', '--bar'], {pascalCase: true}); +//=> 'FooBar' + +camelCase(['foo', 'BAR'], {pascalCase: true, preserveConsecutiveUppercase: true}) +//=> 'FooBAR' + +camelCase('lorem-ipsum', {locale: 'en-US'}); +//=> 'loremIpsum' +``` + +## API + +### camelCase(input, options?) + +#### input + +Type: `string | string[]` + +String to convert to camel case. + +#### options + +Type: `object` + +##### pascalCase + +Type: `boolean`\ +Default: `false` + +Uppercase the first character: `foo-bar` → `FooBar` + +##### preserveConsecutiveUppercase + +Type: `boolean`\ +Default: `false` + +Preserve the consecutive uppercase characters: `foo-BAR` → `FooBAR`. + +##### locale + +Type: `false | string | string[]`\ +Default: The host environment’s current locale. + +The locale parameter indicates the locale to be used to convert to upper/lower case according to any locale-specific case mappings. If multiple locales are given in an array, the best available locale is used. + +```js +const camelCase = require('camelcase'); + +camelCase('lorem-ipsum', {locale: 'en-US'}); +//=> 'loremIpsum' + +camelCase('lorem-ipsum', {locale: 'tr-TR'}); +//=> 'loremİpsum' + +camelCase('lorem-ipsum', {locale: ['en-US', 'en-GB']}); +//=> 'loremIpsum' + +camelCase('lorem-ipsum', {locale: ['tr', 'TR', 'tr-TR']}); +//=> 'loremİpsum' +``` + +Setting `locale: false` ignores the platform locale and uses the [Unicode Default Case Conversion](https://unicode-org.github.io/icu/userguide/transforms/casemappings.html#simple-single-character-case-mapping) algorithm: + +```js +const camelCase = require('camelcase'); + +// On a platform with 'tr-TR' + +camelCase('lorem-ipsum'); +//=> 'loremİpsum' + +camelCase('lorem-ipsum', {locale: false}); +//=> 'loremIpsum' +``` + +## camelcase for enterprise + +Available as part of the Tidelift Subscription. + +The maintainers of camelcase and thousands of other packages are working with Tidelift to deliver commercial support and maintenance for the open source dependencies you use to build your applications. Save time, reduce risk, and improve code health, while paying the maintainers of the exact dependencies you use. [Learn more.](https://tidelift.com/subscription/pkg/npm-camelcase?utm_source=npm-camelcase&utm_medium=referral&utm_campaign=enterprise&utm_term=repo) + +## Related + +- [decamelize](https://github.com/sindresorhus/decamelize) - The inverse of this module +- [uppercamelcase](https://github.com/SamVerschueren/uppercamelcase) - Like this module, but to PascalCase instead of camelCase +- [titleize](https://github.com/sindresorhus/titleize) - Capitalize every word in string +- [humanize-string](https://github.com/sindresorhus/humanize-string) - Convert a camelized/dasherized/underscored string into a humanized one +- [camelcase-keys](https://github.com/sindresorhus/camelcase-keys) - Convert object keys to camel case diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/index.d.ts b/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/index.d.ts new file mode 100644 index 00000000..9cd88f38 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/index.d.ts @@ -0,0 +1,415 @@ +/** +Basic foreground colors. + +[More colors here.](https://github.com/chalk/chalk/blob/master/readme.md#256-and-truecolor-color-support) +*/ +declare type ForegroundColor = + | 'black' + | 'red' + | 'green' + | 'yellow' + | 'blue' + | 'magenta' + | 'cyan' + | 'white' + | 'gray' + | 'grey' + | 'blackBright' + | 'redBright' + | 'greenBright' + | 'yellowBright' + | 'blueBright' + | 'magentaBright' + | 'cyanBright' + | 'whiteBright'; + +/** +Basic background colors. + +[More colors here.](https://github.com/chalk/chalk/blob/master/readme.md#256-and-truecolor-color-support) +*/ +declare type BackgroundColor = + | 'bgBlack' + | 'bgRed' + | 'bgGreen' + | 'bgYellow' + | 'bgBlue' + | 'bgMagenta' + | 'bgCyan' + | 'bgWhite' + | 'bgGray' + | 'bgGrey' + | 'bgBlackBright' + | 'bgRedBright' + | 'bgGreenBright' + | 'bgYellowBright' + | 'bgBlueBright' + | 'bgMagentaBright' + | 'bgCyanBright' + | 'bgWhiteBright'; + +/** +Basic colors. + +[More colors here.](https://github.com/chalk/chalk/blob/master/readme.md#256-and-truecolor-color-support) +*/ +declare type Color = ForegroundColor | BackgroundColor; + +declare type Modifiers = + | 'reset' + | 'bold' + | 'dim' + | 'italic' + | 'underline' + | 'inverse' + | 'hidden' + | 'strikethrough' + | 'visible'; + +declare namespace chalk { + /** + Levels: + - `0` - All colors disabled. + - `1` - Basic 16 colors support. + - `2` - ANSI 256 colors support. + - `3` - Truecolor 16 million colors support. + */ + type Level = 0 | 1 | 2 | 3; + + interface Options { + /** + Specify the color support for Chalk. + + By default, color support is automatically detected based on the environment. + + Levels: + - `0` - All colors disabled. + - `1` - Basic 16 colors support. + - `2` - ANSI 256 colors support. + - `3` - Truecolor 16 million colors support. + */ + level?: Level; + } + + /** + Return a new Chalk instance. + */ + type Instance = new (options?: Options) => Chalk; + + /** + Detect whether the terminal supports color. + */ + interface ColorSupport { + /** + The color level used by Chalk. + */ + level: Level; + + /** + Return whether Chalk supports basic 16 colors. + */ + hasBasic: boolean; + + /** + Return whether Chalk supports ANSI 256 colors. + */ + has256: boolean; + + /** + Return whether Chalk supports Truecolor 16 million colors. + */ + has16m: boolean; + } + + interface ChalkFunction { + /** + Use a template string. + + @remarks Template literals are unsupported for nested calls (see [issue #341](https://github.com/chalk/chalk/issues/341)) + + @example + ``` + import chalk = require('chalk'); + + log(chalk` + CPU: {red ${cpu.totalPercent}%} + RAM: {green ${ram.used / ram.total * 100}%} + DISK: {rgb(255,131,0) ${disk.used / disk.total * 100}%} + `); + ``` + + @example + ``` + import chalk = require('chalk'); + + log(chalk.red.bgBlack`2 + 3 = {bold ${2 + 3}}`) + ``` + */ + (text: TemplateStringsArray, ...placeholders: unknown[]): string; + + (...text: unknown[]): string; + } + + interface Chalk extends ChalkFunction { + /** + Return a new Chalk instance. + */ + Instance: Instance; + + /** + The color support for Chalk. + + By default, color support is automatically detected based on the environment. + + Levels: + - `0` - All colors disabled. + - `1` - Basic 16 colors support. + - `2` - ANSI 256 colors support. + - `3` - Truecolor 16 million colors support. + */ + level: Level; + + /** + Use HEX value to set text color. + + @param color - Hexadecimal value representing the desired color. + + @example + ``` + import chalk = require('chalk'); + + chalk.hex('#DEADED'); + ``` + */ + hex(color: string): Chalk; + + /** + Use keyword color value to set text color. + + @param color - Keyword value representing the desired color. + + @example + ``` + import chalk = require('chalk'); + + chalk.keyword('orange'); + ``` + */ + keyword(color: string): Chalk; + + /** + Use RGB values to set text color. + */ + rgb(red: number, green: number, blue: number): Chalk; + + /** + Use HSL values to set text color. + */ + hsl(hue: number, saturation: number, lightness: number): Chalk; + + /** + Use HSV values to set text color. + */ + hsv(hue: number, saturation: number, value: number): Chalk; + + /** + Use HWB values to set text color. + */ + hwb(hue: number, whiteness: number, blackness: number): Chalk; + + /** + Use a [Select/Set Graphic Rendition](https://en.wikipedia.org/wiki/ANSI_escape_code#SGR_parameters) (SGR) [color code number](https://en.wikipedia.org/wiki/ANSI_escape_code#3/4_bit) to set text color. + + 30 <= code && code < 38 || 90 <= code && code < 98 + For example, 31 for red, 91 for redBright. + */ + ansi(code: number): Chalk; + + /** + Use a [8-bit unsigned number](https://en.wikipedia.org/wiki/ANSI_escape_code#8-bit) to set text color. + */ + ansi256(index: number): Chalk; + + /** + Use HEX value to set background color. + + @param color - Hexadecimal value representing the desired color. + + @example + ``` + import chalk = require('chalk'); + + chalk.bgHex('#DEADED'); + ``` + */ + bgHex(color: string): Chalk; + + /** + Use keyword color value to set background color. + + @param color - Keyword value representing the desired color. + + @example + ``` + import chalk = require('chalk'); + + chalk.bgKeyword('orange'); + ``` + */ + bgKeyword(color: string): Chalk; + + /** + Use RGB values to set background color. + */ + bgRgb(red: number, green: number, blue: number): Chalk; + + /** + Use HSL values to set background color. + */ + bgHsl(hue: number, saturation: number, lightness: number): Chalk; + + /** + Use HSV values to set background color. + */ + bgHsv(hue: number, saturation: number, value: number): Chalk; + + /** + Use HWB values to set background color. + */ + bgHwb(hue: number, whiteness: number, blackness: number): Chalk; + + /** + Use a [Select/Set Graphic Rendition](https://en.wikipedia.org/wiki/ANSI_escape_code#SGR_parameters) (SGR) [color code number](https://en.wikipedia.org/wiki/ANSI_escape_code#3/4_bit) to set background color. + + 30 <= code && code < 38 || 90 <= code && code < 98 + For example, 31 for red, 91 for redBright. + Use the foreground code, not the background code (for example, not 41, nor 101). + */ + bgAnsi(code: number): Chalk; + + /** + Use a [8-bit unsigned number](https://en.wikipedia.org/wiki/ANSI_escape_code#8-bit) to set background color. + */ + bgAnsi256(index: number): Chalk; + + /** + Modifier: Resets the current color chain. + */ + readonly reset: Chalk; + + /** + Modifier: Make text bold. + */ + readonly bold: Chalk; + + /** + Modifier: Emitting only a small amount of light. + */ + readonly dim: Chalk; + + /** + Modifier: Make text italic. (Not widely supported) + */ + readonly italic: Chalk; + + /** + Modifier: Make text underline. (Not widely supported) + */ + readonly underline: Chalk; + + /** + Modifier: Inverse background and foreground colors. + */ + readonly inverse: Chalk; + + /** + Modifier: Prints the text, but makes it invisible. + */ + readonly hidden: Chalk; + + /** + Modifier: Puts a horizontal line through the center of the text. (Not widely supported) + */ + readonly strikethrough: Chalk; + + /** + Modifier: Prints the text only when Chalk has a color support level > 0. + Can be useful for things that are purely cosmetic. + */ + readonly visible: Chalk; + + readonly black: Chalk; + readonly red: Chalk; + readonly green: Chalk; + readonly yellow: Chalk; + readonly blue: Chalk; + readonly magenta: Chalk; + readonly cyan: Chalk; + readonly white: Chalk; + + /* + Alias for `blackBright`. + */ + readonly gray: Chalk; + + /* + Alias for `blackBright`. + */ + readonly grey: Chalk; + + readonly blackBright: Chalk; + readonly redBright: Chalk; + readonly greenBright: Chalk; + readonly yellowBright: Chalk; + readonly blueBright: Chalk; + readonly magentaBright: Chalk; + readonly cyanBright: Chalk; + readonly whiteBright: Chalk; + + readonly bgBlack: Chalk; + readonly bgRed: Chalk; + readonly bgGreen: Chalk; + readonly bgYellow: Chalk; + readonly bgBlue: Chalk; + readonly bgMagenta: Chalk; + readonly bgCyan: Chalk; + readonly bgWhite: Chalk; + + /* + Alias for `bgBlackBright`. + */ + readonly bgGray: Chalk; + + /* + Alias for `bgBlackBright`. + */ + readonly bgGrey: Chalk; + + readonly bgBlackBright: Chalk; + readonly bgRedBright: Chalk; + readonly bgGreenBright: Chalk; + readonly bgYellowBright: Chalk; + readonly bgBlueBright: Chalk; + readonly bgMagentaBright: Chalk; + readonly bgCyanBright: Chalk; + readonly bgWhiteBright: Chalk; + } +} + +/** +Main Chalk object that allows to chain styles together. +Call the last one as a method with a string argument. +Order doesn't matter, and later styles take precedent in case of a conflict. +This simply means that `chalk.red.yellow.green` is equivalent to `chalk.green`. +*/ +declare const chalk: chalk.Chalk & chalk.ChalkFunction & { + supportsColor: chalk.ColorSupport | false; + Level: chalk.Level; + Color: Color; + ForegroundColor: ForegroundColor; + BackgroundColor: BackgroundColor; + Modifiers: Modifiers; + stderr: chalk.Chalk & {supportsColor: chalk.ColorSupport | false}; +}; + +export = chalk; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/license b/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/license new file mode 100644 index 00000000..e7af2f77 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/node_modules/has-flag/index.d.ts b/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/node_modules/has-flag/index.d.ts new file mode 100644 index 00000000..a0a48c89 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/node_modules/has-flag/index.d.ts @@ -0,0 +1,39 @@ +/** +Check if [`argv`](https://nodejs.org/docs/latest/api/process.html#process_process_argv) has a specific flag. + +@param flag - CLI flag to look for. The `--` prefix is optional. +@param argv - CLI arguments. Default: `process.argv`. +@returns Whether the flag exists. + +@example +``` +// $ ts-node foo.ts -f --unicorn --foo=bar -- --rainbow + +// foo.ts +import hasFlag = require('has-flag'); + +hasFlag('unicorn'); +//=> true + +hasFlag('--unicorn'); +//=> true + +hasFlag('f'); +//=> true + +hasFlag('-f'); +//=> true + +hasFlag('foo=bar'); +//=> true + +hasFlag('foo'); +//=> false + +hasFlag('rainbow'); +//=> false +``` +*/ +declare function hasFlag(flag: string, argv?: string[]): boolean; + +export = hasFlag; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/node_modules/has-flag/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/node_modules/has-flag/index.js new file mode 100644 index 00000000..b6f80b1f --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/node_modules/has-flag/index.js @@ -0,0 +1,8 @@ +'use strict'; + +module.exports = (flag, argv = process.argv) => { + const prefix = flag.startsWith('-') ? '' : (flag.length === 1 ? '-' : '--'); + const position = argv.indexOf(prefix + flag); + const terminatorPosition = argv.indexOf('--'); + return position !== -1 && (terminatorPosition === -1 || position < terminatorPosition); +}; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/node_modules/has-flag/license b/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/node_modules/has-flag/license new file mode 100644 index 00000000..e7af2f77 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/node_modules/has-flag/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/node_modules/has-flag/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/node_modules/has-flag/package.json new file mode 100644 index 00000000..560a8fac --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/node_modules/has-flag/package.json @@ -0,0 +1,78 @@ +{ + "_from": "has-flag@^4.0.0", + "_id": "has-flag@4.0.0", + "_inBundle": false, + "_integrity": "sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==", + "_location": "/chalk/has-flag", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "has-flag@^4.0.0", + "name": "has-flag", + "escapedName": "has-flag", + "rawSpec": "^4.0.0", + "saveSpec": null, + "fetchSpec": "^4.0.0" + }, + "_requiredBy": [ + "/chalk/supports-color" + ], + "_resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz", + "_shasum": "944771fd9c81c81265c4d6941860da06bb59479b", + "_spec": "has-flag@^4.0.0", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\chalk\\node_modules\\supports-color", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "sindresorhus.com" + }, + "bugs": { + "url": "https://github.com/sindresorhus/has-flag/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Check if argv has a specific flag", + "devDependencies": { + "ava": "^1.4.1", + "tsd": "^0.7.2", + "xo": "^0.24.0" + }, + "engines": { + "node": ">=8" + }, + "files": [ + "index.js", + "index.d.ts" + ], + "homepage": "https://github.com/sindresorhus/has-flag#readme", + "keywords": [ + "has", + "check", + "detect", + "contains", + "find", + "flag", + "cli", + "command-line", + "argv", + "process", + "arg", + "args", + "argument", + "arguments", + "getopt", + "minimist", + "optimist" + ], + "license": "MIT", + "name": "has-flag", + "repository": { + "type": "git", + "url": "git+https://github.com/sindresorhus/has-flag.git" + }, + "scripts": { + "test": "xo && ava && tsd" + }, + "version": "4.0.0" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/node_modules/has-flag/readme.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/node_modules/has-flag/readme.md new file mode 100644 index 00000000..3f72dff2 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/node_modules/has-flag/readme.md @@ -0,0 +1,89 @@ +# has-flag [![Build Status](https://travis-ci.org/sindresorhus/has-flag.svg?branch=master)](https://travis-ci.org/sindresorhus/has-flag) + +> Check if [`argv`](https://nodejs.org/docs/latest/api/process.html#process_process_argv) has a specific flag + +Correctly stops looking after an `--` argument terminator. + +--- + +
+ + Get professional support for this package with a Tidelift subscription + +
+ + Tidelift helps make open source sustainable for maintainers while giving companies
assurances about security, maintenance, and licensing for their dependencies. + +
+ +--- + + +## Install + +``` +$ npm install has-flag +``` + + +## Usage + +```js +// foo.js +const hasFlag = require('has-flag'); + +hasFlag('unicorn'); +//=> true + +hasFlag('--unicorn'); +//=> true + +hasFlag('f'); +//=> true + +hasFlag('-f'); +//=> true + +hasFlag('foo=bar'); +//=> true + +hasFlag('foo'); +//=> false + +hasFlag('rainbow'); +//=> false +``` + +``` +$ node foo.js -f --unicorn --foo=bar -- --rainbow +``` + + +## API + +### hasFlag(flag, [argv]) + +Returns a boolean for whether the flag exists. + +#### flag + +Type: `string` + +CLI flag to look for. The `--` prefix is optional. + +#### argv + +Type: `string[]`
+Default: `process.argv` + +CLI arguments. + + +## Security + +To report a security vulnerability, please use the [Tidelift security contact](https://tidelift.com/security). Tidelift will coordinate the fix and disclosure. + + +## License + +MIT © [Sindre Sorhus](https://sindresorhus.com) diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/node_modules/supports-color/browser.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/node_modules/supports-color/browser.js new file mode 100644 index 00000000..62afa3a7 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/node_modules/supports-color/browser.js @@ -0,0 +1,5 @@ +'use strict'; +module.exports = { + stdout: false, + stderr: false +}; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/node_modules/supports-color/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/node_modules/supports-color/index.js new file mode 100644 index 00000000..6fada390 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/node_modules/supports-color/index.js @@ -0,0 +1,135 @@ +'use strict'; +const os = require('os'); +const tty = require('tty'); +const hasFlag = require('has-flag'); + +const {env} = process; + +let forceColor; +if (hasFlag('no-color') || + hasFlag('no-colors') || + hasFlag('color=false') || + hasFlag('color=never')) { + forceColor = 0; +} else if (hasFlag('color') || + hasFlag('colors') || + hasFlag('color=true') || + hasFlag('color=always')) { + forceColor = 1; +} + +if ('FORCE_COLOR' in env) { + if (env.FORCE_COLOR === 'true') { + forceColor = 1; + } else if (env.FORCE_COLOR === 'false') { + forceColor = 0; + } else { + forceColor = env.FORCE_COLOR.length === 0 ? 1 : Math.min(parseInt(env.FORCE_COLOR, 10), 3); + } +} + +function translateLevel(level) { + if (level === 0) { + return false; + } + + return { + level, + hasBasic: true, + has256: level >= 2, + has16m: level >= 3 + }; +} + +function supportsColor(haveStream, streamIsTTY) { + if (forceColor === 0) { + return 0; + } + + if (hasFlag('color=16m') || + hasFlag('color=full') || + hasFlag('color=truecolor')) { + return 3; + } + + if (hasFlag('color=256')) { + return 2; + } + + if (haveStream && !streamIsTTY && forceColor === undefined) { + return 0; + } + + const min = forceColor || 0; + + if (env.TERM === 'dumb') { + return min; + } + + if (process.platform === 'win32') { + // Windows 10 build 10586 is the first Windows release that supports 256 colors. + // Windows 10 build 14931 is the first release that supports 16m/TrueColor. + const osRelease = os.release().split('.'); + if ( + Number(osRelease[0]) >= 10 && + Number(osRelease[2]) >= 10586 + ) { + return Number(osRelease[2]) >= 14931 ? 3 : 2; + } + + return 1; + } + + if ('CI' in env) { + if (['TRAVIS', 'CIRCLECI', 'APPVEYOR', 'GITLAB_CI', 'GITHUB_ACTIONS', 'BUILDKITE'].some(sign => sign in env) || env.CI_NAME === 'codeship') { + return 1; + } + + return min; + } + + if ('TEAMCITY_VERSION' in env) { + return /^(9\.(0*[1-9]\d*)\.|\d{2,}\.)/.test(env.TEAMCITY_VERSION) ? 1 : 0; + } + + if (env.COLORTERM === 'truecolor') { + return 3; + } + + if ('TERM_PROGRAM' in env) { + const version = parseInt((env.TERM_PROGRAM_VERSION || '').split('.')[0], 10); + + switch (env.TERM_PROGRAM) { + case 'iTerm.app': + return version >= 3 ? 3 : 2; + case 'Apple_Terminal': + return 2; + // No default + } + } + + if (/-256(color)?$/i.test(env.TERM)) { + return 2; + } + + if (/^screen|^xterm|^vt100|^vt220|^rxvt|color|ansi|cygwin|linux/i.test(env.TERM)) { + return 1; + } + + if ('COLORTERM' in env) { + return 1; + } + + return min; +} + +function getSupportLevel(stream) { + const level = supportsColor(stream, stream && stream.isTTY); + return translateLevel(level); +} + +module.exports = { + supportsColor: getSupportLevel, + stdout: translateLevel(supportsColor(true, tty.isatty(1))), + stderr: translateLevel(supportsColor(true, tty.isatty(2))) +}; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/node_modules/supports-color/license b/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/node_modules/supports-color/license new file mode 100644 index 00000000..e7af2f77 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/node_modules/supports-color/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/node_modules/supports-color/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/node_modules/supports-color/package.json new file mode 100644 index 00000000..aeea4d3d --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/node_modules/supports-color/package.json @@ -0,0 +1,85 @@ +{ + "_from": "supports-color@^7.1.0", + "_id": "supports-color@7.2.0", + "_inBundle": false, + "_integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==", + "_location": "/chalk/supports-color", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "supports-color@^7.1.0", + "name": "supports-color", + "escapedName": "supports-color", + "rawSpec": "^7.1.0", + "saveSpec": null, + "fetchSpec": "^7.1.0" + }, + "_requiredBy": [ + "/chalk" + ], + "_resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", + "_shasum": "1b7dcdcb32b8138801b3e478ba6a51caa89648da", + "_spec": "supports-color@^7.1.0", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\chalk", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "sindresorhus.com" + }, + "browser": "browser.js", + "bugs": { + "url": "https://github.com/chalk/supports-color/issues" + }, + "bundleDependencies": false, + "dependencies": { + "has-flag": "^4.0.0" + }, + "deprecated": false, + "description": "Detect whether a terminal supports color", + "devDependencies": { + "ava": "^1.4.1", + "import-fresh": "^3.0.0", + "xo": "^0.24.0" + }, + "engines": { + "node": ">=8" + }, + "files": [ + "index.js", + "browser.js" + ], + "homepage": "https://github.com/chalk/supports-color#readme", + "keywords": [ + "color", + "colour", + "colors", + "terminal", + "console", + "cli", + "ansi", + "styles", + "tty", + "rgb", + "256", + "shell", + "xterm", + "command-line", + "support", + "supports", + "capability", + "detect", + "truecolor", + "16m" + ], + "license": "MIT", + "name": "supports-color", + "repository": { + "type": "git", + "url": "git+https://github.com/chalk/supports-color.git" + }, + "scripts": { + "test": "xo && ava" + }, + "version": "7.2.0" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/node_modules/supports-color/readme.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/node_modules/supports-color/readme.md new file mode 100644 index 00000000..36542285 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/node_modules/supports-color/readme.md @@ -0,0 +1,76 @@ +# supports-color [![Build Status](https://travis-ci.org/chalk/supports-color.svg?branch=master)](https://travis-ci.org/chalk/supports-color) + +> Detect whether a terminal supports color + + +## Install + +``` +$ npm install supports-color +``` + + +## Usage + +```js +const supportsColor = require('supports-color'); + +if (supportsColor.stdout) { + console.log('Terminal stdout supports color'); +} + +if (supportsColor.stdout.has256) { + console.log('Terminal stdout supports 256 colors'); +} + +if (supportsColor.stderr.has16m) { + console.log('Terminal stderr supports 16 million colors (truecolor)'); +} +``` + + +## API + +Returns an `Object` with a `stdout` and `stderr` property for testing either streams. Each property is an `Object`, or `false` if color is not supported. + +The `stdout`/`stderr` objects specifies a level of support for color through a `.level` property and a corresponding flag: + +- `.level = 1` and `.hasBasic = true`: Basic color support (16 colors) +- `.level = 2` and `.has256 = true`: 256 color support +- `.level = 3` and `.has16m = true`: Truecolor support (16 million colors) + + +## Info + +It obeys the `--color` and `--no-color` CLI flags. + +For situations where using `--color` is not possible, use the environment variable `FORCE_COLOR=1` (level 1), `FORCE_COLOR=2` (level 2), or `FORCE_COLOR=3` (level 3) to forcefully enable color, or `FORCE_COLOR=0` to forcefully disable. The use of `FORCE_COLOR` overrides all other color support checks. + +Explicit 256/Truecolor mode can be enabled using the `--color=256` and `--color=16m` flags, respectively. + + +## Related + +- [supports-color-cli](https://github.com/chalk/supports-color-cli) - CLI for this module +- [chalk](https://github.com/chalk/chalk) - Terminal string styling done right + + +## Maintainers + +- [Sindre Sorhus](https://github.com/sindresorhus) +- [Josh Junon](https://github.com/qix-) + + +--- + +
+ + Get professional support for this package with a Tidelift subscription + +
+ + Tidelift helps make open source sustainable for maintainers while giving companies
assurances about security, maintenance, and licensing for their dependencies. + +
+ +--- diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/package.json new file mode 100644 index 00000000..d601a89d --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/package.json @@ -0,0 +1,101 @@ +{ + "_from": "chalk@^4.1.0", + "_id": "chalk@4.1.2", + "_inBundle": false, + "_integrity": "sha512-oKnbhFyRIXpUuez8iBMmyEa4nbj4IOQyuhc/wy9kY7/WVPcwIO9VA668Pu8RkO7+0G76SLROeyw9CpQ061i4mA==", + "_location": "/chalk", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "chalk@^4.1.0", + "name": "chalk", + "escapedName": "chalk", + "rawSpec": "^4.1.0", + "saveSpec": null, + "fetchSpec": "^4.1.0" + }, + "_requiredBy": [ + "/boxen", + "/update-notifier" + ], + "_resolved": "https://registry.npmjs.org/chalk/-/chalk-4.1.2.tgz", + "_shasum": "aac4e2b7734a740867aeb16bf02aad556a1e7a01", + "_spec": "chalk@^4.1.0", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\update-notifier", + "bugs": { + "url": "https://github.com/chalk/chalk/issues" + }, + "bundleDependencies": false, + "dependencies": { + "ansi-styles": "^4.1.0", + "supports-color": "^7.1.0" + }, + "deprecated": false, + "description": "Terminal string styling done right", + "devDependencies": { + "ava": "^2.4.0", + "coveralls": "^3.0.7", + "execa": "^4.0.0", + "import-fresh": "^3.1.0", + "matcha": "^0.7.0", + "nyc": "^15.0.0", + "resolve-from": "^5.0.0", + "tsd": "^0.7.4", + "xo": "^0.28.2" + }, + "engines": { + "node": ">=10" + }, + "files": [ + "source", + "index.d.ts" + ], + "funding": "https://github.com/chalk/chalk?sponsor=1", + "homepage": "https://github.com/chalk/chalk#readme", + "keywords": [ + "color", + "colour", + "colors", + "terminal", + "console", + "cli", + "string", + "str", + "ansi", + "style", + "styles", + "tty", + "formatting", + "rgb", + "256", + "shell", + "xterm", + "log", + "logging", + "command-line", + "text" + ], + "license": "MIT", + "main": "source", + "name": "chalk", + "repository": { + "type": "git", + "url": "git+https://github.com/chalk/chalk.git" + }, + "scripts": { + "bench": "matcha benchmark.js", + "test": "xo && nyc ava && tsd" + }, + "version": "4.1.2", + "xo": { + "rules": { + "unicorn/prefer-string-slice": "off", + "unicorn/prefer-includes": "off", + "@typescript-eslint/member-ordering": "off", + "no-redeclare": "off", + "unicorn/string-content": "off", + "unicorn/better-regex": "off" + } + } +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/readme.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/readme.md new file mode 100644 index 00000000..a055d21c --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/chalk/readme.md @@ -0,0 +1,341 @@ +

+
+
+ Chalk +
+
+
+

+ +> Terminal string styling done right + +[![Build Status](https://travis-ci.org/chalk/chalk.svg?branch=master)](https://travis-ci.org/chalk/chalk) [![Coverage Status](https://coveralls.io/repos/github/chalk/chalk/badge.svg?branch=master)](https://coveralls.io/github/chalk/chalk?branch=master) [![npm dependents](https://badgen.net/npm/dependents/chalk)](https://www.npmjs.com/package/chalk?activeTab=dependents) [![Downloads](https://badgen.net/npm/dt/chalk)](https://www.npmjs.com/package/chalk) [![](https://img.shields.io/badge/unicorn-approved-ff69b4.svg)](https://www.youtube.com/watch?v=9auOCbH5Ns4) [![XO code style](https://img.shields.io/badge/code_style-XO-5ed9c7.svg)](https://github.com/xojs/xo) ![TypeScript-ready](https://img.shields.io/npm/types/chalk.svg) [![run on repl.it](https://repl.it/badge/github/chalk/chalk)](https://repl.it/github/chalk/chalk) + + + +
+ +--- + + + +--- + +
+ +## Highlights + +- Expressive API +- Highly performant +- Ability to nest styles +- [256/Truecolor color support](#256-and-truecolor-color-support) +- Auto-detects color support +- Doesn't extend `String.prototype` +- Clean and focused +- Actively maintained +- [Used by ~50,000 packages](https://www.npmjs.com/browse/depended/chalk) as of January 1, 2020 + +## Install + +```console +$ npm install chalk +``` + +## Usage + +```js +const chalk = require('chalk'); + +console.log(chalk.blue('Hello world!')); +``` + +Chalk comes with an easy to use composable API where you just chain and nest the styles you want. + +```js +const chalk = require('chalk'); +const log = console.log; + +// Combine styled and normal strings +log(chalk.blue('Hello') + ' World' + chalk.red('!')); + +// Compose multiple styles using the chainable API +log(chalk.blue.bgRed.bold('Hello world!')); + +// Pass in multiple arguments +log(chalk.blue('Hello', 'World!', 'Foo', 'bar', 'biz', 'baz')); + +// Nest styles +log(chalk.red('Hello', chalk.underline.bgBlue('world') + '!')); + +// Nest styles of the same type even (color, underline, background) +log(chalk.green( + 'I am a green line ' + + chalk.blue.underline.bold('with a blue substring') + + ' that becomes green again!' +)); + +// ES2015 template literal +log(` +CPU: ${chalk.red('90%')} +RAM: ${chalk.green('40%')} +DISK: ${chalk.yellow('70%')} +`); + +// ES2015 tagged template literal +log(chalk` +CPU: {red ${cpu.totalPercent}%} +RAM: {green ${ram.used / ram.total * 100}%} +DISK: {rgb(255,131,0) ${disk.used / disk.total * 100}%} +`); + +// Use RGB colors in terminal emulators that support it. +log(chalk.keyword('orange')('Yay for orange colored text!')); +log(chalk.rgb(123, 45, 67).underline('Underlined reddish color')); +log(chalk.hex('#DEADED').bold('Bold gray!')); +``` + +Easily define your own themes: + +```js +const chalk = require('chalk'); + +const error = chalk.bold.red; +const warning = chalk.keyword('orange'); + +console.log(error('Error!')); +console.log(warning('Warning!')); +``` + +Take advantage of console.log [string substitution](https://nodejs.org/docs/latest/api/console.html#console_console_log_data_args): + +```js +const name = 'Sindre'; +console.log(chalk.green('Hello %s'), name); +//=> 'Hello Sindre' +``` + +## API + +### chalk.` + + +
+

Code coverage report for __root__/

+

+ Statements: 100% (4 / 4)      + Branches: 100% (2 / 2)      + Functions: 100% (1 / 1)      + Lines: 100% (4 / 4)      + Ignored: none      +

+
All files » __root__/
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
FileStatementsBranchesFunctionsLines
index.js100%(4 / 4)100%(2 / 2)100%(1 / 1)100%(4 / 4)
+
+
+
+
Generated by istanbul at Thu Dec 03 2015 15:00:03 GMT-0800 (PST)
+
+ + + + + diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-filename/coverage/__root__/index.js.html b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-filename/coverage/__root__/index.js.html new file mode 100644 index 00000000..02e5768d --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-filename/coverage/__root__/index.js.html @@ -0,0 +1,69 @@ + + + + Code coverage report for index.js + + + + + + +
+

Code coverage report for index.js

+

+ Statements: 100% (4 / 4)      + Branches: 100% (2 / 2)      + Functions: 100% (1 / 1)      + Lines: 100% (4 / 4)      + Ignored: none      +

+
All files » __root__/ » index.js
+
+
+

+
+
1
+2
+3
+4
+5
+6
+7
+8
+9 
+1
+ 
+1
+ 
+1
+6
+ 
+ 
'use strict'
+var path = require('path')
+ 
+var uniqueSlug = require('unique-slug')
+ 
+module.exports = function (filepath, prefix, uniq) {
+  return path.join(filepath, (prefix ? prefix + '-' : '') + uniqueSlug(uniq))
+}
+ 
+ +
+
+
Generated by istanbul at Thu Dec 03 2015 15:00:03 GMT-0800 (PST)
+
+ + + + + diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-filename/coverage/base.css b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-filename/coverage/base.css new file mode 100644 index 00000000..a6a2f328 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-filename/coverage/base.css @@ -0,0 +1,182 @@ +body, html { + margin:0; padding: 0; +} +body { + font-family: Helvetica Neue, Helvetica,Arial; + font-size: 10pt; +} +div.header, div.footer { + background: #eee; + padding: 1em; +} +div.header { + z-index: 100; + position: fixed; + top: 0; + border-bottom: 1px solid #666; + width: 100%; +} +div.footer { + border-top: 1px solid #666; +} +div.body { + margin-top: 10em; +} +div.meta { + font-size: 90%; + text-align: center; +} +h1, h2, h3 { + font-weight: normal; +} +h1 { + font-size: 12pt; +} +h2 { + font-size: 10pt; +} +pre { + font-family: Consolas, Menlo, Monaco, monospace; + margin: 0; + padding: 0; + line-height: 1.3; + font-size: 14px; + -moz-tab-size: 2; + -o-tab-size: 2; + tab-size: 2; +} + +div.path { font-size: 110%; } +div.path a:link, div.path a:visited { color: #000; } +table.coverage { border-collapse: collapse; margin:0; padding: 0 } + +table.coverage td { + margin: 0; + padding: 0; + color: #111; + vertical-align: top; +} +table.coverage td.line-count { + width: 50px; + text-align: right; + padding-right: 5px; +} +table.coverage td.line-coverage { + color: #777 !important; + text-align: right; + border-left: 1px solid #666; + border-right: 1px solid #666; +} + +table.coverage td.text { +} + +table.coverage td span.cline-any { + display: inline-block; + padding: 0 5px; + width: 40px; +} +table.coverage td span.cline-neutral { + background: #eee; +} +table.coverage td span.cline-yes { + background: #b5d592; + color: #999; +} +table.coverage td span.cline-no { + background: #fc8c84; +} + +.cstat-yes { color: #111; } +.cstat-no { background: #fc8c84; color: #111; } +.fstat-no { background: #ffc520; color: #111 !important; } +.cbranch-no { background: yellow !important; color: #111; } + +.cstat-skip { background: #ddd; color: #111; } +.fstat-skip { background: #ddd; color: #111 !important; } +.cbranch-skip { background: #ddd !important; color: #111; } + +.missing-if-branch { + display: inline-block; + margin-right: 10px; + position: relative; + padding: 0 4px; + background: black; + color: yellow; +} + +.skip-if-branch { + display: none; + margin-right: 10px; + position: relative; + padding: 0 4px; + background: #ccc; + color: white; +} + +.missing-if-branch .typ, .skip-if-branch .typ { + color: inherit !important; +} + +.entity, .metric { font-weight: bold; } +.metric { display: inline-block; border: 1px solid #333; padding: 0.3em; background: white; } +.metric small { font-size: 80%; font-weight: normal; color: #666; } + +div.coverage-summary table { border-collapse: collapse; margin: 3em; font-size: 110%; } +div.coverage-summary td, div.coverage-summary table th { margin: 0; padding: 0.25em 1em; border-top: 1px solid #666; border-bottom: 1px solid #666; } +div.coverage-summary th { text-align: left; border: 1px solid #666; background: #eee; font-weight: normal; } +div.coverage-summary th.file { border-right: none !important; } +div.coverage-summary th.pic { border-left: none !important; text-align: right; } +div.coverage-summary th.pct { border-right: none !important; } +div.coverage-summary th.abs { border-left: none !important; text-align: right; } +div.coverage-summary td.pct { text-align: right; border-left: 1px solid #666; } +div.coverage-summary td.abs { text-align: right; font-size: 90%; color: #444; border-right: 1px solid #666; } +div.coverage-summary td.file { border-left: 1px solid #666; white-space: nowrap; } +div.coverage-summary td.pic { min-width: 120px !important; } +div.coverage-summary a:link { text-decoration: none; color: #000; } +div.coverage-summary a:visited { text-decoration: none; color: #777; } +div.coverage-summary a:hover { text-decoration: underline; } +div.coverage-summary tfoot td { border-top: 1px solid #666; } + +div.coverage-summary .sorter { + height: 10px; + width: 7px; + display: inline-block; + margin-left: 0.5em; + background: url(sort-arrow-sprite.png) no-repeat scroll 0 0 transparent; +} +div.coverage-summary .sorted .sorter { + background-position: 0 -20px; +} +div.coverage-summary .sorted-desc .sorter { + background-position: 0 -10px; +} + +.high { background: #b5d592 !important; } +.medium { background: #ffe87c !important; } +.low { background: #fc8c84 !important; } + +span.cover-fill, span.cover-empty { + display:inline-block; + border:1px solid #444; + background: white; + height: 12px; +} +span.cover-fill { + background: #ccc; + border-right: 1px solid #444; +} +span.cover-empty { + background: white; + border-left: none; +} +span.cover-full { + border-right: none !important; +} +pre.prettyprint { + border: none !important; + padding: 0 !important; + margin: 0 !important; +} +.com { color: #999 !important; } +.ignore-none { color: #999; font-weight: normal; } diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-filename/coverage/index.html b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-filename/coverage/index.html new file mode 100644 index 00000000..b10d186c --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-filename/coverage/index.html @@ -0,0 +1,73 @@ + + + + Code coverage report for All files + + + + + + +
+

Code coverage report for All files

+

+ Statements: 100% (4 / 4)      + Branches: 100% (2 / 2)      + Functions: 100% (1 / 1)      + Lines: 100% (4 / 4)      + Ignored: none      +

+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
FileStatementsBranchesFunctionsLines
__root__/100%(4 / 4)100%(2 / 2)100%(1 / 1)100%(4 / 4)
+
+
+
+
Generated by istanbul at Thu Dec 03 2015 15:00:03 GMT-0800 (PST)
+
+ + + + + diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-filename/coverage/prettify.css b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-filename/coverage/prettify.css new file mode 100644 index 00000000..b317a7cd --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-filename/coverage/prettify.css @@ -0,0 +1 @@ +.pln{color:#000}@media screen{.str{color:#080}.kwd{color:#008}.com{color:#800}.typ{color:#606}.lit{color:#066}.pun,.opn,.clo{color:#660}.tag{color:#008}.atn{color:#606}.atv{color:#080}.dec,.var{color:#606}.fun{color:red}}@media print,projection{.str{color:#060}.kwd{color:#006;font-weight:bold}.com{color:#600;font-style:italic}.typ{color:#404;font-weight:bold}.lit{color:#044}.pun,.opn,.clo{color:#440}.tag{color:#006;font-weight:bold}.atn{color:#404}.atv{color:#060}}pre.prettyprint{padding:2px;border:1px solid #888}ol.linenums{margin-top:0;margin-bottom:0}li.L0,li.L1,li.L2,li.L3,li.L5,li.L6,li.L7,li.L8{list-style-type:none}li.L1,li.L3,li.L5,li.L7,li.L9{background:#eee} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-filename/coverage/prettify.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-filename/coverage/prettify.js new file mode 100644 index 00000000..ef51e038 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-filename/coverage/prettify.js @@ -0,0 +1 @@ +window.PR_SHOULD_USE_CONTINUATION=true;(function(){var h=["break,continue,do,else,for,if,return,while"];var u=[h,"auto,case,char,const,default,double,enum,extern,float,goto,int,long,register,short,signed,sizeof,static,struct,switch,typedef,union,unsigned,void,volatile"];var p=[u,"catch,class,delete,false,import,new,operator,private,protected,public,this,throw,true,try,typeof"];var l=[p,"alignof,align_union,asm,axiom,bool,concept,concept_map,const_cast,constexpr,decltype,dynamic_cast,explicit,export,friend,inline,late_check,mutable,namespace,nullptr,reinterpret_cast,static_assert,static_cast,template,typeid,typename,using,virtual,where"];var x=[p,"abstract,boolean,byte,extends,final,finally,implements,import,instanceof,null,native,package,strictfp,super,synchronized,throws,transient"];var R=[x,"as,base,by,checked,decimal,delegate,descending,dynamic,event,fixed,foreach,from,group,implicit,in,interface,internal,into,is,lock,object,out,override,orderby,params,partial,readonly,ref,sbyte,sealed,stackalloc,string,select,uint,ulong,unchecked,unsafe,ushort,var"];var r="all,and,by,catch,class,else,extends,false,finally,for,if,in,is,isnt,loop,new,no,not,null,of,off,on,or,return,super,then,true,try,unless,until,when,while,yes";var w=[p,"debugger,eval,export,function,get,null,set,undefined,var,with,Infinity,NaN"];var s="caller,delete,die,do,dump,elsif,eval,exit,foreach,for,goto,if,import,last,local,my,next,no,our,print,package,redo,require,sub,undef,unless,until,use,wantarray,while,BEGIN,END";var I=[h,"and,as,assert,class,def,del,elif,except,exec,finally,from,global,import,in,is,lambda,nonlocal,not,or,pass,print,raise,try,with,yield,False,True,None"];var f=[h,"alias,and,begin,case,class,def,defined,elsif,end,ensure,false,in,module,next,nil,not,or,redo,rescue,retry,self,super,then,true,undef,unless,until,when,yield,BEGIN,END"];var H=[h,"case,done,elif,esac,eval,fi,function,in,local,set,then,until"];var A=[l,R,w,s+I,f,H];var e=/^(DIR|FILE|vector|(de|priority_)?queue|list|stack|(const_)?iterator|(multi)?(set|map)|bitset|u?(int|float)\d*)/;var C="str";var z="kwd";var j="com";var O="typ";var G="lit";var L="pun";var F="pln";var m="tag";var E="dec";var J="src";var P="atn";var n="atv";var N="nocode";var M="(?:^^\\.?|[+-]|\\!|\\!=|\\!==|\\#|\\%|\\%=|&|&&|&&=|&=|\\(|\\*|\\*=|\\+=|\\,|\\-=|\\->|\\/|\\/=|:|::|\\;|<|<<|<<=|<=|=|==|===|>|>=|>>|>>=|>>>|>>>=|\\?|\\@|\\[|\\^|\\^=|\\^\\^|\\^\\^=|\\{|\\||\\|=|\\|\\||\\|\\|=|\\~|break|case|continue|delete|do|else|finally|instanceof|return|throw|try|typeof)\\s*";function k(Z){var ad=0;var S=false;var ac=false;for(var V=0,U=Z.length;V122)){if(!(al<65||ag>90)){af.push([Math.max(65,ag)|32,Math.min(al,90)|32])}if(!(al<97||ag>122)){af.push([Math.max(97,ag)&~32,Math.min(al,122)&~32])}}}}af.sort(function(av,au){return(av[0]-au[0])||(au[1]-av[1])});var ai=[];var ap=[NaN,NaN];for(var ar=0;arat[0]){if(at[1]+1>at[0]){an.push("-")}an.push(T(at[1]))}}an.push("]");return an.join("")}function W(al){var aj=al.source.match(new RegExp("(?:\\[(?:[^\\x5C\\x5D]|\\\\[\\s\\S])*\\]|\\\\u[A-Fa-f0-9]{4}|\\\\x[A-Fa-f0-9]{2}|\\\\[0-9]+|\\\\[^ux0-9]|\\(\\?[:!=]|[\\(\\)\\^]|[^\\x5B\\x5C\\(\\)\\^]+)","g"));var ah=aj.length;var an=[];for(var ak=0,am=0;ak=2&&ai==="["){aj[ak]=X(ag)}else{if(ai!=="\\"){aj[ak]=ag.replace(/[a-zA-Z]/g,function(ao){var ap=ao.charCodeAt(0);return"["+String.fromCharCode(ap&~32,ap|32)+"]"})}}}}return aj.join("")}var aa=[];for(var V=0,U=Z.length;V=0;){S[ac.charAt(ae)]=Y}}var af=Y[1];var aa=""+af;if(!ag.hasOwnProperty(aa)){ah.push(af);ag[aa]=null}}ah.push(/[\0-\uffff]/);V=k(ah)})();var X=T.length;var W=function(ah){var Z=ah.sourceCode,Y=ah.basePos;var ad=[Y,F];var af=0;var an=Z.match(V)||[];var aj={};for(var ae=0,aq=an.length;ae=5&&"lang-"===ap.substring(0,5);if(am&&!(ai&&typeof ai[1]==="string")){am=false;ap=J}if(!am){aj[ag]=ap}}var ab=af;af+=ag.length;if(!am){ad.push(Y+ab,ap)}else{var al=ai[1];var ak=ag.indexOf(al);var ac=ak+al.length;if(ai[2]){ac=ag.length-ai[2].length;ak=ac-al.length}var ar=ap.substring(5);B(Y+ab,ag.substring(0,ak),W,ad);B(Y+ab+ak,al,q(ar,al),ad);B(Y+ab+ac,ag.substring(ac),W,ad)}}ah.decorations=ad};return W}function i(T){var W=[],S=[];if(T.tripleQuotedStrings){W.push([C,/^(?:\'\'\'(?:[^\'\\]|\\[\s\S]|\'{1,2}(?=[^\']))*(?:\'\'\'|$)|\"\"\"(?:[^\"\\]|\\[\s\S]|\"{1,2}(?=[^\"]))*(?:\"\"\"|$)|\'(?:[^\\\']|\\[\s\S])*(?:\'|$)|\"(?:[^\\\"]|\\[\s\S])*(?:\"|$))/,null,"'\""])}else{if(T.multiLineStrings){W.push([C,/^(?:\'(?:[^\\\']|\\[\s\S])*(?:\'|$)|\"(?:[^\\\"]|\\[\s\S])*(?:\"|$)|\`(?:[^\\\`]|\\[\s\S])*(?:\`|$))/,null,"'\"`"])}else{W.push([C,/^(?:\'(?:[^\\\'\r\n]|\\.)*(?:\'|$)|\"(?:[^\\\"\r\n]|\\.)*(?:\"|$))/,null,"\"'"])}}if(T.verbatimStrings){S.push([C,/^@\"(?:[^\"]|\"\")*(?:\"|$)/,null])}var Y=T.hashComments;if(Y){if(T.cStyleComments){if(Y>1){W.push([j,/^#(?:##(?:[^#]|#(?!##))*(?:###|$)|.*)/,null,"#"])}else{W.push([j,/^#(?:(?:define|elif|else|endif|error|ifdef|include|ifndef|line|pragma|undef|warning)\b|[^\r\n]*)/,null,"#"])}S.push([C,/^<(?:(?:(?:\.\.\/)*|\/?)(?:[\w-]+(?:\/[\w-]+)+)?[\w-]+\.h|[a-z]\w*)>/,null])}else{W.push([j,/^#[^\r\n]*/,null,"#"])}}if(T.cStyleComments){S.push([j,/^\/\/[^\r\n]*/,null]);S.push([j,/^\/\*[\s\S]*?(?:\*\/|$)/,null])}if(T.regexLiterals){var X=("/(?=[^/*])(?:[^/\\x5B\\x5C]|\\x5C[\\s\\S]|\\x5B(?:[^\\x5C\\x5D]|\\x5C[\\s\\S])*(?:\\x5D|$))+/");S.push(["lang-regex",new RegExp("^"+M+"("+X+")")])}var V=T.types;if(V){S.push([O,V])}var U=(""+T.keywords).replace(/^ | $/g,"");if(U.length){S.push([z,new RegExp("^(?:"+U.replace(/[\s,]+/g,"|")+")\\b"),null])}W.push([F,/^\s+/,null," \r\n\t\xA0"]);S.push([G,/^@[a-z_$][a-z_$@0-9]*/i,null],[O,/^(?:[@_]?[A-Z]+[a-z][A-Za-z_$@0-9]*|\w+_t\b)/,null],[F,/^[a-z_$][a-z_$@0-9]*/i,null],[G,new RegExp("^(?:0x[a-f0-9]+|(?:\\d(?:_\\d+)*\\d*(?:\\.\\d*)?|\\.\\d\\+)(?:e[+\\-]?\\d+)?)[a-z]*","i"),null,"0123456789"],[F,/^\\[\s\S]?/,null],[L,/^.[^\s\w\.$@\'\"\`\/\#\\]*/,null]);return g(W,S)}var K=i({keywords:A,hashComments:true,cStyleComments:true,multiLineStrings:true,regexLiterals:true});function Q(V,ag){var U=/(?:^|\s)nocode(?:\s|$)/;var ab=/\r\n?|\n/;var ac=V.ownerDocument;var S;if(V.currentStyle){S=V.currentStyle.whiteSpace}else{if(window.getComputedStyle){S=ac.defaultView.getComputedStyle(V,null).getPropertyValue("white-space")}}var Z=S&&"pre"===S.substring(0,3);var af=ac.createElement("LI");while(V.firstChild){af.appendChild(V.firstChild)}var W=[af];function ae(al){switch(al.nodeType){case 1:if(U.test(al.className)){break}if("BR"===al.nodeName){ad(al);if(al.parentNode){al.parentNode.removeChild(al)}}else{for(var an=al.firstChild;an;an=an.nextSibling){ae(an)}}break;case 3:case 4:if(Z){var am=al.nodeValue;var aj=am.match(ab);if(aj){var ai=am.substring(0,aj.index);al.nodeValue=ai;var ah=am.substring(aj.index+aj[0].length);if(ah){var ak=al.parentNode;ak.insertBefore(ac.createTextNode(ah),al.nextSibling)}ad(al);if(!ai){al.parentNode.removeChild(al)}}}break}}function ad(ak){while(!ak.nextSibling){ak=ak.parentNode;if(!ak){return}}function ai(al,ar){var aq=ar?al.cloneNode(false):al;var ao=al.parentNode;if(ao){var ap=ai(ao,1);var an=al.nextSibling;ap.appendChild(aq);for(var am=an;am;am=an){an=am.nextSibling;ap.appendChild(am)}}return aq}var ah=ai(ak.nextSibling,0);for(var aj;(aj=ah.parentNode)&&aj.nodeType===1;){ah=aj}W.push(ah)}for(var Y=0;Y=S){ah+=2}if(V>=ap){Z+=2}}}var t={};function c(U,V){for(var S=V.length;--S>=0;){var T=V[S];if(!t.hasOwnProperty(T)){t[T]=U}else{if(window.console){console.warn("cannot override language handler %s",T)}}}}function q(T,S){if(!(T&&t.hasOwnProperty(T))){T=/^\s*]*(?:>|$)/],[j,/^<\!--[\s\S]*?(?:-\->|$)/],["lang-",/^<\?([\s\S]+?)(?:\?>|$)/],["lang-",/^<%([\s\S]+?)(?:%>|$)/],[L,/^(?:<[%?]|[%?]>)/],["lang-",/^]*>([\s\S]+?)<\/xmp\b[^>]*>/i],["lang-js",/^]*>([\s\S]*?)(<\/script\b[^>]*>)/i],["lang-css",/^]*>([\s\S]*?)(<\/style\b[^>]*>)/i],["lang-in.tag",/^(<\/?[a-z][^<>]*>)/i]]),["default-markup","htm","html","mxml","xhtml","xml","xsl"]);c(g([[F,/^[\s]+/,null," \t\r\n"],[n,/^(?:\"[^\"]*\"?|\'[^\']*\'?)/,null,"\"'"]],[[m,/^^<\/?[a-z](?:[\w.:-]*\w)?|\/?>$/i],[P,/^(?!style[\s=]|on)[a-z](?:[\w:-]*\w)?/i],["lang-uq.val",/^=\s*([^>\'\"\s]*(?:[^>\'\"\s\/]|\/(?=\s)))/],[L,/^[=<>\/]+/],["lang-js",/^on\w+\s*=\s*\"([^\"]+)\"/i],["lang-js",/^on\w+\s*=\s*\'([^\']+)\'/i],["lang-js",/^on\w+\s*=\s*([^\"\'>\s]+)/i],["lang-css",/^style\s*=\s*\"([^\"]+)\"/i],["lang-css",/^style\s*=\s*\'([^\']+)\'/i],["lang-css",/^style\s*=\s*([^\"\'>\s]+)/i]]),["in.tag"]);c(g([],[[n,/^[\s\S]+/]]),["uq.val"]);c(i({keywords:l,hashComments:true,cStyleComments:true,types:e}),["c","cc","cpp","cxx","cyc","m"]);c(i({keywords:"null,true,false"}),["json"]);c(i({keywords:R,hashComments:true,cStyleComments:true,verbatimStrings:true,types:e}),["cs"]);c(i({keywords:x,cStyleComments:true}),["java"]);c(i({keywords:H,hashComments:true,multiLineStrings:true}),["bsh","csh","sh"]);c(i({keywords:I,hashComments:true,multiLineStrings:true,tripleQuotedStrings:true}),["cv","py"]);c(i({keywords:s,hashComments:true,multiLineStrings:true,regexLiterals:true}),["perl","pl","pm"]);c(i({keywords:f,hashComments:true,multiLineStrings:true,regexLiterals:true}),["rb"]);c(i({keywords:w,cStyleComments:true,regexLiterals:true}),["js"]);c(i({keywords:r,hashComments:3,cStyleComments:true,multilineStrings:true,tripleQuotedStrings:true,regexLiterals:true}),["coffee"]);c(g([],[[C,/^[\s\S]+/]]),["regex"]);function d(V){var U=V.langExtension;try{var S=a(V.sourceNode);var T=S.sourceCode;V.sourceCode=T;V.spans=S.spans;V.basePos=0;q(U,T)(V);D(V)}catch(W){if("console" in window){console.log(W&&W.stack?W.stack:W)}}}function y(W,V,U){var S=document.createElement("PRE");S.innerHTML=W;if(U){Q(S,U)}var T={langExtension:V,numberLines:U,sourceNode:S};d(T);return S.innerHTML}function b(ad){function Y(af){return document.getElementsByTagName(af)}var ac=[Y("pre"),Y("code"),Y("xmp")];var T=[];for(var aa=0;aa=0){var ah=ai.match(ab);var am;if(!ah&&(am=o(aj))&&"CODE"===am.tagName){ah=am.className.match(ab)}if(ah){ah=ah[1]}var al=false;for(var ak=aj.parentNode;ak;ak=ak.parentNode){if((ak.tagName==="pre"||ak.tagName==="code"||ak.tagName==="xmp")&&ak.className&&ak.className.indexOf("prettyprint")>=0){al=true;break}}if(!al){var af=aj.className.match(/\blinenums\b(?::(\d+))?/);af=af?af[1]&&af[1].length?+af[1]:true:false;if(af){Q(aj,af)}S={langExtension:ah,sourceNode:aj,numberLines:af};d(S)}}}if(X]*(?:>|$)/],[PR.PR_COMMENT,/^<\!--[\s\S]*?(?:-\->|$)/],[PR.PR_PUNCTUATION,/^(?:<[%?]|[%?]>)/],["lang-",/^<\?([\s\S]+?)(?:\?>|$)/],["lang-",/^<%([\s\S]+?)(?:%>|$)/],["lang-",/^]*>([\s\S]+?)<\/xmp\b[^>]*>/i],["lang-handlebars",/^]*type\s*=\s*['"]?text\/x-handlebars-template['"]?\b[^>]*>([\s\S]*?)(<\/script\b[^>]*>)/i],["lang-js",/^]*>([\s\S]*?)(<\/script\b[^>]*>)/i],["lang-css",/^]*>([\s\S]*?)(<\/style\b[^>]*>)/i],["lang-in.tag",/^(<\/?[a-z][^<>]*>)/i],[PR.PR_DECLARATION,/^{{[#^>/]?\s*[\w.][^}]*}}/],[PR.PR_DECLARATION,/^{{&?\s*[\w.][^}]*}}/],[PR.PR_DECLARATION,/^{{{>?\s*[\w.][^}]*}}}/],[PR.PR_COMMENT,/^{{![^}]*}}/]]),["handlebars","hbs"]);PR.registerLangHandler(PR.createSimpleLexer([[PR.PR_PLAIN,/^[ \t\r\n\f]+/,null," \t\r\n\f"]],[[PR.PR_STRING,/^\"(?:[^\n\r\f\\\"]|\\(?:\r\n?|\n|\f)|\\[\s\S])*\"/,null],[PR.PR_STRING,/^\'(?:[^\n\r\f\\\']|\\(?:\r\n?|\n|\f)|\\[\s\S])*\'/,null],["lang-css-str",/^url\(([^\)\"\']*)\)/i],[PR.PR_KEYWORD,/^(?:url|rgb|\!important|@import|@page|@media|@charset|inherit)(?=[^\-\w]|$)/i,null],["lang-css-kw",/^(-?(?:[_a-z]|(?:\\[0-9a-f]+ ?))(?:[_a-z0-9\-]|\\(?:\\[0-9a-f]+ ?))*)\s*:/i],[PR.PR_COMMENT,/^\/\*[^*]*\*+(?:[^\/*][^*]*\*+)*\//],[PR.PR_COMMENT,/^(?:)/],[PR.PR_LITERAL,/^(?:\d+|\d*\.\d+)(?:%|[a-z]+)?/i],[PR.PR_LITERAL,/^#(?:[0-9a-f]{3}){1,2}/i],[PR.PR_PLAIN,/^-?(?:[_a-z]|(?:\\[\da-f]+ ?))(?:[_a-z\d\-]|\\(?:\\[\da-f]+ ?))*/i],[PR.PR_PUNCTUATION,/^[^\s\w\'\"]+/]]),["css"]);PR.registerLangHandler(PR.createSimpleLexer([],[[PR.PR_KEYWORD,/^-?(?:[_a-z]|(?:\\[\da-f]+ ?))(?:[_a-z\d\-]|\\(?:\\[\da-f]+ ?))*/i]]),["css-kw"]);PR.registerLangHandler(PR.createSimpleLexer([],[[PR.PR_STRING,/^[^\)\"\']+/]]),["css-str"]); diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-filename/coverage/sort-arrow-sprite.png b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-filename/coverage/sort-arrow-sprite.png new file mode 100644 index 00000000..03f704a6 Binary files /dev/null and b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-filename/coverage/sort-arrow-sprite.png differ diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-filename/coverage/sorter.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-filename/coverage/sorter.js new file mode 100644 index 00000000..6afb736c --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-filename/coverage/sorter.js @@ -0,0 +1,156 @@ +var addSorting = (function () { + "use strict"; + var cols, + currentSort = { + index: 0, + desc: false + }; + + // returns the summary table element + function getTable() { return document.querySelector('.coverage-summary table'); } + // returns the thead element of the summary table + function getTableHeader() { return getTable().querySelector('thead tr'); } + // returns the tbody element of the summary table + function getTableBody() { return getTable().querySelector('tbody'); } + // returns the th element for nth column + function getNthColumn(n) { return getTableHeader().querySelectorAll('th')[n]; } + + // loads all columns + function loadColumns() { + var colNodes = getTableHeader().querySelectorAll('th'), + colNode, + cols = [], + col, + i; + + for (i = 0; i < colNodes.length; i += 1) { + colNode = colNodes[i]; + col = { + key: colNode.getAttribute('data-col'), + sortable: !colNode.getAttribute('data-nosort'), + type: colNode.getAttribute('data-type') || 'string' + }; + cols.push(col); + if (col.sortable) { + col.defaultDescSort = col.type === 'number'; + colNode.innerHTML = colNode.innerHTML + ''; + } + } + return cols; + } + // attaches a data attribute to every tr element with an object + // of data values keyed by column name + function loadRowData(tableRow) { + var tableCols = tableRow.querySelectorAll('td'), + colNode, + col, + data = {}, + i, + val; + for (i = 0; i < tableCols.length; i += 1) { + colNode = tableCols[i]; + col = cols[i]; + val = colNode.getAttribute('data-value'); + if (col.type === 'number') { + val = Number(val); + } + data[col.key] = val; + } + return data; + } + // loads all row data + function loadData() { + var rows = getTableBody().querySelectorAll('tr'), + i; + + for (i = 0; i < rows.length; i += 1) { + rows[i].data = loadRowData(rows[i]); + } + } + // sorts the table using the data for the ith column + function sortByIndex(index, desc) { + var key = cols[index].key, + sorter = function (a, b) { + a = a.data[key]; + b = b.data[key]; + return a < b ? -1 : a > b ? 1 : 0; + }, + finalSorter = sorter, + tableBody = document.querySelector('.coverage-summary tbody'), + rowNodes = tableBody.querySelectorAll('tr'), + rows = [], + i; + + if (desc) { + finalSorter = function (a, b) { + return -1 * sorter(a, b); + }; + } + + for (i = 0; i < rowNodes.length; i += 1) { + rows.push(rowNodes[i]); + tableBody.removeChild(rowNodes[i]); + } + + rows.sort(finalSorter); + + for (i = 0; i < rows.length; i += 1) { + tableBody.appendChild(rows[i]); + } + } + // removes sort indicators for current column being sorted + function removeSortIndicators() { + var col = getNthColumn(currentSort.index), + cls = col.className; + + cls = cls.replace(/ sorted$/, '').replace(/ sorted-desc$/, ''); + col.className = cls; + } + // adds sort indicators for current column being sorted + function addSortIndicators() { + getNthColumn(currentSort.index).className += currentSort.desc ? ' sorted-desc' : ' sorted'; + } + // adds event listeners for all sorter widgets + function enableUI() { + var i, + el, + ithSorter = function ithSorter(i) { + var col = cols[i]; + + return function () { + var desc = col.defaultDescSort; + + if (currentSort.index === i) { + desc = !currentSort.desc; + } + sortByIndex(i, desc); + removeSortIndicators(); + currentSort.index = i; + currentSort.desc = desc; + addSortIndicators(); + }; + }; + for (i =0 ; i < cols.length; i += 1) { + if (cols[i].sortable) { + el = getNthColumn(i).querySelector('.sorter'); + if (el.addEventListener) { + el.addEventListener('click', ithSorter(i)); + } else { + el.attachEvent('onclick', ithSorter(i)); + } + } + } + } + // adds sorting functionality to the UI + return function () { + if (!getTable()) { + return; + } + cols = loadColumns(); + loadData(cols); + addSortIndicators(); + enableUI(); + }; +})(); + +window.addEventListener('load', addSorting); diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-filename/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-filename/index.js new file mode 100644 index 00000000..02bf1e27 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-filename/index.js @@ -0,0 +1,8 @@ +'use strict' +var path = require('path') + +var uniqueSlug = require('unique-slug') + +module.exports = function (filepath, prefix, uniq) { + return path.join(filepath, (prefix ? prefix + '-' : '') + uniqueSlug(uniq)) +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-filename/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-filename/package.json new file mode 100644 index 00000000..72ac6e76 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-filename/package.json @@ -0,0 +1,56 @@ +{ + "_from": "unique-filename@^1.1.1", + "_id": "unique-filename@1.1.1", + "_inBundle": false, + "_integrity": "sha512-Vmp0jIp2ln35UTXuryvjzkjGdRyf9b2lTXuSYUiPmzRcl3FDtYqAwOnTJkAngD9SWhnoJzDbTKwaOrZ+STtxNQ==", + "_location": "/unique-filename", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "unique-filename@^1.1.1", + "name": "unique-filename", + "escapedName": "unique-filename", + "rawSpec": "^1.1.1", + "saveSpec": null, + "fetchSpec": "^1.1.1" + }, + "_requiredBy": [ + "/cacache" + ], + "_resolved": "https://registry.npmjs.org/unique-filename/-/unique-filename-1.1.1.tgz", + "_shasum": "1d69769369ada0583103a1e6ae87681b56573230", + "_spec": "unique-filename@^1.1.1", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\cacache", + "author": { + "name": "Rebecca Turner", + "email": "me@re-becca.org", + "url": "http://re-becca.org/" + }, + "bugs": { + "url": "https://github.com/iarna/unique-filename/issues" + }, + "bundleDependencies": false, + "dependencies": { + "unique-slug": "^2.0.0" + }, + "deprecated": false, + "description": "Generate a unique filename for use in temporary directories or caches.", + "devDependencies": { + "standard": "^5.4.1", + "tap": "^2.3.1" + }, + "homepage": "https://github.com/iarna/unique-filename", + "keywords": [], + "license": "ISC", + "main": "index.js", + "name": "unique-filename", + "repository": { + "type": "git", + "url": "git+https://github.com/iarna/unique-filename.git" + }, + "scripts": { + "test": "standard && tap test" + }, + "version": "1.1.1" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-filename/test/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-filename/test/index.js new file mode 100644 index 00000000..105b4e52 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-filename/test/index.js @@ -0,0 +1,23 @@ +'sue strict' +var t = require('tap') +var uniqueFilename = require('../index.js') + +t.plan(6) + +var randomTmpfile = uniqueFilename('tmp') +t.like(randomTmpfile, /^tmp.[a-f0-9]{8}$/, 'random tmp file') + +var randomAgain = uniqueFilename('tmp') +t.notEqual(randomAgain, randomTmpfile, 'random tmp files are not the same') + +var randomPrefixedTmpfile = uniqueFilename('tmp', 'my-test') +t.like(randomPrefixedTmpfile, /^tmp.my-test-[a-f0-9]{8}$/, 'random prefixed tmp file') + +var randomPrefixedAgain = uniqueFilename('tmp', 'my-test') +t.notEqual(randomPrefixedAgain, randomPrefixedTmpfile, 'random prefixed tmp files are not the same') + +var uniqueTmpfile = uniqueFilename('tmp', 'testing', '/my/thing/to/uniq/on') +t.like(uniqueTmpfile, /^tmp.testing-7ddd44c0$/, 'unique filename') + +var uniqueAgain = uniqueFilename('tmp', 'testing', '/my/thing/to/uniq/on') +t.is(uniqueTmpfile, uniqueAgain, 'same unique string component produces same filename') diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-slug/.travis.yml b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-slug/.travis.yml new file mode 100644 index 00000000..5651fce2 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-slug/.travis.yml @@ -0,0 +1,10 @@ +language: node_js +sudo: false +before_install: + - "npm -g install npm" +node_js: + - "6" + - "8" + - "10" + - "lts/*" + - "node" diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-slug/LICENSE b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-slug/LICENSE new file mode 100644 index 00000000..7953647e --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-slug/LICENSE @@ -0,0 +1,15 @@ +The ISC License + +Copyright npm, Inc + +Permission to use, copy, modify, and/or distribute this software for any +purpose with or without fee is hereby granted, provided that the above +copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF +MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR +ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR +IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-slug/README.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-slug/README.md new file mode 100644 index 00000000..87f92f1d --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-slug/README.md @@ -0,0 +1,19 @@ +unique-slug +=========== + +Generate a unique character string suitible for use in files and URLs. + +``` +var uniqueSlug = require('unique-slug') + +var randomSlug = uniqueSlug() +var fileSlug = uniqueSlug('/etc/passwd') +``` + +### uniqueSlug(*str*) → String (8 chars) + +If *str* is passed in then the return value will be its murmur hash in +hex. + +If *str* is not passed in, it will be 4 randomly generated bytes +converted into 8 hexadecimal characters. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-slug/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-slug/index.js new file mode 100644 index 00000000..fa4761ad --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-slug/index.js @@ -0,0 +1,11 @@ +'use strict' +var MurmurHash3 = require('imurmurhash') + +module.exports = function (uniq) { + if (uniq) { + var hash = new MurmurHash3(uniq) + return ('00000000' + hash.result().toString(16)).substr(-8) + } else { + return (Math.random().toString(16) + '0000000').substr(2, 8) + } +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-slug/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-slug/package.json new file mode 100644 index 00000000..4dce9395 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-slug/package.json @@ -0,0 +1,56 @@ +{ + "_from": "unique-slug@^2.0.0", + "_id": "unique-slug@2.0.2", + "_inBundle": false, + "_integrity": "sha512-zoWr9ObaxALD3DOPfjPSqxt4fnZiWblxHIgeWqW8x7UqDzEtHEQLzji2cuJYQFCU6KmoJikOYAZlrTHHebjx2w==", + "_location": "/unique-slug", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "unique-slug@^2.0.0", + "name": "unique-slug", + "escapedName": "unique-slug", + "rawSpec": "^2.0.0", + "saveSpec": null, + "fetchSpec": "^2.0.0" + }, + "_requiredBy": [ + "/unique-filename" + ], + "_resolved": "https://registry.npmjs.org/unique-slug/-/unique-slug-2.0.2.tgz", + "_shasum": "baabce91083fc64e945b0f3ad613e264f7cd4e6c", + "_spec": "unique-slug@^2.0.0", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\unique-filename", + "author": { + "name": "Rebecca Turner", + "email": "me@re-becca.org", + "url": "http://re-becca.org" + }, + "bugs": { + "url": "https://github.com/iarna/unique-slug/issues" + }, + "bundleDependencies": false, + "dependencies": { + "imurmurhash": "^0.1.4" + }, + "deprecated": false, + "description": "Generate a unique character string suitible for use in files and URLs.", + "devDependencies": { + "standard": "^12.0.1", + "tap": "^12.7.0" + }, + "homepage": "https://github.com/iarna/unique-slug#readme", + "keywords": [], + "license": "ISC", + "main": "index.js", + "name": "unique-slug", + "repository": { + "type": "git", + "url": "git://github.com/iarna/unique-slug.git" + }, + "scripts": { + "test": "standard && tap --coverage test" + }, + "version": "2.0.2" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-slug/test/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-slug/test/index.js new file mode 100644 index 00000000..0f4ccad0 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-slug/test/index.js @@ -0,0 +1,13 @@ +'use strict' +var t = require('tap') +var uniqueSlug = require('../index.js') + +t.plan(5) +var slugA = uniqueSlug() +t.is(slugA.length, 8, 'random slugs are 8 chars') +t.notEqual(slugA, uniqueSlug(), "two slugs aren't the same") +var base = '/path/to/thingy' +var slugB = uniqueSlug(base) +t.is(slugB.length, 8, 'string based slugs are 8 chars') +t.is(slugB, uniqueSlug(base), 'two string based slugs, from the same string are the same') +t.notEqual(slugB, uniqueSlug(slugA), 'two string based slongs, from diff strings are different') diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-string/index.d.ts b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-string/index.d.ts new file mode 100644 index 00000000..08959a68 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-string/index.d.ts @@ -0,0 +1,16 @@ +/** +Generate a unique random string. + +@returns A 32 character unique string. Matches the length of MD5, which is [unique enough](https://stackoverflow.com/a/2444336/64949) for non-crypto purposes. + +@example +``` +import uniqueString = require('unique-string'); + +uniqueString(); +//=> 'b4de2a49c8ffa3fbee04446f045483b2' +``` +*/ +declare function uniqueString(): string; + +export = uniqueString; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-string/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-string/index.js new file mode 100644 index 00000000..5bc7787f --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-string/index.js @@ -0,0 +1,4 @@ +'use strict'; +const cryptoRandomString = require('crypto-random-string'); + +module.exports = () => cryptoRandomString(32); diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-string/license b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-string/license new file mode 100644 index 00000000..e7af2f77 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-string/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-string/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-string/package.json new file mode 100644 index 00000000..6405304e --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-string/package.json @@ -0,0 +1,72 @@ +{ + "_from": "unique-string@^2.0.0", + "_id": "unique-string@2.0.0", + "_inBundle": false, + "_integrity": "sha512-uNaeirEPvpZWSgzwsPGtU2zVSTrn/8L5q/IexZmH0eH6SA73CmAA5U4GwORTxQAZs95TAXLNqeLoPPNO5gZfWg==", + "_location": "/unique-string", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "unique-string@^2.0.0", + "name": "unique-string", + "escapedName": "unique-string", + "rawSpec": "^2.0.0", + "saveSpec": null, + "fetchSpec": "^2.0.0" + }, + "_requiredBy": [ + "/configstore" + ], + "_resolved": "https://registry.npmjs.org/unique-string/-/unique-string-2.0.0.tgz", + "_shasum": "39c6451f81afb2749de2b233e3f7c5e8843bd89d", + "_spec": "unique-string@^2.0.0", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\configstore", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "sindresorhus.com" + }, + "bugs": { + "url": "https://github.com/sindresorhus/unique-string/issues" + }, + "bundleDependencies": false, + "dependencies": { + "crypto-random-string": "^2.0.0" + }, + "deprecated": false, + "description": "Generate a unique random string", + "devDependencies": { + "ava": "^1.4.1", + "tsd": "^0.7.2", + "xo": "^0.24.0" + }, + "engines": { + "node": ">=8" + }, + "files": [ + "index.js", + "index.d.ts" + ], + "homepage": "https://github.com/sindresorhus/unique-string#readme", + "keywords": [ + "unique", + "string", + "random", + "text", + "id", + "identifier", + "slug", + "hex" + ], + "license": "MIT", + "name": "unique-string", + "repository": { + "type": "git", + "url": "git+https://github.com/sindresorhus/unique-string.git" + }, + "scripts": { + "test": "xo && ava && tsd" + }, + "version": "2.0.0" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-string/readme.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-string/readme.md new file mode 100644 index 00000000..9213f11e --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unique-string/readme.md @@ -0,0 +1,32 @@ +# unique-string [![Build Status](https://travis-ci.org/sindresorhus/unique-string.svg?branch=master)](https://travis-ci.org/sindresorhus/unique-string) + +> Generate a unique random string + + +## Install + +``` +$ npm install unique-string +``` + + +## Usage + +```js +const uniqueString = require('unique-string'); + +uniqueString(); +//=> 'b4de2a49c8ffa3fbee04446f045483b2' +``` + + +## API + +### uniqueString() + +Returns a 32 character unique string. Matches the length of MD5, which is [unique enough](https://stackoverflow.com/a/2444336/64949) for non-crypto purposes. + + +## License + +MIT © [Sindre Sorhus](https://sindresorhus.com) diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/unpipe/HISTORY.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unpipe/HISTORY.md new file mode 100644 index 00000000..85e0f8d7 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unpipe/HISTORY.md @@ -0,0 +1,4 @@ +1.0.0 / 2015-06-14 +================== + + * Initial release diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/unpipe/LICENSE b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unpipe/LICENSE new file mode 100644 index 00000000..aed01382 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unpipe/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/unpipe/README.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unpipe/README.md new file mode 100644 index 00000000..e536ad2c --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unpipe/README.md @@ -0,0 +1,43 @@ +# unpipe + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-image]][node-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Unpipe a stream from all destinations. + +## Installation + +```sh +$ npm install unpipe +``` + +## API + +```js +var unpipe = require('unpipe') +``` + +### unpipe(stream) + +Unpipes all destinations from a given stream. With stream 2+, this is +equivalent to `stream.unpipe()`. When used with streams 1 style streams +(typically Node.js 0.8 and below), this module attempts to undo the +actions done in `stream.pipe(dest)`. + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/unpipe.svg +[npm-url]: https://npmjs.org/package/unpipe +[node-image]: https://img.shields.io/node/v/unpipe.svg +[node-url]: http://nodejs.org/download/ +[travis-image]: https://img.shields.io/travis/stream-utils/unpipe.svg +[travis-url]: https://travis-ci.org/stream-utils/unpipe +[coveralls-image]: https://img.shields.io/coveralls/stream-utils/unpipe.svg +[coveralls-url]: https://coveralls.io/r/stream-utils/unpipe?branch=master +[downloads-image]: https://img.shields.io/npm/dm/unpipe.svg +[downloads-url]: https://npmjs.org/package/unpipe diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/unpipe/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unpipe/index.js new file mode 100644 index 00000000..15c3d97a --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unpipe/index.js @@ -0,0 +1,69 @@ +/*! + * unpipe + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + * @public + */ + +module.exports = unpipe + +/** + * Determine if there are Node.js pipe-like data listeners. + * @private + */ + +function hasPipeDataListeners(stream) { + var listeners = stream.listeners('data') + + for (var i = 0; i < listeners.length; i++) { + if (listeners[i].name === 'ondata') { + return true + } + } + + return false +} + +/** + * Unpipe a stream from all destinations. + * + * @param {object} stream + * @public + */ + +function unpipe(stream) { + if (!stream) { + throw new TypeError('argument stream is required') + } + + if (typeof stream.unpipe === 'function') { + // new-style + stream.unpipe() + return + } + + // Node.js 0.8 hack + if (!hasPipeDataListeners(stream)) { + return + } + + var listener + var listeners = stream.listeners('close') + + for (var i = 0; i < listeners.length; i++) { + listener = listeners[i] + + if (listener.name !== 'cleanup' && listener.name !== 'onclose') { + continue + } + + // invoke the listener + listener.call(stream) + } +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/unpipe/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unpipe/package.json new file mode 100644 index 00000000..bd5c3c30 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/unpipe/package.json @@ -0,0 +1,64 @@ +{ + "_from": "unpipe@1.0.0", + "_id": "unpipe@1.0.0", + "_inBundle": false, + "_integrity": "sha1-sr9O6FFKrmFltIF4KdIbLvSZBOw=", + "_location": "/unpipe", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "unpipe@1.0.0", + "name": "unpipe", + "escapedName": "unpipe", + "rawSpec": "1.0.0", + "saveSpec": null, + "fetchSpec": "1.0.0" + }, + "_requiredBy": [ + "/body-parser", + "/finalhandler", + "/raw-body" + ], + "_resolved": "https://registry.npmjs.org/unpipe/-/unpipe-1.0.0.tgz", + "_shasum": "b2bf4ee8514aae6165b4817829d21b2ef49904ec", + "_spec": "unpipe@1.0.0", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\body-parser", + "author": { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + "bugs": { + "url": "https://github.com/stream-utils/unpipe/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Unpipe a stream from all destinations", + "devDependencies": { + "istanbul": "0.3.15", + "mocha": "2.2.5", + "readable-stream": "1.1.13" + }, + "engines": { + "node": ">= 0.8" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "README.md", + "index.js" + ], + "homepage": "https://github.com/stream-utils/unpipe#readme", + "license": "MIT", + "name": "unpipe", + "repository": { + "type": "git", + "url": "git+https://github.com/stream-utils/unpipe.git" + }, + "scripts": { + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "1.0.0" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/update-notifier/check.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/update-notifier/check.js new file mode 100644 index 00000000..fc0ee9cb --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/update-notifier/check.js @@ -0,0 +1,28 @@ +/* eslint-disable unicorn/no-process-exit */ +'use strict'; +let updateNotifier = require('.'); + +const options = JSON.parse(process.argv[2]); + +updateNotifier = new updateNotifier.UpdateNotifier(options); + +(async () => { + // Exit process when offline + setTimeout(process.exit, 1000 * 30); + + const update = await updateNotifier.fetchInfo(); + + // Only update the last update check time on success + updateNotifier.config.set('lastUpdateCheck', Date.now()); + + if (update.type && update.type !== 'latest') { + updateNotifier.config.set('update', update); + } + + // Call process exit explicitly to terminate the child process, + // otherwise the child process will run forever, according to the Node.js docs + process.exit(); +})().catch(error => { + console.error(error); + process.exit(1); +}); diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/update-notifier/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/update-notifier/index.js new file mode 100644 index 00000000..5e892164 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/update-notifier/index.js @@ -0,0 +1,188 @@ +'use strict'; +const {spawn} = require('child_process'); +const path = require('path'); +const {format} = require('util'); +const importLazy = require('import-lazy')(require); + +const configstore = importLazy('configstore'); +const chalk = importLazy('chalk'); +const semver = importLazy('semver'); +const semverDiff = importLazy('semver-diff'); +const latestVersion = importLazy('latest-version'); +const isNpm = importLazy('is-npm'); +const isInstalledGlobally = importLazy('is-installed-globally'); +const isYarnGlobal = importLazy('is-yarn-global'); +const hasYarn = importLazy('has-yarn'); +const boxen = importLazy('boxen'); +const xdgBasedir = importLazy('xdg-basedir'); +const isCi = importLazy('is-ci'); +const pupa = importLazy('pupa'); + +const ONE_DAY = 1000 * 60 * 60 * 24; + +class UpdateNotifier { + constructor(options = {}) { + this.options = options; + options.pkg = options.pkg || {}; + options.distTag = options.distTag || 'latest'; + + // Reduce pkg to the essential keys. with fallback to deprecated options + // TODO: Remove deprecated options at some point far into the future + options.pkg = { + name: options.pkg.name || options.packageName, + version: options.pkg.version || options.packageVersion + }; + + if (!options.pkg.name || !options.pkg.version) { + throw new Error('pkg.name and pkg.version required'); + } + + this.packageName = options.pkg.name; + this.packageVersion = options.pkg.version; + this.updateCheckInterval = typeof options.updateCheckInterval === 'number' ? options.updateCheckInterval : ONE_DAY; + this.disabled = 'NO_UPDATE_NOTIFIER' in process.env || + process.env.NODE_ENV === 'test' || + process.argv.includes('--no-update-notifier') || + isCi(); + this.shouldNotifyInNpmScript = options.shouldNotifyInNpmScript; + + if (!this.disabled) { + try { + const ConfigStore = configstore(); + this.config = new ConfigStore(`update-notifier-${this.packageName}`, { + optOut: false, + // Init with the current time so the first check is only + // after the set interval, so not to bother users right away + lastUpdateCheck: Date.now() + }); + } catch { + // Expecting error code EACCES or EPERM + const message = + chalk().yellow(format(' %s update check failed ', options.pkg.name)) + + format('\n Try running with %s or get access ', chalk().cyan('sudo')) + + '\n to the local update config store via \n' + + chalk().cyan(format(' sudo chown -R $USER:$(id -gn $USER) %s ', xdgBasedir().config)); + + process.on('exit', () => { + console.error(boxen()(message, {align: 'center'})); + }); + } + } + } + + check() { + if ( + !this.config || + this.config.get('optOut') || + this.disabled + ) { + return; + } + + this.update = this.config.get('update'); + + if (this.update) { + // Use the real latest version instead of the cached one + this.update.current = this.packageVersion; + + // Clear cached information + this.config.delete('update'); + } + + // Only check for updates on a set interval + if (Date.now() - this.config.get('lastUpdateCheck') < this.updateCheckInterval) { + return; + } + + // Spawn a detached process, passing the options as an environment property + spawn(process.execPath, [path.join(__dirname, 'check.js'), JSON.stringify(this.options)], { + detached: true, + stdio: 'ignore' + }).unref(); + } + + async fetchInfo() { + const {distTag} = this.options; + const latest = await latestVersion()(this.packageName, {version: distTag}); + + return { + latest, + current: this.packageVersion, + type: semverDiff()(this.packageVersion, latest) || distTag, + name: this.packageName + }; + } + + notify(options) { + const suppressForNpm = !this.shouldNotifyInNpmScript && isNpm().isNpmOrYarn; + if (!process.stdout.isTTY || suppressForNpm || !this.update || !semver().gt(this.update.latest, this.update.current)) { + return this; + } + + options = { + isGlobal: isInstalledGlobally(), + isYarnGlobal: isYarnGlobal()(), + ...options + }; + + let installCommand; + if (options.isYarnGlobal) { + installCommand = `yarn global add ${this.packageName}`; + } else if (options.isGlobal) { + installCommand = `npm i -g ${this.packageName}`; + } else if (hasYarn()()) { + installCommand = `yarn add ${this.packageName}`; + } else { + installCommand = `npm i ${this.packageName}`; + } + + const defaultTemplate = 'Update available ' + + chalk().dim('{currentVersion}') + + chalk().reset(' → ') + + chalk().green('{latestVersion}') + + ' \nRun ' + chalk().cyan('{updateCommand}') + ' to update'; + + const template = options.message || defaultTemplate; + + options.boxenOptions = options.boxenOptions || { + padding: 1, + margin: 1, + align: 'center', + borderColor: 'yellow', + borderStyle: 'round' + }; + + const message = boxen()( + pupa()(template, { + packageName: this.packageName, + currentVersion: this.update.current, + latestVersion: this.update.latest, + updateCommand: installCommand + }), + options.boxenOptions + ); + + if (options.defer === false) { + console.error(message); + } else { + process.on('exit', () => { + console.error(message); + }); + + process.on('SIGINT', () => { + console.error(''); + process.exit(); + }); + } + + return this; + } +} + +module.exports = options => { + const updateNotifier = new UpdateNotifier(options); + updateNotifier.check(); + return updateNotifier; +}; + +module.exports.UpdateNotifier = UpdateNotifier; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/update-notifier/license b/25_03_11/frontend_vizsgafeladat/backend/node_modules/update-notifier/license new file mode 100644 index 00000000..cea5a355 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/update-notifier/license @@ -0,0 +1,9 @@ +Copyright Google + +Redistribution and use in source and binary forms, with or without modification, are permitted provided that the following conditions are met: + +1. Redistributions of source code must retain the above copyright notice, this list of conditions and the following disclaimer. + +2. Redistributions in binary form must reproduce the above copyright notice, this list of conditions and the following disclaimer in the documentation and/or other materials provided with the distribution. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/update-notifier/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/update-notifier/package.json new file mode 100644 index 00000000..62107a01 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/update-notifier/package.json @@ -0,0 +1,92 @@ +{ + "_from": "update-notifier@^5.1.0", + "_id": "update-notifier@5.1.0", + "_inBundle": false, + "_integrity": "sha512-ItnICHbeMh9GqUy31hFPrD1kcuZ3rpxDZbf4KUDavXwS0bW5m7SLbDQpGX3UYr072cbrF5hFUs3r5tUsPwjfHw==", + "_location": "/update-notifier", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "update-notifier@^5.1.0", + "name": "update-notifier", + "escapedName": "update-notifier", + "rawSpec": "^5.1.0", + "saveSpec": null, + "fetchSpec": "^5.1.0" + }, + "_requiredBy": [ + "/nodemon" + ], + "_resolved": "https://registry.npmjs.org/update-notifier/-/update-notifier-5.1.0.tgz", + "_shasum": "4ab0d7c7f36a231dd7316cf7729313f0214d9ad9", + "_spec": "update-notifier@^5.1.0", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\nodemon", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "https://sindresorhus.com" + }, + "bugs": { + "url": "https://github.com/yeoman/update-notifier/issues" + }, + "bundleDependencies": false, + "dependencies": { + "boxen": "^5.0.0", + "chalk": "^4.1.0", + "configstore": "^5.0.1", + "has-yarn": "^2.1.0", + "import-lazy": "^2.1.0", + "is-ci": "^2.0.0", + "is-installed-globally": "^0.4.0", + "is-npm": "^5.0.0", + "is-yarn-global": "^0.3.0", + "latest-version": "^5.1.0", + "pupa": "^2.1.1", + "semver": "^7.3.4", + "semver-diff": "^3.1.1", + "xdg-basedir": "^4.0.0" + }, + "deprecated": false, + "description": "Update notifications for your CLI app", + "devDependencies": { + "ava": "^2.4.0", + "clear-module": "^4.1.1", + "fixture-stdout": "^0.2.1", + "mock-require": "^3.0.3", + "strip-ansi": "^6.0.0", + "xo": "^0.37.1" + }, + "engines": { + "node": ">=10" + }, + "files": [ + "index.js", + "check.js" + ], + "funding": "https://github.com/yeoman/update-notifier?sponsor=1", + "homepage": "https://github.com/yeoman/update-notifier#readme", + "keywords": [ + "npm", + "update", + "updater", + "notify", + "notifier", + "check", + "checker", + "cli", + "module", + "package", + "version" + ], + "license": "BSD-2-Clause", + "name": "update-notifier", + "repository": { + "type": "git", + "url": "git+https://github.com/yeoman/update-notifier.git" + }, + "scripts": { + "test": "xo && ava --timeout=20s --serial" + }, + "version": "5.1.0" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/update-notifier/readme.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/update-notifier/readme.md new file mode 100644 index 00000000..140c987a --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/update-notifier/readme.md @@ -0,0 +1,223 @@ +# update-notifier + +> Update notifications for your CLI app + +![](screenshot.png) + +Inform users of your package of updates in a non-intrusive way. + +#### Contents + +- [Install](#install) +- [Usage](#usage) +- [How](#how) +- [API](#api) +- [About](#about) +- [Users](#users) + +## Install + +``` +$ npm install update-notifier +``` + +## Usage + +### Simple + +```js +const updateNotifier = require('update-notifier'); +const pkg = require('./package.json'); + +updateNotifier({pkg}).notify(); +``` + +### Comprehensive + +```js +const updateNotifier = require('update-notifier'); +const pkg = require('./package.json'); + +// Checks for available update and returns an instance +const notifier = updateNotifier({pkg}); + +// Notify using the built-in convenience method +notifier.notify(); + +// `notifier.update` contains some useful info about the update +console.log(notifier.update); +/* +{ + latest: '1.0.1', + current: '1.0.0', + type: 'patch', // Possible values: latest, major, minor, patch, prerelease, build + name: 'pageres' +} +*/ +``` + +### Options and custom message + +```js +const notifier = updateNotifier({ + pkg, + updateCheckInterval: 1000 * 60 * 60 * 24 * 7 // 1 week +}); + +if (notifier.update) { + console.log(`Update available: ${notifier.update.latest}`); +} +``` + +## How + +Whenever you initiate the update notifier and it's not within the interval threshold, it will asynchronously check with npm in the background for available updates, then persist the result. The next time the notifier is initiated, the result will be loaded into the `.update` property. This prevents any impact on your package startup performance. +The update check is done in a unref'ed [child process](https://nodejs.org/api/child_process.html#child_process_child_process_spawn_command_args_options). This means that if you call `process.exit`, the check will still be performed in its own process. + +The first time the user runs your app, it will check for an update, and even if an update is available, it will wait the specified `updateCheckInterval` before notifying the user. This is done to not be annoying to the user, but might surprise you as an implementer if you're testing whether it works. Check out [`example.js`](example.js) to quickly test out `update-notifier` and see how you can test that it works in your app. + +## API + +### notifier = updateNotifier(options) + +Checks if there is an available update. Accepts options defined below. Returns an instance with an `.update` property if there is an available update, otherwise `undefined`. + +### options + +Type: `object` + +#### pkg + +Type: `object` + +##### name + +*Required*\ +Type: `string` + +##### version + +*Required*\ +Type: `string` + +#### updateCheckInterval + +Type: `number`\ +Default: `1000 * 60 * 60 * 24` *(1 day)* + +How often to check for updates. + +#### shouldNotifyInNpmScript + +Type: `boolean`\ +Default: `false` + +Allows notification to be shown when running as an npm script. + +#### distTag + +Type: `string`\ +Default: `'latest'` + +Which [dist-tag](https://docs.npmjs.com/adding-dist-tags-to-packages) to use to find the latest version. + +### notifier.fetchInfo() + +Check update information. + +Returns an `object` with: + +- `latest` _(String)_ - Latest version. +- `current` _(String)_ - Current version. +- `type` _(String)_ - Type of current update. Possible values: `latest`, `major`, `minor`, `patch`, `prerelease`, `build`. +- `name` _(String)_ - Package name. + +### notifier.notify(options?) + +Convenience method to display a notification message. *(See screenshot)* + +Only notifies if there is an update and the process is [TTY](https://nodejs.org/api/process.html#process_a_note_on_process_i_o). + +#### options + +Type: `object` + +##### defer + +Type: `boolean`\ +Default: `true` + +Defer showing the notification to after the process has exited. + +##### message + +Type: `string`\ +Default: [See above screenshot](https://github.com/yeoman/update-notifier#update-notifier-) + +Message that will be shown when an update is available. + +Available placeholders: + +- `{packageName}` - Package name. +- `{currentVersion}` - Current version. +- `{latestVersion}` - Latest version. +- `{updateCommand}` - Update command. + +```js +notifier.notify({message: 'Run `{updateCommand}` to update.'}); + +// Output: +// Run `npm install update-notifier-tester@1.0.0` to update. +``` + +##### isGlobal + +Type: `boolean`\ +Default: Auto-detect + +Include the `-g` argument in the default message's `npm i` recommendation. You may want to change this if your CLI package can be installed as a dependency of another project, and don't want to recommend a global installation. This option is ignored if you supply your own `message` (see above). + +##### boxenOptions + +Type: `object`\ +Default: `{padding: 1, margin: 1, align: 'center', borderColor: 'yellow', borderStyle: 'round'}` *(See screenshot)* + +Options object that will be passed to [`boxen`](https://github.com/sindresorhus/boxen). + +### User settings + +Users of your module have the ability to opt-out of the update notifier by changing the `optOut` property to `true` in `~/.config/configstore/update-notifier-[your-module-name].json`. The path is available in `notifier.config.path`. + +Users can also opt-out by [setting the environment variable](https://github.com/sindresorhus/guides/blob/main/set-environment-variables.md) `NO_UPDATE_NOTIFIER` with any value or by using the `--no-update-notifier` flag on a per run basis. + +The check is also skipped automatically: + - on CI + - in unit tests (when the `NODE_ENV` environment variable is `test`) + +## About + +The idea for this module came from the desire to apply the browser update strategy to CLI tools, where everyone is always on the latest version. We first tried automatic updating, which we discovered wasn't popular. This is the second iteration of that idea, but limited to just update notifications. + +## Users + +There are a bunch projects using it: + +- [npm](https://github.com/npm/npm) - Package manager for JavaScript +- [Yeoman](https://yeoman.io) - Modern workflows for modern webapps +- [AVA](https://avajs.dev) - Simple concurrent test runner +- [XO](https://github.com/xojs/xo) - JavaScript happiness style linter +- [Node GH](https://github.com/node-gh/gh) - GitHub command line tool + +[And 2700+ more…](https://www.npmjs.org/browse/depended/update-notifier) + +--- + +
+ + Get professional support for this package with a Tidelift subscription + +
+ + Tidelift helps make open source sustainable for maintainers while giving companies
assurances about security, maintenance, and licensing for their dependencies. + +
diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/url-parse-lax/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/url-parse-lax/index.js new file mode 100644 index 00000000..5c62a589 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/url-parse-lax/index.js @@ -0,0 +1,12 @@ +'use strict'; +const url = require('url'); +const prependHttp = require('prepend-http'); + +module.exports = (input, options) => { + if (typeof input !== 'string') { + throw new TypeError(`Expected \`url\` to be of type \`string\`, got \`${typeof input}\` instead.`); + } + + const finalUrl = prependHttp(input, Object.assign({https: true}, options)); + return url.parse(finalUrl); +}; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/url-parse-lax/license b/25_03_11/frontend_vizsgafeladat/backend/node_modules/url-parse-lax/license new file mode 100644 index 00000000..e7af2f77 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/url-parse-lax/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/url-parse-lax/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/url-parse-lax/package.json new file mode 100644 index 00000000..29e62734 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/url-parse-lax/package.json @@ -0,0 +1,74 @@ +{ + "_from": "url-parse-lax@^3.0.0", + "_id": "url-parse-lax@3.0.0", + "_inBundle": false, + "_integrity": "sha1-FrXK/Afb42dsGxmZF3gj1lA6yww=", + "_location": "/url-parse-lax", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "url-parse-lax@^3.0.0", + "name": "url-parse-lax", + "escapedName": "url-parse-lax", + "rawSpec": "^3.0.0", + "saveSpec": null, + "fetchSpec": "^3.0.0" + }, + "_requiredBy": [ + "/got" + ], + "_resolved": "https://registry.npmjs.org/url-parse-lax/-/url-parse-lax-3.0.0.tgz", + "_shasum": "16b5cafc07dbe3676c1b1999177823d6503acb0c", + "_spec": "url-parse-lax@^3.0.0", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\got", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "sindresorhus.com" + }, + "bugs": { + "url": "https://github.com/sindresorhus/url-parse-lax/issues" + }, + "bundleDependencies": false, + "dependencies": { + "prepend-http": "^2.0.0" + }, + "deprecated": false, + "description": "Lax url.parse() with support for protocol-less URLs & IPs", + "devDependencies": { + "ava": "*", + "xo": "*" + }, + "engines": { + "node": ">=4" + }, + "files": [ + "index.js" + ], + "homepage": "https://github.com/sindresorhus/url-parse-lax#readme", + "keywords": [ + "url", + "uri", + "parse", + "parser", + "loose", + "lax", + "protocol", + "less", + "protocol-less", + "ip", + "ipv4", + "ipv6" + ], + "license": "MIT", + "name": "url-parse-lax", + "repository": { + "type": "git", + "url": "git+https://github.com/sindresorhus/url-parse-lax.git" + }, + "scripts": { + "test": "xo && ava" + }, + "version": "3.0.0" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/url-parse-lax/readme.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/url-parse-lax/readme.md new file mode 100644 index 00000000..be0d4371 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/url-parse-lax/readme.md @@ -0,0 +1,127 @@ +# url-parse-lax [![Build Status](https://travis-ci.org/sindresorhus/url-parse-lax.svg?branch=master)](https://travis-ci.org/sindresorhus/url-parse-lax) + +> Lax [`url.parse()`](https://nodejs.org/docs/latest/api/url.html#url_url_parse_urlstr_parsequerystring_slashesdenotehost) with support for protocol-less URLs & IPs + + +## Install + +``` +$ npm install url-parse-lax +``` + + +## Usage + +```js +const urlParseLax = require('url-parse-lax'); + +urlParseLax('sindresorhus.com'); +/* +{ + protocol: 'https:', + slashes: true, + auth: null, + host: 'sindresorhus.com', + port: null, + hostname: 'sindresorhus.com', + hash: null, + search: null, + query: null, + pathname: '/', + path: '/', + href: 'https://sindresorhus.com/' +} +*/ + +urlParseLax('[2001:db8::]:8000'); +/* +{ + protocol: null, + slashes: true, + auth: null, + host: '[2001:db8::]:8000', + port: '8000', + hostname: '2001:db8::', + hash: null, + search: null, + query: null, + pathname: '/', + path: '/', + href: 'http://[2001:db8::]:8000/' +} +*/ +``` + +And with the built-in `url.parse()`: + +```js +const url = require('url'); + +url.parse('sindresorhus.com'); +/* +{ + protocol: null, + slashes: null, + auth: null, + host: null, + port: null, + hostname: null, + hash: null, + search: null, + query: null, + pathname: 'sindresorhus', + path: 'sindresorhus', + href: 'sindresorhus' +} +*/ + +url.parse('[2001:db8::]:8000'); +/* +{ + protocol: null, + slashes: null, + auth: null, + host: null, + port: null, + hostname: null, + hash: null, + search: null, + query: null, + pathname: '[2001:db8::]:8000', + path: '[2001:db8::]:8000', + href: '[2001:db8::]:8000' +} +*/ +``` + + +## API + +### urlParseLax(url, [options]) + +#### url + +Type: `string` + +URL to parse. + +#### options + +Type: `Object` + +##### https + +Type: `boolean`
+Default: `true` + +Prepend `https://` instead of `http://` to protocol-less URLs. + + +## Related + +- [url-format-lax](https://github.com/sindresorhus/url-format-lax) - Lax `url.format()` that formats a hostname and port into IPv6-compatible socket form of `hostname:port` + + +## License + +MIT © [Sindre Sorhus](https://sindresorhus.com) diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/util-deprecate/History.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/util-deprecate/History.md new file mode 100644 index 00000000..acc86753 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/util-deprecate/History.md @@ -0,0 +1,16 @@ + +1.0.2 / 2015-10-07 +================== + + * use try/catch when checking `localStorage` (#3, @kumavis) + +1.0.1 / 2014-11-25 +================== + + * browser: use `console.warn()` for deprecation calls + * browser: more jsdocs + +1.0.0 / 2014-04-30 +================== + + * initial commit diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/util-deprecate/LICENSE b/25_03_11/frontend_vizsgafeladat/backend/node_modules/util-deprecate/LICENSE new file mode 100644 index 00000000..6a60e8c2 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/util-deprecate/LICENSE @@ -0,0 +1,24 @@ +(The MIT License) + +Copyright (c) 2014 Nathan Rajlich + +Permission is hereby granted, free of charge, to any person +obtaining a copy of this software and associated documentation +files (the "Software"), to deal in the Software without +restriction, including without limitation the rights to use, +copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the +Software is furnished to do so, subject to the following +conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES +OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT +HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +OTHER DEALINGS IN THE SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/util-deprecate/README.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/util-deprecate/README.md new file mode 100644 index 00000000..75622fa7 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/util-deprecate/README.md @@ -0,0 +1,53 @@ +util-deprecate +============== +### The Node.js `util.deprecate()` function with browser support + +In Node.js, this module simply re-exports the `util.deprecate()` function. + +In the web browser (i.e. via browserify), a browser-specific implementation +of the `util.deprecate()` function is used. + + +## API + +A `deprecate()` function is the only thing exposed by this module. + +``` javascript +// setup: +exports.foo = deprecate(foo, 'foo() is deprecated, use bar() instead'); + + +// users see: +foo(); +// foo() is deprecated, use bar() instead +foo(); +foo(); +``` + + +## License + +(The MIT License) + +Copyright (c) 2014 Nathan Rajlich + +Permission is hereby granted, free of charge, to any person +obtaining a copy of this software and associated documentation +files (the "Software"), to deal in the Software without +restriction, including without limitation the rights to use, +copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the +Software is furnished to do so, subject to the following +conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES +OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT +HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +OTHER DEALINGS IN THE SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/util-deprecate/browser.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/util-deprecate/browser.js new file mode 100644 index 00000000..549ae2f0 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/util-deprecate/browser.js @@ -0,0 +1,67 @@ + +/** + * Module exports. + */ + +module.exports = deprecate; + +/** + * Mark that a method should not be used. + * Returns a modified function which warns once by default. + * + * If `localStorage.noDeprecation = true` is set, then it is a no-op. + * + * If `localStorage.throwDeprecation = true` is set, then deprecated functions + * will throw an Error when invoked. + * + * If `localStorage.traceDeprecation = true` is set, then deprecated functions + * will invoke `console.trace()` instead of `console.error()`. + * + * @param {Function} fn - the function to deprecate + * @param {String} msg - the string to print to the console when `fn` is invoked + * @returns {Function} a new "deprecated" version of `fn` + * @api public + */ + +function deprecate (fn, msg) { + if (config('noDeprecation')) { + return fn; + } + + var warned = false; + function deprecated() { + if (!warned) { + if (config('throwDeprecation')) { + throw new Error(msg); + } else if (config('traceDeprecation')) { + console.trace(msg); + } else { + console.warn(msg); + } + warned = true; + } + return fn.apply(this, arguments); + } + + return deprecated; +} + +/** + * Checks `localStorage` for boolean values for the given `name`. + * + * @param {String} name + * @returns {Boolean} + * @api private + */ + +function config (name) { + // accessing global.localStorage can trigger a DOMException in sandboxed iframes + try { + if (!global.localStorage) return false; + } catch (_) { + return false; + } + var val = global.localStorage[name]; + if (null == val) return false; + return String(val).toLowerCase() === 'true'; +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/util-deprecate/node.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/util-deprecate/node.js new file mode 100644 index 00000000..5e6fcff5 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/util-deprecate/node.js @@ -0,0 +1,6 @@ + +/** + * For Node.js, simply re-export the core `util.deprecate` function. + */ + +module.exports = require('util').deprecate; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/util-deprecate/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/util-deprecate/package.json new file mode 100644 index 00000000..9c3995a7 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/util-deprecate/package.json @@ -0,0 +1,56 @@ +{ + "_from": "util-deprecate@^1.0.1", + "_id": "util-deprecate@1.0.2", + "_inBundle": false, + "_integrity": "sha1-RQ1Nyfpw3nMnYvvS1KKJgUGaDM8=", + "_location": "/util-deprecate", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "util-deprecate@^1.0.1", + "name": "util-deprecate", + "escapedName": "util-deprecate", + "rawSpec": "^1.0.1", + "saveSpec": null, + "fetchSpec": "^1.0.1" + }, + "_requiredBy": [ + "/readable-stream" + ], + "_resolved": "https://registry.npmjs.org/util-deprecate/-/util-deprecate-1.0.2.tgz", + "_shasum": "450d4dc9fa70de732762fbd2d4a28981419a0ccf", + "_spec": "util-deprecate@^1.0.1", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\readable-stream", + "author": { + "name": "Nathan Rajlich", + "email": "nathan@tootallnate.net", + "url": "http://n8.io/" + }, + "browser": "browser.js", + "bugs": { + "url": "https://github.com/TooTallNate/util-deprecate/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "The Node.js `util.deprecate()` function with browser support", + "homepage": "https://github.com/TooTallNate/util-deprecate", + "keywords": [ + "util", + "deprecate", + "browserify", + "browser", + "node" + ], + "license": "MIT", + "main": "node.js", + "name": "util-deprecate", + "repository": { + "type": "git", + "url": "git://github.com/TooTallNate/util-deprecate.git" + }, + "scripts": { + "test": "echo \"Error: no test specified\" && exit 1" + }, + "version": "1.0.2" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/utils-merge/.npmignore b/25_03_11/frontend_vizsgafeladat/backend/node_modules/utils-merge/.npmignore new file mode 100644 index 00000000..3e538441 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/utils-merge/.npmignore @@ -0,0 +1,9 @@ +CONTRIBUTING.md +Makefile +docs/ +examples/ +reports/ +test/ + +.jshintrc +.travis.yml diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/utils-merge/LICENSE b/25_03_11/frontend_vizsgafeladat/backend/node_modules/utils-merge/LICENSE new file mode 100644 index 00000000..76f6d083 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/utils-merge/LICENSE @@ -0,0 +1,20 @@ +The MIT License (MIT) + +Copyright (c) 2013-2017 Jared Hanson + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of +the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS +FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR +COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER +IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/utils-merge/README.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/utils-merge/README.md new file mode 100644 index 00000000..0cb71171 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/utils-merge/README.md @@ -0,0 +1,34 @@ +# utils-merge + +[![Version](https://img.shields.io/npm/v/utils-merge.svg?label=version)](https://www.npmjs.com/package/utils-merge) +[![Build](https://img.shields.io/travis/jaredhanson/utils-merge.svg)](https://travis-ci.org/jaredhanson/utils-merge) +[![Quality](https://img.shields.io/codeclimate/github/jaredhanson/utils-merge.svg?label=quality)](https://codeclimate.com/github/jaredhanson/utils-merge) +[![Coverage](https://img.shields.io/coveralls/jaredhanson/utils-merge.svg)](https://coveralls.io/r/jaredhanson/utils-merge) +[![Dependencies](https://img.shields.io/david/jaredhanson/utils-merge.svg)](https://david-dm.org/jaredhanson/utils-merge) + + +Merges the properties from a source object into a destination object. + +## Install + +```bash +$ npm install utils-merge +``` + +## Usage + +```javascript +var a = { foo: 'bar' } + , b = { bar: 'baz' }; + +merge(a, b); +// => { foo: 'bar', bar: 'baz' } +``` + +## License + +[The MIT License](http://opensource.org/licenses/MIT) + +Copyright (c) 2013-2017 Jared Hanson <[http://jaredhanson.net/](http://jaredhanson.net/)> + + Sponsor diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/utils-merge/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/utils-merge/index.js new file mode 100644 index 00000000..4265c694 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/utils-merge/index.js @@ -0,0 +1,23 @@ +/** + * Merge object b with object a. + * + * var a = { foo: 'bar' } + * , b = { bar: 'baz' }; + * + * merge(a, b); + * // => { foo: 'bar', bar: 'baz' } + * + * @param {Object} a + * @param {Object} b + * @return {Object} + * @api public + */ + +exports = module.exports = function(a, b){ + if (a && b) { + for (var key in b) { + a[key] = b[key]; + } + } + return a; +}; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/utils-merge/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/utils-merge/package.json new file mode 100644 index 00000000..e03ca09b --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/utils-merge/package.json @@ -0,0 +1,66 @@ +{ + "_from": "utils-merge@1.0.1", + "_id": "utils-merge@1.0.1", + "_inBundle": false, + "_integrity": "sha1-n5VxD1CiZ5R7LMwSR0HBAoQn5xM=", + "_location": "/utils-merge", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "utils-merge@1.0.1", + "name": "utils-merge", + "escapedName": "utils-merge", + "rawSpec": "1.0.1", + "saveSpec": null, + "fetchSpec": "1.0.1" + }, + "_requiredBy": [ + "/express" + ], + "_resolved": "https://registry.npmjs.org/utils-merge/-/utils-merge-1.0.1.tgz", + "_shasum": "9f95710f50a267947b2ccc124741c1028427e713", + "_spec": "utils-merge@1.0.1", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\express", + "author": { + "name": "Jared Hanson", + "email": "jaredhanson@gmail.com", + "url": "http://www.jaredhanson.net/" + }, + "bugs": { + "url": "http://github.com/jaredhanson/utils-merge/issues" + }, + "bundleDependencies": false, + "dependencies": {}, + "deprecated": false, + "description": "merge() utility function", + "devDependencies": { + "chai": "1.x.x", + "make-node": "0.3.x", + "mocha": "1.x.x" + }, + "engines": { + "node": ">= 0.4.0" + }, + "homepage": "https://github.com/jaredhanson/utils-merge#readme", + "keywords": [ + "util" + ], + "license": "MIT", + "licenses": [ + { + "type": "MIT", + "url": "http://opensource.org/licenses/MIT" + } + ], + "main": "./index", + "name": "utils-merge", + "repository": { + "type": "git", + "url": "git://github.com/jaredhanson/utils-merge.git" + }, + "scripts": { + "test": "mocha --reporter spec --require test/bootstrap/node test/*.test.js" + }, + "version": "1.0.1" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/vary/HISTORY.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/vary/HISTORY.md new file mode 100644 index 00000000..f6cbcf7f --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/vary/HISTORY.md @@ -0,0 +1,39 @@ +1.1.2 / 2017-09-23 +================== + + * perf: improve header token parsing speed + +1.1.1 / 2017-03-20 +================== + + * perf: hoist regular expression + +1.1.0 / 2015-09-29 +================== + + * Only accept valid field names in the `field` argument + - Ensures the resulting string is a valid HTTP header value + +1.0.1 / 2015-07-08 +================== + + * Fix setting empty header from empty `field` + * perf: enable strict mode + * perf: remove argument reassignments + +1.0.0 / 2014-08-10 +================== + + * Accept valid `Vary` header string as `field` + * Add `vary.append` for low-level string manipulation + * Move to `jshttp` orgainzation + +0.1.0 / 2014-06-05 +================== + + * Support array of fields to set + +0.0.0 / 2014-06-04 +================== + + * Initial release diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/vary/LICENSE b/25_03_11/frontend_vizsgafeladat/backend/node_modules/vary/LICENSE new file mode 100644 index 00000000..84441fbb --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/vary/LICENSE @@ -0,0 +1,22 @@ +(The MIT License) + +Copyright (c) 2014-2017 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/vary/README.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/vary/README.md new file mode 100644 index 00000000..cc000b34 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/vary/README.md @@ -0,0 +1,101 @@ +# vary + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Manipulate the HTTP Vary header + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install vary +``` + +## API + + + +```js +var vary = require('vary') +``` + +### vary(res, field) + +Adds the given header `field` to the `Vary` response header of `res`. +This can be a string of a single field, a string of a valid `Vary` +header, or an array of multiple fields. + +This will append the header if not already listed, otherwise leaves +it listed in the current location. + + + +```js +// Append "Origin" to the Vary header of the response +vary(res, 'Origin') +``` + +### vary.append(header, field) + +Adds the given header `field` to the `Vary` response header string `header`. +This can be a string of a single field, a string of a valid `Vary` header, +or an array of multiple fields. + +This will append the header if not already listed, otherwise leaves +it listed in the current location. The new header string is returned. + + + +```js +// Get header string appending "Origin" to "Accept, User-Agent" +vary.append('Accept, User-Agent', 'Origin') +``` + +## Examples + +### Updating the Vary header when content is based on it + +```js +var http = require('http') +var vary = require('vary') + +http.createServer(function onRequest (req, res) { + // about to user-agent sniff + vary(res, 'User-Agent') + + var ua = req.headers['user-agent'] || '' + var isMobile = /mobi|android|touch|mini/i.test(ua) + + // serve site, depending on isMobile + res.setHeader('Content-Type', 'text/html') + res.end('You are (probably) ' + (isMobile ? '' : 'not ') + 'a mobile user') +}) +``` + +## Testing + +```sh +$ npm test +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/vary.svg +[npm-url]: https://npmjs.org/package/vary +[node-version-image]: https://img.shields.io/node/v/vary.svg +[node-version-url]: https://nodejs.org/en/download +[travis-image]: https://img.shields.io/travis/jshttp/vary/master.svg +[travis-url]: https://travis-ci.org/jshttp/vary +[coveralls-image]: https://img.shields.io/coveralls/jshttp/vary/master.svg +[coveralls-url]: https://coveralls.io/r/jshttp/vary +[downloads-image]: https://img.shields.io/npm/dm/vary.svg +[downloads-url]: https://npmjs.org/package/vary diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/vary/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/vary/index.js new file mode 100644 index 00000000..5b5e7412 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/vary/index.js @@ -0,0 +1,149 @@ +/*! + * vary + * Copyright(c) 2014-2017 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module exports. + */ + +module.exports = vary +module.exports.append = append + +/** + * RegExp to match field-name in RFC 7230 sec 3.2 + * + * field-name = token + * token = 1*tchar + * tchar = "!" / "#" / "$" / "%" / "&" / "'" / "*" + * / "+" / "-" / "." / "^" / "_" / "`" / "|" / "~" + * / DIGIT / ALPHA + * ; any VCHAR, except delimiters + */ + +var FIELD_NAME_REGEXP = /^[!#$%&'*+\-.^_`|~0-9A-Za-z]+$/ + +/** + * Append a field to a vary header. + * + * @param {String} header + * @param {String|Array} field + * @return {String} + * @public + */ + +function append (header, field) { + if (typeof header !== 'string') { + throw new TypeError('header argument is required') + } + + if (!field) { + throw new TypeError('field argument is required') + } + + // get fields array + var fields = !Array.isArray(field) + ? parse(String(field)) + : field + + // assert on invalid field names + for (var j = 0; j < fields.length; j++) { + if (!FIELD_NAME_REGEXP.test(fields[j])) { + throw new TypeError('field argument contains an invalid header name') + } + } + + // existing, unspecified vary + if (header === '*') { + return header + } + + // enumerate current values + var val = header + var vals = parse(header.toLowerCase()) + + // unspecified vary + if (fields.indexOf('*') !== -1 || vals.indexOf('*') !== -1) { + return '*' + } + + for (var i = 0; i < fields.length; i++) { + var fld = fields[i].toLowerCase() + + // append value (case-preserving) + if (vals.indexOf(fld) === -1) { + vals.push(fld) + val = val + ? val + ', ' + fields[i] + : fields[i] + } + } + + return val +} + +/** + * Parse a vary header into an array. + * + * @param {String} header + * @return {Array} + * @private + */ + +function parse (header) { + var end = 0 + var list = [] + var start = 0 + + // gather tokens + for (var i = 0, len = header.length; i < len; i++) { + switch (header.charCodeAt(i)) { + case 0x20: /* */ + if (start === end) { + start = end = i + 1 + } + break + case 0x2c: /* , */ + list.push(header.substring(start, end)) + start = end = i + 1 + break + default: + end = i + 1 + break + } + } + + // final token + list.push(header.substring(start, end)) + + return list +} + +/** + * Mark that a request is varied on a header field. + * + * @param {Object} res + * @param {String|Array} field + * @public + */ + +function vary (res, field) { + if (!res || !res.getHeader || !res.setHeader) { + // quack quack + throw new TypeError('res argument is required') + } + + // get existing header + var val = res.getHeader('Vary') || '' + var header = Array.isArray(val) + ? val.join(', ') + : String(val) + + // set new header + if ((val = append(header, field))) { + res.setHeader('Vary', val) + } +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/vary/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/vary/package.json new file mode 100644 index 00000000..12d2417b --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/vary/package.json @@ -0,0 +1,79 @@ +{ + "_from": "vary@^1", + "_id": "vary@1.1.2", + "_inBundle": false, + "_integrity": "sha1-IpnwLG3tMNSllhsLn3RSShj2NPw=", + "_location": "/vary", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "vary@^1", + "name": "vary", + "escapedName": "vary", + "rawSpec": "^1", + "saveSpec": null, + "fetchSpec": "^1" + }, + "_requiredBy": [ + "/cors", + "/express" + ], + "_resolved": "https://registry.npmjs.org/vary/-/vary-1.1.2.tgz", + "_shasum": "2299f02c6ded30d4a5961b0b9f74524a18f634fc", + "_spec": "vary@^1", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\cors", + "author": { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + "bugs": { + "url": "https://github.com/jshttp/vary/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Manipulate the HTTP Vary header", + "devDependencies": { + "beautify-benchmark": "0.2.4", + "benchmark": "2.1.4", + "eslint": "3.19.0", + "eslint-config-standard": "10.2.1", + "eslint-plugin-import": "2.7.0", + "eslint-plugin-markdown": "1.0.0-beta.6", + "eslint-plugin-node": "5.1.1", + "eslint-plugin-promise": "3.5.0", + "eslint-plugin-standard": "3.0.1", + "istanbul": "0.4.5", + "mocha": "2.5.3", + "supertest": "1.1.0" + }, + "engines": { + "node": ">= 0.8" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "README.md", + "index.js" + ], + "homepage": "https://github.com/jshttp/vary#readme", + "keywords": [ + "http", + "res", + "vary" + ], + "license": "MIT", + "name": "vary", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/vary.git" + }, + "scripts": { + "bench": "node benchmark/index.js", + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/" + }, + "version": "1.1.2" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/webidl-conversions/LICENSE.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/webidl-conversions/LICENSE.md new file mode 100644 index 00000000..d4a994f5 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/webidl-conversions/LICENSE.md @@ -0,0 +1,12 @@ +# The BSD 2-Clause License + +Copyright (c) 2014, Domenic Denicola +All rights reserved. + +Redistribution and use in source and binary forms, with or without modification, are permitted provided that the following conditions are met: + +1. Redistributions of source code must retain the above copyright notice, this list of conditions and the following disclaimer. + +2. Redistributions in binary form must reproduce the above copyright notice, this list of conditions and the following disclaimer in the documentation and/or other materials provided with the distribution. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/webidl-conversions/README.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/webidl-conversions/README.md new file mode 100644 index 00000000..3657890a --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/webidl-conversions/README.md @@ -0,0 +1,53 @@ +# WebIDL Type Conversions on JavaScript Values + +This package implements, in JavaScript, the algorithms to convert a given JavaScript value according to a given [WebIDL](http://heycam.github.io/webidl/) [type](http://heycam.github.io/webidl/#idl-types). + +The goal is that you should be able to write code like + +```js +const conversions = require("webidl-conversions"); + +function doStuff(x, y) { + x = conversions["boolean"](x); + y = conversions["unsigned long"](y); + // actual algorithm code here +} +``` + +and your function `doStuff` will behave the same as a WebIDL operation declared as + +```webidl +void doStuff(boolean x, unsigned long y); +``` + +## API + +This package's main module's default export is an object with a variety of methods, each corresponding to a different WebIDL type. Each method, when invoked on a JavaScript value, will give back the new JavaScript value that results after passing through the WebIDL conversion rules. (See below for more details on what that means.) Alternately, the method could throw an error, if the WebIDL algorithm is specified to do so: for example `conversions["float"](NaN)` [will throw a `TypeError`](http://heycam.github.io/webidl/#es-float). + +## Status + +All of the numeric types are implemented (float being implemented as double) and some others are as well - check the source for all of them. This list will grow over time in service of the [HTML as Custom Elements](https://github.com/dglazkov/html-as-custom-elements) project, but in the meantime, pull requests welcome! + +I'm not sure yet what the strategy will be for modifiers, e.g. [`[Clamp]`](http://heycam.github.io/webidl/#Clamp). Maybe something like `conversions["unsigned long"](x, { clamp: true })`? We'll see. + +We might also want to extend the API to give better error messages, e.g. "Argument 1 of HTMLMediaElement.fastSeek is not a finite floating-point value" instead of "Argument is not a finite floating-point value." This would require passing in more information to the conversion functions than we currently do. + +## Background + +What's actually going on here, conceptually, is pretty weird. Let's try to explain. + +WebIDL, as part of its madness-inducing design, has its own type system. When people write algorithms in web platform specs, they usually operate on WebIDL values, i.e. instances of WebIDL types. For example, if they were specifying the algorithm for our `doStuff` operation above, they would treat `x` as a WebIDL value of [WebIDL type `boolean`](http://heycam.github.io/webidl/#idl-boolean). Crucially, they would _not_ treat `x` as a JavaScript variable whose value is either the JavaScript `true` or `false`. They're instead working in a different type system altogether, with its own rules. + +Separately from its type system, WebIDL defines a ["binding"](http://heycam.github.io/webidl/#ecmascript-binding) of the type system into JavaScript. This contains rules like: when you pass a JavaScript value to the JavaScript method that manifests a given WebIDL operation, how does that get converted into a WebIDL value? For example, a JavaScript `true` passed in the position of a WebIDL `boolean` argument becomes a WebIDL `true`. But, a JavaScript `true` passed in the position of a [WebIDL `unsigned long`](http://heycam.github.io/webidl/#idl-unsigned-long) becomes a WebIDL `1`. And so on. + +Finally, we have the actual implementation code. This is usually C++, although these days [some smart people are using Rust](https://github.com/servo/servo). The implementation, of course, has its own type system. So when they implement the WebIDL algorithms, they don't actually use WebIDL values, since those aren't "real" outside of specs. Instead, implementations apply the WebIDL binding rules in such a way as to convert incoming JavaScript values into C++ values. For example, if code in the browser called `doStuff(true, true)`, then the implementation code would eventually receive a C++ `bool` containing `true` and a C++ `uint32_t` containing `1`. + +The upside of all this is that implementations can abstract all the conversion logic away, letting WebIDL handle it, and focus on implementing the relevant methods in C++ with values of the correct type already provided. That is payoff of WebIDL, in a nutshell. + +And getting to that payoff is the goal of _this_ project—but for JavaScript implementations, instead of C++ ones. That is, this library is designed to make it easier for JavaScript developers to write functions that behave like a given WebIDL operation. So conceptually, the conversion pipeline, which in its general form is JavaScript values ↦ WebIDL values ↦ implementation-language values, in this case becomes JavaScript values ↦ WebIDL values ↦ JavaScript values. And that intermediate step is where all the logic is performed: a JavaScript `true` becomes a WebIDL `1` in an unsigned long context, which then becomes a JavaScript `1`. + +## Don't Use This + +Seriously, why would you ever use this? You really shouldn't. WebIDL is … not great, and you shouldn't be emulating its semantics. If you're looking for a generic argument-processing library, you should find one with better rules than those from WebIDL. In general, your JavaScript should not be trying to become more like WebIDL; if anything, we should fix WebIDL to make it more like JavaScript. + +The _only_ people who should use this are those trying to create faithful implementations (or polyfills) of web platform interfaces defined in WebIDL. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/webidl-conversions/lib/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/webidl-conversions/lib/index.js new file mode 100644 index 00000000..c5153a3a --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/webidl-conversions/lib/index.js @@ -0,0 +1,189 @@ +"use strict"; + +var conversions = {}; +module.exports = conversions; + +function sign(x) { + return x < 0 ? -1 : 1; +} + +function evenRound(x) { + // Round x to the nearest integer, choosing the even integer if it lies halfway between two. + if ((x % 1) === 0.5 && (x & 1) === 0) { // [even number].5; round down (i.e. floor) + return Math.floor(x); + } else { + return Math.round(x); + } +} + +function createNumberConversion(bitLength, typeOpts) { + if (!typeOpts.unsigned) { + --bitLength; + } + const lowerBound = typeOpts.unsigned ? 0 : -Math.pow(2, bitLength); + const upperBound = Math.pow(2, bitLength) - 1; + + const moduloVal = typeOpts.moduloBitLength ? Math.pow(2, typeOpts.moduloBitLength) : Math.pow(2, bitLength); + const moduloBound = typeOpts.moduloBitLength ? Math.pow(2, typeOpts.moduloBitLength - 1) : Math.pow(2, bitLength - 1); + + return function(V, opts) { + if (!opts) opts = {}; + + let x = +V; + + if (opts.enforceRange) { + if (!Number.isFinite(x)) { + throw new TypeError("Argument is not a finite number"); + } + + x = sign(x) * Math.floor(Math.abs(x)); + if (x < lowerBound || x > upperBound) { + throw new TypeError("Argument is not in byte range"); + } + + return x; + } + + if (!isNaN(x) && opts.clamp) { + x = evenRound(x); + + if (x < lowerBound) x = lowerBound; + if (x > upperBound) x = upperBound; + return x; + } + + if (!Number.isFinite(x) || x === 0) { + return 0; + } + + x = sign(x) * Math.floor(Math.abs(x)); + x = x % moduloVal; + + if (!typeOpts.unsigned && x >= moduloBound) { + return x - moduloVal; + } else if (typeOpts.unsigned) { + if (x < 0) { + x += moduloVal; + } else if (x === -0) { // don't return negative zero + return 0; + } + } + + return x; + } +} + +conversions["void"] = function () { + return undefined; +}; + +conversions["boolean"] = function (val) { + return !!val; +}; + +conversions["byte"] = createNumberConversion(8, { unsigned: false }); +conversions["octet"] = createNumberConversion(8, { unsigned: true }); + +conversions["short"] = createNumberConversion(16, { unsigned: false }); +conversions["unsigned short"] = createNumberConversion(16, { unsigned: true }); + +conversions["long"] = createNumberConversion(32, { unsigned: false }); +conversions["unsigned long"] = createNumberConversion(32, { unsigned: true }); + +conversions["long long"] = createNumberConversion(32, { unsigned: false, moduloBitLength: 64 }); +conversions["unsigned long long"] = createNumberConversion(32, { unsigned: true, moduloBitLength: 64 }); + +conversions["double"] = function (V) { + const x = +V; + + if (!Number.isFinite(x)) { + throw new TypeError("Argument is not a finite floating-point value"); + } + + return x; +}; + +conversions["unrestricted double"] = function (V) { + const x = +V; + + if (isNaN(x)) { + throw new TypeError("Argument is NaN"); + } + + return x; +}; + +// not quite valid, but good enough for JS +conversions["float"] = conversions["double"]; +conversions["unrestricted float"] = conversions["unrestricted double"]; + +conversions["DOMString"] = function (V, opts) { + if (!opts) opts = {}; + + if (opts.treatNullAsEmptyString && V === null) { + return ""; + } + + return String(V); +}; + +conversions["ByteString"] = function (V, opts) { + const x = String(V); + let c = undefined; + for (let i = 0; (c = x.codePointAt(i)) !== undefined; ++i) { + if (c > 255) { + throw new TypeError("Argument is not a valid bytestring"); + } + } + + return x; +}; + +conversions["USVString"] = function (V) { + const S = String(V); + const n = S.length; + const U = []; + for (let i = 0; i < n; ++i) { + const c = S.charCodeAt(i); + if (c < 0xD800 || c > 0xDFFF) { + U.push(String.fromCodePoint(c)); + } else if (0xDC00 <= c && c <= 0xDFFF) { + U.push(String.fromCodePoint(0xFFFD)); + } else { + if (i === n - 1) { + U.push(String.fromCodePoint(0xFFFD)); + } else { + const d = S.charCodeAt(i + 1); + if (0xDC00 <= d && d <= 0xDFFF) { + const a = c & 0x3FF; + const b = d & 0x3FF; + U.push(String.fromCodePoint((2 << 15) + (2 << 9) * a + b)); + ++i; + } else { + U.push(String.fromCodePoint(0xFFFD)); + } + } + } + } + + return U.join(''); +}; + +conversions["Date"] = function (V, opts) { + if (!(V instanceof Date)) { + throw new TypeError("Argument is not a Date object"); + } + if (isNaN(V)) { + return undefined; + } + + return V; +}; + +conversions["RegExp"] = function (V, opts) { + if (!(V instanceof RegExp)) { + V = new RegExp(V); + } + + return V; +}; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/webidl-conversions/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/webidl-conversions/package.json new file mode 100644 index 00000000..27c18491 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/webidl-conversions/package.json @@ -0,0 +1,59 @@ +{ + "_from": "webidl-conversions@^3.0.0", + "_id": "webidl-conversions@3.0.1", + "_inBundle": false, + "_integrity": "sha1-JFNCdeKnvGvnvIZhHMFq4KVlSHE=", + "_location": "/webidl-conversions", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "webidl-conversions@^3.0.0", + "name": "webidl-conversions", + "escapedName": "webidl-conversions", + "rawSpec": "^3.0.0", + "saveSpec": null, + "fetchSpec": "^3.0.0" + }, + "_requiredBy": [ + "/whatwg-url" + ], + "_resolved": "https://registry.npmjs.org/webidl-conversions/-/webidl-conversions-3.0.1.tgz", + "_shasum": "24534275e2a7bc6be7bc86611cc16ae0a5654871", + "_spec": "webidl-conversions@^3.0.0", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\whatwg-url", + "author": { + "name": "Domenic Denicola", + "email": "d@domenic.me", + "url": "https://domenic.me/" + }, + "bugs": { + "url": "https://github.com/jsdom/webidl-conversions/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Implements the WebIDL algorithms for converting to and from JavaScript values", + "devDependencies": { + "mocha": "^1.21.4" + }, + "files": [ + "lib/" + ], + "homepage": "https://github.com/jsdom/webidl-conversions#readme", + "keywords": [ + "webidl", + "web", + "types" + ], + "license": "BSD-2-Clause", + "main": "lib/index.js", + "name": "webidl-conversions", + "repository": { + "type": "git", + "url": "git+https://github.com/jsdom/webidl-conversions.git" + }, + "scripts": { + "test": "mocha test/*.js" + }, + "version": "3.0.1" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/whatwg-url/LICENSE.txt b/25_03_11/frontend_vizsgafeladat/backend/node_modules/whatwg-url/LICENSE.txt new file mode 100644 index 00000000..54dfac39 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/whatwg-url/LICENSE.txt @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2015–2016 Sebastian Mayr + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/whatwg-url/README.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/whatwg-url/README.md new file mode 100644 index 00000000..4347a7fc --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/whatwg-url/README.md @@ -0,0 +1,67 @@ +# whatwg-url + +whatwg-url is a full implementation of the WHATWG [URL Standard](https://url.spec.whatwg.org/). It can be used standalone, but it also exposes a lot of the internal algorithms that are useful for integrating a URL parser into a project like [jsdom](https://github.com/tmpvar/jsdom). + +## Current Status + +whatwg-url is currently up to date with the URL spec up to commit [a62223](https://github.com/whatwg/url/commit/a622235308342c9adc7fc2fd1659ff059f7d5e2a). + +## API + +### The `URL` Constructor + +The main API is the [`URL`](https://url.spec.whatwg.org/#url) export, which follows the spec's behavior in all ways (including e.g. `USVString` conversion). Most consumers of this library will want to use this. + +### Low-level URL Standard API + +The following methods are exported for use by places like jsdom that need to implement things like [`HTMLHyperlinkElementUtils`](https://html.spec.whatwg.org/#htmlhyperlinkelementutils). They operate on or return an "internal URL" or ["URL record"](https://url.spec.whatwg.org/#concept-url) type. + +- [URL parser](https://url.spec.whatwg.org/#concept-url-parser): `parseURL(input, { baseURL, encodingOverride })` +- [Basic URL parser](https://url.spec.whatwg.org/#concept-basic-url-parser): `basicURLParse(input, { baseURL, encodingOverride, url, stateOverride })` +- [URL serializer](https://url.spec.whatwg.org/#concept-url-serializer): `serializeURL(urlRecord, excludeFragment)` +- [Host serializer](https://url.spec.whatwg.org/#concept-host-serializer): `serializeHost(hostFromURLRecord)` +- [Serialize an integer](https://url.spec.whatwg.org/#serialize-an-integer): `serializeInteger(number)` +- [Origin](https://url.spec.whatwg.org/#concept-url-origin) [serializer](https://html.spec.whatwg.org/multipage/browsers.html#serialization-of-an-origin): `serializeURLOrigin(urlRecord)` +- [Set the username](https://url.spec.whatwg.org/#set-the-username): `setTheUsername(urlRecord, usernameString)` +- [Set the password](https://url.spec.whatwg.org/#set-the-password): `setThePassword(urlRecord, passwordString)` +- [Cannot have a username/password/port](https://url.spec.whatwg.org/#cannot-have-a-username-password-port): `cannotHaveAUsernamePasswordPort(urlRecord)` + +The `stateOverride` parameter is one of the following strings: + +- [`"scheme start"`](https://url.spec.whatwg.org/#scheme-start-state) +- [`"scheme"`](https://url.spec.whatwg.org/#scheme-state) +- [`"no scheme"`](https://url.spec.whatwg.org/#no-scheme-state) +- [`"special relative or authority"`](https://url.spec.whatwg.org/#special-relative-or-authority-state) +- [`"path or authority"`](https://url.spec.whatwg.org/#path-or-authority-state) +- [`"relative"`](https://url.spec.whatwg.org/#relative-state) +- [`"relative slash"`](https://url.spec.whatwg.org/#relative-slash-state) +- [`"special authority slashes"`](https://url.spec.whatwg.org/#special-authority-slashes-state) +- [`"special authority ignore slashes"`](https://url.spec.whatwg.org/#special-authority-ignore-slashes-state) +- [`"authority"`](https://url.spec.whatwg.org/#authority-state) +- [`"host"`](https://url.spec.whatwg.org/#host-state) +- [`"hostname"`](https://url.spec.whatwg.org/#hostname-state) +- [`"port"`](https://url.spec.whatwg.org/#port-state) +- [`"file"`](https://url.spec.whatwg.org/#file-state) +- [`"file slash"`](https://url.spec.whatwg.org/#file-slash-state) +- [`"file host"`](https://url.spec.whatwg.org/#file-host-state) +- [`"path start"`](https://url.spec.whatwg.org/#path-start-state) +- [`"path"`](https://url.spec.whatwg.org/#path-state) +- [`"cannot-be-a-base-URL path"`](https://url.spec.whatwg.org/#cannot-be-a-base-url-path-state) +- [`"query"`](https://url.spec.whatwg.org/#query-state) +- [`"fragment"`](https://url.spec.whatwg.org/#fragment-state) + +The URL record type has the following API: + +- [`scheme`](https://url.spec.whatwg.org/#concept-url-scheme) +- [`username`](https://url.spec.whatwg.org/#concept-url-username) +- [`password`](https://url.spec.whatwg.org/#concept-url-password) +- [`host`](https://url.spec.whatwg.org/#concept-url-host) +- [`port`](https://url.spec.whatwg.org/#concept-url-port) +- [`path`](https://url.spec.whatwg.org/#concept-url-path) (as an array) +- [`query`](https://url.spec.whatwg.org/#concept-url-query) +- [`fragment`](https://url.spec.whatwg.org/#concept-url-fragment) +- [`cannotBeABaseURL`](https://url.spec.whatwg.org/#url-cannot-be-a-base-url-flag) (as a boolean) + +These properties should be treated with care, as in general changing them will cause the URL record to be in an inconsistent state until the appropriate invocation of `basicURLParse` is used to fix it up. You can see examples of this in the URL Standard, where there are many step sequences like "4. Set context object’s url’s fragment to the empty string. 5. Basic URL parse _input_ with context object’s url as _url_ and fragment state as _state override_." In between those two steps, a URL record is in an unusable state. + +The return value of "failure" in the spec is represented by the string `"failure"`. That is, functions like `parseURL` and `basicURLParse` can return _either_ a URL record _or_ the string `"failure"`. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/whatwg-url/lib/URL-impl.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/whatwg-url/lib/URL-impl.js new file mode 100644 index 00000000..dc7452cc --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/whatwg-url/lib/URL-impl.js @@ -0,0 +1,200 @@ +"use strict"; +const usm = require("./url-state-machine"); + +exports.implementation = class URLImpl { + constructor(constructorArgs) { + const url = constructorArgs[0]; + const base = constructorArgs[1]; + + let parsedBase = null; + if (base !== undefined) { + parsedBase = usm.basicURLParse(base); + if (parsedBase === "failure") { + throw new TypeError("Invalid base URL"); + } + } + + const parsedURL = usm.basicURLParse(url, { baseURL: parsedBase }); + if (parsedURL === "failure") { + throw new TypeError("Invalid URL"); + } + + this._url = parsedURL; + + // TODO: query stuff + } + + get href() { + return usm.serializeURL(this._url); + } + + set href(v) { + const parsedURL = usm.basicURLParse(v); + if (parsedURL === "failure") { + throw new TypeError("Invalid URL"); + } + + this._url = parsedURL; + } + + get origin() { + return usm.serializeURLOrigin(this._url); + } + + get protocol() { + return this._url.scheme + ":"; + } + + set protocol(v) { + usm.basicURLParse(v + ":", { url: this._url, stateOverride: "scheme start" }); + } + + get username() { + return this._url.username; + } + + set username(v) { + if (usm.cannotHaveAUsernamePasswordPort(this._url)) { + return; + } + + usm.setTheUsername(this._url, v); + } + + get password() { + return this._url.password; + } + + set password(v) { + if (usm.cannotHaveAUsernamePasswordPort(this._url)) { + return; + } + + usm.setThePassword(this._url, v); + } + + get host() { + const url = this._url; + + if (url.host === null) { + return ""; + } + + if (url.port === null) { + return usm.serializeHost(url.host); + } + + return usm.serializeHost(url.host) + ":" + usm.serializeInteger(url.port); + } + + set host(v) { + if (this._url.cannotBeABaseURL) { + return; + } + + usm.basicURLParse(v, { url: this._url, stateOverride: "host" }); + } + + get hostname() { + if (this._url.host === null) { + return ""; + } + + return usm.serializeHost(this._url.host); + } + + set hostname(v) { + if (this._url.cannotBeABaseURL) { + return; + } + + usm.basicURLParse(v, { url: this._url, stateOverride: "hostname" }); + } + + get port() { + if (this._url.port === null) { + return ""; + } + + return usm.serializeInteger(this._url.port); + } + + set port(v) { + if (usm.cannotHaveAUsernamePasswordPort(this._url)) { + return; + } + + if (v === "") { + this._url.port = null; + } else { + usm.basicURLParse(v, { url: this._url, stateOverride: "port" }); + } + } + + get pathname() { + if (this._url.cannotBeABaseURL) { + return this._url.path[0]; + } + + if (this._url.path.length === 0) { + return ""; + } + + return "/" + this._url.path.join("/"); + } + + set pathname(v) { + if (this._url.cannotBeABaseURL) { + return; + } + + this._url.path = []; + usm.basicURLParse(v, { url: this._url, stateOverride: "path start" }); + } + + get search() { + if (this._url.query === null || this._url.query === "") { + return ""; + } + + return "?" + this._url.query; + } + + set search(v) { + // TODO: query stuff + + const url = this._url; + + if (v === "") { + url.query = null; + return; + } + + const input = v[0] === "?" ? v.substring(1) : v; + url.query = ""; + usm.basicURLParse(input, { url, stateOverride: "query" }); + } + + get hash() { + if (this._url.fragment === null || this._url.fragment === "") { + return ""; + } + + return "#" + this._url.fragment; + } + + set hash(v) { + if (v === "") { + this._url.fragment = null; + return; + } + + const input = v[0] === "#" ? v.substring(1) : v; + this._url.fragment = ""; + usm.basicURLParse(input, { url: this._url, stateOverride: "fragment" }); + } + + toJSON() { + return this.href; + } +}; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/whatwg-url/lib/URL.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/whatwg-url/lib/URL.js new file mode 100644 index 00000000..78c7207e --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/whatwg-url/lib/URL.js @@ -0,0 +1,196 @@ +"use strict"; + +const conversions = require("webidl-conversions"); +const utils = require("./utils.js"); +const Impl = require(".//URL-impl.js"); + +const impl = utils.implSymbol; + +function URL(url) { + if (!this || this[impl] || !(this instanceof URL)) { + throw new TypeError("Failed to construct 'URL': Please use the 'new' operator, this DOM object constructor cannot be called as a function."); + } + if (arguments.length < 1) { + throw new TypeError("Failed to construct 'URL': 1 argument required, but only " + arguments.length + " present."); + } + const args = []; + for (let i = 0; i < arguments.length && i < 2; ++i) { + args[i] = arguments[i]; + } + args[0] = conversions["USVString"](args[0]); + if (args[1] !== undefined) { + args[1] = conversions["USVString"](args[1]); + } + + module.exports.setup(this, args); +} + +URL.prototype.toJSON = function toJSON() { + if (!this || !module.exports.is(this)) { + throw new TypeError("Illegal invocation"); + } + const args = []; + for (let i = 0; i < arguments.length && i < 0; ++i) { + args[i] = arguments[i]; + } + return this[impl].toJSON.apply(this[impl], args); +}; +Object.defineProperty(URL.prototype, "href", { + get() { + return this[impl].href; + }, + set(V) { + V = conversions["USVString"](V); + this[impl].href = V; + }, + enumerable: true, + configurable: true +}); + +URL.prototype.toString = function () { + if (!this || !module.exports.is(this)) { + throw new TypeError("Illegal invocation"); + } + return this.href; +}; + +Object.defineProperty(URL.prototype, "origin", { + get() { + return this[impl].origin; + }, + enumerable: true, + configurable: true +}); + +Object.defineProperty(URL.prototype, "protocol", { + get() { + return this[impl].protocol; + }, + set(V) { + V = conversions["USVString"](V); + this[impl].protocol = V; + }, + enumerable: true, + configurable: true +}); + +Object.defineProperty(URL.prototype, "username", { + get() { + return this[impl].username; + }, + set(V) { + V = conversions["USVString"](V); + this[impl].username = V; + }, + enumerable: true, + configurable: true +}); + +Object.defineProperty(URL.prototype, "password", { + get() { + return this[impl].password; + }, + set(V) { + V = conversions["USVString"](V); + this[impl].password = V; + }, + enumerable: true, + configurable: true +}); + +Object.defineProperty(URL.prototype, "host", { + get() { + return this[impl].host; + }, + set(V) { + V = conversions["USVString"](V); + this[impl].host = V; + }, + enumerable: true, + configurable: true +}); + +Object.defineProperty(URL.prototype, "hostname", { + get() { + return this[impl].hostname; + }, + set(V) { + V = conversions["USVString"](V); + this[impl].hostname = V; + }, + enumerable: true, + configurable: true +}); + +Object.defineProperty(URL.prototype, "port", { + get() { + return this[impl].port; + }, + set(V) { + V = conversions["USVString"](V); + this[impl].port = V; + }, + enumerable: true, + configurable: true +}); + +Object.defineProperty(URL.prototype, "pathname", { + get() { + return this[impl].pathname; + }, + set(V) { + V = conversions["USVString"](V); + this[impl].pathname = V; + }, + enumerable: true, + configurable: true +}); + +Object.defineProperty(URL.prototype, "search", { + get() { + return this[impl].search; + }, + set(V) { + V = conversions["USVString"](V); + this[impl].search = V; + }, + enumerable: true, + configurable: true +}); + +Object.defineProperty(URL.prototype, "hash", { + get() { + return this[impl].hash; + }, + set(V) { + V = conversions["USVString"](V); + this[impl].hash = V; + }, + enumerable: true, + configurable: true +}); + + +module.exports = { + is(obj) { + return !!obj && obj[impl] instanceof Impl.implementation; + }, + create(constructorArgs, privateData) { + let obj = Object.create(URL.prototype); + this.setup(obj, constructorArgs, privateData); + return obj; + }, + setup(obj, constructorArgs, privateData) { + if (!privateData) privateData = {}; + privateData.wrapper = obj; + + obj[impl] = new Impl.implementation(constructorArgs, privateData); + obj[impl][utils.wrapperSymbol] = obj; + }, + interface: URL, + expose: { + Window: { URL: URL }, + Worker: { URL: URL } + } +}; + diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/whatwg-url/lib/public-api.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/whatwg-url/lib/public-api.js new file mode 100644 index 00000000..932dcada --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/whatwg-url/lib/public-api.js @@ -0,0 +1,11 @@ +"use strict"; + +exports.URL = require("./URL").interface; +exports.serializeURL = require("./url-state-machine").serializeURL; +exports.serializeURLOrigin = require("./url-state-machine").serializeURLOrigin; +exports.basicURLParse = require("./url-state-machine").basicURLParse; +exports.setTheUsername = require("./url-state-machine").setTheUsername; +exports.setThePassword = require("./url-state-machine").setThePassword; +exports.serializeHost = require("./url-state-machine").serializeHost; +exports.serializeInteger = require("./url-state-machine").serializeInteger; +exports.parseURL = require("./url-state-machine").parseURL; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/whatwg-url/lib/url-state-machine.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/whatwg-url/lib/url-state-machine.js new file mode 100644 index 00000000..27d977a2 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/whatwg-url/lib/url-state-machine.js @@ -0,0 +1,1297 @@ +"use strict"; +const punycode = require("punycode"); +const tr46 = require("tr46"); + +const specialSchemes = { + ftp: 21, + file: null, + gopher: 70, + http: 80, + https: 443, + ws: 80, + wss: 443 +}; + +const failure = Symbol("failure"); + +function countSymbols(str) { + return punycode.ucs2.decode(str).length; +} + +function at(input, idx) { + const c = input[idx]; + return isNaN(c) ? undefined : String.fromCodePoint(c); +} + +function isASCIIDigit(c) { + return c >= 0x30 && c <= 0x39; +} + +function isASCIIAlpha(c) { + return (c >= 0x41 && c <= 0x5A) || (c >= 0x61 && c <= 0x7A); +} + +function isASCIIAlphanumeric(c) { + return isASCIIAlpha(c) || isASCIIDigit(c); +} + +function isASCIIHex(c) { + return isASCIIDigit(c) || (c >= 0x41 && c <= 0x46) || (c >= 0x61 && c <= 0x66); +} + +function isSingleDot(buffer) { + return buffer === "." || buffer.toLowerCase() === "%2e"; +} + +function isDoubleDot(buffer) { + buffer = buffer.toLowerCase(); + return buffer === ".." || buffer === "%2e." || buffer === ".%2e" || buffer === "%2e%2e"; +} + +function isWindowsDriveLetterCodePoints(cp1, cp2) { + return isASCIIAlpha(cp1) && (cp2 === 58 || cp2 === 124); +} + +function isWindowsDriveLetterString(string) { + return string.length === 2 && isASCIIAlpha(string.codePointAt(0)) && (string[1] === ":" || string[1] === "|"); +} + +function isNormalizedWindowsDriveLetterString(string) { + return string.length === 2 && isASCIIAlpha(string.codePointAt(0)) && string[1] === ":"; +} + +function containsForbiddenHostCodePoint(string) { + return string.search(/\u0000|\u0009|\u000A|\u000D|\u0020|#|%|\/|:|\?|@|\[|\\|\]/) !== -1; +} + +function containsForbiddenHostCodePointExcludingPercent(string) { + return string.search(/\u0000|\u0009|\u000A|\u000D|\u0020|#|\/|:|\?|@|\[|\\|\]/) !== -1; +} + +function isSpecialScheme(scheme) { + return specialSchemes[scheme] !== undefined; +} + +function isSpecial(url) { + return isSpecialScheme(url.scheme); +} + +function defaultPort(scheme) { + return specialSchemes[scheme]; +} + +function percentEncode(c) { + let hex = c.toString(16).toUpperCase(); + if (hex.length === 1) { + hex = "0" + hex; + } + + return "%" + hex; +} + +function utf8PercentEncode(c) { + const buf = new Buffer(c); + + let str = ""; + + for (let i = 0; i < buf.length; ++i) { + str += percentEncode(buf[i]); + } + + return str; +} + +function utf8PercentDecode(str) { + const input = new Buffer(str); + const output = []; + for (let i = 0; i < input.length; ++i) { + if (input[i] !== 37) { + output.push(input[i]); + } else if (input[i] === 37 && isASCIIHex(input[i + 1]) && isASCIIHex(input[i + 2])) { + output.push(parseInt(input.slice(i + 1, i + 3).toString(), 16)); + i += 2; + } else { + output.push(input[i]); + } + } + return new Buffer(output).toString(); +} + +function isC0ControlPercentEncode(c) { + return c <= 0x1F || c > 0x7E; +} + +const extraPathPercentEncodeSet = new Set([32, 34, 35, 60, 62, 63, 96, 123, 125]); +function isPathPercentEncode(c) { + return isC0ControlPercentEncode(c) || extraPathPercentEncodeSet.has(c); +} + +const extraUserinfoPercentEncodeSet = + new Set([47, 58, 59, 61, 64, 91, 92, 93, 94, 124]); +function isUserinfoPercentEncode(c) { + return isPathPercentEncode(c) || extraUserinfoPercentEncodeSet.has(c); +} + +function percentEncodeChar(c, encodeSetPredicate) { + const cStr = String.fromCodePoint(c); + + if (encodeSetPredicate(c)) { + return utf8PercentEncode(cStr); + } + + return cStr; +} + +function parseIPv4Number(input) { + let R = 10; + + if (input.length >= 2 && input.charAt(0) === "0" && input.charAt(1).toLowerCase() === "x") { + input = input.substring(2); + R = 16; + } else if (input.length >= 2 && input.charAt(0) === "0") { + input = input.substring(1); + R = 8; + } + + if (input === "") { + return 0; + } + + const regex = R === 10 ? /[^0-9]/ : (R === 16 ? /[^0-9A-Fa-f]/ : /[^0-7]/); + if (regex.test(input)) { + return failure; + } + + return parseInt(input, R); +} + +function parseIPv4(input) { + const parts = input.split("."); + if (parts[parts.length - 1] === "") { + if (parts.length > 1) { + parts.pop(); + } + } + + if (parts.length > 4) { + return input; + } + + const numbers = []; + for (const part of parts) { + if (part === "") { + return input; + } + const n = parseIPv4Number(part); + if (n === failure) { + return input; + } + + numbers.push(n); + } + + for (let i = 0; i < numbers.length - 1; ++i) { + if (numbers[i] > 255) { + return failure; + } + } + if (numbers[numbers.length - 1] >= Math.pow(256, 5 - numbers.length)) { + return failure; + } + + let ipv4 = numbers.pop(); + let counter = 0; + + for (const n of numbers) { + ipv4 += n * Math.pow(256, 3 - counter); + ++counter; + } + + return ipv4; +} + +function serializeIPv4(address) { + let output = ""; + let n = address; + + for (let i = 1; i <= 4; ++i) { + output = String(n % 256) + output; + if (i !== 4) { + output = "." + output; + } + n = Math.floor(n / 256); + } + + return output; +} + +function parseIPv6(input) { + const address = [0, 0, 0, 0, 0, 0, 0, 0]; + let pieceIndex = 0; + let compress = null; + let pointer = 0; + + input = punycode.ucs2.decode(input); + + if (input[pointer] === 58) { + if (input[pointer + 1] !== 58) { + return failure; + } + + pointer += 2; + ++pieceIndex; + compress = pieceIndex; + } + + while (pointer < input.length) { + if (pieceIndex === 8) { + return failure; + } + + if (input[pointer] === 58) { + if (compress !== null) { + return failure; + } + ++pointer; + ++pieceIndex; + compress = pieceIndex; + continue; + } + + let value = 0; + let length = 0; + + while (length < 4 && isASCIIHex(input[pointer])) { + value = value * 0x10 + parseInt(at(input, pointer), 16); + ++pointer; + ++length; + } + + if (input[pointer] === 46) { + if (length === 0) { + return failure; + } + + pointer -= length; + + if (pieceIndex > 6) { + return failure; + } + + let numbersSeen = 0; + + while (input[pointer] !== undefined) { + let ipv4Piece = null; + + if (numbersSeen > 0) { + if (input[pointer] === 46 && numbersSeen < 4) { + ++pointer; + } else { + return failure; + } + } + + if (!isASCIIDigit(input[pointer])) { + return failure; + } + + while (isASCIIDigit(input[pointer])) { + const number = parseInt(at(input, pointer)); + if (ipv4Piece === null) { + ipv4Piece = number; + } else if (ipv4Piece === 0) { + return failure; + } else { + ipv4Piece = ipv4Piece * 10 + number; + } + if (ipv4Piece > 255) { + return failure; + } + ++pointer; + } + + address[pieceIndex] = address[pieceIndex] * 0x100 + ipv4Piece; + + ++numbersSeen; + + if (numbersSeen === 2 || numbersSeen === 4) { + ++pieceIndex; + } + } + + if (numbersSeen !== 4) { + return failure; + } + + break; + } else if (input[pointer] === 58) { + ++pointer; + if (input[pointer] === undefined) { + return failure; + } + } else if (input[pointer] !== undefined) { + return failure; + } + + address[pieceIndex] = value; + ++pieceIndex; + } + + if (compress !== null) { + let swaps = pieceIndex - compress; + pieceIndex = 7; + while (pieceIndex !== 0 && swaps > 0) { + const temp = address[compress + swaps - 1]; + address[compress + swaps - 1] = address[pieceIndex]; + address[pieceIndex] = temp; + --pieceIndex; + --swaps; + } + } else if (compress === null && pieceIndex !== 8) { + return failure; + } + + return address; +} + +function serializeIPv6(address) { + let output = ""; + const seqResult = findLongestZeroSequence(address); + const compress = seqResult.idx; + let ignore0 = false; + + for (let pieceIndex = 0; pieceIndex <= 7; ++pieceIndex) { + if (ignore0 && address[pieceIndex] === 0) { + continue; + } else if (ignore0) { + ignore0 = false; + } + + if (compress === pieceIndex) { + const separator = pieceIndex === 0 ? "::" : ":"; + output += separator; + ignore0 = true; + continue; + } + + output += address[pieceIndex].toString(16); + + if (pieceIndex !== 7) { + output += ":"; + } + } + + return output; +} + +function parseHost(input, isSpecialArg) { + if (input[0] === "[") { + if (input[input.length - 1] !== "]") { + return failure; + } + + return parseIPv6(input.substring(1, input.length - 1)); + } + + if (!isSpecialArg) { + return parseOpaqueHost(input); + } + + const domain = utf8PercentDecode(input); + const asciiDomain = tr46.toASCII(domain, false, tr46.PROCESSING_OPTIONS.NONTRANSITIONAL, false); + if (asciiDomain === null) { + return failure; + } + + if (containsForbiddenHostCodePoint(asciiDomain)) { + return failure; + } + + const ipv4Host = parseIPv4(asciiDomain); + if (typeof ipv4Host === "number" || ipv4Host === failure) { + return ipv4Host; + } + + return asciiDomain; +} + +function parseOpaqueHost(input) { + if (containsForbiddenHostCodePointExcludingPercent(input)) { + return failure; + } + + let output = ""; + const decoded = punycode.ucs2.decode(input); + for (let i = 0; i < decoded.length; ++i) { + output += percentEncodeChar(decoded[i], isC0ControlPercentEncode); + } + return output; +} + +function findLongestZeroSequence(arr) { + let maxIdx = null; + let maxLen = 1; // only find elements > 1 + let currStart = null; + let currLen = 0; + + for (let i = 0; i < arr.length; ++i) { + if (arr[i] !== 0) { + if (currLen > maxLen) { + maxIdx = currStart; + maxLen = currLen; + } + + currStart = null; + currLen = 0; + } else { + if (currStart === null) { + currStart = i; + } + ++currLen; + } + } + + // if trailing zeros + if (currLen > maxLen) { + maxIdx = currStart; + maxLen = currLen; + } + + return { + idx: maxIdx, + len: maxLen + }; +} + +function serializeHost(host) { + if (typeof host === "number") { + return serializeIPv4(host); + } + + // IPv6 serializer + if (host instanceof Array) { + return "[" + serializeIPv6(host) + "]"; + } + + return host; +} + +function trimControlChars(url) { + return url.replace(/^[\u0000-\u001F\u0020]+|[\u0000-\u001F\u0020]+$/g, ""); +} + +function trimTabAndNewline(url) { + return url.replace(/\u0009|\u000A|\u000D/g, ""); +} + +function shortenPath(url) { + const path = url.path; + if (path.length === 0) { + return; + } + if (url.scheme === "file" && path.length === 1 && isNormalizedWindowsDriveLetter(path[0])) { + return; + } + + path.pop(); +} + +function includesCredentials(url) { + return url.username !== "" || url.password !== ""; +} + +function cannotHaveAUsernamePasswordPort(url) { + return url.host === null || url.host === "" || url.cannotBeABaseURL || url.scheme === "file"; +} + +function isNormalizedWindowsDriveLetter(string) { + return /^[A-Za-z]:$/.test(string); +} + +function URLStateMachine(input, base, encodingOverride, url, stateOverride) { + this.pointer = 0; + this.input = input; + this.base = base || null; + this.encodingOverride = encodingOverride || "utf-8"; + this.stateOverride = stateOverride; + this.url = url; + this.failure = false; + this.parseError = false; + + if (!this.url) { + this.url = { + scheme: "", + username: "", + password: "", + host: null, + port: null, + path: [], + query: null, + fragment: null, + + cannotBeABaseURL: false + }; + + const res = trimControlChars(this.input); + if (res !== this.input) { + this.parseError = true; + } + this.input = res; + } + + const res = trimTabAndNewline(this.input); + if (res !== this.input) { + this.parseError = true; + } + this.input = res; + + this.state = stateOverride || "scheme start"; + + this.buffer = ""; + this.atFlag = false; + this.arrFlag = false; + this.passwordTokenSeenFlag = false; + + this.input = punycode.ucs2.decode(this.input); + + for (; this.pointer <= this.input.length; ++this.pointer) { + const c = this.input[this.pointer]; + const cStr = isNaN(c) ? undefined : String.fromCodePoint(c); + + // exec state machine + const ret = this["parse " + this.state](c, cStr); + if (!ret) { + break; // terminate algorithm + } else if (ret === failure) { + this.failure = true; + break; + } + } +} + +URLStateMachine.prototype["parse scheme start"] = function parseSchemeStart(c, cStr) { + if (isASCIIAlpha(c)) { + this.buffer += cStr.toLowerCase(); + this.state = "scheme"; + } else if (!this.stateOverride) { + this.state = "no scheme"; + --this.pointer; + } else { + this.parseError = true; + return failure; + } + + return true; +}; + +URLStateMachine.prototype["parse scheme"] = function parseScheme(c, cStr) { + if (isASCIIAlphanumeric(c) || c === 43 || c === 45 || c === 46) { + this.buffer += cStr.toLowerCase(); + } else if (c === 58) { + if (this.stateOverride) { + if (isSpecial(this.url) && !isSpecialScheme(this.buffer)) { + return false; + } + + if (!isSpecial(this.url) && isSpecialScheme(this.buffer)) { + return false; + } + + if ((includesCredentials(this.url) || this.url.port !== null) && this.buffer === "file") { + return false; + } + + if (this.url.scheme === "file" && (this.url.host === "" || this.url.host === null)) { + return false; + } + } + this.url.scheme = this.buffer; + this.buffer = ""; + if (this.stateOverride) { + return false; + } + if (this.url.scheme === "file") { + if (this.input[this.pointer + 1] !== 47 || this.input[this.pointer + 2] !== 47) { + this.parseError = true; + } + this.state = "file"; + } else if (isSpecial(this.url) && this.base !== null && this.base.scheme === this.url.scheme) { + this.state = "special relative or authority"; + } else if (isSpecial(this.url)) { + this.state = "special authority slashes"; + } else if (this.input[this.pointer + 1] === 47) { + this.state = "path or authority"; + ++this.pointer; + } else { + this.url.cannotBeABaseURL = true; + this.url.path.push(""); + this.state = "cannot-be-a-base-URL path"; + } + } else if (!this.stateOverride) { + this.buffer = ""; + this.state = "no scheme"; + this.pointer = -1; + } else { + this.parseError = true; + return failure; + } + + return true; +}; + +URLStateMachine.prototype["parse no scheme"] = function parseNoScheme(c) { + if (this.base === null || (this.base.cannotBeABaseURL && c !== 35)) { + return failure; + } else if (this.base.cannotBeABaseURL && c === 35) { + this.url.scheme = this.base.scheme; + this.url.path = this.base.path.slice(); + this.url.query = this.base.query; + this.url.fragment = ""; + this.url.cannotBeABaseURL = true; + this.state = "fragment"; + } else if (this.base.scheme === "file") { + this.state = "file"; + --this.pointer; + } else { + this.state = "relative"; + --this.pointer; + } + + return true; +}; + +URLStateMachine.prototype["parse special relative or authority"] = function parseSpecialRelativeOrAuthority(c) { + if (c === 47 && this.input[this.pointer + 1] === 47) { + this.state = "special authority ignore slashes"; + ++this.pointer; + } else { + this.parseError = true; + this.state = "relative"; + --this.pointer; + } + + return true; +}; + +URLStateMachine.prototype["parse path or authority"] = function parsePathOrAuthority(c) { + if (c === 47) { + this.state = "authority"; + } else { + this.state = "path"; + --this.pointer; + } + + return true; +}; + +URLStateMachine.prototype["parse relative"] = function parseRelative(c) { + this.url.scheme = this.base.scheme; + if (isNaN(c)) { + this.url.username = this.base.username; + this.url.password = this.base.password; + this.url.host = this.base.host; + this.url.port = this.base.port; + this.url.path = this.base.path.slice(); + this.url.query = this.base.query; + } else if (c === 47) { + this.state = "relative slash"; + } else if (c === 63) { + this.url.username = this.base.username; + this.url.password = this.base.password; + this.url.host = this.base.host; + this.url.port = this.base.port; + this.url.path = this.base.path.slice(); + this.url.query = ""; + this.state = "query"; + } else if (c === 35) { + this.url.username = this.base.username; + this.url.password = this.base.password; + this.url.host = this.base.host; + this.url.port = this.base.port; + this.url.path = this.base.path.slice(); + this.url.query = this.base.query; + this.url.fragment = ""; + this.state = "fragment"; + } else if (isSpecial(this.url) && c === 92) { + this.parseError = true; + this.state = "relative slash"; + } else { + this.url.username = this.base.username; + this.url.password = this.base.password; + this.url.host = this.base.host; + this.url.port = this.base.port; + this.url.path = this.base.path.slice(0, this.base.path.length - 1); + + this.state = "path"; + --this.pointer; + } + + return true; +}; + +URLStateMachine.prototype["parse relative slash"] = function parseRelativeSlash(c) { + if (isSpecial(this.url) && (c === 47 || c === 92)) { + if (c === 92) { + this.parseError = true; + } + this.state = "special authority ignore slashes"; + } else if (c === 47) { + this.state = "authority"; + } else { + this.url.username = this.base.username; + this.url.password = this.base.password; + this.url.host = this.base.host; + this.url.port = this.base.port; + this.state = "path"; + --this.pointer; + } + + return true; +}; + +URLStateMachine.prototype["parse special authority slashes"] = function parseSpecialAuthoritySlashes(c) { + if (c === 47 && this.input[this.pointer + 1] === 47) { + this.state = "special authority ignore slashes"; + ++this.pointer; + } else { + this.parseError = true; + this.state = "special authority ignore slashes"; + --this.pointer; + } + + return true; +}; + +URLStateMachine.prototype["parse special authority ignore slashes"] = function parseSpecialAuthorityIgnoreSlashes(c) { + if (c !== 47 && c !== 92) { + this.state = "authority"; + --this.pointer; + } else { + this.parseError = true; + } + + return true; +}; + +URLStateMachine.prototype["parse authority"] = function parseAuthority(c, cStr) { + if (c === 64) { + this.parseError = true; + if (this.atFlag) { + this.buffer = "%40" + this.buffer; + } + this.atFlag = true; + + // careful, this is based on buffer and has its own pointer (this.pointer != pointer) and inner chars + const len = countSymbols(this.buffer); + for (let pointer = 0; pointer < len; ++pointer) { + const codePoint = this.buffer.codePointAt(pointer); + + if (codePoint === 58 && !this.passwordTokenSeenFlag) { + this.passwordTokenSeenFlag = true; + continue; + } + const encodedCodePoints = percentEncodeChar(codePoint, isUserinfoPercentEncode); + if (this.passwordTokenSeenFlag) { + this.url.password += encodedCodePoints; + } else { + this.url.username += encodedCodePoints; + } + } + this.buffer = ""; + } else if (isNaN(c) || c === 47 || c === 63 || c === 35 || + (isSpecial(this.url) && c === 92)) { + if (this.atFlag && this.buffer === "") { + this.parseError = true; + return failure; + } + this.pointer -= countSymbols(this.buffer) + 1; + this.buffer = ""; + this.state = "host"; + } else { + this.buffer += cStr; + } + + return true; +}; + +URLStateMachine.prototype["parse hostname"] = +URLStateMachine.prototype["parse host"] = function parseHostName(c, cStr) { + if (this.stateOverride && this.url.scheme === "file") { + --this.pointer; + this.state = "file host"; + } else if (c === 58 && !this.arrFlag) { + if (this.buffer === "") { + this.parseError = true; + return failure; + } + + const host = parseHost(this.buffer, isSpecial(this.url)); + if (host === failure) { + return failure; + } + + this.url.host = host; + this.buffer = ""; + this.state = "port"; + if (this.stateOverride === "hostname") { + return false; + } + } else if (isNaN(c) || c === 47 || c === 63 || c === 35 || + (isSpecial(this.url) && c === 92)) { + --this.pointer; + if (isSpecial(this.url) && this.buffer === "") { + this.parseError = true; + return failure; + } else if (this.stateOverride && this.buffer === "" && + (includesCredentials(this.url) || this.url.port !== null)) { + this.parseError = true; + return false; + } + + const host = parseHost(this.buffer, isSpecial(this.url)); + if (host === failure) { + return failure; + } + + this.url.host = host; + this.buffer = ""; + this.state = "path start"; + if (this.stateOverride) { + return false; + } + } else { + if (c === 91) { + this.arrFlag = true; + } else if (c === 93) { + this.arrFlag = false; + } + this.buffer += cStr; + } + + return true; +}; + +URLStateMachine.prototype["parse port"] = function parsePort(c, cStr) { + if (isASCIIDigit(c)) { + this.buffer += cStr; + } else if (isNaN(c) || c === 47 || c === 63 || c === 35 || + (isSpecial(this.url) && c === 92) || + this.stateOverride) { + if (this.buffer !== "") { + const port = parseInt(this.buffer); + if (port > Math.pow(2, 16) - 1) { + this.parseError = true; + return failure; + } + this.url.port = port === defaultPort(this.url.scheme) ? null : port; + this.buffer = ""; + } + if (this.stateOverride) { + return false; + } + this.state = "path start"; + --this.pointer; + } else { + this.parseError = true; + return failure; + } + + return true; +}; + +const fileOtherwiseCodePoints = new Set([47, 92, 63, 35]); + +URLStateMachine.prototype["parse file"] = function parseFile(c) { + this.url.scheme = "file"; + + if (c === 47 || c === 92) { + if (c === 92) { + this.parseError = true; + } + this.state = "file slash"; + } else if (this.base !== null && this.base.scheme === "file") { + if (isNaN(c)) { + this.url.host = this.base.host; + this.url.path = this.base.path.slice(); + this.url.query = this.base.query; + } else if (c === 63) { + this.url.host = this.base.host; + this.url.path = this.base.path.slice(); + this.url.query = ""; + this.state = "query"; + } else if (c === 35) { + this.url.host = this.base.host; + this.url.path = this.base.path.slice(); + this.url.query = this.base.query; + this.url.fragment = ""; + this.state = "fragment"; + } else { + if (this.input.length - this.pointer - 1 === 0 || // remaining consists of 0 code points + !isWindowsDriveLetterCodePoints(c, this.input[this.pointer + 1]) || + (this.input.length - this.pointer - 1 >= 2 && // remaining has at least 2 code points + !fileOtherwiseCodePoints.has(this.input[this.pointer + 2]))) { + this.url.host = this.base.host; + this.url.path = this.base.path.slice(); + shortenPath(this.url); + } else { + this.parseError = true; + } + + this.state = "path"; + --this.pointer; + } + } else { + this.state = "path"; + --this.pointer; + } + + return true; +}; + +URLStateMachine.prototype["parse file slash"] = function parseFileSlash(c) { + if (c === 47 || c === 92) { + if (c === 92) { + this.parseError = true; + } + this.state = "file host"; + } else { + if (this.base !== null && this.base.scheme === "file") { + if (isNormalizedWindowsDriveLetterString(this.base.path[0])) { + this.url.path.push(this.base.path[0]); + } else { + this.url.host = this.base.host; + } + } + this.state = "path"; + --this.pointer; + } + + return true; +}; + +URLStateMachine.prototype["parse file host"] = function parseFileHost(c, cStr) { + if (isNaN(c) || c === 47 || c === 92 || c === 63 || c === 35) { + --this.pointer; + if (!this.stateOverride && isWindowsDriveLetterString(this.buffer)) { + this.parseError = true; + this.state = "path"; + } else if (this.buffer === "") { + this.url.host = ""; + if (this.stateOverride) { + return false; + } + this.state = "path start"; + } else { + let host = parseHost(this.buffer, isSpecial(this.url)); + if (host === failure) { + return failure; + } + if (host === "localhost") { + host = ""; + } + this.url.host = host; + + if (this.stateOverride) { + return false; + } + + this.buffer = ""; + this.state = "path start"; + } + } else { + this.buffer += cStr; + } + + return true; +}; + +URLStateMachine.prototype["parse path start"] = function parsePathStart(c) { + if (isSpecial(this.url)) { + if (c === 92) { + this.parseError = true; + } + this.state = "path"; + + if (c !== 47 && c !== 92) { + --this.pointer; + } + } else if (!this.stateOverride && c === 63) { + this.url.query = ""; + this.state = "query"; + } else if (!this.stateOverride && c === 35) { + this.url.fragment = ""; + this.state = "fragment"; + } else if (c !== undefined) { + this.state = "path"; + if (c !== 47) { + --this.pointer; + } + } + + return true; +}; + +URLStateMachine.prototype["parse path"] = function parsePath(c) { + if (isNaN(c) || c === 47 || (isSpecial(this.url) && c === 92) || + (!this.stateOverride && (c === 63 || c === 35))) { + if (isSpecial(this.url) && c === 92) { + this.parseError = true; + } + + if (isDoubleDot(this.buffer)) { + shortenPath(this.url); + if (c !== 47 && !(isSpecial(this.url) && c === 92)) { + this.url.path.push(""); + } + } else if (isSingleDot(this.buffer) && c !== 47 && + !(isSpecial(this.url) && c === 92)) { + this.url.path.push(""); + } else if (!isSingleDot(this.buffer)) { + if (this.url.scheme === "file" && this.url.path.length === 0 && isWindowsDriveLetterString(this.buffer)) { + if (this.url.host !== "" && this.url.host !== null) { + this.parseError = true; + this.url.host = ""; + } + this.buffer = this.buffer[0] + ":"; + } + this.url.path.push(this.buffer); + } + this.buffer = ""; + if (this.url.scheme === "file" && (c === undefined || c === 63 || c === 35)) { + while (this.url.path.length > 1 && this.url.path[0] === "") { + this.parseError = true; + this.url.path.shift(); + } + } + if (c === 63) { + this.url.query = ""; + this.state = "query"; + } + if (c === 35) { + this.url.fragment = ""; + this.state = "fragment"; + } + } else { + // TODO: If c is not a URL code point and not "%", parse error. + + if (c === 37 && + (!isASCIIHex(this.input[this.pointer + 1]) || + !isASCIIHex(this.input[this.pointer + 2]))) { + this.parseError = true; + } + + this.buffer += percentEncodeChar(c, isPathPercentEncode); + } + + return true; +}; + +URLStateMachine.prototype["parse cannot-be-a-base-URL path"] = function parseCannotBeABaseURLPath(c) { + if (c === 63) { + this.url.query = ""; + this.state = "query"; + } else if (c === 35) { + this.url.fragment = ""; + this.state = "fragment"; + } else { + // TODO: Add: not a URL code point + if (!isNaN(c) && c !== 37) { + this.parseError = true; + } + + if (c === 37 && + (!isASCIIHex(this.input[this.pointer + 1]) || + !isASCIIHex(this.input[this.pointer + 2]))) { + this.parseError = true; + } + + if (!isNaN(c)) { + this.url.path[0] = this.url.path[0] + percentEncodeChar(c, isC0ControlPercentEncode); + } + } + + return true; +}; + +URLStateMachine.prototype["parse query"] = function parseQuery(c, cStr) { + if (isNaN(c) || (!this.stateOverride && c === 35)) { + if (!isSpecial(this.url) || this.url.scheme === "ws" || this.url.scheme === "wss") { + this.encodingOverride = "utf-8"; + } + + const buffer = new Buffer(this.buffer); // TODO: Use encoding override instead + for (let i = 0; i < buffer.length; ++i) { + if (buffer[i] < 0x21 || buffer[i] > 0x7E || buffer[i] === 0x22 || buffer[i] === 0x23 || + buffer[i] === 0x3C || buffer[i] === 0x3E) { + this.url.query += percentEncode(buffer[i]); + } else { + this.url.query += String.fromCodePoint(buffer[i]); + } + } + + this.buffer = ""; + if (c === 35) { + this.url.fragment = ""; + this.state = "fragment"; + } + } else { + // TODO: If c is not a URL code point and not "%", parse error. + if (c === 37 && + (!isASCIIHex(this.input[this.pointer + 1]) || + !isASCIIHex(this.input[this.pointer + 2]))) { + this.parseError = true; + } + + this.buffer += cStr; + } + + return true; +}; + +URLStateMachine.prototype["parse fragment"] = function parseFragment(c) { + if (isNaN(c)) { // do nothing + } else if (c === 0x0) { + this.parseError = true; + } else { + // TODO: If c is not a URL code point and not "%", parse error. + if (c === 37 && + (!isASCIIHex(this.input[this.pointer + 1]) || + !isASCIIHex(this.input[this.pointer + 2]))) { + this.parseError = true; + } + + this.url.fragment += percentEncodeChar(c, isC0ControlPercentEncode); + } + + return true; +}; + +function serializeURL(url, excludeFragment) { + let output = url.scheme + ":"; + if (url.host !== null) { + output += "//"; + + if (url.username !== "" || url.password !== "") { + output += url.username; + if (url.password !== "") { + output += ":" + url.password; + } + output += "@"; + } + + output += serializeHost(url.host); + + if (url.port !== null) { + output += ":" + url.port; + } + } else if (url.host === null && url.scheme === "file") { + output += "//"; + } + + if (url.cannotBeABaseURL) { + output += url.path[0]; + } else { + for (const string of url.path) { + output += "/" + string; + } + } + + if (url.query !== null) { + output += "?" + url.query; + } + + if (!excludeFragment && url.fragment !== null) { + output += "#" + url.fragment; + } + + return output; +} + +function serializeOrigin(tuple) { + let result = tuple.scheme + "://"; + result += serializeHost(tuple.host); + + if (tuple.port !== null) { + result += ":" + tuple.port; + } + + return result; +} + +module.exports.serializeURL = serializeURL; + +module.exports.serializeURLOrigin = function (url) { + // https://url.spec.whatwg.org/#concept-url-origin + switch (url.scheme) { + case "blob": + try { + return module.exports.serializeURLOrigin(module.exports.parseURL(url.path[0])); + } catch (e) { + // serializing an opaque origin returns "null" + return "null"; + } + case "ftp": + case "gopher": + case "http": + case "https": + case "ws": + case "wss": + return serializeOrigin({ + scheme: url.scheme, + host: url.host, + port: url.port + }); + case "file": + // spec says "exercise to the reader", chrome says "file://" + return "file://"; + default: + // serializing an opaque origin returns "null" + return "null"; + } +}; + +module.exports.basicURLParse = function (input, options) { + if (options === undefined) { + options = {}; + } + + const usm = new URLStateMachine(input, options.baseURL, options.encodingOverride, options.url, options.stateOverride); + if (usm.failure) { + return "failure"; + } + + return usm.url; +}; + +module.exports.setTheUsername = function (url, username) { + url.username = ""; + const decoded = punycode.ucs2.decode(username); + for (let i = 0; i < decoded.length; ++i) { + url.username += percentEncodeChar(decoded[i], isUserinfoPercentEncode); + } +}; + +module.exports.setThePassword = function (url, password) { + url.password = ""; + const decoded = punycode.ucs2.decode(password); + for (let i = 0; i < decoded.length; ++i) { + url.password += percentEncodeChar(decoded[i], isUserinfoPercentEncode); + } +}; + +module.exports.serializeHost = serializeHost; + +module.exports.cannotHaveAUsernamePasswordPort = cannotHaveAUsernamePasswordPort; + +module.exports.serializeInteger = function (integer) { + return String(integer); +}; + +module.exports.parseURL = function (input, options) { + if (options === undefined) { + options = {}; + } + + // We don't handle blobs, so this just delegates: + return module.exports.basicURLParse(input, { baseURL: options.baseURL, encodingOverride: options.encodingOverride }); +}; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/whatwg-url/lib/utils.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/whatwg-url/lib/utils.js new file mode 100644 index 00000000..a562009c --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/whatwg-url/lib/utils.js @@ -0,0 +1,20 @@ +"use strict"; + +module.exports.mixin = function mixin(target, source) { + const keys = Object.getOwnPropertyNames(source); + for (let i = 0; i < keys.length; ++i) { + Object.defineProperty(target, keys[i], Object.getOwnPropertyDescriptor(source, keys[i])); + } +}; + +module.exports.wrapperSymbol = Symbol("wrapper"); +module.exports.implSymbol = Symbol("impl"); + +module.exports.wrapperForImpl = function (impl) { + return impl[module.exports.wrapperSymbol]; +}; + +module.exports.implForWrapper = function (wrapper) { + return wrapper[module.exports.implSymbol]; +}; + diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/whatwg-url/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/whatwg-url/package.json new file mode 100644 index 00000000..cefd2061 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/whatwg-url/package.json @@ -0,0 +1,67 @@ +{ + "_from": "whatwg-url@^5.0.0", + "_id": "whatwg-url@5.0.0", + "_inBundle": false, + "_integrity": "sha1-lmRU6HZUYuN2RNNib2dCzotwll0=", + "_location": "/whatwg-url", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "whatwg-url@^5.0.0", + "name": "whatwg-url", + "escapedName": "whatwg-url", + "rawSpec": "^5.0.0", + "saveSpec": null, + "fetchSpec": "^5.0.0" + }, + "_requiredBy": [ + "/node-fetch" + ], + "_resolved": "https://registry.npmjs.org/whatwg-url/-/whatwg-url-5.0.0.tgz", + "_shasum": "966454e8765462e37644d3626f6742ce8b70965d", + "_spec": "whatwg-url@^5.0.0", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\node-fetch", + "author": { + "name": "Sebastian Mayr", + "email": "github@smayr.name" + }, + "bugs": { + "url": "https://github.com/jsdom/whatwg-url/issues" + }, + "bundleDependencies": false, + "dependencies": { + "tr46": "~0.0.3", + "webidl-conversions": "^3.0.0" + }, + "deprecated": false, + "description": "An implementation of the WHATWG URL Standard's URL API and parsing machinery", + "devDependencies": { + "eslint": "^2.6.0", + "istanbul": "~0.4.3", + "mocha": "^2.2.4", + "recast": "~0.10.29", + "request": "^2.55.0", + "webidl2js": "^3.0.2" + }, + "files": [ + "lib/" + ], + "homepage": "https://github.com/jsdom/whatwg-url#readme", + "license": "MIT", + "main": "lib/public-api.js", + "name": "whatwg-url", + "repository": { + "type": "git", + "url": "git+https://github.com/jsdom/whatwg-url.git" + }, + "scripts": { + "build": "node scripts/transform.js && node scripts/convert-idl.js", + "coverage": "istanbul cover node_modules/mocha/bin/_mocha", + "lint": "eslint .", + "prepublish": "npm run build", + "pretest": "node scripts/get-latest-platform-tests.js && npm run build", + "test": "mocha" + }, + "version": "5.0.0" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/which/CHANGELOG.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/which/CHANGELOG.md new file mode 100644 index 00000000..7fb1f203 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/which/CHANGELOG.md @@ -0,0 +1,166 @@ +# Changes + + +## 2.0.2 + +* Rename bin to `node-which` + +## 2.0.1 + +* generate changelog and publish on version bump +* enforce 100% test coverage +* Promise interface + +## 2.0.0 + +* Parallel tests, modern JavaScript, and drop support for node < 8 + +## 1.3.1 + +* update deps +* update travis + +## v1.3.0 + +* Add nothrow option to which.sync +* update tap + +## v1.2.14 + +* appveyor: drop node 5 and 0.x +* travis-ci: add node 6, drop 0.x + +## v1.2.13 + +* test: Pass missing option to pass on windows +* update tap +* update isexe to 2.0.0 +* neveragain.tech pledge request + +## v1.2.12 + +* Removed unused require + +## v1.2.11 + +* Prevent changelog script from being included in package + +## v1.2.10 + +* Use env.PATH only, not env.Path + +## v1.2.9 + +* fix for paths starting with ../ +* Remove unused `is-absolute` module + +## v1.2.8 + +* bullet items in changelog that contain (but don't start with) # + +## v1.2.7 + +* strip 'update changelog' changelog entries out of changelog + +## v1.2.6 + +* make the changelog bulleted + +## v1.2.5 + +* make a changelog, and keep it up to date +* don't include tests in package +* Properly handle relative-path executables +* appveyor +* Attach error code to Not Found error +* Make tests pass on Windows + +## v1.2.4 + +* Fix typo + +## v1.2.3 + +* update isexe, fix regression in pathExt handling + +## v1.2.2 + +* update deps, use isexe module, test windows + +## v1.2.1 + +* Sometimes windows PATH entries are quoted +* Fixed a bug in the check for group and user mode bits. This bug was introduced during refactoring for supporting strict mode. +* doc cli + +## v1.2.0 + +* Add support for opt.all and -as cli flags +* test the bin +* update travis +* Allow checking for multiple programs in bin/which +* tap 2 + +## v1.1.2 + +* travis +* Refactored and fixed undefined error on Windows +* Support strict mode + +## v1.1.1 + +* test +g exes against secondary groups, if available +* Use windows exe semantics on cygwin & msys +* cwd should be first in path on win32, not last +* Handle lower-case 'env.Path' on Windows +* Update docs +* use single-quotes + +## v1.1.0 + +* Add tests, depend on is-absolute + +## v1.0.9 + +* which.js: root is allowed to execute files owned by anyone + +## v1.0.8 + +* don't use graceful-fs + +## v1.0.7 + +* add license to package.json + +## v1.0.6 + +* isc license + +## 1.0.5 + +* Awful typo + +## 1.0.4 + +* Test for path absoluteness properly +* win: Allow '' as a pathext if cmd has a . in it + +## 1.0.3 + +* Remove references to execPath +* Make `which.sync()` work on Windows by honoring the PATHEXT variable. +* Make `isExe()` always return true on Windows. +* MIT + +## 1.0.2 + +* Only files can be exes + +## 1.0.1 + +* Respect the PATHEXT env for win32 support +* should 0755 the bin +* binary +* guts +* package +* 1st diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/which/LICENSE b/25_03_11/frontend_vizsgafeladat/backend/node_modules/which/LICENSE new file mode 100644 index 00000000..19129e31 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/which/LICENSE @@ -0,0 +1,15 @@ +The ISC License + +Copyright (c) Isaac Z. Schlueter and Contributors + +Permission to use, copy, modify, and/or distribute this software for any +purpose with or without fee is hereby granted, provided that the above +copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF +MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR +ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR +IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/which/README.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/which/README.md new file mode 100644 index 00000000..cd833509 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/which/README.md @@ -0,0 +1,54 @@ +# which + +Like the unix `which` utility. + +Finds the first instance of a specified executable in the PATH +environment variable. Does not cache the results, so `hash -r` is not +needed when the PATH changes. + +## USAGE + +```javascript +var which = require('which') + +// async usage +which('node', function (er, resolvedPath) { + // er is returned if no "node" is found on the PATH + // if it is found, then the absolute path to the exec is returned +}) + +// or promise +which('node').then(resolvedPath => { ... }).catch(er => { ... not found ... }) + +// sync usage +// throws if not found +var resolved = which.sync('node') + +// if nothrow option is used, returns null if not found +resolved = which.sync('node', {nothrow: true}) + +// Pass options to override the PATH and PATHEXT environment vars. +which('node', { path: someOtherPath }, function (er, resolved) { + if (er) + throw er + console.log('found at %j', resolved) +}) +``` + +## CLI USAGE + +Same as the BSD `which(1)` binary. + +``` +usage: which [-as] program ... +``` + +## OPTIONS + +You may pass an options object as the second argument. + +- `path`: Use instead of the `PATH` environment variable. +- `pathExt`: Use instead of the `PATHEXT` environment variable. +- `all`: Return all matches, instead of just the first one. Note that + this means the function returns an array of strings instead of a + single string. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/which/bin/node-which b/25_03_11/frontend_vizsgafeladat/backend/node_modules/which/bin/node-which new file mode 100644 index 00000000..7cee3729 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/which/bin/node-which @@ -0,0 +1,52 @@ +#!/usr/bin/env node +var which = require("../") +if (process.argv.length < 3) + usage() + +function usage () { + console.error('usage: which [-as] program ...') + process.exit(1) +} + +var all = false +var silent = false +var dashdash = false +var args = process.argv.slice(2).filter(function (arg) { + if (dashdash || !/^-/.test(arg)) + return true + + if (arg === '--') { + dashdash = true + return false + } + + var flags = arg.substr(1).split('') + for (var f = 0; f < flags.length; f++) { + var flag = flags[f] + switch (flag) { + case 's': + silent = true + break + case 'a': + all = true + break + default: + console.error('which: illegal option -- ' + flag) + usage() + } + } + return false +}) + +process.exit(args.reduce(function (pv, current) { + try { + var f = which.sync(current, { all: all }) + if (all) + f = f.join('\n') + if (!silent) + console.log(f) + return pv; + } catch (e) { + return 1; + } +}, 0)) diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/which/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/which/package.json new file mode 100644 index 00000000..311e9dba --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/which/package.json @@ -0,0 +1,76 @@ +{ + "_from": "which@^2.0.2", + "_id": "which@2.0.2", + "_inBundle": false, + "_integrity": "sha512-BLI3Tl1TW3Pvl70l3yq3Y64i+awpwXqsGBYWkkqMtnbXgrMD+yj7rhW0kuEDxzJaYXGjEW5ogapKNMEKNMjibA==", + "_location": "/which", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "which@^2.0.2", + "name": "which", + "escapedName": "which", + "rawSpec": "^2.0.2", + "saveSpec": null, + "fetchSpec": "^2.0.2" + }, + "_requiredBy": [ + "/node-gyp" + ], + "_resolved": "https://registry.npmjs.org/which/-/which-2.0.2.tgz", + "_shasum": "7c6a8dd0a636a0327e10b59c9286eee93f3f51b1", + "_spec": "which@^2.0.2", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\node-gyp", + "author": { + "name": "Isaac Z. Schlueter", + "email": "i@izs.me", + "url": "http://blog.izs.me" + }, + "bin": { + "node-which": "bin/node-which" + }, + "bugs": { + "url": "https://github.com/isaacs/node-which/issues" + }, + "bundleDependencies": false, + "dependencies": { + "isexe": "^2.0.0" + }, + "deprecated": false, + "description": "Like which(1) unix command. Find the first instance of an executable in the PATH.", + "devDependencies": { + "mkdirp": "^0.5.0", + "rimraf": "^2.6.2", + "tap": "^14.6.9" + }, + "engines": { + "node": ">= 8" + }, + "files": [ + "which.js", + "bin/node-which" + ], + "homepage": "https://github.com/isaacs/node-which#readme", + "license": "ISC", + "main": "which.js", + "name": "which", + "repository": { + "type": "git", + "url": "git://github.com/isaacs/node-which.git" + }, + "scripts": { + "changelog": "git add CHANGELOG.md", + "postchangelog": "git commit -m 'update changelog - '${npm_package_version}", + "postpublish": "git push origin --follow-tags", + "postversion": "npm publish", + "prechangelog": "bash gen-changelog.sh", + "prepublish": "npm run changelog", + "preversion": "npm test", + "test": "tap" + }, + "tap": { + "check-coverage": true + }, + "version": "2.0.2" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/which/which.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/which/which.js new file mode 100644 index 00000000..82afffd2 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/which/which.js @@ -0,0 +1,125 @@ +const isWindows = process.platform === 'win32' || + process.env.OSTYPE === 'cygwin' || + process.env.OSTYPE === 'msys' + +const path = require('path') +const COLON = isWindows ? ';' : ':' +const isexe = require('isexe') + +const getNotFoundError = (cmd) => + Object.assign(new Error(`not found: ${cmd}`), { code: 'ENOENT' }) + +const getPathInfo = (cmd, opt) => { + const colon = opt.colon || COLON + + // If it has a slash, then we don't bother searching the pathenv. + // just check the file itself, and that's it. + const pathEnv = cmd.match(/\//) || isWindows && cmd.match(/\\/) ? [''] + : ( + [ + // windows always checks the cwd first + ...(isWindows ? [process.cwd()] : []), + ...(opt.path || process.env.PATH || + /* istanbul ignore next: very unusual */ '').split(colon), + ] + ) + const pathExtExe = isWindows + ? opt.pathExt || process.env.PATHEXT || '.EXE;.CMD;.BAT;.COM' + : '' + const pathExt = isWindows ? pathExtExe.split(colon) : [''] + + if (isWindows) { + if (cmd.indexOf('.') !== -1 && pathExt[0] !== '') + pathExt.unshift('') + } + + return { + pathEnv, + pathExt, + pathExtExe, + } +} + +const which = (cmd, opt, cb) => { + if (typeof opt === 'function') { + cb = opt + opt = {} + } + if (!opt) + opt = {} + + const { pathEnv, pathExt, pathExtExe } = getPathInfo(cmd, opt) + const found = [] + + const step = i => new Promise((resolve, reject) => { + if (i === pathEnv.length) + return opt.all && found.length ? resolve(found) + : reject(getNotFoundError(cmd)) + + const ppRaw = pathEnv[i] + const pathPart = /^".*"$/.test(ppRaw) ? ppRaw.slice(1, -1) : ppRaw + + const pCmd = path.join(pathPart, cmd) + const p = !pathPart && /^\.[\\\/]/.test(cmd) ? cmd.slice(0, 2) + pCmd + : pCmd + + resolve(subStep(p, i, 0)) + }) + + const subStep = (p, i, ii) => new Promise((resolve, reject) => { + if (ii === pathExt.length) + return resolve(step(i + 1)) + const ext = pathExt[ii] + isexe(p + ext, { pathExt: pathExtExe }, (er, is) => { + if (!er && is) { + if (opt.all) + found.push(p + ext) + else + return resolve(p + ext) + } + return resolve(subStep(p, i, ii + 1)) + }) + }) + + return cb ? step(0).then(res => cb(null, res), cb) : step(0) +} + +const whichSync = (cmd, opt) => { + opt = opt || {} + + const { pathEnv, pathExt, pathExtExe } = getPathInfo(cmd, opt) + const found = [] + + for (let i = 0; i < pathEnv.length; i ++) { + const ppRaw = pathEnv[i] + const pathPart = /^".*"$/.test(ppRaw) ? ppRaw.slice(1, -1) : ppRaw + + const pCmd = path.join(pathPart, cmd) + const p = !pathPart && /^\.[\\\/]/.test(cmd) ? cmd.slice(0, 2) + pCmd + : pCmd + + for (let j = 0; j < pathExt.length; j ++) { + const cur = p + pathExt[j] + try { + const is = isexe.sync(cur, { pathExt: pathExtExe }) + if (is) { + if (opt.all) + found.push(cur) + else + return cur + } + } catch (ex) {} + } + } + + if (opt.all && found.length) + return found + + if (opt.nothrow) + return null + + throw getNotFoundError(cmd) +} + +module.exports = which +which.sync = whichSync diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/wide-align/LICENSE b/25_03_11/frontend_vizsgafeladat/backend/node_modules/wide-align/LICENSE new file mode 100644 index 00000000..f4be44d8 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/wide-align/LICENSE @@ -0,0 +1,14 @@ +Copyright (c) 2015, Rebecca Turner + +Permission to use, copy, modify, and/or distribute this software for any +purpose with or without fee is hereby granted, provided that the above +copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF +MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR +ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF +OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/wide-align/README.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/wide-align/README.md new file mode 100644 index 00000000..32f1be04 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/wide-align/README.md @@ -0,0 +1,47 @@ +wide-align +---------- + +A wide-character aware text alignment function for use in terminals / on the +console. + +### Usage + +``` +var align = require('wide-align') + +// Note that if you view this on a unicode console, all of the slashes are +// aligned. This is because on a console, all narrow characters are +// an en wide and all wide characters are an em. In browsers, this isn't +// held to and wide characters like "古" can be less than two narrow +// characters even with a fixed width font. + +console.log(align.center('abc', 10)) // ' abc ' +console.log(align.center('古古古', 10)) // ' 古古古 ' +console.log(align.left('abc', 10)) // 'abc ' +console.log(align.left('古古古', 10)) // '古古古 ' +console.log(align.right('abc', 10)) // ' abc' +console.log(align.right('古古古', 10)) // ' 古古古' +``` + +### Functions + +#### `align.center(str, length)` → `str` + +Returns *str* with spaces added to both sides such that that it is *length* +chars long and centered in the spaces. + +#### `align.left(str, length)` → `str` + +Returns *str* with spaces to the right such that it is *length* chars long. + +### `align.right(str, length)` → `str` + +Returns *str* with spaces to the left such that it is *length* chars long. + +### Origins + +These functions were originally taken from +[cliui](https://npmjs.com/package/cliui). Changes include switching to the +MUCH faster pad generation function from +[lodash](https://npmjs.com/package/lodash), making center alignment pad +both sides and adding left alignment. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/wide-align/align.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/wide-align/align.js new file mode 100644 index 00000000..4f94ca4c --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/wide-align/align.js @@ -0,0 +1,65 @@ +'use strict' +var stringWidth = require('string-width') + +exports.center = alignCenter +exports.left = alignLeft +exports.right = alignRight + +// lodash's way of generating pad characters. + +function createPadding (width) { + var result = '' + var string = ' ' + var n = width + do { + if (n % 2) { + result += string; + } + n = Math.floor(n / 2); + string += string; + } while (n); + + return result; +} + +function alignLeft (str, width) { + var trimmed = str.trimRight() + if (trimmed.length === 0 && str.length >= width) return str + var padding = '' + var strWidth = stringWidth(trimmed) + + if (strWidth < width) { + padding = createPadding(width - strWidth) + } + + return trimmed + padding +} + +function alignRight (str, width) { + var trimmed = str.trimLeft() + if (trimmed.length === 0 && str.length >= width) return str + var padding = '' + var strWidth = stringWidth(trimmed) + + if (strWidth < width) { + padding = createPadding(width - strWidth) + } + + return padding + trimmed +} + +function alignCenter (str, width) { + var trimmed = str.trim() + if (trimmed.length === 0 && str.length >= width) return str + var padLeft = '' + var padRight = '' + var strWidth = stringWidth(trimmed) + + if (strWidth < width) { + var padLeftBy = parseInt((width - strWidth) / 2, 10) + padLeft = createPadding(padLeftBy) + padRight = createPadding(width - (strWidth + padLeftBy)) + } + + return padLeft + trimmed + padRight +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/wide-align/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/wide-align/package.json new file mode 100644 index 00000000..e950a079 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/wide-align/package.json @@ -0,0 +1,67 @@ +{ + "//": "But not version 5 of string-width, as that's ESM only", + "_from": "wide-align@^1.1.2", + "_id": "wide-align@1.1.5", + "_inBundle": false, + "_integrity": "sha512-eDMORYaPNZ4sQIuuYPDHdQvf4gyCF9rEEV/yPxGfwPkRodwEgiMUUXTx/dex+Me0wxx53S+NgUHaP7y3MGlDmg==", + "_location": "/wide-align", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "wide-align@^1.1.2", + "name": "wide-align", + "escapedName": "wide-align", + "rawSpec": "^1.1.2", + "saveSpec": null, + "fetchSpec": "^1.1.2" + }, + "_requiredBy": [ + "/gauge", + "/node-gyp/gauge" + ], + "_resolved": "https://registry.npmjs.org/wide-align/-/wide-align-1.1.5.tgz", + "_shasum": "df1d4c206854369ecf3c9a4898f1b23fbd9d15d3", + "_spec": "wide-align@^1.1.2", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\gauge", + "author": { + "name": "Rebecca Turner", + "email": "me@re-becca.org", + "url": "http://re-becca.org/" + }, + "bugs": { + "url": "https://github.com/iarna/wide-align/issues" + }, + "bundleDependencies": false, + "dependencies": { + "string-width": "^1.0.2 || 2 || 3 || 4" + }, + "deprecated": false, + "description": "A wide-character aware text alignment function for use on the console or with fixed width fonts.", + "devDependencies": { + "tap": "*" + }, + "files": [ + "align.js" + ], + "homepage": "https://github.com/iarna/wide-align#readme", + "keywords": [ + "wide", + "double", + "unicode", + "cjkv", + "pad", + "align" + ], + "license": "ISC", + "main": "align.js", + "name": "wide-align", + "repository": { + "type": "git", + "url": "git+https://github.com/iarna/wide-align.git" + }, + "scripts": { + "test": "tap --coverage test/*.js" + }, + "version": "1.1.5" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/widest-line/index.d.ts b/25_03_11/frontend_vizsgafeladat/backend/node_modules/widest-line/index.d.ts new file mode 100644 index 00000000..845ceaab --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/widest-line/index.d.ts @@ -0,0 +1,21 @@ +declare const widestLine: { + /** + Get the visual width of the widest line in a string - the number of columns required to display it. + + @example + ``` + import widestLine = require('widest-line'); + + widestLine('古\n\u001B[1m@\u001B[22m'); + //=> 2 + ``` + */ + (input: string): number; + + // TODO: remove this in the next major version, refactor definition to: + // declare function widestLine(input: string): number; + // export = widestLine; + default: typeof widestLine; +}; + +export = widestLine; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/widest-line/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/widest-line/index.js new file mode 100644 index 00000000..98f8ce45 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/widest-line/index.js @@ -0,0 +1,16 @@ +'use strict'; +const stringWidth = require('string-width'); + +const widestLine = input => { + let max = 0; + + for (const line of input.split('\n')) { + max = Math.max(max, stringWidth(line)); + } + + return max; +}; + +module.exports = widestLine; +// TODO: remove this in the next major version +module.exports.default = widestLine; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/widest-line/license b/25_03_11/frontend_vizsgafeladat/backend/node_modules/widest-line/license new file mode 100644 index 00000000..e7af2f77 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/widest-line/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/widest-line/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/widest-line/package.json new file mode 100644 index 00000000..7a0da894 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/widest-line/package.json @@ -0,0 +1,86 @@ +{ + "_from": "widest-line@^3.1.0", + "_id": "widest-line@3.1.0", + "_inBundle": false, + "_integrity": "sha512-NsmoXalsWVDMGupxZ5R08ka9flZjjiLvHVAWYOKtiKM8ujtZWr9cRffak+uSE48+Ob8ObalXpwyeUiyDD6QFgg==", + "_location": "/widest-line", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "widest-line@^3.1.0", + "name": "widest-line", + "escapedName": "widest-line", + "rawSpec": "^3.1.0", + "saveSpec": null, + "fetchSpec": "^3.1.0" + }, + "_requiredBy": [ + "/boxen" + ], + "_resolved": "https://registry.npmjs.org/widest-line/-/widest-line-3.1.0.tgz", + "_shasum": "8292333bbf66cb45ff0de1603b136b7ae1496eca", + "_spec": "widest-line@^3.1.0", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\boxen", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "sindresorhus.com" + }, + "bugs": { + "url": "https://github.com/sindresorhus/widest-line/issues" + }, + "bundleDependencies": false, + "dependencies": { + "string-width": "^4.0.0" + }, + "deprecated": false, + "description": "Get the visual width of the widest line in a string - the number of columns required to display it", + "devDependencies": { + "ava": "^1.4.1", + "tsd": "^0.7.1", + "xo": "^0.24.0" + }, + "engines": { + "node": ">=8" + }, + "files": [ + "index.js", + "index.d.ts" + ], + "homepage": "https://github.com/sindresorhus/widest-line#readme", + "keywords": [ + "string", + "character", + "unicode", + "width", + "visual", + "column", + "columns", + "fullwidth", + "full-width", + "full", + "ansi", + "escape", + "codes", + "cli", + "command-line", + "terminal", + "console", + "cjk", + "chinese", + "japanese", + "korean", + "fixed-width" + ], + "license": "MIT", + "name": "widest-line", + "repository": { + "type": "git", + "url": "git+https://github.com/sindresorhus/widest-line.git" + }, + "scripts": { + "test": "xo && ava && tsd" + }, + "version": "3.1.0" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/widest-line/readme.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/widest-line/readme.md new file mode 100644 index 00000000..20e02d57 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/widest-line/readme.md @@ -0,0 +1,34 @@ +# widest-line [![Build Status](https://travis-ci.org/sindresorhus/widest-line.svg?branch=master)](https://travis-ci.org/sindresorhus/widest-line) + +> Get the visual width of the widest line in a string - the number of columns required to display it + +Some Unicode characters are [fullwidth](https://en.wikipedia.org/wiki/Halfwidth_and_fullwidth_forms) and use double the normal width. [ANSI escape codes](http://en.wikipedia.org/wiki/ANSI_escape_code) are stripped and doesn't affect the width. + +Useful to be able to know the maximum width a string will take up in the terminal. + + +## Install + +``` +$ npm install widest-line +``` + + +## Usage + +```js +const widestLine = require('widest-line'); + +widestLine('古\n\u001B[1m@\u001B[22m'); +//=> 2 +``` + + +## Related + +- [string-width](https://github.com/sindresorhus/string-width) - Get the visual width of a string + + +## License + +MIT © [Sindre Sorhus](https://sindresorhus.com) diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/wrap-ansi/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/wrap-ansi/index.js new file mode 100644 index 00000000..d502255b --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/wrap-ansi/index.js @@ -0,0 +1,216 @@ +'use strict'; +const stringWidth = require('string-width'); +const stripAnsi = require('strip-ansi'); +const ansiStyles = require('ansi-styles'); + +const ESCAPES = new Set([ + '\u001B', + '\u009B' +]); + +const END_CODE = 39; + +const ANSI_ESCAPE_BELL = '\u0007'; +const ANSI_CSI = '['; +const ANSI_OSC = ']'; +const ANSI_SGR_TERMINATOR = 'm'; +const ANSI_ESCAPE_LINK = `${ANSI_OSC}8;;`; + +const wrapAnsi = code => `${ESCAPES.values().next().value}${ANSI_CSI}${code}${ANSI_SGR_TERMINATOR}`; +const wrapAnsiHyperlink = uri => `${ESCAPES.values().next().value}${ANSI_ESCAPE_LINK}${uri}${ANSI_ESCAPE_BELL}`; + +// Calculate the length of words split on ' ', ignoring +// the extra characters added by ansi escape codes +const wordLengths = string => string.split(' ').map(character => stringWidth(character)); + +// Wrap a long word across multiple rows +// Ansi escape codes do not count towards length +const wrapWord = (rows, word, columns) => { + const characters = [...word]; + + let isInsideEscape = false; + let isInsideLinkEscape = false; + let visible = stringWidth(stripAnsi(rows[rows.length - 1])); + + for (const [index, character] of characters.entries()) { + const characterLength = stringWidth(character); + + if (visible + characterLength <= columns) { + rows[rows.length - 1] += character; + } else { + rows.push(character); + visible = 0; + } + + if (ESCAPES.has(character)) { + isInsideEscape = true; + isInsideLinkEscape = characters.slice(index + 1).join('').startsWith(ANSI_ESCAPE_LINK); + } + + if (isInsideEscape) { + if (isInsideLinkEscape) { + if (character === ANSI_ESCAPE_BELL) { + isInsideEscape = false; + isInsideLinkEscape = false; + } + } else if (character === ANSI_SGR_TERMINATOR) { + isInsideEscape = false; + } + + continue; + } + + visible += characterLength; + + if (visible === columns && index < characters.length - 1) { + rows.push(''); + visible = 0; + } + } + + // It's possible that the last row we copy over is only + // ansi escape characters, handle this edge-case + if (!visible && rows[rows.length - 1].length > 0 && rows.length > 1) { + rows[rows.length - 2] += rows.pop(); + } +}; + +// Trims spaces from a string ignoring invisible sequences +const stringVisibleTrimSpacesRight = string => { + const words = string.split(' '); + let last = words.length; + + while (last > 0) { + if (stringWidth(words[last - 1]) > 0) { + break; + } + + last--; + } + + if (last === words.length) { + return string; + } + + return words.slice(0, last).join(' ') + words.slice(last).join(''); +}; + +// The wrap-ansi module can be invoked in either 'hard' or 'soft' wrap mode +// +// 'hard' will never allow a string to take up more than columns characters +// +// 'soft' allows long words to expand past the column length +const exec = (string, columns, options = {}) => { + if (options.trim !== false && string.trim() === '') { + return ''; + } + + let returnValue = ''; + let escapeCode; + let escapeUrl; + + const lengths = wordLengths(string); + let rows = ['']; + + for (const [index, word] of string.split(' ').entries()) { + if (options.trim !== false) { + rows[rows.length - 1] = rows[rows.length - 1].trimStart(); + } + + let rowLength = stringWidth(rows[rows.length - 1]); + + if (index !== 0) { + if (rowLength >= columns && (options.wordWrap === false || options.trim === false)) { + // If we start with a new word but the current row length equals the length of the columns, add a new row + rows.push(''); + rowLength = 0; + } + + if (rowLength > 0 || options.trim === false) { + rows[rows.length - 1] += ' '; + rowLength++; + } + } + + // In 'hard' wrap mode, the length of a line is never allowed to extend past 'columns' + if (options.hard && lengths[index] > columns) { + const remainingColumns = (columns - rowLength); + const breaksStartingThisLine = 1 + Math.floor((lengths[index] - remainingColumns - 1) / columns); + const breaksStartingNextLine = Math.floor((lengths[index] - 1) / columns); + if (breaksStartingNextLine < breaksStartingThisLine) { + rows.push(''); + } + + wrapWord(rows, word, columns); + continue; + } + + if (rowLength + lengths[index] > columns && rowLength > 0 && lengths[index] > 0) { + if (options.wordWrap === false && rowLength < columns) { + wrapWord(rows, word, columns); + continue; + } + + rows.push(''); + } + + if (rowLength + lengths[index] > columns && options.wordWrap === false) { + wrapWord(rows, word, columns); + continue; + } + + rows[rows.length - 1] += word; + } + + if (options.trim !== false) { + rows = rows.map(stringVisibleTrimSpacesRight); + } + + const pre = [...rows.join('\n')]; + + for (const [index, character] of pre.entries()) { + returnValue += character; + + if (ESCAPES.has(character)) { + const {groups} = new RegExp(`(?:\\${ANSI_CSI}(?\\d+)m|\\${ANSI_ESCAPE_LINK}(?.*)${ANSI_ESCAPE_BELL})`).exec(pre.slice(index).join('')) || {groups: {}}; + if (groups.code !== undefined) { + const code = Number.parseFloat(groups.code); + escapeCode = code === END_CODE ? undefined : code; + } else if (groups.uri !== undefined) { + escapeUrl = groups.uri.length === 0 ? undefined : groups.uri; + } + } + + const code = ansiStyles.codes.get(Number(escapeCode)); + + if (pre[index + 1] === '\n') { + if (escapeUrl) { + returnValue += wrapAnsiHyperlink(''); + } + + if (escapeCode && code) { + returnValue += wrapAnsi(code); + } + } else if (character === '\n') { + if (escapeCode && code) { + returnValue += wrapAnsi(escapeCode); + } + + if (escapeUrl) { + returnValue += wrapAnsiHyperlink(escapeUrl); + } + } + } + + return returnValue; +}; + +// For each newline, invoke the method separately +module.exports = (string, columns, options) => { + return String(string) + .normalize() + .replace(/\r\n/g, '\n') + .split('\n') + .map(line => exec(line, columns, options)) + .join('\n'); +}; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/wrap-ansi/license b/25_03_11/frontend_vizsgafeladat/backend/node_modules/wrap-ansi/license new file mode 100644 index 00000000..fa7ceba3 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/wrap-ansi/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus (https://sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/wrap-ansi/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/wrap-ansi/package.json new file mode 100644 index 00000000..96502085 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/wrap-ansi/package.json @@ -0,0 +1,94 @@ +{ + "_from": "wrap-ansi@^7.0.0", + "_id": "wrap-ansi@7.0.0", + "_inBundle": false, + "_integrity": "sha512-YVGIj2kamLSTxw6NsZjoBxfSwsn0ycdesmc4p+Q21c5zPuZ1pl+NfxVdxPtdHvmNVOQ6XSYG4AUtyt/Fi7D16Q==", + "_location": "/wrap-ansi", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "wrap-ansi@^7.0.0", + "name": "wrap-ansi", + "escapedName": "wrap-ansi", + "rawSpec": "^7.0.0", + "saveSpec": null, + "fetchSpec": "^7.0.0" + }, + "_requiredBy": [ + "/boxen" + ], + "_resolved": "https://registry.npmjs.org/wrap-ansi/-/wrap-ansi-7.0.0.tgz", + "_shasum": "67e145cff510a6a6984bdf1152911d69d2eb9e43", + "_spec": "wrap-ansi@^7.0.0", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\boxen", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "https://sindresorhus.com" + }, + "bugs": { + "url": "https://github.com/chalk/wrap-ansi/issues" + }, + "bundleDependencies": false, + "dependencies": { + "ansi-styles": "^4.0.0", + "string-width": "^4.1.0", + "strip-ansi": "^6.0.0" + }, + "deprecated": false, + "description": "Wordwrap a string with ANSI escape codes", + "devDependencies": { + "ava": "^2.1.0", + "chalk": "^4.0.0", + "coveralls": "^3.0.3", + "has-ansi": "^4.0.0", + "nyc": "^15.0.1", + "xo": "^0.29.1" + }, + "engines": { + "node": ">=10" + }, + "files": [ + "index.js" + ], + "funding": "https://github.com/chalk/wrap-ansi?sponsor=1", + "homepage": "https://github.com/chalk/wrap-ansi#readme", + "keywords": [ + "wrap", + "break", + "wordwrap", + "wordbreak", + "linewrap", + "ansi", + "styles", + "color", + "colour", + "colors", + "terminal", + "console", + "cli", + "string", + "tty", + "escape", + "formatting", + "rgb", + "256", + "shell", + "xterm", + "log", + "logging", + "command-line", + "text" + ], + "license": "MIT", + "name": "wrap-ansi", + "repository": { + "type": "git", + "url": "git+https://github.com/chalk/wrap-ansi.git" + }, + "scripts": { + "test": "xo && nyc ava" + }, + "version": "7.0.0" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/wrap-ansi/readme.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/wrap-ansi/readme.md new file mode 100644 index 00000000..68779ba5 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/wrap-ansi/readme.md @@ -0,0 +1,91 @@ +# wrap-ansi [![Build Status](https://travis-ci.com/chalk/wrap-ansi.svg?branch=master)](https://travis-ci.com/chalk/wrap-ansi) [![Coverage Status](https://coveralls.io/repos/github/chalk/wrap-ansi/badge.svg?branch=master)](https://coveralls.io/github/chalk/wrap-ansi?branch=master) + +> Wordwrap a string with [ANSI escape codes](https://en.wikipedia.org/wiki/ANSI_escape_code#Colors_and_Styles) + +## Install + +``` +$ npm install wrap-ansi +``` + +## Usage + +```js +const chalk = require('chalk'); +const wrapAnsi = require('wrap-ansi'); + +const input = 'The quick brown ' + chalk.red('fox jumped over ') + + 'the lazy ' + chalk.green('dog and then ran away with the unicorn.'); + +console.log(wrapAnsi(input, 20)); +``` + + + +## API + +### wrapAnsi(string, columns, options?) + +Wrap words to the specified column width. + +#### string + +Type: `string` + +String with ANSI escape codes. Like one styled by [`chalk`](https://github.com/chalk/chalk). Newline characters will be normalized to `\n`. + +#### columns + +Type: `number` + +Number of columns to wrap the text to. + +#### options + +Type: `object` + +##### hard + +Type: `boolean`\ +Default: `false` + +By default the wrap is soft, meaning long words may extend past the column width. Setting this to `true` will make it hard wrap at the column width. + +##### wordWrap + +Type: `boolean`\ +Default: `true` + +By default, an attempt is made to split words at spaces, ensuring that they don't extend past the configured columns. If wordWrap is `false`, each column will instead be completely filled splitting words as necessary. + +##### trim + +Type: `boolean`\ +Default: `true` + +Whitespace on all lines is removed by default. Set this option to `false` if you don't want to trim. + +## Related + +- [slice-ansi](https://github.com/chalk/slice-ansi) - Slice a string with ANSI escape codes +- [cli-truncate](https://github.com/sindresorhus/cli-truncate) - Truncate a string to a specific width in the terminal +- [chalk](https://github.com/chalk/chalk) - Terminal string styling done right +- [jsesc](https://github.com/mathiasbynens/jsesc) - Generate ASCII-only output from Unicode strings. Useful for creating test fixtures. + +## Maintainers + +- [Sindre Sorhus](https://github.com/sindresorhus) +- [Josh Junon](https://github.com/qix-) +- [Benjamin Coe](https://github.com/bcoe) + +--- + +
+ + Get professional support for this package with a Tidelift subscription + +
+ + Tidelift helps make open source sustainable for maintainers while giving companies
assurances about security, maintenance, and licensing for their dependencies. + +
diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/wrappy/LICENSE b/25_03_11/frontend_vizsgafeladat/backend/node_modules/wrappy/LICENSE new file mode 100644 index 00000000..19129e31 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/wrappy/LICENSE @@ -0,0 +1,15 @@ +The ISC License + +Copyright (c) Isaac Z. Schlueter and Contributors + +Permission to use, copy, modify, and/or distribute this software for any +purpose with or without fee is hereby granted, provided that the above +copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF +MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR +ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR +IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/wrappy/README.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/wrappy/README.md new file mode 100644 index 00000000..98eab252 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/wrappy/README.md @@ -0,0 +1,36 @@ +# wrappy + +Callback wrapping utility + +## USAGE + +```javascript +var wrappy = require("wrappy") + +// var wrapper = wrappy(wrapperFunction) + +// make sure a cb is called only once +// See also: http://npm.im/once for this specific use case +var once = wrappy(function (cb) { + var called = false + return function () { + if (called) return + called = true + return cb.apply(this, arguments) + } +}) + +function printBoo () { + console.log('boo') +} +// has some rando property +printBoo.iAmBooPrinter = true + +var onlyPrintOnce = once(printBoo) + +onlyPrintOnce() // prints 'boo' +onlyPrintOnce() // does nothing + +// random property is retained! +assert.equal(onlyPrintOnce.iAmBooPrinter, true) +``` diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/wrappy/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/wrappy/package.json new file mode 100644 index 00000000..0c70fc53 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/wrappy/package.json @@ -0,0 +1,59 @@ +{ + "_from": "wrappy@1", + "_id": "wrappy@1.0.2", + "_inBundle": false, + "_integrity": "sha1-tSQ9jz7BqjXxNkYFvA0QNuMKtp8=", + "_location": "/wrappy", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "wrappy@1", + "name": "wrappy", + "escapedName": "wrappy", + "rawSpec": "1", + "saveSpec": null, + "fetchSpec": "1" + }, + "_requiredBy": [ + "/inflight", + "/once" + ], + "_resolved": "https://registry.npmjs.org/wrappy/-/wrappy-1.0.2.tgz", + "_shasum": "b5243d8f3ec1aa35f1364605bc0d1036e30ab69f", + "_spec": "wrappy@1", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\inflight", + "author": { + "name": "Isaac Z. Schlueter", + "email": "i@izs.me", + "url": "http://blog.izs.me/" + }, + "bugs": { + "url": "https://github.com/npm/wrappy/issues" + }, + "bundleDependencies": false, + "dependencies": {}, + "deprecated": false, + "description": "Callback wrapping utility", + "devDependencies": { + "tap": "^2.3.1" + }, + "directories": { + "test": "test" + }, + "files": [ + "wrappy.js" + ], + "homepage": "https://github.com/npm/wrappy", + "license": "ISC", + "main": "wrappy.js", + "name": "wrappy", + "repository": { + "type": "git", + "url": "git+https://github.com/npm/wrappy.git" + }, + "scripts": { + "test": "tap --coverage test/*.js" + }, + "version": "1.0.2" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/wrappy/wrappy.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/wrappy/wrappy.js new file mode 100644 index 00000000..bb7e7d6f --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/wrappy/wrappy.js @@ -0,0 +1,33 @@ +// Returns a wrapper function that returns a wrapped callback +// The wrapper function should do some stuff, and return a +// presumably different callback function. +// This makes sure that own properties are retained, so that +// decorations and such are not lost along the way. +module.exports = wrappy +function wrappy (fn, cb) { + if (fn && cb) return wrappy(fn)(cb) + + if (typeof fn !== 'function') + throw new TypeError('need wrapper function') + + Object.keys(fn).forEach(function (k) { + wrapper[k] = fn[k] + }) + + return wrapper + + function wrapper() { + var args = new Array(arguments.length) + for (var i = 0; i < args.length; i++) { + args[i] = arguments[i] + } + var ret = fn.apply(this, args) + var cb = args[args.length-1] + if (typeof ret === 'function' && ret !== cb) { + Object.keys(cb).forEach(function (k) { + ret[k] = cb[k] + }) + } + return ret + } +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/write-file-atomic/CHANGELOG.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/write-file-atomic/CHANGELOG.md new file mode 100644 index 00000000..d1a6c1b8 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/write-file-atomic/CHANGELOG.md @@ -0,0 +1,32 @@ +# 3.0.0 + +* Implement options.tmpfileCreated callback. +* Drop Node.js 6, modernize code, return Promise from async function. +* Support write TypedArray's like in node fs.writeFile. +* Remove graceful-fs dependency. + +# 2.4.3 + +* Ignore errors raised by `fs.closeSync` when cleaning up after a write + error. + +# 2.4.2 + +* A pair of patches to fix some fd leaks. We would leak fds with sync use + when errors occured and with async use any time fsync was not in use. (#34) + +# 2.4.1 + +* Fix a bug where `signal-exit` instances would be leaked. This was fixed when addressing #35. + +# 2.4.0 + +## Features + +* Allow chown and mode options to be set to false to disable the defaulting behavior. (#20) +* Support passing encoding strings in options slot for compat with Node.js API. (#31) +* Add support for running inside of worker threads (#37) + +## Fixes + +* Remove unneeded call when returning success (#36) diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/write-file-atomic/LICENSE b/25_03_11/frontend_vizsgafeladat/backend/node_modules/write-file-atomic/LICENSE new file mode 100644 index 00000000..95e65a77 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/write-file-atomic/LICENSE @@ -0,0 +1,6 @@ +Copyright (c) 2015, Rebecca Turner + +Permission to use, copy, modify, and/or distribute this software for any purpose with or without fee is hereby granted, provided that the above copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/write-file-atomic/README.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/write-file-atomic/README.md new file mode 100644 index 00000000..caea7995 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/write-file-atomic/README.md @@ -0,0 +1,72 @@ +write-file-atomic +----------------- + +This is an extension for node's `fs.writeFile` that makes its operation +atomic and allows you set ownership (uid/gid of the file). + +### var writeFileAtomic = require('write-file-atomic')
writeFileAtomic(filename, data, [options], [callback]) + +* filename **String** +* data **String** | **Buffer** +* options **Object** | **String** + * chown **Object** default, uid & gid of existing file, if any + * uid **Number** + * gid **Number** + * encoding **String** | **Null** default = 'utf8' + * fsync **Boolean** default = true + * mode **Number** default, from existing file, if any + * tmpfileCreated **Function** called when the tmpfile is created +* callback **Function** + +Atomically and asynchronously writes data to a file, replacing the file if it already +exists. data can be a string or a buffer. + +The file is initially named `filename + "." + murmurhex(__filename, process.pid, ++invocations)`. +Note that `require('worker_threads').threadId` is used in addition to `process.pid` if running inside of a worker thread. +If writeFile completes successfully then, if passed the **chown** option it will change +the ownership of the file. Finally it renames the file back to the filename you specified. If +it encounters errors at any of these steps it will attempt to unlink the temporary file and then +pass the error back to the caller. +If multiple writes are concurrently issued to the same file, the write operations are put into a queue and serialized in the order they were called, using Promises. Writes to different files are still executed in parallel. + +If provided, the **chown** option requires both **uid** and **gid** properties or else +you'll get an error. If **chown** is not specified it will default to using +the owner of the previous file. To prevent chown from being ran you can +also pass `false`, in which case the file will be created with the current user's credentials. + +If **mode** is not specified, it will default to using the permissions from +an existing file, if any. Expicitly setting this to `false` remove this default, resulting +in a file created with the system default permissions. + +If options is a String, it's assumed to be the **encoding** option. The **encoding** option is ignored if **data** is a buffer. It defaults to 'utf8'. + +If the **fsync** option is **false**, writeFile will skip the final fsync call. + +If the **tmpfileCreated** option is specified it will be called with the name of the tmpfile when created. + +Example: + +```javascript +writeFileAtomic('message.txt', 'Hello Node', {chown:{uid:100,gid:50}}, function (err) { + if (err) throw err; + console.log('It\'s saved!'); +}); +``` + +This function also supports async/await: + +```javascript +(async () => { + try { + await writeFileAtomic('message.txt', 'Hello Node', {chown:{uid:100,gid:50}}); + console.log('It\'s saved!'); + } catch (err) { + console.error(err); + process.exit(1); + } +})(); +``` + +### var writeFileAtomicSync = require('write-file-atomic').sync
writeFileAtomicSync(filename, data, [options]) + +The synchronous version of **writeFileAtomic**. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/write-file-atomic/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/write-file-atomic/index.js new file mode 100644 index 00000000..df5b72a1 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/write-file-atomic/index.js @@ -0,0 +1,259 @@ +'use strict' +module.exports = writeFile +module.exports.sync = writeFileSync +module.exports._getTmpname = getTmpname // for testing +module.exports._cleanupOnExit = cleanupOnExit + +const fs = require('fs') +const MurmurHash3 = require('imurmurhash') +const onExit = require('signal-exit') +const path = require('path') +const isTypedArray = require('is-typedarray') +const typedArrayToBuffer = require('typedarray-to-buffer') +const { promisify } = require('util') +const activeFiles = {} + +// if we run inside of a worker_thread, `process.pid` is not unique +/* istanbul ignore next */ +const threadId = (function getId () { + try { + const workerThreads = require('worker_threads') + + /// if we are in main thread, this is set to `0` + return workerThreads.threadId + } catch (e) { + // worker_threads are not available, fallback to 0 + return 0 + } +})() + +let invocations = 0 +function getTmpname (filename) { + return filename + '.' + + MurmurHash3(__filename) + .hash(String(process.pid)) + .hash(String(threadId)) + .hash(String(++invocations)) + .result() +} + +function cleanupOnExit (tmpfile) { + return () => { + try { + fs.unlinkSync(typeof tmpfile === 'function' ? tmpfile() : tmpfile) + } catch (_) {} + } +} + +function serializeActiveFile (absoluteName) { + return new Promise(resolve => { + // make a queue if it doesn't already exist + if (!activeFiles[absoluteName]) activeFiles[absoluteName] = [] + + activeFiles[absoluteName].push(resolve) // add this job to the queue + if (activeFiles[absoluteName].length === 1) resolve() // kick off the first one + }) +} + +// https://github.com/isaacs/node-graceful-fs/blob/master/polyfills.js#L315-L342 +function isChownErrOk (err) { + if (err.code === 'ENOSYS') { + return true + } + + const nonroot = !process.getuid || process.getuid() !== 0 + if (nonroot) { + if (err.code === 'EINVAL' || err.code === 'EPERM') { + return true + } + } + + return false +} + +async function writeFileAsync (filename, data, options = {}) { + if (typeof options === 'string') { + options = { encoding: options } + } + + let fd + let tmpfile + /* istanbul ignore next -- The closure only gets called when onExit triggers */ + const removeOnExitHandler = onExit(cleanupOnExit(() => tmpfile)) + const absoluteName = path.resolve(filename) + + try { + await serializeActiveFile(absoluteName) + const truename = await promisify(fs.realpath)(filename).catch(() => filename) + tmpfile = getTmpname(truename) + + if (!options.mode || !options.chown) { + // Either mode or chown is not explicitly set + // Default behavior is to copy it from original file + const stats = await promisify(fs.stat)(truename).catch(() => {}) + if (stats) { + if (options.mode == null) { + options.mode = stats.mode + } + + if (options.chown == null && process.getuid) { + options.chown = { uid: stats.uid, gid: stats.gid } + } + } + } + + fd = await promisify(fs.open)(tmpfile, 'w', options.mode) + if (options.tmpfileCreated) { + await options.tmpfileCreated(tmpfile) + } + if (isTypedArray(data)) { + data = typedArrayToBuffer(data) + } + if (Buffer.isBuffer(data)) { + await promisify(fs.write)(fd, data, 0, data.length, 0) + } else if (data != null) { + await promisify(fs.write)(fd, String(data), 0, String(options.encoding || 'utf8')) + } + + if (options.fsync !== false) { + await promisify(fs.fsync)(fd) + } + + await promisify(fs.close)(fd) + fd = null + + if (options.chown) { + await promisify(fs.chown)(tmpfile, options.chown.uid, options.chown.gid).catch(err => { + if (!isChownErrOk(err)) { + throw err + } + }) + } + + if (options.mode) { + await promisify(fs.chmod)(tmpfile, options.mode).catch(err => { + if (!isChownErrOk(err)) { + throw err + } + }) + } + + await promisify(fs.rename)(tmpfile, truename) + } finally { + if (fd) { + await promisify(fs.close)(fd).catch( + /* istanbul ignore next */ + () => {} + ) + } + removeOnExitHandler() + await promisify(fs.unlink)(tmpfile).catch(() => {}) + activeFiles[absoluteName].shift() // remove the element added by serializeSameFile + if (activeFiles[absoluteName].length > 0) { + activeFiles[absoluteName][0]() // start next job if one is pending + } else delete activeFiles[absoluteName] + } +} + +function writeFile (filename, data, options, callback) { + if (options instanceof Function) { + callback = options + options = {} + } + + const promise = writeFileAsync(filename, data, options) + if (callback) { + promise.then(callback, callback) + } + + return promise +} + +function writeFileSync (filename, data, options) { + if (typeof options === 'string') options = { encoding: options } + else if (!options) options = {} + try { + filename = fs.realpathSync(filename) + } catch (ex) { + // it's ok, it'll happen on a not yet existing file + } + const tmpfile = getTmpname(filename) + + if (!options.mode || !options.chown) { + // Either mode or chown is not explicitly set + // Default behavior is to copy it from original file + try { + const stats = fs.statSync(filename) + options = Object.assign({}, options) + if (!options.mode) { + options.mode = stats.mode + } + if (!options.chown && process.getuid) { + options.chown = { uid: stats.uid, gid: stats.gid } + } + } catch (ex) { + // ignore stat errors + } + } + + let fd + const cleanup = cleanupOnExit(tmpfile) + const removeOnExitHandler = onExit(cleanup) + + let threw = true + try { + fd = fs.openSync(tmpfile, 'w', options.mode || 0o666) + if (options.tmpfileCreated) { + options.tmpfileCreated(tmpfile) + } + if (isTypedArray(data)) { + data = typedArrayToBuffer(data) + } + if (Buffer.isBuffer(data)) { + fs.writeSync(fd, data, 0, data.length, 0) + } else if (data != null) { + fs.writeSync(fd, String(data), 0, String(options.encoding || 'utf8')) + } + if (options.fsync !== false) { + fs.fsyncSync(fd) + } + + fs.closeSync(fd) + fd = null + + if (options.chown) { + try { + fs.chownSync(tmpfile, options.chown.uid, options.chown.gid) + } catch (err) { + if (!isChownErrOk(err)) { + throw err + } + } + } + + if (options.mode) { + try { + fs.chmodSync(tmpfile, options.mode) + } catch (err) { + if (!isChownErrOk(err)) { + throw err + } + } + } + + fs.renameSync(tmpfile, filename) + threw = false + } finally { + if (fd) { + try { + fs.closeSync(fd) + } catch (ex) { + // ignore close errors at this stage, error may have closed fd already. + } + } + removeOnExitHandler() + if (threw) { + cleanup() + } + } +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/write-file-atomic/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/write-file-atomic/package.json new file mode 100644 index 00000000..00b8210a --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/write-file-atomic/package.json @@ -0,0 +1,77 @@ +{ + "_from": "write-file-atomic@^3.0.0", + "_id": "write-file-atomic@3.0.3", + "_inBundle": false, + "_integrity": "sha512-AvHcyZ5JnSfq3ioSyjrBkH9yW4m7Ayk8/9My/DD9onKeu/94fwrMocemO2QAJFAlnnDN+ZDS+ZjAR5ua1/PV/Q==", + "_location": "/write-file-atomic", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "write-file-atomic@^3.0.0", + "name": "write-file-atomic", + "escapedName": "write-file-atomic", + "rawSpec": "^3.0.0", + "saveSpec": null, + "fetchSpec": "^3.0.0" + }, + "_requiredBy": [ + "/configstore" + ], + "_resolved": "https://registry.npmjs.org/write-file-atomic/-/write-file-atomic-3.0.3.tgz", + "_shasum": "56bd5c5a5c70481cd19c571bd39ab965a5de56e8", + "_spec": "write-file-atomic@^3.0.0", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\configstore", + "author": { + "name": "Rebecca Turner", + "email": "me@re-becca.org", + "url": "http://re-becca.org" + }, + "bugs": { + "url": "https://github.com/npm/write-file-atomic/issues" + }, + "bundleDependencies": false, + "dependencies": { + "imurmurhash": "^0.1.4", + "is-typedarray": "^1.0.0", + "signal-exit": "^3.0.2", + "typedarray-to-buffer": "^3.1.5" + }, + "deprecated": false, + "description": "Write files in an atomic fashion w/configurable ownership", + "devDependencies": { + "mkdirp": "^0.5.1", + "require-inject": "^1.4.4", + "rimraf": "^2.6.3", + "standard": "^14.3.1", + "tap": "^14.10.6" + }, + "files": [ + "index.js" + ], + "homepage": "https://github.com/npm/write-file-atomic", + "keywords": [ + "writeFile", + "atomic" + ], + "license": "ISC", + "main": "index.js", + "name": "write-file-atomic", + "repository": { + "type": "git", + "url": "git://github.com/npm/write-file-atomic.git" + }, + "scripts": { + "lint": "standard", + "postlint": "rimraf chowncopy good nochmod nochown nofsync nofsyncopt noopen norename \"norename nounlink\" nowrite", + "posttest": "npm run lint", + "postversion": "npm publish", + "prepublishOnly": "git push origin --follow-tags", + "preversion": "npm test", + "test": "tap" + }, + "tap": { + "100": true + }, + "version": "3.0.3" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/xdg-basedir/index.d.ts b/25_03_11/frontend_vizsgafeladat/backend/node_modules/xdg-basedir/index.d.ts new file mode 100644 index 00000000..c70b7d41 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/xdg-basedir/index.d.ts @@ -0,0 +1,81 @@ +declare const xdgBasedir: { + /** + Directory for user-specific data files. + + @example + ```js + import xdgBasedir = require('xdg-basedir'); + + xdgBasedir.data; + //=> '/home/sindresorhus/.local/share' + ``` + */ + readonly data?: string; + + /** + Directory for user-specific configuration files. + + @example + ```js + import xdgBasedir = require('xdg-basedir'); + + xdgBasedir.config; + //=> '/home/sindresorhus/.config' + ``` + */ + readonly config?: string; + + /** + Directory for user-specific non-essential data files. + + @example + ```js + import xdgBasedir = require('xdg-basedir'); + + xdgBasedir.cache; + //=> '/home/sindresorhus/.cache' + ``` + */ + readonly cache?: string; + + /** + Directory for user-specific non-essential runtime files and other file objects (such as sockets, named pipes, etc). + + @example + ```js + import xdgBasedir = require('xdg-basedir'); + + xdgBasedir.runtime; + //=> '/run/user/sindresorhus' + ``` + */ + readonly runtime?: string; + + /** + Preference-ordered array of base directories to search for data files in addition to `.data`. + + @example + ```js + import xdgBasedir = require('xdg-basedir'); + + xdgBasedir.dataDirs + //=> ['/home/sindresorhus/.local/share', '/usr/local/share/', '/usr/share/'] + ``` + */ + readonly dataDirs: readonly string[]; + + /** + Preference-ordered array of base directories to search for configuration files in addition to `.config`. + + @example + ```js + import xdgBasedir = require('xdg-basedir'); + + xdgBasedir.configDirs; + //=> ['/home/sindresorhus/.config', '/etc/xdg'] + ``` + */ + readonly configDirs: readonly string[]; +}; + +export = xdgBasedir; diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/xdg-basedir/index.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/xdg-basedir/index.js new file mode 100644 index 00000000..0da1f2fa --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/xdg-basedir/index.js @@ -0,0 +1,28 @@ +'use strict'; +const os = require('os'); +const path = require('path'); + +const homeDirectory = os.homedir(); +const {env} = process; + +exports.data = env.XDG_DATA_HOME || + (homeDirectory ? path.join(homeDirectory, '.local', 'share') : undefined); + +exports.config = env.XDG_CONFIG_HOME || + (homeDirectory ? path.join(homeDirectory, '.config') : undefined); + +exports.cache = env.XDG_CACHE_HOME || (homeDirectory ? path.join(homeDirectory, '.cache') : undefined); + +exports.runtime = env.XDG_RUNTIME_DIR || undefined; + +exports.dataDirs = (env.XDG_DATA_DIRS || '/usr/local/share/:/usr/share/').split(':'); + +if (exports.data) { + exports.dataDirs.unshift(exports.data); +} + +exports.configDirs = (env.XDG_CONFIG_DIRS || '/etc/xdg').split(':'); + +if (exports.config) { + exports.configDirs.unshift(exports.config); +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/xdg-basedir/license b/25_03_11/frontend_vizsgafeladat/backend/node_modules/xdg-basedir/license new file mode 100644 index 00000000..e7af2f77 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/xdg-basedir/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/xdg-basedir/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/xdg-basedir/package.json new file mode 100644 index 00000000..ebb1591c --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/xdg-basedir/package.json @@ -0,0 +1,74 @@ +{ + "_from": "xdg-basedir@^4.0.0", + "_id": "xdg-basedir@4.0.0", + "_inBundle": false, + "_integrity": "sha512-PSNhEJDejZYV7h50BohL09Er9VaIefr2LMAf3OEmpCkjOi34eYyQYAXUTjEQtZJTKcF0E2UKTh+osDLsgNim9Q==", + "_location": "/xdg-basedir", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "xdg-basedir@^4.0.0", + "name": "xdg-basedir", + "escapedName": "xdg-basedir", + "rawSpec": "^4.0.0", + "saveSpec": null, + "fetchSpec": "^4.0.0" + }, + "_requiredBy": [ + "/configstore", + "/update-notifier" + ], + "_resolved": "https://registry.npmjs.org/xdg-basedir/-/xdg-basedir-4.0.0.tgz", + "_shasum": "4bc8d9984403696225ef83a1573cbbcb4e79db13", + "_spec": "xdg-basedir@^4.0.0", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\update-notifier", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "sindresorhus.com" + }, + "bugs": { + "url": "https://github.com/sindresorhus/xdg-basedir/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Get XDG Base Directory paths", + "devDependencies": { + "ava": "^1.4.1", + "import-fresh": "^3.0.0", + "tsd": "^0.7.2", + "xo": "^0.24.0" + }, + "engines": { + "node": ">=8" + }, + "files": [ + "index.js", + "index.d.ts" + ], + "homepage": "https://github.com/sindresorhus/xdg-basedir#readme", + "keywords": [ + "xdg", + "base", + "directory", + "basedir", + "path", + "data", + "config", + "cache", + "linux", + "unix", + "spec" + ], + "license": "MIT", + "name": "xdg-basedir", + "repository": { + "type": "git", + "url": "git+https://github.com/sindresorhus/xdg-basedir.git" + }, + "scripts": { + "test": "xo && ava && tsd" + }, + "version": "4.0.0" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/xdg-basedir/readme.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/xdg-basedir/readme.md new file mode 100644 index 00000000..f7aca051 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/xdg-basedir/readme.md @@ -0,0 +1,60 @@ +# xdg-basedir [![Build Status](https://travis-ci.org/sindresorhus/xdg-basedir.svg?branch=master)](https://travis-ci.org/sindresorhus/xdg-basedir) + +> Get [XDG Base Directory](https://specifications.freedesktop.org/basedir-spec/basedir-spec-latest.html) paths + + +## Install + +``` +$ npm install xdg-basedir +``` + + +## Usage + +```js +const xdgBasedir = require('xdg-basedir'); + +xdgBasedir.data; +//=> '/home/sindresorhus/.local/share' + +xdgBasedir.config; +//=> '/home/sindresorhus/.config' + +xdgBasedir.dataDirs +//=> ['/home/sindresorhus/.local/share', '/usr/local/share/', '/usr/share/'] +``` + + +## API + +The properties `.data`, `.config`, `.cache`, `.runtime` will return `null` in the uncommon case that both the XDG environment variable is not set and the users home directory can't be found. You need to handle this case. A common solution is to [fall back to a temp directory](https://github.com/yeoman/configstore/blob/b82690fc401318ad18dcd7d151a0003a4898a314/index.js#L15). + +### .data + +Directory for user-specific data files. + +### .config + +Directory for user-specific configuration files. + +### .cache + +Directory for user-specific non-essential data files. + +### .runtime + +Directory for user-specific non-essential runtime files and other file objects (such as sockets, named pipes, etc). + +### .dataDirs + +Preference-ordered array of base directories to search for data files in addition to `.data`. + +### .configDirs + +Preference-ordered array of base directories to search for configuration files in addition to `.config`. + + +## License + +MIT © [Sindre Sorhus](https://sindresorhus.com) diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/yallist/LICENSE b/25_03_11/frontend_vizsgafeladat/backend/node_modules/yallist/LICENSE new file mode 100644 index 00000000..19129e31 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/yallist/LICENSE @@ -0,0 +1,15 @@ +The ISC License + +Copyright (c) Isaac Z. Schlueter and Contributors + +Permission to use, copy, modify, and/or distribute this software for any +purpose with or without fee is hereby granted, provided that the above +copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF +MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR +ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR +IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/yallist/README.md b/25_03_11/frontend_vizsgafeladat/backend/node_modules/yallist/README.md new file mode 100644 index 00000000..f5861018 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/yallist/README.md @@ -0,0 +1,204 @@ +# yallist + +Yet Another Linked List + +There are many doubly-linked list implementations like it, but this +one is mine. + +For when an array would be too big, and a Map can't be iterated in +reverse order. + + +[![Build Status](https://travis-ci.org/isaacs/yallist.svg?branch=master)](https://travis-ci.org/isaacs/yallist) [![Coverage Status](https://coveralls.io/repos/isaacs/yallist/badge.svg?service=github)](https://coveralls.io/github/isaacs/yallist) + +## basic usage + +```javascript +var yallist = require('yallist') +var myList = yallist.create([1, 2, 3]) +myList.push('foo') +myList.unshift('bar') +// of course pop() and shift() are there, too +console.log(myList.toArray()) // ['bar', 1, 2, 3, 'foo'] +myList.forEach(function (k) { + // walk the list head to tail +}) +myList.forEachReverse(function (k, index, list) { + // walk the list tail to head +}) +var myDoubledList = myList.map(function (k) { + return k + k +}) +// now myDoubledList contains ['barbar', 2, 4, 6, 'foofoo'] +// mapReverse is also a thing +var myDoubledListReverse = myList.mapReverse(function (k) { + return k + k +}) // ['foofoo', 6, 4, 2, 'barbar'] + +var reduced = myList.reduce(function (set, entry) { + set += entry + return set +}, 'start') +console.log(reduced) // 'startfoo123bar' +``` + +## api + +The whole API is considered "public". + +Functions with the same name as an Array method work more or less the +same way. + +There's reverse versions of most things because that's the point. + +### Yallist + +Default export, the class that holds and manages a list. + +Call it with either a forEach-able (like an array) or a set of +arguments, to initialize the list. + +The Array-ish methods all act like you'd expect. No magic length, +though, so if you change that it won't automatically prune or add +empty spots. + +### Yallist.create(..) + +Alias for Yallist function. Some people like factories. + +#### yallist.head + +The first node in the list + +#### yallist.tail + +The last node in the list + +#### yallist.length + +The number of nodes in the list. (Change this at your peril. It is +not magic like Array length.) + +#### yallist.toArray() + +Convert the list to an array. + +#### yallist.forEach(fn, [thisp]) + +Call a function on each item in the list. + +#### yallist.forEachReverse(fn, [thisp]) + +Call a function on each item in the list, in reverse order. + +#### yallist.get(n) + +Get the data at position `n` in the list. If you use this a lot, +probably better off just using an Array. + +#### yallist.getReverse(n) + +Get the data at position `n`, counting from the tail. + +#### yallist.map(fn, thisp) + +Create a new Yallist with the result of calling the function on each +item. + +#### yallist.mapReverse(fn, thisp) + +Same as `map`, but in reverse. + +#### yallist.pop() + +Get the data from the list tail, and remove the tail from the list. + +#### yallist.push(item, ...) + +Insert one or more items to the tail of the list. + +#### yallist.reduce(fn, initialValue) + +Like Array.reduce. + +#### yallist.reduceReverse + +Like Array.reduce, but in reverse. + +#### yallist.reverse + +Reverse the list in place. + +#### yallist.shift() + +Get the data from the list head, and remove the head from the list. + +#### yallist.slice([from], [to]) + +Just like Array.slice, but returns a new Yallist. + +#### yallist.sliceReverse([from], [to]) + +Just like yallist.slice, but the result is returned in reverse. + +#### yallist.toArray() + +Create an array representation of the list. + +#### yallist.toArrayReverse() + +Create a reversed array representation of the list. + +#### yallist.unshift(item, ...) + +Insert one or more items to the head of the list. + +#### yallist.unshiftNode(node) + +Move a Node object to the front of the list. (That is, pull it out of +wherever it lives, and make it the new head.) + +If the node belongs to a different list, then that list will remove it +first. + +#### yallist.pushNode(node) + +Move a Node object to the end of the list. (That is, pull it out of +wherever it lives, and make it the new tail.) + +If the node belongs to a list already, then that list will remove it +first. + +#### yallist.removeNode(node) + +Remove a node from the list, preserving referential integrity of head +and tail and other nodes. + +Will throw an error if you try to have a list remove a node that +doesn't belong to it. + +### Yallist.Node + +The class that holds the data and is actually the list. + +Call with `var n = new Node(value, previousNode, nextNode)` + +Note that if you do direct operations on Nodes themselves, it's very +easy to get into weird states where the list is broken. Be careful :) + +#### node.next + +The next node in the list. + +#### node.prev + +The previous node in the list. + +#### node.value + +The data the node contains. + +#### node.list + +The list to which this node belongs. (Null if it does not belong to +any list.) diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/yallist/iterator.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/yallist/iterator.js new file mode 100644 index 00000000..d41c97a1 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/yallist/iterator.js @@ -0,0 +1,8 @@ +'use strict' +module.exports = function (Yallist) { + Yallist.prototype[Symbol.iterator] = function* () { + for (let walker = this.head; walker; walker = walker.next) { + yield walker.value + } + } +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/yallist/package.json b/25_03_11/frontend_vizsgafeladat/backend/node_modules/yallist/package.json new file mode 100644 index 00000000..a1985b19 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/yallist/package.json @@ -0,0 +1,65 @@ +{ + "_from": "yallist@^4.0.0", + "_id": "yallist@4.0.0", + "_inBundle": false, + "_integrity": "sha512-3wdGidZyq5PB084XLES5TpOSRA3wjXAlIWMhum2kRcv/41Sn2emQ0dycQW4uZXLejwKvg6EsvbdlVL+FYEct7A==", + "_location": "/yallist", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "yallist@^4.0.0", + "name": "yallist", + "escapedName": "yallist", + "rawSpec": "^4.0.0", + "saveSpec": null, + "fetchSpec": "^4.0.0" + }, + "_requiredBy": [ + "/lru-cache", + "/minipass", + "/minizlib", + "/tar" + ], + "_resolved": "https://registry.npmjs.org/yallist/-/yallist-4.0.0.tgz", + "_shasum": "9bb92790d9c0effec63be73519e11a35019a3a72", + "_spec": "yallist@^4.0.0", + "_where": "D:\\rud\\kodtarak\\14d_frontend_2021\\chinook\\node_modules\\lru-cache", + "author": { + "name": "Isaac Z. Schlueter", + "email": "i@izs.me", + "url": "http://blog.izs.me/" + }, + "bugs": { + "url": "https://github.com/isaacs/yallist/issues" + }, + "bundleDependencies": false, + "dependencies": {}, + "deprecated": false, + "description": "Yet Another Linked List", + "devDependencies": { + "tap": "^12.1.0" + }, + "directories": { + "test": "test" + }, + "files": [ + "yallist.js", + "iterator.js" + ], + "homepage": "https://github.com/isaacs/yallist#readme", + "license": "ISC", + "main": "yallist.js", + "name": "yallist", + "repository": { + "type": "git", + "url": "git+https://github.com/isaacs/yallist.git" + }, + "scripts": { + "postpublish": "git push origin --all; git push origin --tags", + "postversion": "npm publish", + "preversion": "npm test", + "test": "tap test/*.js --100" + }, + "version": "4.0.0" +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/node_modules/yallist/yallist.js b/25_03_11/frontend_vizsgafeladat/backend/node_modules/yallist/yallist.js new file mode 100644 index 00000000..4e83ab1c --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/node_modules/yallist/yallist.js @@ -0,0 +1,426 @@ +'use strict' +module.exports = Yallist + +Yallist.Node = Node +Yallist.create = Yallist + +function Yallist (list) { + var self = this + if (!(self instanceof Yallist)) { + self = new Yallist() + } + + self.tail = null + self.head = null + self.length = 0 + + if (list && typeof list.forEach === 'function') { + list.forEach(function (item) { + self.push(item) + }) + } else if (arguments.length > 0) { + for (var i = 0, l = arguments.length; i < l; i++) { + self.push(arguments[i]) + } + } + + return self +} + +Yallist.prototype.removeNode = function (node) { + if (node.list !== this) { + throw new Error('removing node which does not belong to this list') + } + + var next = node.next + var prev = node.prev + + if (next) { + next.prev = prev + } + + if (prev) { + prev.next = next + } + + if (node === this.head) { + this.head = next + } + if (node === this.tail) { + this.tail = prev + } + + node.list.length-- + node.next = null + node.prev = null + node.list = null + + return next +} + +Yallist.prototype.unshiftNode = function (node) { + if (node === this.head) { + return + } + + if (node.list) { + node.list.removeNode(node) + } + + var head = this.head + node.list = this + node.next = head + if (head) { + head.prev = node + } + + this.head = node + if (!this.tail) { + this.tail = node + } + this.length++ +} + +Yallist.prototype.pushNode = function (node) { + if (node === this.tail) { + return + } + + if (node.list) { + node.list.removeNode(node) + } + + var tail = this.tail + node.list = this + node.prev = tail + if (tail) { + tail.next = node + } + + this.tail = node + if (!this.head) { + this.head = node + } + this.length++ +} + +Yallist.prototype.push = function () { + for (var i = 0, l = arguments.length; i < l; i++) { + push(this, arguments[i]) + } + return this.length +} + +Yallist.prototype.unshift = function () { + for (var i = 0, l = arguments.length; i < l; i++) { + unshift(this, arguments[i]) + } + return this.length +} + +Yallist.prototype.pop = function () { + if (!this.tail) { + return undefined + } + + var res = this.tail.value + this.tail = this.tail.prev + if (this.tail) { + this.tail.next = null + } else { + this.head = null + } + this.length-- + return res +} + +Yallist.prototype.shift = function () { + if (!this.head) { + return undefined + } + + var res = this.head.value + this.head = this.head.next + if (this.head) { + this.head.prev = null + } else { + this.tail = null + } + this.length-- + return res +} + +Yallist.prototype.forEach = function (fn, thisp) { + thisp = thisp || this + for (var walker = this.head, i = 0; walker !== null; i++) { + fn.call(thisp, walker.value, i, this) + walker = walker.next + } +} + +Yallist.prototype.forEachReverse = function (fn, thisp) { + thisp = thisp || this + for (var walker = this.tail, i = this.length - 1; walker !== null; i--) { + fn.call(thisp, walker.value, i, this) + walker = walker.prev + } +} + +Yallist.prototype.get = function (n) { + for (var i = 0, walker = this.head; walker !== null && i < n; i++) { + // abort out of the list early if we hit a cycle + walker = walker.next + } + if (i === n && walker !== null) { + return walker.value + } +} + +Yallist.prototype.getReverse = function (n) { + for (var i = 0, walker = this.tail; walker !== null && i < n; i++) { + // abort out of the list early if we hit a cycle + walker = walker.prev + } + if (i === n && walker !== null) { + return walker.value + } +} + +Yallist.prototype.map = function (fn, thisp) { + thisp = thisp || this + var res = new Yallist() + for (var walker = this.head; walker !== null;) { + res.push(fn.call(thisp, walker.value, this)) + walker = walker.next + } + return res +} + +Yallist.prototype.mapReverse = function (fn, thisp) { + thisp = thisp || this + var res = new Yallist() + for (var walker = this.tail; walker !== null;) { + res.push(fn.call(thisp, walker.value, this)) + walker = walker.prev + } + return res +} + +Yallist.prototype.reduce = function (fn, initial) { + var acc + var walker = this.head + if (arguments.length > 1) { + acc = initial + } else if (this.head) { + walker = this.head.next + acc = this.head.value + } else { + throw new TypeError('Reduce of empty list with no initial value') + } + + for (var i = 0; walker !== null; i++) { + acc = fn(acc, walker.value, i) + walker = walker.next + } + + return acc +} + +Yallist.prototype.reduceReverse = function (fn, initial) { + var acc + var walker = this.tail + if (arguments.length > 1) { + acc = initial + } else if (this.tail) { + walker = this.tail.prev + acc = this.tail.value + } else { + throw new TypeError('Reduce of empty list with no initial value') + } + + for (var i = this.length - 1; walker !== null; i--) { + acc = fn(acc, walker.value, i) + walker = walker.prev + } + + return acc +} + +Yallist.prototype.toArray = function () { + var arr = new Array(this.length) + for (var i = 0, walker = this.head; walker !== null; i++) { + arr[i] = walker.value + walker = walker.next + } + return arr +} + +Yallist.prototype.toArrayReverse = function () { + var arr = new Array(this.length) + for (var i = 0, walker = this.tail; walker !== null; i++) { + arr[i] = walker.value + walker = walker.prev + } + return arr +} + +Yallist.prototype.slice = function (from, to) { + to = to || this.length + if (to < 0) { + to += this.length + } + from = from || 0 + if (from < 0) { + from += this.length + } + var ret = new Yallist() + if (to < from || to < 0) { + return ret + } + if (from < 0) { + from = 0 + } + if (to > this.length) { + to = this.length + } + for (var i = 0, walker = this.head; walker !== null && i < from; i++) { + walker = walker.next + } + for (; walker !== null && i < to; i++, walker = walker.next) { + ret.push(walker.value) + } + return ret +} + +Yallist.prototype.sliceReverse = function (from, to) { + to = to || this.length + if (to < 0) { + to += this.length + } + from = from || 0 + if (from < 0) { + from += this.length + } + var ret = new Yallist() + if (to < from || to < 0) { + return ret + } + if (from < 0) { + from = 0 + } + if (to > this.length) { + to = this.length + } + for (var i = this.length, walker = this.tail; walker !== null && i > to; i--) { + walker = walker.prev + } + for (; walker !== null && i > from; i--, walker = walker.prev) { + ret.push(walker.value) + } + return ret +} + +Yallist.prototype.splice = function (start, deleteCount, ...nodes) { + if (start > this.length) { + start = this.length - 1 + } + if (start < 0) { + start = this.length + start; + } + + for (var i = 0, walker = this.head; walker !== null && i < start; i++) { + walker = walker.next + } + + var ret = [] + for (var i = 0; walker && i < deleteCount; i++) { + ret.push(walker.value) + walker = this.removeNode(walker) + } + if (walker === null) { + walker = this.tail + } + + if (walker !== this.head && walker !== this.tail) { + walker = walker.prev + } + + for (var i = 0; i < nodes.length; i++) { + walker = insert(this, walker, nodes[i]) + } + return ret; +} + +Yallist.prototype.reverse = function () { + var head = this.head + var tail = this.tail + for (var walker = head; walker !== null; walker = walker.prev) { + var p = walker.prev + walker.prev = walker.next + walker.next = p + } + this.head = tail + this.tail = head + return this +} + +function insert (self, node, value) { + var inserted = node === self.head ? + new Node(value, null, node, self) : + new Node(value, node, node.next, self) + + if (inserted.next === null) { + self.tail = inserted + } + if (inserted.prev === null) { + self.head = inserted + } + + self.length++ + + return inserted +} + +function push (self, item) { + self.tail = new Node(item, self.tail, null, self) + if (!self.head) { + self.head = self.tail + } + self.length++ +} + +function unshift (self, item) { + self.head = new Node(item, null, self.head, self) + if (!self.tail) { + self.tail = self.head + } + self.length++ +} + +function Node (value, prev, next, list) { + if (!(this instanceof Node)) { + return new Node(value, prev, next, list) + } + + this.list = list + this.value = value + + if (prev) { + prev.next = this + this.prev = prev + } else { + this.prev = null + } + + if (next) { + next.prev = this + this.next = next + } else { + this.next = null + } +} + +try { + // add if support for Symbol.iterator is present + require('./iterator.js')(Yallist) +} catch (er) {} diff --git a/25_03_11/frontend_vizsgafeladat/backend/package-lock.json b/25_03_11/frontend_vizsgafeladat/backend/package-lock.json new file mode 100644 index 00000000..be50c4fa --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/package-lock.json @@ -0,0 +1,2145 @@ +{ + "name": "chinook", + "version": "1.0.0", + "lockfileVersion": 1, + "requires": true, + "dependencies": { + "@gar/promisify": { + "version": "1.1.3", + "resolved": "https://registry.npmjs.org/@gar/promisify/-/promisify-1.1.3.tgz", + "integrity": "sha512-k2Ty1JcVojjJFwrg/ThKi2ujJ7XNLYaFGNB/bWT9wGR+oSMJHMa5w+CUq6p/pVrKeNNgA7pCqEcjSnHVoqJQFw==", + "optional": true + }, + "@mapbox/node-pre-gyp": { + "version": "1.0.9", + "resolved": "https://registry.npmjs.org/@mapbox/node-pre-gyp/-/node-pre-gyp-1.0.9.tgz", + "integrity": "sha512-aDF3S3rK9Q2gey/WAttUlISduDItz5BU3306M9Eyv6/oS40aMprnopshtlKTykxRNIBEZuRMaZAnbrQ4QtKGyw==", + "requires": { + "detect-libc": "^2.0.0", + "https-proxy-agent": "^5.0.0", + "make-dir": "^3.1.0", + "node-fetch": "^2.6.7", + "nopt": "^5.0.0", + "npmlog": "^5.0.1", + "rimraf": "^3.0.2", + "semver": "^7.3.5", + "tar": "^6.1.11" + } + }, + "@npmcli/fs": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/@npmcli/fs/-/fs-1.1.1.tgz", + "integrity": "sha512-8KG5RD0GVP4ydEzRn/I4BNDuxDtqVbOdm8675T49OIG/NGhaK0pjPX7ZcDlvKYbA+ulvVK3ztfcF4uBdOxuJbQ==", + "optional": true, + "requires": { + "@gar/promisify": "^1.0.1", + "semver": "^7.3.5" + } + }, + "@npmcli/move-file": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/@npmcli/move-file/-/move-file-1.1.2.tgz", + "integrity": "sha512-1SUf/Cg2GzGDyaf15aR9St9TWlb+XvbZXWpDx8YKs7MLzMH/BCeopv+y9vzrzgkfykCGuWOlSu3mZhj2+FQcrg==", + "optional": true, + "requires": { + "mkdirp": "^1.0.4", + "rimraf": "^3.0.2" + } + }, + "@sindresorhus/is": { + "version": "0.14.0", + "resolved": "https://registry.npmjs.org/@sindresorhus/is/-/is-0.14.0.tgz", + "integrity": "sha512-9NET910DNaIPngYnLLPeg+Ogzqsi9uM4mSboU5y6p8S5DzMTVEsJZrawi+BoDNUVBa2DhJqQYUFvMDfgU062LQ==", + "dev": true + }, + "@szmarczak/http-timer": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/@szmarczak/http-timer/-/http-timer-1.1.2.tgz", + "integrity": "sha512-XIB2XbzHTN6ieIjfIMV9hlVcfPU26s2vafYWQcZHWXHOxiaRZYEDKEwdl129Zyg50+foYV2jCgtrqSA6qNuNSA==", + "dev": true, + "requires": { + "defer-to-connect": "^1.0.1" + } + }, + "@tootallnate/once": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/@tootallnate/once/-/once-1.1.2.tgz", + "integrity": "sha512-RbzJvlNzmRq5c3O09UipeuXno4tA1FE6ikOjxZK0tuxVv3412l64l5t1W5pj4+rJq9vpkm/kwiR07aZXnsKPxw==", + "optional": true + }, + "abbrev": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/abbrev/-/abbrev-1.1.1.tgz", + "integrity": "sha512-nne9/IiQ/hzIhY6pdDnbBtz7DjPTKrY00P/zvPSm5pOFkl6xuGrGnXn/VtTNNfNtAfZ9/1RtehkszU9qcTii0Q==" + }, + "accepts": { + "version": "1.3.8", + "resolved": "https://registry.npmjs.org/accepts/-/accepts-1.3.8.tgz", + "integrity": "sha512-PYAthTa2m2VKxuvSD3DPC/Gy+U+sOA1LAuT8mkmRuvw+NACSaeXEQ+NHcVF7rONl6qcaxV3Uuemwawk+7+SJLw==", + "requires": { + "mime-types": "~2.1.34", + "negotiator": "0.6.3" + } + }, + "agent-base": { + "version": "6.0.2", + "resolved": "https://registry.npmjs.org/agent-base/-/agent-base-6.0.2.tgz", + "integrity": "sha512-RZNwNclF7+MS/8bDg70amg32dyeZGZxiDuQmZxKLAlQjr3jGyLx+4Kkk58UO7D2QdgFIQCovuSuZESne6RG6XQ==", + "requires": { + "debug": "4" + }, + "dependencies": { + "debug": { + "version": "4.3.4", + "resolved": "https://registry.npmjs.org/debug/-/debug-4.3.4.tgz", + "integrity": "sha512-PRWFHuSU3eDtQJPvnNY7Jcket1j0t5OuOsFzPPzsekD52Zl8qUfFIPEiswXqIvHWGVHOgX+7G/vCNNhehwxfkQ==", + "requires": { + "ms": "2.1.2" + } + }, + "ms": { + "version": "2.1.2", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.2.tgz", + "integrity": "sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==" + } + } + }, + "agentkeepalive": { + "version": "4.2.1", + "resolved": "https://registry.npmjs.org/agentkeepalive/-/agentkeepalive-4.2.1.tgz", + "integrity": "sha512-Zn4cw2NEqd+9fiSVWMscnjyQ1a8Yfoc5oBajLeo5w+YBHgDUcEBY2hS4YpTz6iN5f/2zQiktcuM6tS8x1p9dpA==", + "optional": true, + "requires": { + "debug": "^4.1.0", + "depd": "^1.1.2", + "humanize-ms": "^1.2.1" + }, + "dependencies": { + "debug": { + "version": "4.3.4", + "resolved": "https://registry.npmjs.org/debug/-/debug-4.3.4.tgz", + "integrity": "sha512-PRWFHuSU3eDtQJPvnNY7Jcket1j0t5OuOsFzPPzsekD52Zl8qUfFIPEiswXqIvHWGVHOgX+7G/vCNNhehwxfkQ==", + "optional": true, + "requires": { + "ms": "2.1.2" + } + }, + "depd": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/depd/-/depd-1.1.2.tgz", + "integrity": "sha1-m81S4UwJd2PnSbJ0xDRu0uVgtak=", + "optional": true + }, + "ms": { + "version": "2.1.2", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.2.tgz", + "integrity": "sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==", + "optional": true + } + } + }, + "aggregate-error": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/aggregate-error/-/aggregate-error-3.1.0.tgz", + "integrity": "sha512-4I7Td01quW/RpocfNayFdFVk1qSuoh0E7JrbRJ16nH01HhKFQ88INq9Sd+nd72zqRySlr9BmDA8xlEJ6vJMrYA==", + "optional": true, + "requires": { + "clean-stack": "^2.0.0", + "indent-string": "^4.0.0" + } + }, + "ansi-align": { + "version": "3.0.1", + "resolved": "https://registry.npmjs.org/ansi-align/-/ansi-align-3.0.1.tgz", + "integrity": "sha512-IOfwwBF5iczOjp/WeY4YxyjqAFMQoZufdQWDd19SEExbVLNXqvpzSJ/M7Za4/sCPmQ0+GRquoA7bGcINcxew6w==", + "dev": true, + "requires": { + "string-width": "^4.1.0" + } + }, + "ansi-regex": { + "version": "5.0.1", + "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-5.0.1.tgz", + "integrity": "sha512-quJQXlTSUGL2LH9SUXo8VwsY4soanhgo6LNSm84E1LBcE8s3O0wpdiRzyR9z/ZZJMlMWv37qOOb9pdJlMUEKFQ==" + }, + "ansi-styles": { + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", + "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==", + "dev": true, + "requires": { + "color-convert": "^2.0.1" + } + }, + "anymatch": { + "version": "3.1.2", + "resolved": "https://registry.npmjs.org/anymatch/-/anymatch-3.1.2.tgz", + "integrity": "sha512-P43ePfOAIupkguHUycrc4qJ9kz8ZiuOUijaETwX7THt0Y/GNK7v0aa8rY816xWjZ7rJdA5XdMcpVFTKMq+RvWg==", + "dev": true, + "requires": { + "normalize-path": "^3.0.0", + "picomatch": "^2.0.4" + } + }, + "aproba": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/aproba/-/aproba-2.0.0.tgz", + "integrity": "sha512-lYe4Gx7QT+MKGbDsA+Z+he/Wtef0BiwDOlK/XkBrdfsh9J/jPPXbX0tE9x9cl27Tmu5gg3QUbUrQYa/y+KOHPQ==" + }, + "are-we-there-yet": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/are-we-there-yet/-/are-we-there-yet-2.0.0.tgz", + "integrity": "sha512-Ci/qENmwHnsYo9xKIcUJN5LeDKdJ6R1Z1j9V/J5wyq8nh/mYPEpIKJbBZXtZjG04HiK7zV/p6Vs9952MrMeUIw==", + "requires": { + "delegates": "^1.0.0", + "readable-stream": "^3.6.0" + } + }, + "array-flatten": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/array-flatten/-/array-flatten-1.1.1.tgz", + "integrity": "sha1-ml9pkFGx5wczKPKgCJaLZOopVdI=" + }, + "balanced-match": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/balanced-match/-/balanced-match-1.0.2.tgz", + "integrity": "sha512-3oSeUO0TMV67hN1AmbXsK4yaqU7tjiHlbxRDZOpH0KW9+CeX4bRAaX0Anxt0tx2MrpRpWwQaPwIlISEJhYU5Pw==" + }, + "binary-extensions": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/binary-extensions/-/binary-extensions-2.2.0.tgz", + "integrity": "sha512-jDctJ/IVQbZoJykoeHbhXpOlNBqGNcwXJKJog42E5HDPUwQTSdjCHdihjj0DlnheQ7blbT6dHOafNAiS8ooQKA==", + "dev": true + }, + "body-parser": { + "version": "1.20.0", + "resolved": "https://registry.npmjs.org/body-parser/-/body-parser-1.20.0.tgz", + "integrity": "sha512-DfJ+q6EPcGKZD1QWUjSpqp+Q7bDQTsQIF4zfUAtZ6qk+H/3/QRhg9CEp39ss+/T2vw0+HaidC0ecJj/DRLIaKg==", + "requires": { + "bytes": "3.1.2", + "content-type": "~1.0.4", + "debug": "2.6.9", + "depd": "2.0.0", + "destroy": "1.2.0", + "http-errors": "2.0.0", + "iconv-lite": "0.4.24", + "on-finished": "2.4.1", + "qs": "6.10.3", + "raw-body": "2.5.1", + "type-is": "~1.6.18", + "unpipe": "1.0.0" + } + }, + "boxen": { + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/boxen/-/boxen-5.1.2.tgz", + "integrity": "sha512-9gYgQKXx+1nP8mP7CzFyaUARhg7D3n1dF/FnErWmu9l6JvGpNUN278h0aSb+QjoiKSWG+iZ3uHrcqk0qrY9RQQ==", + "dev": true, + "requires": { + "ansi-align": "^3.0.0", + "camelcase": "^6.2.0", + "chalk": "^4.1.0", + "cli-boxes": "^2.2.1", + "string-width": "^4.2.2", + "type-fest": "^0.20.2", + "widest-line": "^3.1.0", + "wrap-ansi": "^7.0.0" + } + }, + "brace-expansion": { + "version": "1.1.11", + "resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.11.tgz", + "integrity": "sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==", + "requires": { + "balanced-match": "^1.0.0", + "concat-map": "0.0.1" + } + }, + "braces": { + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/braces/-/braces-3.0.2.tgz", + "integrity": "sha512-b8um+L1RzM3WDSzvhm6gIz1yfTbBt6YTlcEKAvsmqCZZFw46z626lVj9j1yEPW33H5H+lBQpZMP1k8l+78Ha0A==", + "dev": true, + "requires": { + "fill-range": "^7.0.1" + } + }, + "bytes": { + "version": "3.1.2", + "resolved": "https://registry.npmjs.org/bytes/-/bytes-3.1.2.tgz", + "integrity": "sha512-/Nf7TyzTx6S3yRJObOAV7956r8cr2+Oj8AC5dt8wSP3BQAoeX58NoHyCU8P8zGkNXStjTSi6fzO6F0pBdcYbEg==" + }, + "cacache": { + "version": "15.3.0", + "resolved": "https://registry.npmjs.org/cacache/-/cacache-15.3.0.tgz", + "integrity": "sha512-VVdYzXEn+cnbXpFgWs5hTT7OScegHVmLhJIR8Ufqk3iFD6A6j5iSX1KuBTfNEv4tdJWE2PzA6IVFtcLC7fN9wQ==", + "optional": true, + "requires": { + "@npmcli/fs": "^1.0.0", + "@npmcli/move-file": "^1.0.1", + "chownr": "^2.0.0", + "fs-minipass": "^2.0.0", + "glob": "^7.1.4", + "infer-owner": "^1.0.4", + "lru-cache": "^6.0.0", + "minipass": "^3.1.1", + "minipass-collect": "^1.0.2", + "minipass-flush": "^1.0.5", + "minipass-pipeline": "^1.2.2", + "mkdirp": "^1.0.3", + "p-map": "^4.0.0", + "promise-inflight": "^1.0.1", + "rimraf": "^3.0.2", + "ssri": "^8.0.1", + "tar": "^6.0.2", + "unique-filename": "^1.1.1" + } + }, + "cacheable-request": { + "version": "6.1.0", + "resolved": "https://registry.npmjs.org/cacheable-request/-/cacheable-request-6.1.0.tgz", + "integrity": "sha512-Oj3cAGPCqOZX7Rz64Uny2GYAZNliQSqfbePrgAQ1wKAihYmCUnraBtJtKcGR4xz7wF+LoJC+ssFZvv5BgF9Igg==", + "dev": true, + "requires": { + "clone-response": "^1.0.2", + "get-stream": "^5.1.0", + "http-cache-semantics": "^4.0.0", + "keyv": "^3.0.0", + "lowercase-keys": "^2.0.0", + "normalize-url": "^4.1.0", + "responselike": "^1.0.2" + }, + "dependencies": { + "get-stream": { + "version": "5.2.0", + "resolved": "https://registry.npmjs.org/get-stream/-/get-stream-5.2.0.tgz", + "integrity": "sha512-nBF+F1rAZVCu/p7rjzgA+Yb4lfYXrpl7a6VmJrU8wF9I1CKvP/QwPNZHnOlwbTkY6dvtFIzFMSyQXbLoTQPRpA==", + "dev": true, + "requires": { + "pump": "^3.0.0" + } + }, + "lowercase-keys": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/lowercase-keys/-/lowercase-keys-2.0.0.tgz", + "integrity": "sha512-tqNXrS78oMOE73NMxK4EMLQsQowWf8jKooH9g7xPavRT706R6bkQJ6DY2Te7QukaZsulxa30wQ7bk0pm4XiHmA==", + "dev": true + } + } + }, + "call-bind": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/call-bind/-/call-bind-1.0.2.tgz", + "integrity": "sha512-7O+FbCihrB5WGbFYesctwmTKae6rOiIzmz1icreWJ+0aA7LJfuqhEso2T9ncpcFtzMQtzXf2QGGueWJGTYsqrA==", + "requires": { + "function-bind": "^1.1.1", + "get-intrinsic": "^1.0.2" + } + }, + "camelcase": { + "version": "6.3.0", + "resolved": "https://registry.npmjs.org/camelcase/-/camelcase-6.3.0.tgz", + "integrity": "sha512-Gmy6FhYlCY7uOElZUSbxo2UCDH8owEk996gkbrpsgGtrJLM3J7jGxl9Ic7Qwwj4ivOE5AWZWRMecDdF7hqGjFA==", + "dev": true + }, + "chalk": { + "version": "4.1.2", + "resolved": "https://registry.npmjs.org/chalk/-/chalk-4.1.2.tgz", + "integrity": "sha512-oKnbhFyRIXpUuez8iBMmyEa4nbj4IOQyuhc/wy9kY7/WVPcwIO9VA668Pu8RkO7+0G76SLROeyw9CpQ061i4mA==", + "dev": true, + "requires": { + "ansi-styles": "^4.1.0", + "supports-color": "^7.1.0" + }, + "dependencies": { + "has-flag": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz", + "integrity": "sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==", + "dev": true + }, + "supports-color": { + "version": "7.2.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", + "integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==", + "dev": true, + "requires": { + "has-flag": "^4.0.0" + } + } + } + }, + "chokidar": { + "version": "3.5.3", + "resolved": "https://registry.npmjs.org/chokidar/-/chokidar-3.5.3.tgz", + "integrity": "sha512-Dr3sfKRP6oTcjf2JmUmFJfeVMvXBdegxB0iVQ5eb2V10uFJUCAS8OByZdVAyVb8xXNz3GjjTgj9kLWsZTqE6kw==", + "dev": true, + "requires": { + "anymatch": "~3.1.2", + "braces": "~3.0.2", + "fsevents": "~2.3.2", + "glob-parent": "~5.1.2", + "is-binary-path": "~2.1.0", + "is-glob": "~4.0.1", + "normalize-path": "~3.0.0", + "readdirp": "~3.6.0" + } + }, + "chownr": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/chownr/-/chownr-2.0.0.tgz", + "integrity": "sha512-bIomtDF5KGpdogkLd9VspvFzk9KfpyyGlS8YFVZl7TGPBHL5snIOnxeshwVgPteQ9b4Eydl+pVbIyE1DcvCWgQ==" + }, + "ci-info": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/ci-info/-/ci-info-2.0.0.tgz", + "integrity": "sha512-5tK7EtrZ0N+OLFMthtqOj4fI2Jeb88C4CAZPu25LDVUgXJ0A3Js4PMGqrn0JU1W0Mh1/Z8wZzYPxqUrXeBboCQ==", + "dev": true + }, + "clean-stack": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/clean-stack/-/clean-stack-2.2.0.tgz", + "integrity": "sha512-4diC9HaTE+KRAMWhDhrGOECgWZxoevMc5TlkObMqNSsVU62PYzXZ/SMTjzyGAFF1YusgxGcSWTEXBhp0CPwQ1A==", + "optional": true + }, + "cli-boxes": { + "version": "2.2.1", + "resolved": "https://registry.npmjs.org/cli-boxes/-/cli-boxes-2.2.1.tgz", + "integrity": "sha512-y4coMcylgSCdVinjiDBuR8PCC2bLjyGTwEmPb9NHR/QaNU6EUOXcTY/s6VjGMD6ENSEaeQYHCY0GNGS5jfMwPw==", + "dev": true + }, + "clone-response": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/clone-response/-/clone-response-1.0.2.tgz", + "integrity": "sha1-0dyXOSAxTfZ/vrlCI7TuNQI56Ws=", + "dev": true, + "requires": { + "mimic-response": "^1.0.0" + } + }, + "color-convert": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-2.0.1.tgz", + "integrity": "sha512-RRECPsj7iu/xb5oKYcsFHSppFNnsj/52OVTRKb4zP5onXwVF3zVmmToNcOfGC+CRDpfK/U584fMg38ZHCaElKQ==", + "dev": true, + "requires": { + "color-name": "~1.1.4" + } + }, + "color-name": { + "version": "1.1.4", + "resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.4.tgz", + "integrity": "sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==", + "dev": true + }, + "color-support": { + "version": "1.1.3", + "resolved": "https://registry.npmjs.org/color-support/-/color-support-1.1.3.tgz", + "integrity": "sha512-qiBjkpbMLO/HL68y+lh4q0/O1MZFj2RX6X/KmMa3+gJD3z+WwI1ZzDHysvqHGS3mP6mznPckpXmw1nI9cJjyRg==" + }, + "concat-map": { + "version": "0.0.1", + "resolved": "https://registry.npmjs.org/concat-map/-/concat-map-0.0.1.tgz", + "integrity": "sha1-2Klr13/Wjfd5OnMDajug1UBdR3s=" + }, + "configstore": { + "version": "5.0.1", + "resolved": "https://registry.npmjs.org/configstore/-/configstore-5.0.1.tgz", + "integrity": "sha512-aMKprgk5YhBNyH25hj8wGt2+D52Sw1DRRIzqBwLp2Ya9mFmY8KPvvtvmna8SxVR9JMZ4kzMD68N22vlaRpkeFA==", + "dev": true, + "requires": { + "dot-prop": "^5.2.0", + "graceful-fs": "^4.1.2", + "make-dir": "^3.0.0", + "unique-string": "^2.0.0", + "write-file-atomic": "^3.0.0", + "xdg-basedir": "^4.0.0" + } + }, + "console-control-strings": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/console-control-strings/-/console-control-strings-1.1.0.tgz", + "integrity": "sha1-PXz0Rk22RG6mRL9LOVB/mFEAjo4=" + }, + "content-disposition": { + "version": "0.5.4", + "resolved": "https://registry.npmjs.org/content-disposition/-/content-disposition-0.5.4.tgz", + "integrity": "sha512-FveZTNuGw04cxlAiWbzi6zTAL/lhehaWbTtgluJh4/E95DqMwTmha3KZN1aAWA8cFIhHzMZUvLevkw5Rqk+tSQ==", + "requires": { + "safe-buffer": "5.2.1" + } + }, + "content-type": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/content-type/-/content-type-1.0.4.tgz", + "integrity": "sha512-hIP3EEPs8tB9AT1L+NUqtwOAps4mk2Zob89MWXMHjHWg9milF/j4osnnQLXBCBFBk/tvIG/tUc9mOUJiPBhPXA==" + }, + "cookie": { + "version": "0.5.0", + "resolved": "https://registry.npmjs.org/cookie/-/cookie-0.5.0.tgz", + "integrity": "sha512-YZ3GUyn/o8gfKJlnlX7g7xq4gyO6OSuhGPKaaGssGB2qgDUS0gPgtTvoyZLTt9Ab6dC4hfc9dV5arkvc/OCmrw==" + }, + "cookie-signature": { + "version": "1.0.6", + "resolved": "https://registry.npmjs.org/cookie-signature/-/cookie-signature-1.0.6.tgz", + "integrity": "sha1-4wOogrNCzD7oylE6eZmXNNqzriw=" + }, + "cors": { + "version": "2.8.5", + "resolved": "https://registry.npmjs.org/cors/-/cors-2.8.5.tgz", + "integrity": "sha512-KIHbLJqu73RGr/hnbrO9uBeixNGuvSQjul/jdFvS/KFSIH1hWVd1ng7zOHx+YrEfInLG7q4n6GHQ9cDtxv/P6g==", + "requires": { + "object-assign": "^4", + "vary": "^1" + } + }, + "crypto-random-string": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/crypto-random-string/-/crypto-random-string-2.0.0.tgz", + "integrity": "sha512-v1plID3y9r/lPhviJ1wrXpLeyUIGAZ2SHNYTEapm7/8A9nLPoyvVp3RK/EPFqn5kEznyWgYZNsRtYYIWbuG8KA==", + "dev": true + }, + "debug": { + "version": "2.6.9", + "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz", + "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==", + "requires": { + "ms": "2.0.0" + } + }, + "decompress-response": { + "version": "3.3.0", + "resolved": "https://registry.npmjs.org/decompress-response/-/decompress-response-3.3.0.tgz", + "integrity": "sha1-gKTdMjdIOEv6JICDYirt7Jgq3/M=", + "dev": true, + "requires": { + "mimic-response": "^1.0.0" + } + }, + "deep-extend": { + "version": "0.6.0", + "resolved": "https://registry.npmjs.org/deep-extend/-/deep-extend-0.6.0.tgz", + "integrity": "sha512-LOHxIOaPYdHlJRtCQfDIVZtfw/ufM8+rVj649RIHzcm/vGwQRXFt6OPqIFWsm2XEMrNIEtWR64sY1LEKD2vAOA==", + "dev": true + }, + "defer-to-connect": { + "version": "1.1.3", + "resolved": "https://registry.npmjs.org/defer-to-connect/-/defer-to-connect-1.1.3.tgz", + "integrity": "sha512-0ISdNousHvZT2EiFlZeZAHBUvSxmKswVCEf8hW7KWgG4a8MVEu/3Vb6uWYozkjylyCxe0JBIiRB1jV45S70WVQ==", + "dev": true + }, + "delegates": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/delegates/-/delegates-1.0.0.tgz", + "integrity": "sha1-hMbhWbgZBP3KWaDvRM2HDTElD5o=" + }, + "depd": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/depd/-/depd-2.0.0.tgz", + "integrity": "sha512-g7nH6P6dyDioJogAAGprGpCtVImJhpPk/roCzdb3fIh61/s/nPsfR6onyMwkCAR/OlC3yBC0lESvUoQEAssIrw==" + }, + "destroy": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/destroy/-/destroy-1.2.0.tgz", + "integrity": "sha512-2sJGJTaXIIaR1w4iJSNoN0hnMY7Gpc/n8D4qSCJw8QqFWXf7cuAgnEHxBpweaVcPevC2l3KpjYCx3NypQQgaJg==" + }, + "detect-libc": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/detect-libc/-/detect-libc-2.0.1.tgz", + "integrity": "sha512-463v3ZeIrcWtdgIg6vI6XUncguvr2TnGl4SzDXinkt9mSLpBJKXT3mW6xT3VQdDN11+WVs29pgvivTc4Lp8v+w==" + }, + "dot-prop": { + "version": "5.3.0", + "resolved": "https://registry.npmjs.org/dot-prop/-/dot-prop-5.3.0.tgz", + "integrity": "sha512-QM8q3zDe58hqUqjraQOmzZ1LIH9SWQJTlEKCH4kJ2oQvLZk7RbQXvtDM2XEq3fwkV9CCvvH4LA0AV+ogFsBM2Q==", + "dev": true, + "requires": { + "is-obj": "^2.0.0" + } + }, + "duplexer3": { + "version": "0.1.4", + "resolved": "https://registry.npmjs.org/duplexer3/-/duplexer3-0.1.4.tgz", + "integrity": "sha1-7gHdHKwO08vH/b6jfcCo8c4ALOI=", + "dev": true + }, + "ee-first": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/ee-first/-/ee-first-1.1.1.tgz", + "integrity": "sha1-WQxhFWsK4vTwJVcyoViyZrxWsh0=" + }, + "emoji-regex": { + "version": "8.0.0", + "resolved": "https://registry.npmjs.org/emoji-regex/-/emoji-regex-8.0.0.tgz", + "integrity": "sha512-MSjYzcWNOA0ewAHpz0MxpYFvwg6yjy1NG3xteoqz644VCo/RPgnr1/GGt+ic3iJTzQ8Eu3TdM14SawnVUmGE6A==" + }, + "encodeurl": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/encodeurl/-/encodeurl-1.0.2.tgz", + "integrity": "sha1-rT/0yG7C0CkyL1oCw6mmBslbP1k=" + }, + "encoding": { + "version": "0.1.13", + "resolved": "https://registry.npmjs.org/encoding/-/encoding-0.1.13.tgz", + "integrity": "sha512-ETBauow1T35Y/WZMkio9jiM0Z5xjHHmJ4XmjZOq1l/dXz3lr2sRn87nJy20RupqSh1F2m3HHPSp8ShIPQJrJ3A==", + "optional": true, + "requires": { + "iconv-lite": "^0.6.2" + }, + "dependencies": { + "iconv-lite": { + "version": "0.6.3", + "resolved": "https://registry.npmjs.org/iconv-lite/-/iconv-lite-0.6.3.tgz", + "integrity": "sha512-4fCk79wshMdzMp2rH06qWrJE4iolqLhCUH+OiuIgU++RB0+94NlDL81atO7GX55uUKueo0txHNtvEyI6D7WdMw==", + "optional": true, + "requires": { + "safer-buffer": ">= 2.1.2 < 3.0.0" + } + } + } + }, + "end-of-stream": { + "version": "1.4.4", + "resolved": "https://registry.npmjs.org/end-of-stream/-/end-of-stream-1.4.4.tgz", + "integrity": "sha512-+uw1inIHVPQoaVuHzRyXd21icM+cnt4CzD5rW+NC1wjOUSTOs+Te7FOv7AhN7vS9x/oIyhLP5PR1H+phQAHu5Q==", + "dev": true, + "requires": { + "once": "^1.4.0" + } + }, + "env-paths": { + "version": "2.2.1", + "resolved": "https://registry.npmjs.org/env-paths/-/env-paths-2.2.1.tgz", + "integrity": "sha512-+h1lkLKhZMTYjog1VEpJNG7NZJWcuc2DDk/qsqSTRRCOXiLjeQ1d1/udrUGhqMxUgAlwKNZ0cf2uqan5GLuS2A==", + "optional": true + }, + "err-code": { + "version": "2.0.3", + "resolved": "https://registry.npmjs.org/err-code/-/err-code-2.0.3.tgz", + "integrity": "sha512-2bmlRpNKBxT/CRmPOlyISQpNj+qSeYvcym/uT0Jx2bMOlKLtSy1ZmLuVxSEKKyor/N5yhvp/ZiG1oE3DEYMSFA==", + "optional": true + }, + "escape-goat": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/escape-goat/-/escape-goat-2.1.1.tgz", + "integrity": "sha512-8/uIhbG12Csjy2JEW7D9pHbreaVaS/OpN3ycnyvElTdwM5n6GY6W6e2IPemfvGZeUMqZ9A/3GqIZMgKnBhAw/Q==", + "dev": true + }, + "escape-html": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/escape-html/-/escape-html-1.0.3.tgz", + "integrity": "sha1-Aljq5NPQwJdN4cFpGI7wBR0dGYg=" + }, + "etag": { + "version": "1.8.1", + "resolved": "https://registry.npmjs.org/etag/-/etag-1.8.1.tgz", + "integrity": "sha1-Qa4u62XvpiJorr/qg6x9eSmbCIc=" + }, + "express": { + "version": "4.18.1", + "resolved": "https://registry.npmjs.org/express/-/express-4.18.1.tgz", + "integrity": "sha512-zZBcOX9TfehHQhtupq57OF8lFZ3UZi08Y97dwFCkD8p9d/d2Y3M+ykKcwaMDEL+4qyUolgBDX6AblpR3fL212Q==", + "requires": { + "accepts": "~1.3.8", + "array-flatten": "1.1.1", + "body-parser": "1.20.0", + "content-disposition": "0.5.4", + "content-type": "~1.0.4", + "cookie": "0.5.0", + "cookie-signature": "1.0.6", + "debug": "2.6.9", + "depd": "2.0.0", + "encodeurl": "~1.0.2", + "escape-html": "~1.0.3", + "etag": "~1.8.1", + "finalhandler": "1.2.0", + "fresh": "0.5.2", + "http-errors": "2.0.0", + "merge-descriptors": "1.0.1", + "methods": "~1.1.2", + "on-finished": "2.4.1", + "parseurl": "~1.3.3", + "path-to-regexp": "0.1.7", + "proxy-addr": "~2.0.7", + "qs": "6.10.3", + "range-parser": "~1.2.1", + "safe-buffer": "5.2.1", + "send": "0.18.0", + "serve-static": "1.15.0", + "setprototypeof": "1.2.0", + "statuses": "2.0.1", + "type-is": "~1.6.18", + "utils-merge": "1.0.1", + "vary": "~1.1.2" + } + }, + "fill-range": { + "version": "7.0.1", + "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-7.0.1.tgz", + "integrity": "sha512-qOo9F+dMUmC2Lcb4BbVvnKJxTPjCm+RRpe4gDuGrzkL7mEVl/djYSu2OdQ2Pa302N4oqkSg9ir6jaLWJ2USVpQ==", + "dev": true, + "requires": { + "to-regex-range": "^5.0.1" + } + }, + "finalhandler": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/finalhandler/-/finalhandler-1.2.0.tgz", + "integrity": "sha512-5uXcUVftlQMFnWC9qu/svkWv3GTd2PfUhK/3PLkYNAe7FbqJMt3515HaxE6eRL74GdsriiwujiawdaB1BpEISg==", + "requires": { + "debug": "2.6.9", + "encodeurl": "~1.0.2", + "escape-html": "~1.0.3", + "on-finished": "2.4.1", + "parseurl": "~1.3.3", + "statuses": "2.0.1", + "unpipe": "~1.0.0" + } + }, + "forwarded": { + "version": "0.2.0", + "resolved": "https://registry.npmjs.org/forwarded/-/forwarded-0.2.0.tgz", + "integrity": "sha512-buRG0fpBtRHSTCOASe6hD258tEubFoRLb4ZNA6NxMVHNw2gOcwHo9wyablzMzOA5z9xA9L1KNjk/Nt6MT9aYow==" + }, + "fresh": { + "version": "0.5.2", + "resolved": "https://registry.npmjs.org/fresh/-/fresh-0.5.2.tgz", + "integrity": "sha1-PYyt2Q2XZWn6g1qx+OSyOhBWBac=" + }, + "fs-minipass": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/fs-minipass/-/fs-minipass-2.1.0.tgz", + "integrity": "sha512-V/JgOLFCS+R6Vcq0slCuaeWEdNC3ouDlJMNIsacH2VtALiu9mV4LPrHc5cDl8k5aw6J8jwgWWpiTo5RYhmIzvg==", + "requires": { + "minipass": "^3.0.0" + } + }, + "fs.realpath": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/fs.realpath/-/fs.realpath-1.0.0.tgz", + "integrity": "sha1-FQStJSMVjKpA20onh8sBQRmU6k8=" + }, + "fsevents": { + "version": "2.3.2", + "resolved": "https://registry.npmjs.org/fsevents/-/fsevents-2.3.2.tgz", + "integrity": "sha512-xiqMQR4xAeHTuB9uWm+fFRcIOgKBMiOBP+eXiyT7jsgVCq1bkVygt00oASowB7EdtpOHaaPgKt812P9ab+DDKA==", + "dev": true, + "optional": true + }, + "function-bind": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/function-bind/-/function-bind-1.1.1.tgz", + "integrity": "sha512-yIovAzMX49sF8Yl58fSCWJ5svSLuaibPxXQJFLmBObTuCr0Mf1KiPopGM9NiFjiYBCbfaa2Fh6breQ6ANVTI0A==" + }, + "gauge": { + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/gauge/-/gauge-3.0.2.tgz", + "integrity": "sha512-+5J6MS/5XksCuXq++uFRsnUd7Ovu1XenbeuIuNRJxYWjgQbPuFhT14lAvsWfqfAmnwluf1OwMjz39HjfLPci0Q==", + "requires": { + "aproba": "^1.0.3 || ^2.0.0", + "color-support": "^1.1.2", + "console-control-strings": "^1.0.0", + "has-unicode": "^2.0.1", + "object-assign": "^4.1.1", + "signal-exit": "^3.0.0", + "string-width": "^4.2.3", + "strip-ansi": "^6.0.1", + "wide-align": "^1.1.2" + } + }, + "get-intrinsic": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/get-intrinsic/-/get-intrinsic-1.1.1.tgz", + "integrity": "sha512-kWZrnVM42QCiEA2Ig1bG8zjoIMOgxWwYCEeNdwY6Tv/cOSeGpcoX4pXHfKUxNKVoArnrEr2e9srnAxxGIraS9Q==", + "requires": { + "function-bind": "^1.1.1", + "has": "^1.0.3", + "has-symbols": "^1.0.1" + } + }, + "get-stream": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/get-stream/-/get-stream-4.1.0.tgz", + "integrity": "sha512-GMat4EJ5161kIy2HevLlr4luNjBgvmj413KaQA7jt4V8B4RDsfpHk7WQ9GVqfYyyx8OS/L66Kox+rJRNklLK7w==", + "dev": true, + "requires": { + "pump": "^3.0.0" + } + }, + "glob": { + "version": "7.2.0", + "resolved": "https://registry.npmjs.org/glob/-/glob-7.2.0.tgz", + "integrity": "sha512-lmLf6gtyrPq8tTjSmrO94wBeQbFR3HbLHbuyD69wuyQkImp2hWqMGB47OX65FBkPffO641IP9jWa1z4ivqG26Q==", + "requires": { + "fs.realpath": "^1.0.0", + "inflight": "^1.0.4", + "inherits": "2", + "minimatch": "^3.0.4", + "once": "^1.3.0", + "path-is-absolute": "^1.0.0" + } + }, + "glob-parent": { + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-5.1.2.tgz", + "integrity": "sha512-AOIgSQCepiJYwP3ARnGx+5VnTu2HBYdzbGP45eLw1vr3zB3vZLeyed1sC9hnbcOc9/SrMyM5RPQrkGz4aS9Zow==", + "dev": true, + "requires": { + "is-glob": "^4.0.1" + } + }, + "global-dirs": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/global-dirs/-/global-dirs-3.0.0.tgz", + "integrity": "sha512-v8ho2DS5RiCjftj1nD9NmnfaOzTdud7RRnVd9kFNOjqZbISlx5DQ+OrTkywgd0dIt7oFCvKetZSHoHcP3sDdiA==", + "dev": true, + "requires": { + "ini": "2.0.0" + } + }, + "got": { + "version": "9.6.0", + "resolved": "https://registry.npmjs.org/got/-/got-9.6.0.tgz", + "integrity": "sha512-R7eWptXuGYxwijs0eV+v3o6+XH1IqVK8dJOEecQfTmkncw9AV4dcw/Dhxi8MdlqPthxxpZyizMzyg8RTmEsG+Q==", + "dev": true, + "requires": { + "@sindresorhus/is": "^0.14.0", + "@szmarczak/http-timer": "^1.1.2", + "cacheable-request": "^6.0.0", + "decompress-response": "^3.3.0", + "duplexer3": "^0.1.4", + "get-stream": "^4.1.0", + "lowercase-keys": "^1.0.1", + "mimic-response": "^1.0.1", + "p-cancelable": "^1.0.0", + "to-readable-stream": "^1.0.0", + "url-parse-lax": "^3.0.0" + } + }, + "graceful-fs": { + "version": "4.2.10", + "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.10.tgz", + "integrity": "sha512-9ByhssR2fPVsNZj478qUUbKfmL0+t5BDVyjShtyZZLiK7ZDAArFFfopyOTj0M05wE2tJPisA4iTnnXl2YoPvOA==" + }, + "has": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/has/-/has-1.0.3.tgz", + "integrity": "sha512-f2dvO0VU6Oej7RkWJGrehjbzMAjFp5/VKPp5tTpWIV4JHHZK1/BxbFRtf/siA2SWTe09caDmVtYYzWEIbBS4zw==", + "requires": { + "function-bind": "^1.1.1" + } + }, + "has-flag": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-3.0.0.tgz", + "integrity": "sha1-tdRU3CGZriJWmfNGfloH87lVuv0=", + "dev": true + }, + "has-symbols": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/has-symbols/-/has-symbols-1.0.3.tgz", + "integrity": "sha512-l3LCuF6MgDNwTDKkdYGEihYjt5pRPbEg46rtlmnSPlUbgmB8LOIrKJbYYFBSbnPaJexMKtiPO8hmeRjRz2Td+A==" + }, + "has-unicode": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/has-unicode/-/has-unicode-2.0.1.tgz", + "integrity": "sha1-4Ob+aijPUROIVeCG0Wkedx3iqLk=" + }, + "has-yarn": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/has-yarn/-/has-yarn-2.1.0.tgz", + "integrity": "sha512-UqBRqi4ju7T+TqGNdqAO0PaSVGsDGJUBQvk9eUWNGRY1CFGDzYhLWoM7JQEemnlvVcv/YEmc2wNW8BC24EnUsw==", + "dev": true + }, + "http-cache-semantics": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/http-cache-semantics/-/http-cache-semantics-4.1.0.tgz", + "integrity": "sha512-carPklcUh7ROWRK7Cv27RPtdhYhUsela/ue5/jKzjegVvXDqM2ILE9Q2BGn9JZJh1g87cp56su/FgQSzcWS8cQ==" + }, + "http-errors": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/http-errors/-/http-errors-2.0.0.tgz", + "integrity": "sha512-FtwrG/euBzaEjYeRqOgly7G0qviiXoJWnvEH2Z1plBdXgbyjv34pHTSb9zoeHMyDy33+DWy5Wt9Wo+TURtOYSQ==", + "requires": { + "depd": "2.0.0", + "inherits": "2.0.4", + "setprototypeof": "1.2.0", + "statuses": "2.0.1", + "toidentifier": "1.0.1" + } + }, + "http-proxy-agent": { + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/http-proxy-agent/-/http-proxy-agent-4.0.1.tgz", + "integrity": "sha512-k0zdNgqWTGA6aeIRVpvfVob4fL52dTfaehylg0Y4UvSySvOq/Y+BOyPrgpUrA7HylqvU8vIZGsRuXmspskV0Tg==", + "optional": true, + "requires": { + "@tootallnate/once": "1", + "agent-base": "6", + "debug": "4" + }, + "dependencies": { + "debug": { + "version": "4.3.4", + "resolved": "https://registry.npmjs.org/debug/-/debug-4.3.4.tgz", + "integrity": "sha512-PRWFHuSU3eDtQJPvnNY7Jcket1j0t5OuOsFzPPzsekD52Zl8qUfFIPEiswXqIvHWGVHOgX+7G/vCNNhehwxfkQ==", + "optional": true, + "requires": { + "ms": "2.1.2" + } + }, + "ms": { + "version": "2.1.2", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.2.tgz", + "integrity": "sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==", + "optional": true + } + } + }, + "https-proxy-agent": { + "version": "5.0.1", + "resolved": "https://registry.npmjs.org/https-proxy-agent/-/https-proxy-agent-5.0.1.tgz", + "integrity": "sha512-dFcAjpTQFgoLMzC2VwU+C/CbS7uRL0lWmxDITmqm7C+7F0Odmj6s9l6alZc6AELXhrnggM2CeWSXHGOdX2YtwA==", + "requires": { + "agent-base": "6", + "debug": "4" + }, + "dependencies": { + "debug": { + "version": "4.3.4", + "resolved": "https://registry.npmjs.org/debug/-/debug-4.3.4.tgz", + "integrity": "sha512-PRWFHuSU3eDtQJPvnNY7Jcket1j0t5OuOsFzPPzsekD52Zl8qUfFIPEiswXqIvHWGVHOgX+7G/vCNNhehwxfkQ==", + "requires": { + "ms": "2.1.2" + } + }, + "ms": { + "version": "2.1.2", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.2.tgz", + "integrity": "sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==" + } + } + }, + "humanize-ms": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/humanize-ms/-/humanize-ms-1.2.1.tgz", + "integrity": "sha1-xG4xWaKT9riW2ikxbYtv6Lt5u+0=", + "optional": true, + "requires": { + "ms": "^2.0.0" + } + }, + "iconv-lite": { + "version": "0.4.24", + "resolved": "https://registry.npmjs.org/iconv-lite/-/iconv-lite-0.4.24.tgz", + "integrity": "sha512-v3MXnZAcvnywkTUEZomIActle7RXXeedOR31wwl7VlyoXO4Qi9arvSenNQWne1TcRwhCL1HwLI21bEqdpj8/rA==", + "requires": { + "safer-buffer": ">= 2.1.2 < 3" + } + }, + "ignore-by-default": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/ignore-by-default/-/ignore-by-default-1.0.1.tgz", + "integrity": "sha1-SMptcvbGo68Aqa1K5odr44ieKwk=", + "dev": true + }, + "import-lazy": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/import-lazy/-/import-lazy-2.1.0.tgz", + "integrity": "sha1-BWmOPUXIjo1+nZLLBYTnfwlvPkM=", + "dev": true + }, + "imurmurhash": { + "version": "0.1.4", + "resolved": "https://registry.npmjs.org/imurmurhash/-/imurmurhash-0.1.4.tgz", + "integrity": "sha1-khi5srkoojixPcT7a21XbyMUU+o=" + }, + "indent-string": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/indent-string/-/indent-string-4.0.0.tgz", + "integrity": "sha512-EdDDZu4A2OyIK7Lr/2zG+w5jmbuk1DVBnEwREQvBzspBJkCEbRa8GxU1lghYcaGJCnRWibjDXlq779X1/y5xwg==", + "optional": true + }, + "infer-owner": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/infer-owner/-/infer-owner-1.0.4.tgz", + "integrity": "sha512-IClj+Xz94+d7irH5qRyfJonOdfTzuDaifE6ZPWfx0N0+/ATZCbuTPq2prFl526urkQd90WyUKIh1DfBQ2hMz9A==", + "optional": true + }, + "inflight": { + "version": "1.0.6", + "resolved": "https://registry.npmjs.org/inflight/-/inflight-1.0.6.tgz", + "integrity": "sha1-Sb1jMdfQLQwJvJEKEHW6gWW1bfk=", + "requires": { + "once": "^1.3.0", + "wrappy": "1" + } + }, + "inherits": { + "version": "2.0.4", + "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.4.tgz", + "integrity": "sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ==" + }, + "ini": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/ini/-/ini-2.0.0.tgz", + "integrity": "sha512-7PnF4oN3CvZF23ADhA5wRaYEQpJ8qygSkbtTXWBeXWXmEVRXK+1ITciHWwHhsjv1TmW0MgacIv6hEi5pX5NQdA==", + "dev": true + }, + "ip": { + "version": "1.1.5", + "resolved": "https://registry.npmjs.org/ip/-/ip-1.1.5.tgz", + "integrity": "sha1-vd7XARQpCCjAoDnnLvJfWq7ENUo=", + "optional": true + }, + "ipaddr.js": { + "version": "1.9.1", + "resolved": "https://registry.npmjs.org/ipaddr.js/-/ipaddr.js-1.9.1.tgz", + "integrity": "sha512-0KI/607xoxSToH7GjN1FfSbLoU0+btTicjsQSWQlh/hZykN8KpmMf7uYwPW3R+akZ6R/w18ZlXSHBYXiYUPO3g==" + }, + "is-binary-path": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/is-binary-path/-/is-binary-path-2.1.0.tgz", + "integrity": "sha512-ZMERYes6pDydyuGidse7OsHxtbI7WVeUEozgR/g7rd0xUimYNlvZRE/K2MgZTjWy725IfelLeVcEM97mmtRGXw==", + "dev": true, + "requires": { + "binary-extensions": "^2.0.0" + } + }, + "is-ci": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/is-ci/-/is-ci-2.0.0.tgz", + "integrity": "sha512-YfJT7rkpQB0updsdHLGWrvhBJfcfzNNawYDNIyQXJz0IViGf75O8EBPKSdvw2rF+LGCsX4FZ8tcr3b19LcZq4w==", + "dev": true, + "requires": { + "ci-info": "^2.0.0" + } + }, + "is-extglob": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/is-extglob/-/is-extglob-2.1.1.tgz", + "integrity": "sha1-qIwCU1eR8C7TfHahueqXc8gz+MI=", + "dev": true + }, + "is-fullwidth-code-point": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-3.0.0.tgz", + "integrity": "sha512-zymm5+u+sCsSWyD9qNaejV3DFvhCKclKdizYaJUuHA83RLjb7nSuGnddCHGv0hk+KY7BMAlsWeK4Ueg6EV6XQg==" + }, + "is-glob": { + "version": "4.0.3", + "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-4.0.3.tgz", + "integrity": "sha512-xelSayHH36ZgE7ZWhli7pW34hNbNl8Ojv5KVmkJD4hBdD3th8Tfk9vYasLM+mXWOZhFkgZfxhLSnrwRr4elSSg==", + "dev": true, + "requires": { + "is-extglob": "^2.1.1" + } + }, + "is-installed-globally": { + "version": "0.4.0", + "resolved": "https://registry.npmjs.org/is-installed-globally/-/is-installed-globally-0.4.0.tgz", + "integrity": "sha512-iwGqO3J21aaSkC7jWnHP/difazwS7SFeIqxv6wEtLU8Y5KlzFTjyqcSIT0d8s4+dDhKytsk9PJZ2BkS5eZwQRQ==", + "dev": true, + "requires": { + "global-dirs": "^3.0.0", + "is-path-inside": "^3.0.2" + } + }, + "is-lambda": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/is-lambda/-/is-lambda-1.0.1.tgz", + "integrity": "sha1-PZh3iZ5qU+/AFgUEzeFfgubwYdU=", + "optional": true + }, + "is-npm": { + "version": "5.0.0", + "resolved": "https://registry.npmjs.org/is-npm/-/is-npm-5.0.0.tgz", + "integrity": "sha512-WW/rQLOazUq+ST/bCAVBp/2oMERWLsR7OrKyt052dNDk4DHcDE0/7QSXITlmi+VBcV13DfIbysG3tZJm5RfdBA==", + "dev": true + }, + "is-number": { + "version": "7.0.0", + "resolved": "https://registry.npmjs.org/is-number/-/is-number-7.0.0.tgz", + "integrity": "sha512-41Cifkg6e8TylSpdtTpeLVMqvSBEVzTttHvERD741+pnZ8ANv0004MRL43QKPDlK9cGvNp6NZWZUBlbGXYxxng==", + "dev": true + }, + "is-obj": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/is-obj/-/is-obj-2.0.0.tgz", + "integrity": "sha512-drqDG3cbczxxEJRoOXcOjtdp1J/lyp1mNn0xaznRs8+muBhgQcrnbspox5X5fOw0HnMnbfDzvnEMEtqDEJEo8w==", + "dev": true + }, + "is-path-inside": { + "version": "3.0.3", + "resolved": "https://registry.npmjs.org/is-path-inside/-/is-path-inside-3.0.3.tgz", + "integrity": "sha512-Fd4gABb+ycGAmKou8eMftCupSir5lRxqf4aD/vd0cD2qc4HL07OjCeuHMr8Ro4CoMaeCKDB0/ECBOVWjTwUvPQ==", + "dev": true + }, + "is-typedarray": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/is-typedarray/-/is-typedarray-1.0.0.tgz", + "integrity": "sha1-5HnICFjfDBsR3dppQPlgEfzaSpo=", + "dev": true + }, + "is-yarn-global": { + "version": "0.3.0", + "resolved": "https://registry.npmjs.org/is-yarn-global/-/is-yarn-global-0.3.0.tgz", + "integrity": "sha512-VjSeb/lHmkoyd8ryPVIKvOCn4D1koMqY+vqyjjUfc3xyKtP4dYOxM44sZrnqQSzSds3xyOrUTLTC9LVCVgLngw==", + "dev": true + }, + "isexe": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/isexe/-/isexe-2.0.0.tgz", + "integrity": "sha1-6PvzdNxVb/iUehDcsFctYz8s+hA=", + "optional": true + }, + "json-buffer": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/json-buffer/-/json-buffer-3.0.0.tgz", + "integrity": "sha1-Wx85evx11ne96Lz8Dkfh+aPZqJg=", + "dev": true + }, + "keyv": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/keyv/-/keyv-3.1.0.tgz", + "integrity": "sha512-9ykJ/46SN/9KPM/sichzQ7OvXyGDYKGTaDlKMGCAlg2UK8KRy4jb0d8sFc+0Tt0YYnThq8X2RZgCg74RPxgcVA==", + "dev": true, + "requires": { + "json-buffer": "3.0.0" + } + }, + "latest-version": { + "version": "5.1.0", + "resolved": "https://registry.npmjs.org/latest-version/-/latest-version-5.1.0.tgz", + "integrity": "sha512-weT+r0kTkRQdCdYCNtkMwWXQTMEswKrFBkm4ckQOMVhhqhIMI1UT2hMj+1iigIhgSZm5gTmrRXBNoGUgaTY1xA==", + "dev": true, + "requires": { + "package-json": "^6.3.0" + } + }, + "lowercase-keys": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/lowercase-keys/-/lowercase-keys-1.0.1.tgz", + "integrity": "sha512-G2Lj61tXDnVFFOi8VZds+SoQjtQC3dgokKdDG2mTm1tx4m50NUHBOZSBwQQHyy0V12A0JTG4icfZQH+xPyh8VA==", + "dev": true + }, + "lru-cache": { + "version": "6.0.0", + "resolved": "https://registry.npmjs.org/lru-cache/-/lru-cache-6.0.0.tgz", + "integrity": "sha512-Jo6dJ04CmSjuznwJSS3pUeWmd/H0ffTlkXXgwZi+eq1UCmqQwCh+eLsYOYCwY991i2Fah4h1BEMCx4qThGbsiA==", + "requires": { + "yallist": "^4.0.0" + } + }, + "make-dir": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/make-dir/-/make-dir-3.1.0.tgz", + "integrity": "sha512-g3FeP20LNwhALb/6Cz6Dd4F2ngze0jz7tbzrD2wAV+o9FeNHe4rL+yK2md0J/fiSf1sa1ADhXqi5+oVwOM/eGw==", + "requires": { + "semver": "^6.0.0" + }, + "dependencies": { + "semver": { + "version": "6.3.0", + "resolved": "https://registry.npmjs.org/semver/-/semver-6.3.0.tgz", + "integrity": "sha512-b39TBaTSfV6yBrapU89p5fKekE2m/NwnDocOVruQFS1/veMgdzuPcnOM34M6CwxW8jH/lxEa5rBoDeUwu5HHTw==" + } + } + }, + "make-fetch-happen": { + "version": "9.1.0", + "resolved": "https://registry.npmjs.org/make-fetch-happen/-/make-fetch-happen-9.1.0.tgz", + "integrity": "sha512-+zopwDy7DNknmwPQplem5lAZX/eCOzSvSNNcSKm5eVwTkOBzoktEfXsa9L23J/GIRhxRsaxzkPEhrJEpE2F4Gg==", + "optional": true, + "requires": { + "agentkeepalive": "^4.1.3", + "cacache": "^15.2.0", + "http-cache-semantics": "^4.1.0", + "http-proxy-agent": "^4.0.1", + "https-proxy-agent": "^5.0.0", + "is-lambda": "^1.0.1", + "lru-cache": "^6.0.0", + "minipass": "^3.1.3", + "minipass-collect": "^1.0.2", + "minipass-fetch": "^1.3.2", + "minipass-flush": "^1.0.5", + "minipass-pipeline": "^1.2.4", + "negotiator": "^0.6.2", + "promise-retry": "^2.0.1", + "socks-proxy-agent": "^6.0.0", + "ssri": "^8.0.0" + } + }, + "media-typer": { + "version": "0.3.0", + "resolved": "https://registry.npmjs.org/media-typer/-/media-typer-0.3.0.tgz", + "integrity": "sha1-hxDXrwqmJvj/+hzgAWhUUmMlV0g=" + }, + "merge-descriptors": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/merge-descriptors/-/merge-descriptors-1.0.1.tgz", + "integrity": "sha1-sAqqVW3YtEVoFQ7J0blT8/kMu2E=" + }, + "methods": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/methods/-/methods-1.1.2.tgz", + "integrity": "sha1-VSmk1nZUE07cxSZmVoNbD4Ua/O4=" + }, + "mime": { + "version": "1.6.0", + "resolved": "https://registry.npmjs.org/mime/-/mime-1.6.0.tgz", + "integrity": "sha512-x0Vn8spI+wuJ1O6S7gnbaQg8Pxh4NNHb7KSINmEWKiPE4RKOplvijn+NkmYmmRgP68mc70j2EbeTFRsrswaQeg==" + }, + "mime-db": { + "version": "1.52.0", + "resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.52.0.tgz", + "integrity": "sha512-sPU4uV7dYlvtWJxwwxHD0PuihVNiE7TyAbQ5SWxDCB9mUYvOgroQOwYQQOKPJ8CIbE+1ETVlOoK1UC2nU3gYvg==" + }, + "mime-types": { + "version": "2.1.35", + "resolved": "https://registry.npmjs.org/mime-types/-/mime-types-2.1.35.tgz", + "integrity": "sha512-ZDY+bPm5zTTF+YpCrAU9nK0UgICYPT0QtT1NZWFv4s++TNkcgVaT0g6+4R2uI4MjQjzysHB1zxuWL50hzaeXiw==", + "requires": { + "mime-db": "1.52.0" + } + }, + "mimic-response": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/mimic-response/-/mimic-response-1.0.1.tgz", + "integrity": "sha512-j5EctnkH7amfV/q5Hgmoal1g2QHFJRraOtmx0JpIqkxhBhI/lJSl1nMpQ45hVarwNETOoWEimndZ4QK0RHxuxQ==", + "dev": true + }, + "minimatch": { + "version": "3.1.2", + "resolved": "https://registry.npmjs.org/minimatch/-/minimatch-3.1.2.tgz", + "integrity": "sha512-J7p63hRiAjw1NDEww1W7i37+ByIrOWO5XQQAzZ3VOcL0PNybwpfmV/N05zFAzwQ9USyEcX6t3UO+K5aqBQOIHw==", + "requires": { + "brace-expansion": "^1.1.7" + } + }, + "minimist": { + "version": "1.2.6", + "resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.6.tgz", + "integrity": "sha512-Jsjnk4bw3YJqYzbdyBiNsPWHPfO++UGG749Cxs6peCu5Xg4nrena6OVxOYxrQTqww0Jmwt+Ref8rggumkTLz9Q==", + "dev": true + }, + "minipass": { + "version": "3.1.6", + "resolved": "https://registry.npmjs.org/minipass/-/minipass-3.1.6.tgz", + "integrity": "sha512-rty5kpw9/z8SX9dmxblFA6edItUmwJgMeYDZRrwlIVN27i8gysGbznJwUggw2V/FVqFSDdWy040ZPS811DYAqQ==", + "requires": { + "yallist": "^4.0.0" + } + }, + "minipass-collect": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/minipass-collect/-/minipass-collect-1.0.2.tgz", + "integrity": "sha512-6T6lH0H8OG9kITm/Jm6tdooIbogG9e0tLgpY6mphXSm/A9u8Nq1ryBG+Qspiub9LjWlBPsPS3tWQ/Botq4FdxA==", + "optional": true, + "requires": { + "minipass": "^3.0.0" + } + }, + "minipass-fetch": { + "version": "1.4.1", + "resolved": "https://registry.npmjs.org/minipass-fetch/-/minipass-fetch-1.4.1.tgz", + "integrity": "sha512-CGH1eblLq26Y15+Azk7ey4xh0J/XfJfrCox5LDJiKqI2Q2iwOLOKrlmIaODiSQS8d18jalF6y2K2ePUm0CmShw==", + "optional": true, + "requires": { + "encoding": "^0.1.12", + "minipass": "^3.1.0", + "minipass-sized": "^1.0.3", + "minizlib": "^2.0.0" + } + }, + "minipass-flush": { + "version": "1.0.5", + "resolved": "https://registry.npmjs.org/minipass-flush/-/minipass-flush-1.0.5.tgz", + "integrity": "sha512-JmQSYYpPUqX5Jyn1mXaRwOda1uQ8HP5KAT/oDSLCzt1BYRhQU0/hDtsB1ufZfEEzMZ9aAVmsBw8+FWsIXlClWw==", + "optional": true, + "requires": { + "minipass": "^3.0.0" + } + }, + "minipass-pipeline": { + "version": "1.2.4", + "resolved": "https://registry.npmjs.org/minipass-pipeline/-/minipass-pipeline-1.2.4.tgz", + "integrity": "sha512-xuIq7cIOt09RPRJ19gdi4b+RiNvDFYe5JH+ggNvBqGqpQXcru3PcRmOZuHBKWK1Txf9+cQ+HMVN4d6z46LZP7A==", + "optional": true, + "requires": { + "minipass": "^3.0.0" + } + }, + "minipass-sized": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/minipass-sized/-/minipass-sized-1.0.3.tgz", + "integrity": "sha512-MbkQQ2CTiBMlA2Dm/5cY+9SWFEN8pzzOXi6rlM5Xxq0Yqbda5ZQy9sU75a673FE9ZK0Zsbr6Y5iP6u9nktfg2g==", + "optional": true, + "requires": { + "minipass": "^3.0.0" + } + }, + "minizlib": { + "version": "2.1.2", + "resolved": "https://registry.npmjs.org/minizlib/-/minizlib-2.1.2.tgz", + "integrity": "sha512-bAxsR8BVfj60DWXHE3u30oHzfl4G7khkSuPW+qvpd7jFRHm7dLxOjUk1EHACJ/hxLY8phGJ0YhYHZo7jil7Qdg==", + "requires": { + "minipass": "^3.0.0", + "yallist": "^4.0.0" + } + }, + "mkdirp": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/mkdirp/-/mkdirp-1.0.4.tgz", + "integrity": "sha512-vVqVZQyf3WLx2Shd0qJ9xuvqgAyKPLAiqITEtqW0oIUjzo3PePDd6fW9iFz30ef7Ysp/oiWqbhszeGWW2T6Gzw==" + }, + "ms": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz", + "integrity": "sha1-VgiurfwAvmwpAd9fmGF4jeDVl8g=" + }, + "negotiator": { + "version": "0.6.3", + "resolved": "https://registry.npmjs.org/negotiator/-/negotiator-0.6.3.tgz", + "integrity": "sha512-+EUsqGPLsM+j/zdChZjsnX51g4XrHFOIXwfnCVPGlQk/k5giakcKsuxCObBRu6DSm9opw/O6slWbJdghQM4bBg==" + }, + "node-addon-api": { + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/node-addon-api/-/node-addon-api-4.3.0.tgz", + "integrity": "sha512-73sE9+3UaLYYFmDsFZnqCInzPyh3MqIwZO9cw58yIqAZhONrrabrYyYe3TuIqtIiOuTXVhsGau8hcrhhwSsDIQ==" + }, + "node-fetch": { + "version": "2.6.7", + "resolved": "https://registry.npmjs.org/node-fetch/-/node-fetch-2.6.7.tgz", + "integrity": "sha512-ZjMPFEfVx5j+y2yF35Kzx5sF7kDzxuDj6ziH4FFbOp87zKDZNx8yExJIb05OGF4Nlt9IHFIMBkRl41VdvcNdbQ==", + "requires": { + "whatwg-url": "^5.0.0" + } + }, + "node-gyp": { + "version": "8.4.1", + "resolved": "https://registry.npmjs.org/node-gyp/-/node-gyp-8.4.1.tgz", + "integrity": "sha512-olTJRgUtAb/hOXG0E93wZDs5YiJlgbXxTwQAFHyNlRsXQnYzUaF2aGgujZbw+hR8aF4ZG/rST57bWMWD16jr9w==", + "optional": true, + "requires": { + "env-paths": "^2.2.0", + "glob": "^7.1.4", + "graceful-fs": "^4.2.6", + "make-fetch-happen": "^9.1.0", + "nopt": "^5.0.0", + "npmlog": "^6.0.0", + "rimraf": "^3.0.2", + "semver": "^7.3.5", + "tar": "^6.1.2", + "which": "^2.0.2" + }, + "dependencies": { + "are-we-there-yet": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/are-we-there-yet/-/are-we-there-yet-3.0.0.tgz", + "integrity": "sha512-0GWpv50YSOcLXaN6/FAKY3vfRbllXWV2xvfA/oKJF8pzFhWXPV+yjhJXDBbjscDYowv7Yw1A3uigpzn5iEGTyw==", + "optional": true, + "requires": { + "delegates": "^1.0.0", + "readable-stream": "^3.6.0" + } + }, + "gauge": { + "version": "4.0.4", + "resolved": "https://registry.npmjs.org/gauge/-/gauge-4.0.4.tgz", + "integrity": "sha512-f9m+BEN5jkg6a0fZjleidjN51VE1X+mPFQ2DJ0uv1V39oCLCbsGe6yjbBnp7eK7z/+GAon99a3nHuqbuuthyPg==", + "optional": true, + "requires": { + "aproba": "^1.0.3 || ^2.0.0", + "color-support": "^1.1.3", + "console-control-strings": "^1.1.0", + "has-unicode": "^2.0.1", + "signal-exit": "^3.0.7", + "string-width": "^4.2.3", + "strip-ansi": "^6.0.1", + "wide-align": "^1.1.5" + } + }, + "npmlog": { + "version": "6.0.2", + "resolved": "https://registry.npmjs.org/npmlog/-/npmlog-6.0.2.tgz", + "integrity": "sha512-/vBvz5Jfr9dT/aFWd0FIRf+T/Q2WBsLENygUaFUqstqsycmZAP/t5BvFJTK0viFmSUxiUKTUplWy5vt+rvKIxg==", + "optional": true, + "requires": { + "are-we-there-yet": "^3.0.0", + "console-control-strings": "^1.1.0", + "gauge": "^4.0.3", + "set-blocking": "^2.0.0" + } + } + } + }, + "nodemon": { + "version": "2.0.16", + "resolved": "https://registry.npmjs.org/nodemon/-/nodemon-2.0.16.tgz", + "integrity": "sha512-zsrcaOfTWRuUzBn3P44RDliLlp263Z/76FPoHFr3cFFkOz0lTPAcIw8dCzfdVIx/t3AtDYCZRCDkoCojJqaG3w==", + "dev": true, + "requires": { + "chokidar": "^3.5.2", + "debug": "^3.2.7", + "ignore-by-default": "^1.0.1", + "minimatch": "^3.0.4", + "pstree.remy": "^1.1.8", + "semver": "^5.7.1", + "supports-color": "^5.5.0", + "touch": "^3.1.0", + "undefsafe": "^2.0.5", + "update-notifier": "^5.1.0" + }, + "dependencies": { + "debug": { + "version": "3.2.7", + "resolved": "https://registry.npmjs.org/debug/-/debug-3.2.7.tgz", + "integrity": "sha512-CFjzYYAi4ThfiQvizrFQevTTXHtnCqWfe7x1AhgEscTz6ZbLbfoLRLPugTQyBth6f8ZERVUSyWHFD/7Wu4t1XQ==", + "dev": true, + "requires": { + "ms": "^2.1.1" + } + }, + "ms": { + "version": "2.1.3", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.3.tgz", + "integrity": "sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA==", + "dev": true + }, + "semver": { + "version": "5.7.1", + "resolved": "https://registry.npmjs.org/semver/-/semver-5.7.1.tgz", + "integrity": "sha512-sauaDf/PZdVgrLTNYHRtpXa1iRiKcaebiKQ1BJdpQlWH2lCvexQdX55snPFyK7QzpudqbCI0qXFfOasHdyNDGQ==", + "dev": true + } + } + }, + "nopt": { + "version": "5.0.0", + "resolved": "https://registry.npmjs.org/nopt/-/nopt-5.0.0.tgz", + "integrity": "sha512-Tbj67rffqceeLpcRXrT7vKAN8CwfPeIBgM7E6iBkmKLV7bEMwpGgYLGv0jACUsECaa/vuxP0IjEont6umdMgtQ==", + "requires": { + "abbrev": "1" + } + }, + "normalize-path": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/normalize-path/-/normalize-path-3.0.0.tgz", + "integrity": "sha512-6eZs5Ls3WtCisHWp9S2GUy8dqkpGi4BVSz3GaqiE6ezub0512ESztXUwUB6C6IKbQkY2Pnb/mD4WYojCRwcwLA==", + "dev": true + }, + "normalize-url": { + "version": "4.5.1", + "resolved": "https://registry.npmjs.org/normalize-url/-/normalize-url-4.5.1.tgz", + "integrity": "sha512-9UZCFRHQdNrfTpGg8+1INIg93B6zE0aXMVFkw1WFwvO4SlZywU6aLg5Of0Ap/PgcbSw4LNxvMWXMeugwMCX0AA==", + "dev": true + }, + "npmlog": { + "version": "5.0.1", + "resolved": "https://registry.npmjs.org/npmlog/-/npmlog-5.0.1.tgz", + "integrity": "sha512-AqZtDUWOMKs1G/8lwylVjrdYgqA4d9nu8hc+0gzRxlDb1I10+FHBGMXs6aiQHFdCUUlqH99MUMuLfzWDNDtfxw==", + "requires": { + "are-we-there-yet": "^2.0.0", + "console-control-strings": "^1.1.0", + "gauge": "^3.0.0", + "set-blocking": "^2.0.0" + } + }, + "object-assign": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/object-assign/-/object-assign-4.1.1.tgz", + "integrity": "sha1-IQmtx5ZYh8/AXLvUQsrIv7s2CGM=" + }, + "object-inspect": { + "version": "1.12.0", + "resolved": "https://registry.npmjs.org/object-inspect/-/object-inspect-1.12.0.tgz", + "integrity": "sha512-Ho2z80bVIvJloH+YzRmpZVQe87+qASmBUKZDWgx9cu+KDrX2ZDH/3tMy+gXbZETVGs2M8YdxObOh7XAtim9Y0g==" + }, + "on-finished": { + "version": "2.4.1", + "resolved": "https://registry.npmjs.org/on-finished/-/on-finished-2.4.1.tgz", + "integrity": "sha512-oVlzkg3ENAhCk2zdv7IJwd/QUD4z2RxRwpkcGY8psCVcCYZNq4wYnVWALHM+brtuJjePWiYF/ClmuDr8Ch5+kg==", + "requires": { + "ee-first": "1.1.1" + } + }, + "once": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/once/-/once-1.4.0.tgz", + "integrity": "sha1-WDsap3WWHUsROsF9nFC6753Xa9E=", + "requires": { + "wrappy": "1" + } + }, + "p-cancelable": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/p-cancelable/-/p-cancelable-1.1.0.tgz", + "integrity": "sha512-s73XxOZ4zpt1edZYZzvhqFa6uvQc1vwUa0K0BdtIZgQMAJj9IbebH+JkgKZc9h+B05PKHLOTl4ajG1BmNrVZlw==", + "dev": true + }, + "p-map": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/p-map/-/p-map-4.0.0.tgz", + "integrity": "sha512-/bjOqmgETBYB5BoEeGVea8dmvHb2m9GLy1E9W43yeyfP6QQCZGFNa+XRceJEuDB6zqr+gKpIAmlLebMpykw/MQ==", + "optional": true, + "requires": { + "aggregate-error": "^3.0.0" + } + }, + "package-json": { + "version": "6.5.0", + "resolved": "https://registry.npmjs.org/package-json/-/package-json-6.5.0.tgz", + "integrity": "sha512-k3bdm2n25tkyxcjSKzB5x8kfVxlMdgsbPr0GkZcwHsLpba6cBjqCt1KlcChKEvxHIcTB1FVMuwoijZ26xex5MQ==", + "dev": true, + "requires": { + "got": "^9.6.0", + "registry-auth-token": "^4.0.0", + "registry-url": "^5.0.0", + "semver": "^6.2.0" + }, + "dependencies": { + "semver": { + "version": "6.3.0", + "resolved": "https://registry.npmjs.org/semver/-/semver-6.3.0.tgz", + "integrity": "sha512-b39TBaTSfV6yBrapU89p5fKekE2m/NwnDocOVruQFS1/veMgdzuPcnOM34M6CwxW8jH/lxEa5rBoDeUwu5HHTw==", + "dev": true + } + } + }, + "parseurl": { + "version": "1.3.3", + "resolved": "https://registry.npmjs.org/parseurl/-/parseurl-1.3.3.tgz", + "integrity": "sha512-CiyeOxFT/JZyN5m0z9PfXw4SCBJ6Sygz1Dpl0wqjlhDEGGBP1GnsUVEL0p63hoG1fcj3fHynXi9NYO4nWOL+qQ==" + }, + "path-is-absolute": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/path-is-absolute/-/path-is-absolute-1.0.1.tgz", + "integrity": "sha1-F0uSaHNVNP+8es5r9TpanhtcX18=" + }, + "path-to-regexp": { + "version": "0.1.7", + "resolved": "https://registry.npmjs.org/path-to-regexp/-/path-to-regexp-0.1.7.tgz", + "integrity": "sha1-32BBeABfUi8V60SQ5yR6G/qmf4w=" + }, + "picomatch": { + "version": "2.3.1", + "resolved": "https://registry.npmjs.org/picomatch/-/picomatch-2.3.1.tgz", + "integrity": "sha512-JU3teHTNjmE2VCGFzuY8EXzCDVwEqB2a8fsIvwaStHhAWJEeVd1o1QD80CU6+ZdEXXSLbSsuLwJjkCBWqRQUVA==", + "dev": true + }, + "prepend-http": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/prepend-http/-/prepend-http-2.0.0.tgz", + "integrity": "sha1-6SQ0v6XqjBn0HN/UAddBo8gZ2Jc=", + "dev": true + }, + "promise-inflight": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/promise-inflight/-/promise-inflight-1.0.1.tgz", + "integrity": "sha1-mEcocL8igTL8vdhoEputEsPAKeM=", + "optional": true + }, + "promise-retry": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/promise-retry/-/promise-retry-2.0.1.tgz", + "integrity": "sha512-y+WKFlBR8BGXnsNlIHFGPZmyDf3DFMoLhaflAnyZgV6rG6xu+JwesTo2Q9R6XwYmtmwAFCkAk3e35jEdoeh/3g==", + "optional": true, + "requires": { + "err-code": "^2.0.2", + "retry": "^0.12.0" + } + }, + "proxy-addr": { + "version": "2.0.7", + "resolved": "https://registry.npmjs.org/proxy-addr/-/proxy-addr-2.0.7.tgz", + "integrity": "sha512-llQsMLSUDUPT44jdrU/O37qlnifitDP+ZwrmmZcoSKyLKvtZxpyV0n2/bD/N4tBAAZ/gJEdZU7KMraoK1+XYAg==", + "requires": { + "forwarded": "0.2.0", + "ipaddr.js": "1.9.1" + } + }, + "pstree.remy": { + "version": "1.1.8", + "resolved": "https://registry.npmjs.org/pstree.remy/-/pstree.remy-1.1.8.tgz", + "integrity": "sha512-77DZwxQmxKnu3aR542U+X8FypNzbfJ+C5XQDk3uWjWxn6151aIMGthWYRXTqT1E5oJvg+ljaa2OJi+VfvCOQ8w==", + "dev": true + }, + "pump": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/pump/-/pump-3.0.0.tgz", + "integrity": "sha512-LwZy+p3SFs1Pytd/jYct4wpv49HiYCqd9Rlc5ZVdk0V+8Yzv6jR5Blk3TRmPL1ft69TxP0IMZGJ+WPFU2BFhww==", + "dev": true, + "requires": { + "end-of-stream": "^1.1.0", + "once": "^1.3.1" + } + }, + "pupa": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/pupa/-/pupa-2.1.1.tgz", + "integrity": "sha512-l1jNAspIBSFqbT+y+5FosojNpVpF94nlI+wDUpqP9enwOTfHx9f0gh5nB96vl+6yTpsJsypeNrwfzPrKuHB41A==", + "dev": true, + "requires": { + "escape-goat": "^2.0.0" + } + }, + "qs": { + "version": "6.10.3", + "resolved": "https://registry.npmjs.org/qs/-/qs-6.10.3.tgz", + "integrity": "sha512-wr7M2E0OFRfIfJZjKGieI8lBKb7fRCH4Fv5KNPEs7gJ8jadvotdsS08PzOKR7opXhZ/Xkjtt3WF9g38drmyRqQ==", + "requires": { + "side-channel": "^1.0.4" + } + }, + "range-parser": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/range-parser/-/range-parser-1.2.1.tgz", + "integrity": "sha512-Hrgsx+orqoygnmhFbKaHE6c296J+HTAQXoxEF6gNupROmmGJRoyzfG3ccAveqCBrwr/2yxQ5BVd/GTl5agOwSg==" + }, + "raw-body": { + "version": "2.5.1", + "resolved": "https://registry.npmjs.org/raw-body/-/raw-body-2.5.1.tgz", + "integrity": "sha512-qqJBtEyVgS0ZmPGdCFPWJ3FreoqvG4MVQln/kCgF7Olq95IbOp0/BWyMwbdtn4VTvkM8Y7khCQ2Xgk/tcrCXig==", + "requires": { + "bytes": "3.1.2", + "http-errors": "2.0.0", + "iconv-lite": "0.4.24", + "unpipe": "1.0.0" + } + }, + "rc": { + "version": "1.2.8", + "resolved": "https://registry.npmjs.org/rc/-/rc-1.2.8.tgz", + "integrity": "sha512-y3bGgqKj3QBdxLbLkomlohkvsA8gdAiUQlSBJnBhfn+BPxg4bc62d8TcBW15wavDfgexCgccckhcZvywyQYPOw==", + "dev": true, + "requires": { + "deep-extend": "^0.6.0", + "ini": "~1.3.0", + "minimist": "^1.2.0", + "strip-json-comments": "~2.0.1" + }, + "dependencies": { + "ini": { + "version": "1.3.8", + "resolved": "https://registry.npmjs.org/ini/-/ini-1.3.8.tgz", + "integrity": "sha512-JV/yugV2uzW5iMRSiZAyDtQd+nxtUnjeLt0acNdw98kKLrvuRVyB80tsREOE7yvGVgalhZ6RNXCmEHkUKBKxew==", + "dev": true + } + } + }, + "readable-stream": { + "version": "3.6.0", + "resolved": "https://registry.npmjs.org/readable-stream/-/readable-stream-3.6.0.tgz", + "integrity": "sha512-BViHy7LKeTz4oNnkcLJ+lVSL6vpiFeX6/d3oSH8zCW7UxP2onchk+vTGB143xuFjHS3deTgkKoXXymXqymiIdA==", + "requires": { + "inherits": "^2.0.3", + "string_decoder": "^1.1.1", + "util-deprecate": "^1.0.1" + } + }, + "readdirp": { + "version": "3.6.0", + "resolved": "https://registry.npmjs.org/readdirp/-/readdirp-3.6.0.tgz", + "integrity": "sha512-hOS089on8RduqdbhvQ5Z37A0ESjsqz6qnRcffsMU3495FuTdqSm+7bhJ29JvIOsBDEEnan5DPu9t3To9VRlMzA==", + "dev": true, + "requires": { + "picomatch": "^2.2.1" + } + }, + "registry-auth-token": { + "version": "4.2.1", + "resolved": "https://registry.npmjs.org/registry-auth-token/-/registry-auth-token-4.2.1.tgz", + "integrity": "sha512-6gkSb4U6aWJB4SF2ZvLb76yCBjcvufXBqvvEx1HbmKPkutswjW1xNVRY0+daljIYRbogN7O0etYSlbiaEQyMyw==", + "dev": true, + "requires": { + "rc": "^1.2.8" + } + }, + "registry-url": { + "version": "5.1.0", + "resolved": "https://registry.npmjs.org/registry-url/-/registry-url-5.1.0.tgz", + "integrity": "sha512-8acYXXTI0AkQv6RAOjE3vOaIXZkT9wo4LOFbBKYQEEnnMNBpKqdUrI6S4NT0KPIo/WVvJ5tE/X5LF/TQUf0ekw==", + "dev": true, + "requires": { + "rc": "^1.2.8" + } + }, + "responselike": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/responselike/-/responselike-1.0.2.tgz", + "integrity": "sha1-kYcg7ztjHFZCvgaPFa3lpG9Loec=", + "dev": true, + "requires": { + "lowercase-keys": "^1.0.0" + } + }, + "retry": { + "version": "0.12.0", + "resolved": "https://registry.npmjs.org/retry/-/retry-0.12.0.tgz", + "integrity": "sha1-G0KmJmoh8HQh0bC1S33BZ7AcATs=", + "optional": true + }, + "rimraf": { + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-3.0.2.tgz", + "integrity": "sha512-JZkJMZkAGFFPP2YqXZXPbMlMBgsxzE8ILs4lMIX/2o0L9UBw9O/Y3o6wFw/i9YLapcUJWwqbi3kdxIPdC62TIA==", + "requires": { + "glob": "^7.1.3" + } + }, + "safe-buffer": { + "version": "5.2.1", + "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.2.1.tgz", + "integrity": "sha512-rp3So07KcdmmKbGvgaNxQSJr7bGVSVk5S9Eq1F+ppbRo70+YeaDxkw5Dd8NPN+GD6bjnYm2VuPuCXmpuYvmCXQ==" + }, + "safer-buffer": { + "version": "2.1.2", + "resolved": "https://registry.npmjs.org/safer-buffer/-/safer-buffer-2.1.2.tgz", + "integrity": "sha512-YZo3K82SD7Riyi0E1EQPojLz7kpepnSQI9IyPbHHg1XXXevb5dJI7tpyN2ADxGcQbHG7vcyRHk0cbwqcQriUtg==" + }, + "semver": { + "version": "7.3.7", + "resolved": "https://registry.npmjs.org/semver/-/semver-7.3.7.tgz", + "integrity": "sha512-QlYTucUYOews+WeEujDoEGziz4K6c47V/Bd+LjSSYcA94p+DmINdf7ncaUinThfvZyu13lN9OY1XDxt8C0Tw0g==", + "requires": { + "lru-cache": "^6.0.0" + } + }, + "semver-diff": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/semver-diff/-/semver-diff-3.1.1.tgz", + "integrity": "sha512-GX0Ix/CJcHyB8c4ykpHGIAvLyOwOobtM/8d+TQkAd81/bEjgPHrfba41Vpesr7jX/t8Uh+R3EX9eAS5be+jQYg==", + "dev": true, + "requires": { + "semver": "^6.3.0" + }, + "dependencies": { + "semver": { + "version": "6.3.0", + "resolved": "https://registry.npmjs.org/semver/-/semver-6.3.0.tgz", + "integrity": "sha512-b39TBaTSfV6yBrapU89p5fKekE2m/NwnDocOVruQFS1/veMgdzuPcnOM34M6CwxW8jH/lxEa5rBoDeUwu5HHTw==", + "dev": true + } + } + }, + "send": { + "version": "0.18.0", + "resolved": "https://registry.npmjs.org/send/-/send-0.18.0.tgz", + "integrity": "sha512-qqWzuOjSFOuqPjFe4NOsMLafToQQwBSOEpS+FwEt3A2V3vKubTquT3vmLTQpFgMXp8AlFWFuP1qKaJZOtPpVXg==", + "requires": { + "debug": "2.6.9", + "depd": "2.0.0", + "destroy": "1.2.0", + "encodeurl": "~1.0.2", + "escape-html": "~1.0.3", + "etag": "~1.8.1", + "fresh": "0.5.2", + "http-errors": "2.0.0", + "mime": "1.6.0", + "ms": "2.1.3", + "on-finished": "2.4.1", + "range-parser": "~1.2.1", + "statuses": "2.0.1" + }, + "dependencies": { + "ms": { + "version": "2.1.3", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.3.tgz", + "integrity": "sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA==" + } + } + }, + "serve-static": { + "version": "1.15.0", + "resolved": "https://registry.npmjs.org/serve-static/-/serve-static-1.15.0.tgz", + "integrity": "sha512-XGuRDNjXUijsUL0vl6nSD7cwURuzEgglbOaFuZM9g3kwDXOWVTck0jLzjPzGD+TazWbboZYu52/9/XPdUgne9g==", + "requires": { + "encodeurl": "~1.0.2", + "escape-html": "~1.0.3", + "parseurl": "~1.3.3", + "send": "0.18.0" + } + }, + "set-blocking": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/set-blocking/-/set-blocking-2.0.0.tgz", + "integrity": "sha1-BF+XgtARrppoA93TgrJDkrPYkPc=" + }, + "setprototypeof": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/setprototypeof/-/setprototypeof-1.2.0.tgz", + "integrity": "sha512-E5LDX7Wrp85Kil5bhZv46j8jOeboKq5JMmYM3gVGdGH8xFpPWXUMsNrlODCrkoxMEeNi/XZIwuRvY4XNwYMJpw==" + }, + "side-channel": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/side-channel/-/side-channel-1.0.4.tgz", + "integrity": "sha512-q5XPytqFEIKHkGdiMIrY10mvLRvnQh42/+GoBlFW3b2LXLE2xxJpZFdm94we0BaoV3RwJyGqg5wS7epxTv0Zvw==", + "requires": { + "call-bind": "^1.0.0", + "get-intrinsic": "^1.0.2", + "object-inspect": "^1.9.0" + } + }, + "signal-exit": { + "version": "3.0.7", + "resolved": "https://registry.npmjs.org/signal-exit/-/signal-exit-3.0.7.tgz", + "integrity": "sha512-wnD2ZE+l+SPC/uoS0vXeE9L1+0wuaMqKlfz9AMUo38JsyLSBWSFcHR1Rri62LZc12vLr1gb3jl7iwQhgwpAbGQ==" + }, + "smart-buffer": { + "version": "4.2.0", + "resolved": "https://registry.npmjs.org/smart-buffer/-/smart-buffer-4.2.0.tgz", + "integrity": "sha512-94hK0Hh8rPqQl2xXc3HsaBoOXKV20MToPkcXvwbISWLEs+64sBq5kFgn2kJDHb1Pry9yrP0dxrCI9RRci7RXKg==", + "optional": true + }, + "socks": { + "version": "2.6.2", + "resolved": "https://registry.npmjs.org/socks/-/socks-2.6.2.tgz", + "integrity": "sha512-zDZhHhZRY9PxRruRMR7kMhnf3I8hDs4S3f9RecfnGxvcBHQcKcIH/oUcEWffsfl1XxdYlA7nnlGbbTvPz9D8gA==", + "optional": true, + "requires": { + "ip": "^1.1.5", + "smart-buffer": "^4.2.0" + } + }, + "socks-proxy-agent": { + "version": "6.2.0", + "resolved": "https://registry.npmjs.org/socks-proxy-agent/-/socks-proxy-agent-6.2.0.tgz", + "integrity": "sha512-wWqJhjb32Q6GsrUqzuFkukxb/zzide5quXYcMVpIjxalDBBYy2nqKCFQ/9+Ie4dvOYSQdOk3hUlZSdzZOd3zMQ==", + "optional": true, + "requires": { + "agent-base": "^6.0.2", + "debug": "^4.3.3", + "socks": "^2.6.2" + }, + "dependencies": { + "debug": { + "version": "4.3.4", + "resolved": "https://registry.npmjs.org/debug/-/debug-4.3.4.tgz", + "integrity": "sha512-PRWFHuSU3eDtQJPvnNY7Jcket1j0t5OuOsFzPPzsekD52Zl8qUfFIPEiswXqIvHWGVHOgX+7G/vCNNhehwxfkQ==", + "optional": true, + "requires": { + "ms": "2.1.2" + } + }, + "ms": { + "version": "2.1.2", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.2.tgz", + "integrity": "sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==", + "optional": true + } + } + }, + "sqlite3": { + "version": "5.0.6", + "resolved": "https://registry.npmjs.org/sqlite3/-/sqlite3-5.0.6.tgz", + "integrity": "sha512-uT1dC6N3ReF+jchY01zvl1wVFFJ5xO86wSnCpK39uA/zmAHBDm6TiAq1v876QKv8JgiijxQ7/fb5C2LPm7ZAJA==", + "requires": { + "@mapbox/node-pre-gyp": "^1.0.0", + "node-addon-api": "^4.2.0", + "node-gyp": "8.x", + "tar": "^6.1.11" + } + }, + "ssri": { + "version": "8.0.1", + "resolved": "https://registry.npmjs.org/ssri/-/ssri-8.0.1.tgz", + "integrity": "sha512-97qShzy1AiyxvPNIkLWoGua7xoQzzPjQ0HAH4B0rWKo7SZ6USuPcrUiAFrws0UH8RrbWmgq3LMTObhPIHbbBeQ==", + "optional": true, + "requires": { + "minipass": "^3.1.1" + } + }, + "statuses": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/statuses/-/statuses-2.0.1.tgz", + "integrity": "sha512-RwNA9Z/7PrK06rYLIzFMlaF+l73iwpzsqRIFgbMLbTcLD6cOao82TaWefPXQvB2fOC4AjuYSEndS7N/mTCbkdQ==" + }, + "string-width": { + "version": "4.2.3", + "resolved": "https://registry.npmjs.org/string-width/-/string-width-4.2.3.tgz", + "integrity": "sha512-wKyQRQpjJ0sIp62ErSZdGsjMJWsap5oRNihHhu6G7JVO/9jIB6UyevL+tXuOqrng8j/cxKTWyWUwvSTriiZz/g==", + "requires": { + "emoji-regex": "^8.0.0", + "is-fullwidth-code-point": "^3.0.0", + "strip-ansi": "^6.0.1" + } + }, + "string_decoder": { + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/string_decoder/-/string_decoder-1.3.0.tgz", + "integrity": "sha512-hkRX8U1WjJFd8LsDJ2yQ/wWWxaopEsABU1XfkM8A+j0+85JAGppt16cr1Whg6KIbb4okU6Mql6BOj+uup/wKeA==", + "requires": { + "safe-buffer": "~5.2.0" + } + }, + "strip-ansi": { + "version": "6.0.1", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-6.0.1.tgz", + "integrity": "sha512-Y38VPSHcqkFrCpFnQ9vuSXmquuv5oXOKpGeT6aGrr3o3Gc9AlVa6JBfUSOCnbxGGZF+/0ooI7KrPuUSztUdU5A==", + "requires": { + "ansi-regex": "^5.0.1" + } + }, + "strip-json-comments": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/strip-json-comments/-/strip-json-comments-2.0.1.tgz", + "integrity": "sha1-PFMZQukIwml8DsNEhYwobHygpgo=", + "dev": true + }, + "supports-color": { + "version": "5.5.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz", + "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", + "dev": true, + "requires": { + "has-flag": "^3.0.0" + } + }, + "tar": { + "version": "6.1.11", + "resolved": "https://registry.npmjs.org/tar/-/tar-6.1.11.tgz", + "integrity": "sha512-an/KZQzQUkZCkuoAA64hM92X0Urb6VpRhAFllDzz44U2mcD5scmT3zBc4VgVpkugF580+DQn8eAFSyoQt0tznA==", + "requires": { + "chownr": "^2.0.0", + "fs-minipass": "^2.0.0", + "minipass": "^3.0.0", + "minizlib": "^2.1.1", + "mkdirp": "^1.0.3", + "yallist": "^4.0.0" + } + }, + "to-readable-stream": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/to-readable-stream/-/to-readable-stream-1.0.0.tgz", + "integrity": "sha512-Iq25XBt6zD5npPhlLVXGFN3/gyR2/qODcKNNyTMd4vbm39HUaOiAM4PMq0eMVC/Tkxz+Zjdsc55g9yyz+Yq00Q==", + "dev": true + }, + "to-regex-range": { + "version": "5.0.1", + "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-5.0.1.tgz", + "integrity": "sha512-65P7iz6X5yEr1cwcgvQxbbIw7Uk3gOy5dIdtZ4rDveLqhrdJP+Li/Hx6tyK0NEb+2GCyneCMJiGqrADCSNk8sQ==", + "dev": true, + "requires": { + "is-number": "^7.0.0" + } + }, + "toidentifier": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/toidentifier/-/toidentifier-1.0.1.tgz", + "integrity": "sha512-o5sSPKEkg/DIQNmH43V0/uerLrpzVedkUh8tGNvaeXpfpuwjKenlSox/2O/BTlZUtEe+JG7s5YhEz608PlAHRA==" + }, + "touch": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/touch/-/touch-3.1.0.tgz", + "integrity": "sha512-WBx8Uy5TLtOSRtIq+M03/sKDrXCLHxwDcquSP2c43Le03/9serjQBIztjRz6FkJez9D/hleyAXTBGLwwZUw9lA==", + "dev": true, + "requires": { + "nopt": "~1.0.10" + }, + "dependencies": { + "nopt": { + "version": "1.0.10", + "resolved": "https://registry.npmjs.org/nopt/-/nopt-1.0.10.tgz", + "integrity": "sha1-bd0hvSoxQXuScn3Vhfim83YI6+4=", + "dev": true, + "requires": { + "abbrev": "1" + } + } + } + }, + "tr46": { + "version": "0.0.3", + "resolved": "https://registry.npmjs.org/tr46/-/tr46-0.0.3.tgz", + "integrity": "sha1-gYT9NH2snNwYWZLzpmIuFLnZq2o=" + }, + "type-fest": { + "version": "0.20.2", + "resolved": "https://registry.npmjs.org/type-fest/-/type-fest-0.20.2.tgz", + "integrity": "sha512-Ne+eE4r0/iWnpAxD852z3A+N0Bt5RN//NjJwRd2VFHEmrywxf5vsZlh4R6lixl6B+wz/8d+maTSAkN1FIkI3LQ==", + "dev": true + }, + "type-is": { + "version": "1.6.18", + "resolved": "https://registry.npmjs.org/type-is/-/type-is-1.6.18.tgz", + "integrity": "sha512-TkRKr9sUTxEH8MdfuCSP7VizJyzRNMjj2J2do2Jr3Kym598JVdEksuzPQCnlFPW4ky9Q+iA+ma9BGm06XQBy8g==", + "requires": { + "media-typer": "0.3.0", + "mime-types": "~2.1.24" + } + }, + "typedarray-to-buffer": { + "version": "3.1.5", + "resolved": "https://registry.npmjs.org/typedarray-to-buffer/-/typedarray-to-buffer-3.1.5.tgz", + "integrity": "sha512-zdu8XMNEDepKKR+XYOXAVPtWui0ly0NtohUscw+UmaHiAWT8hrV1rr//H6V+0DvJ3OQ19S979M0laLfX8rm82Q==", + "dev": true, + "requires": { + "is-typedarray": "^1.0.0" + } + }, + "undefsafe": { + "version": "2.0.5", + "resolved": "https://registry.npmjs.org/undefsafe/-/undefsafe-2.0.5.tgz", + "integrity": "sha512-WxONCrssBM8TSPRqN5EmsjVrsv4A8X12J4ArBiiayv3DyyG3ZlIg6yysuuSYdZsVz3TKcTg2fd//Ujd4CHV1iA==", + "dev": true + }, + "unique-filename": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/unique-filename/-/unique-filename-1.1.1.tgz", + "integrity": "sha512-Vmp0jIp2ln35UTXuryvjzkjGdRyf9b2lTXuSYUiPmzRcl3FDtYqAwOnTJkAngD9SWhnoJzDbTKwaOrZ+STtxNQ==", + "optional": true, + "requires": { + "unique-slug": "^2.0.0" + } + }, + "unique-slug": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/unique-slug/-/unique-slug-2.0.2.tgz", + "integrity": "sha512-zoWr9ObaxALD3DOPfjPSqxt4fnZiWblxHIgeWqW8x7UqDzEtHEQLzji2cuJYQFCU6KmoJikOYAZlrTHHebjx2w==", + "optional": true, + "requires": { + "imurmurhash": "^0.1.4" + } + }, + "unique-string": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/unique-string/-/unique-string-2.0.0.tgz", + "integrity": "sha512-uNaeirEPvpZWSgzwsPGtU2zVSTrn/8L5q/IexZmH0eH6SA73CmAA5U4GwORTxQAZs95TAXLNqeLoPPNO5gZfWg==", + "dev": true, + "requires": { + "crypto-random-string": "^2.0.0" + } + }, + "unpipe": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/unpipe/-/unpipe-1.0.0.tgz", + "integrity": "sha1-sr9O6FFKrmFltIF4KdIbLvSZBOw=" + }, + "update-notifier": { + "version": "5.1.0", + "resolved": "https://registry.npmjs.org/update-notifier/-/update-notifier-5.1.0.tgz", + "integrity": "sha512-ItnICHbeMh9GqUy31hFPrD1kcuZ3rpxDZbf4KUDavXwS0bW5m7SLbDQpGX3UYr072cbrF5hFUs3r5tUsPwjfHw==", + "dev": true, + "requires": { + "boxen": "^5.0.0", + "chalk": "^4.1.0", + "configstore": "^5.0.1", + "has-yarn": "^2.1.0", + "import-lazy": "^2.1.0", + "is-ci": "^2.0.0", + "is-installed-globally": "^0.4.0", + "is-npm": "^5.0.0", + "is-yarn-global": "^0.3.0", + "latest-version": "^5.1.0", + "pupa": "^2.1.1", + "semver": "^7.3.4", + "semver-diff": "^3.1.1", + "xdg-basedir": "^4.0.0" + } + }, + "url-parse-lax": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/url-parse-lax/-/url-parse-lax-3.0.0.tgz", + "integrity": "sha1-FrXK/Afb42dsGxmZF3gj1lA6yww=", + "dev": true, + "requires": { + "prepend-http": "^2.0.0" + } + }, + "util-deprecate": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/util-deprecate/-/util-deprecate-1.0.2.tgz", + "integrity": "sha1-RQ1Nyfpw3nMnYvvS1KKJgUGaDM8=" + }, + "utils-merge": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/utils-merge/-/utils-merge-1.0.1.tgz", + "integrity": "sha1-n5VxD1CiZ5R7LMwSR0HBAoQn5xM=" + }, + "vary": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/vary/-/vary-1.1.2.tgz", + "integrity": "sha1-IpnwLG3tMNSllhsLn3RSShj2NPw=" + }, + "webidl-conversions": { + "version": "3.0.1", + "resolved": "https://registry.npmjs.org/webidl-conversions/-/webidl-conversions-3.0.1.tgz", + "integrity": "sha1-JFNCdeKnvGvnvIZhHMFq4KVlSHE=" + }, + "whatwg-url": { + "version": "5.0.0", + "resolved": "https://registry.npmjs.org/whatwg-url/-/whatwg-url-5.0.0.tgz", + "integrity": "sha1-lmRU6HZUYuN2RNNib2dCzotwll0=", + "requires": { + "tr46": "~0.0.3", + "webidl-conversions": "^3.0.0" + } + }, + "which": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/which/-/which-2.0.2.tgz", + "integrity": "sha512-BLI3Tl1TW3Pvl70l3yq3Y64i+awpwXqsGBYWkkqMtnbXgrMD+yj7rhW0kuEDxzJaYXGjEW5ogapKNMEKNMjibA==", + "optional": true, + "requires": { + "isexe": "^2.0.0" + } + }, + "wide-align": { + "version": "1.1.5", + "resolved": "https://registry.npmjs.org/wide-align/-/wide-align-1.1.5.tgz", + "integrity": "sha512-eDMORYaPNZ4sQIuuYPDHdQvf4gyCF9rEEV/yPxGfwPkRodwEgiMUUXTx/dex+Me0wxx53S+NgUHaP7y3MGlDmg==", + "requires": { + "string-width": "^1.0.2 || 2 || 3 || 4" + } + }, + "widest-line": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/widest-line/-/widest-line-3.1.0.tgz", + "integrity": "sha512-NsmoXalsWVDMGupxZ5R08ka9flZjjiLvHVAWYOKtiKM8ujtZWr9cRffak+uSE48+Ob8ObalXpwyeUiyDD6QFgg==", + "dev": true, + "requires": { + "string-width": "^4.0.0" + } + }, + "wrap-ansi": { + "version": "7.0.0", + "resolved": "https://registry.npmjs.org/wrap-ansi/-/wrap-ansi-7.0.0.tgz", + "integrity": "sha512-YVGIj2kamLSTxw6NsZjoBxfSwsn0ycdesmc4p+Q21c5zPuZ1pl+NfxVdxPtdHvmNVOQ6XSYG4AUtyt/Fi7D16Q==", + "dev": true, + "requires": { + "ansi-styles": "^4.0.0", + "string-width": "^4.1.0", + "strip-ansi": "^6.0.0" + } + }, + "wrappy": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/wrappy/-/wrappy-1.0.2.tgz", + "integrity": "sha1-tSQ9jz7BqjXxNkYFvA0QNuMKtp8=" + }, + "write-file-atomic": { + "version": "3.0.3", + "resolved": "https://registry.npmjs.org/write-file-atomic/-/write-file-atomic-3.0.3.tgz", + "integrity": "sha512-AvHcyZ5JnSfq3ioSyjrBkH9yW4m7Ayk8/9My/DD9onKeu/94fwrMocemO2QAJFAlnnDN+ZDS+ZjAR5ua1/PV/Q==", + "dev": true, + "requires": { + "imurmurhash": "^0.1.4", + "is-typedarray": "^1.0.0", + "signal-exit": "^3.0.2", + "typedarray-to-buffer": "^3.1.5" + } + }, + "xdg-basedir": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/xdg-basedir/-/xdg-basedir-4.0.0.tgz", + "integrity": "sha512-PSNhEJDejZYV7h50BohL09Er9VaIefr2LMAf3OEmpCkjOi34eYyQYAXUTjEQtZJTKcF0E2UKTh+osDLsgNim9Q==", + "dev": true + }, + "yallist": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/yallist/-/yallist-4.0.0.tgz", + "integrity": "sha512-3wdGidZyq5PB084XLES5TpOSRA3wjXAlIWMhum2kRcv/41Sn2emQ0dycQW4uZXLejwKvg6EsvbdlVL+FYEct7A==" + } + } +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/package.json b/25_03_11/frontend_vizsgafeladat/backend/package.json new file mode 100644 index 00000000..02af0832 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/backend/package.json @@ -0,0 +1,20 @@ +{ + "name": "webshop", + "version": "1.0.0", + "description": "", + "main": "index.js", + "scripts": { + "start": "nodemon index.js" + }, + "keywords": [], + "author": "", + "license": "ISC", + "dependencies": { + "cors": "^2.8.5", + "express": "^4.18.1", + "sqlite3": "^5.0.6" + }, + "devDependencies": { + "nodemon": "^2.0.16" + } +} diff --git a/25_03_11/frontend_vizsgafeladat/backend/webshop.db b/25_03_11/frontend_vizsgafeladat/backend/webshop.db new file mode 100644 index 00000000..ce7d3679 Binary files /dev/null and b/25_03_11/frontend_vizsgafeladat/backend/webshop.db differ diff --git a/25_03_11/frontend_vizsgafeladat/frontend/.eslintrc.cjs b/25_03_11/frontend_vizsgafeladat/frontend/.eslintrc.cjs new file mode 100644 index 00000000..3e212e1d --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/frontend/.eslintrc.cjs @@ -0,0 +1,21 @@ +module.exports = { + root: true, + env: { browser: true, es2020: true }, + extends: [ + 'eslint:recommended', + 'plugin:react/recommended', + 'plugin:react/jsx-runtime', + 'plugin:react-hooks/recommended', + ], + ignorePatterns: ['dist', '.eslintrc.cjs'], + parserOptions: { ecmaVersion: 'latest', sourceType: 'module' }, + settings: { react: { version: '18.2' } }, + plugins: ['react-refresh'], + rules: { + 'react/jsx-no-target-blank': 'off', + 'react-refresh/only-export-components': [ + 'warn', + { allowConstantExport: true }, + ], + }, +} diff --git a/25_03_11/frontend_vizsgafeladat/frontend/.gitignore b/25_03_11/frontend_vizsgafeladat/frontend/.gitignore new file mode 100644 index 00000000..a547bf36 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/frontend/.gitignore @@ -0,0 +1,24 @@ +# Logs +logs +*.log +npm-debug.log* +yarn-debug.log* +yarn-error.log* +pnpm-debug.log* +lerna-debug.log* + +node_modules +dist +dist-ssr +*.local + +# Editor directories and files +.vscode/* +!.vscode/extensions.json +.idea +.DS_Store +*.suo +*.ntvs* +*.njsproj +*.sln +*.sw? diff --git a/25_03_11/frontend_vizsgafeladat/frontend/README.md b/25_03_11/frontend_vizsgafeladat/frontend/README.md new file mode 100644 index 00000000..f768e33f --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/frontend/README.md @@ -0,0 +1,8 @@ +# React + Vite + +This template provides a minimal setup to get React working in Vite with HMR and some ESLint rules. + +Currently, two official plugins are available: + +- [@vitejs/plugin-react](https://github.com/vitejs/vite-plugin-react/blob/main/packages/plugin-react/README.md) uses [Babel](https://babeljs.io/) for Fast Refresh +- [@vitejs/plugin-react-swc](https://github.com/vitejs/vite-plugin-react-swc) uses [SWC](https://swc.rs/) for Fast Refresh diff --git a/25_03_11/frontend_vizsgafeladat/frontend/index.html b/25_03_11/frontend_vizsgafeladat/frontend/index.html new file mode 100644 index 00000000..ea937b6d --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/frontend/index.html @@ -0,0 +1,13 @@ + + + + + + + Frontend vizsgafeladat + + +
+ + + diff --git a/25_03_11/frontend_vizsgafeladat/frontend/mintak/adattablak.png b/25_03_11/frontend_vizsgafeladat/frontend/mintak/adattablak.png new file mode 100644 index 00000000..f12c51b5 Binary files /dev/null and b/25_03_11/frontend_vizsgafeladat/frontend/mintak/adattablak.png differ diff --git a/25_03_11/frontend_vizsgafeladat/frontend/mintak/fooldal_minta.png b/25_03_11/frontend_vizsgafeladat/frontend/mintak/fooldal_minta.png new file mode 100644 index 00000000..95438832 Binary files /dev/null and b/25_03_11/frontend_vizsgafeladat/frontend/mintak/fooldal_minta.png differ diff --git a/25_03_11/frontend_vizsgafeladat/frontend/mintak/termekek_minta.png b/25_03_11/frontend_vizsgafeladat/frontend/mintak/termekek_minta.png new file mode 100644 index 00000000..85e19439 Binary files /dev/null and b/25_03_11/frontend_vizsgafeladat/frontend/mintak/termekek_minta.png differ diff --git a/25_03_11/frontend_vizsgafeladat/frontend/mintak/ujtermek_minta.png b/25_03_11/frontend_vizsgafeladat/frontend/mintak/ujtermek_minta.png new file mode 100644 index 00000000..fffc231c Binary files /dev/null and b/25_03_11/frontend_vizsgafeladat/frontend/mintak/ujtermek_minta.png differ diff --git a/25_03_11/frontend_vizsgafeladat/frontend/package-lock.json b/25_03_11/frontend_vizsgafeladat/frontend/package-lock.json new file mode 100644 index 00000000..5534e35f --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/frontend/package-lock.json @@ -0,0 +1,5428 @@ +{ + "name": "frontend", + "version": "0.0.0", + "lockfileVersion": 3, + "requires": true, + "packages": { + "": { + "name": "frontend", + "version": "0.0.0", + "dependencies": { + "daisyui": "^4.10.2", + "react": "^18.2.0", + "react-dom": "^18.2.0", + "react-router-dom": "^6.22.3" + }, + "devDependencies": { + "@types/react": "^18.2.66", + "@types/react-dom": "^18.2.22", + "@vitejs/plugin-react": "^4.2.1", + "autoprefixer": "^10.4.19", + "eslint": "^8.57.0", + "eslint-plugin-react": "^7.34.1", + "eslint-plugin-react-hooks": "^4.6.0", + "eslint-plugin-react-refresh": "^0.4.6", + "postcss": "^8.4.38", + "tailwindcss": "^3.4.3", + "vite": "^5.2.0" + } + }, + "node_modules/@aashutoshrathi/word-wrap": { + "version": "1.2.6", + "resolved": "https://registry.npmjs.org/@aashutoshrathi/word-wrap/-/word-wrap-1.2.6.tgz", + "integrity": "sha512-1Yjs2SvM8TflER/OD3cOjhWWOZb58A2t7wpE2S9XfBYTiIl+XFhQG2bjy4Pu1I+EAlCNUzRDYDdFwFYUKvXcIA==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/@alloc/quick-lru": { + "version": "5.2.0", + "resolved": "https://registry.npmjs.org/@alloc/quick-lru/-/quick-lru-5.2.0.tgz", + "integrity": "sha512-UrcABB+4bUrFABwbluTIBErXwvbsU/V7TZWfmbgJfbkwiBuziS9gxdODUyuiecfdGQ85jglMW6juS3+z5TsKLw==", + "dev": true, + "engines": { + "node": ">=10" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/@ampproject/remapping": { + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/@ampproject/remapping/-/remapping-2.3.0.tgz", + "integrity": "sha512-30iZtAPgz+LTIYoeivqYo853f02jBYSd5uGnGpkFV0M3xOt9aN73erkgYAmZU43x4VfqcnLxW9Kpg3R5LC4YYw==", + "dev": true, + "dependencies": { + "@jridgewell/gen-mapping": "^0.3.5", + "@jridgewell/trace-mapping": "^0.3.24" + }, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/@babel/code-frame": { + "version": "7.24.2", + "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.24.2.tgz", + "integrity": "sha512-y5+tLQyV8pg3fsiln67BVLD1P13Eg4lh5RW9mF0zUuvLrv9uIQ4MCL+CRT+FTsBlBjcIan6PGsLcBN0m3ClUyQ==", + "dev": true, + "dependencies": { + "@babel/highlight": "^7.24.2", + "picocolors": "^1.0.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/compat-data": { + "version": "7.24.4", + "resolved": "https://registry.npmjs.org/@babel/compat-data/-/compat-data-7.24.4.tgz", + "integrity": "sha512-vg8Gih2MLK+kOkHJp4gBEIkyaIi00jgWot2D9QOmmfLC8jINSOzmCLta6Bvz/JSBCqnegV0L80jhxkol5GWNfQ==", + "dev": true, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/core": { + "version": "7.24.4", + "resolved": "https://registry.npmjs.org/@babel/core/-/core-7.24.4.tgz", + "integrity": "sha512-MBVlMXP+kkl5394RBLSxxk/iLTeVGuXTV3cIDXavPpMMqnSnt6apKgan/U8O3USWZCWZT/TbgfEpKa4uMgN4Dg==", + "dev": true, + "dependencies": { + "@ampproject/remapping": "^2.2.0", + "@babel/code-frame": "^7.24.2", + "@babel/generator": "^7.24.4", + "@babel/helper-compilation-targets": "^7.23.6", + "@babel/helper-module-transforms": "^7.23.3", + "@babel/helpers": "^7.24.4", + "@babel/parser": "^7.24.4", + "@babel/template": "^7.24.0", + "@babel/traverse": "^7.24.1", + "@babel/types": "^7.24.0", + "convert-source-map": "^2.0.0", + "debug": "^4.1.0", + "gensync": "^1.0.0-beta.2", + "json5": "^2.2.3", + "semver": "^6.3.1" + }, + "engines": { + "node": ">=6.9.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/babel" + } + }, + "node_modules/@babel/generator": { + "version": "7.24.4", + "resolved": "https://registry.npmjs.org/@babel/generator/-/generator-7.24.4.tgz", + "integrity": "sha512-Xd6+v6SnjWVx/nus+y0l1sxMOTOMBkyL4+BIdbALyatQnAe/SRVjANeDPSCYaX+i1iJmuGSKf3Z+E+V/va1Hvw==", + "dev": true, + "dependencies": { + "@babel/types": "^7.24.0", + "@jridgewell/gen-mapping": "^0.3.5", + "@jridgewell/trace-mapping": "^0.3.25", + "jsesc": "^2.5.1" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helper-compilation-targets": { + "version": "7.23.6", + "resolved": "https://registry.npmjs.org/@babel/helper-compilation-targets/-/helper-compilation-targets-7.23.6.tgz", + "integrity": "sha512-9JB548GZoQVmzrFgp8o7KxdgkTGm6xs9DW0o/Pim72UDjzr5ObUQ6ZzYPqA+g9OTS2bBQoctLJrky0RDCAWRgQ==", + "dev": true, + "dependencies": { + "@babel/compat-data": "^7.23.5", + "@babel/helper-validator-option": "^7.23.5", + "browserslist": "^4.22.2", + "lru-cache": "^5.1.1", + "semver": "^6.3.1" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helper-environment-visitor": { + "version": "7.22.20", + "resolved": "https://registry.npmjs.org/@babel/helper-environment-visitor/-/helper-environment-visitor-7.22.20.tgz", + "integrity": "sha512-zfedSIzFhat/gFhWfHtgWvlec0nqB9YEIVrpuwjruLlXfUSnA8cJB0miHKwqDnQ7d32aKo2xt88/xZptwxbfhA==", + "dev": true, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helper-function-name": { + "version": "7.23.0", + "resolved": "https://registry.npmjs.org/@babel/helper-function-name/-/helper-function-name-7.23.0.tgz", + "integrity": "sha512-OErEqsrxjZTJciZ4Oo+eoZqeW9UIiOcuYKRJA4ZAgV9myA+pOXhhmpfNCKjEH/auVfEYVFJ6y1Tc4r0eIApqiw==", + "dev": true, + "dependencies": { + "@babel/template": "^7.22.15", + "@babel/types": "^7.23.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helper-hoist-variables": { + "version": "7.22.5", + "resolved": "https://registry.npmjs.org/@babel/helper-hoist-variables/-/helper-hoist-variables-7.22.5.tgz", + "integrity": "sha512-wGjk9QZVzvknA6yKIUURb8zY3grXCcOZt+/7Wcy8O2uctxhplmUPkOdlgoNhmdVee2c92JXbf1xpMtVNbfoxRw==", + "dev": true, + "dependencies": { + "@babel/types": "^7.22.5" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helper-module-imports": { + "version": "7.24.3", + "resolved": "https://registry.npmjs.org/@babel/helper-module-imports/-/helper-module-imports-7.24.3.tgz", + "integrity": "sha512-viKb0F9f2s0BCS22QSF308z/+1YWKV/76mwt61NBzS5izMzDPwdq1pTrzf+Li3npBWX9KdQbkeCt1jSAM7lZqg==", + "dev": true, + "dependencies": { + "@babel/types": "^7.24.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helper-module-transforms": { + "version": "7.23.3", + "resolved": "https://registry.npmjs.org/@babel/helper-module-transforms/-/helper-module-transforms-7.23.3.tgz", + "integrity": "sha512-7bBs4ED9OmswdfDzpz4MpWgSrV7FXlc3zIagvLFjS5H+Mk7Snr21vQ6QwrsoCGMfNC4e4LQPdoULEt4ykz0SRQ==", + "dev": true, + "dependencies": { + "@babel/helper-environment-visitor": "^7.22.20", + "@babel/helper-module-imports": "^7.22.15", + "@babel/helper-simple-access": "^7.22.5", + "@babel/helper-split-export-declaration": "^7.22.6", + "@babel/helper-validator-identifier": "^7.22.20" + }, + "engines": { + "node": ">=6.9.0" + }, + "peerDependencies": { + "@babel/core": "^7.0.0" + } + }, + "node_modules/@babel/helper-plugin-utils": { + "version": "7.24.0", + "resolved": "https://registry.npmjs.org/@babel/helper-plugin-utils/-/helper-plugin-utils-7.24.0.tgz", + "integrity": "sha512-9cUznXMG0+FxRuJfvL82QlTqIzhVW9sL0KjMPHhAOOvpQGL8QtdxnBKILjBqxlHyliz0yCa1G903ZXI/FuHy2w==", + "dev": true, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helper-simple-access": { + "version": "7.22.5", + "resolved": "https://registry.npmjs.org/@babel/helper-simple-access/-/helper-simple-access-7.22.5.tgz", + "integrity": "sha512-n0H99E/K+Bika3++WNL17POvo4rKWZ7lZEp1Q+fStVbUi8nxPQEBOlTmCOxW/0JsS56SKKQ+ojAe2pHKJHN35w==", + "dev": true, + "dependencies": { + "@babel/types": "^7.22.5" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helper-split-export-declaration": { + "version": "7.22.6", + "resolved": "https://registry.npmjs.org/@babel/helper-split-export-declaration/-/helper-split-export-declaration-7.22.6.tgz", + "integrity": "sha512-AsUnxuLhRYsisFiaJwvp1QF+I3KjD5FOxut14q/GzovUe6orHLesW2C7d754kRm53h5gqrz6sFl6sxc4BVtE/g==", + "dev": true, + "dependencies": { + "@babel/types": "^7.22.5" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helper-string-parser": { + "version": "7.24.1", + "resolved": "https://registry.npmjs.org/@babel/helper-string-parser/-/helper-string-parser-7.24.1.tgz", + "integrity": "sha512-2ofRCjnnA9y+wk8b9IAREroeUP02KHp431N2mhKniy2yKIDKpbrHv9eXwm8cBeWQYcJmzv5qKCu65P47eCF7CQ==", + "dev": true, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helper-validator-identifier": { + "version": "7.22.20", + "resolved": "https://registry.npmjs.org/@babel/helper-validator-identifier/-/helper-validator-identifier-7.22.20.tgz", + "integrity": "sha512-Y4OZ+ytlatR8AI+8KZfKuL5urKp7qey08ha31L8b3BwewJAoJamTzyvxPR/5D+KkdJCGPq/+8TukHBlY10FX9A==", + "dev": true, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helper-validator-option": { + "version": "7.23.5", + "resolved": "https://registry.npmjs.org/@babel/helper-validator-option/-/helper-validator-option-7.23.5.tgz", + "integrity": "sha512-85ttAOMLsr53VgXkTbkx8oA6YTfT4q7/HzXSLEYmjcSTJPMPQtvq1BD79Byep5xMUYbGRzEpDsjUf3dyp54IKw==", + "dev": true, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/helpers": { + "version": "7.24.4", + "resolved": "https://registry.npmjs.org/@babel/helpers/-/helpers-7.24.4.tgz", + "integrity": "sha512-FewdlZbSiwaVGlgT1DPANDuCHaDMiOo+D/IDYRFYjHOuv66xMSJ7fQwwODwRNAPkADIO/z1EoF/l2BCWlWABDw==", + "dev": true, + "dependencies": { + "@babel/template": "^7.24.0", + "@babel/traverse": "^7.24.1", + "@babel/types": "^7.24.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/highlight": { + "version": "7.24.2", + "resolved": "https://registry.npmjs.org/@babel/highlight/-/highlight-7.24.2.tgz", + "integrity": "sha512-Yac1ao4flkTxTteCDZLEvdxg2fZfz1v8M4QpaGypq/WPDqg3ijHYbDfs+LG5hvzSoqaSZ9/Z9lKSP3CjZjv+pA==", + "dev": true, + "dependencies": { + "@babel/helper-validator-identifier": "^7.22.20", + "chalk": "^2.4.2", + "js-tokens": "^4.0.0", + "picocolors": "^1.0.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/parser": { + "version": "7.24.4", + "resolved": "https://registry.npmjs.org/@babel/parser/-/parser-7.24.4.tgz", + "integrity": "sha512-zTvEBcghmeBma9QIGunWevvBAp4/Qu9Bdq+2k0Ot4fVMD6v3dsC9WOcRSKk7tRRyBM/53yKMJko9xOatGQAwSg==", + "dev": true, + "bin": { + "parser": "bin/babel-parser.js" + }, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/@babel/plugin-transform-react-jsx-self": { + "version": "7.24.1", + "resolved": "https://registry.npmjs.org/@babel/plugin-transform-react-jsx-self/-/plugin-transform-react-jsx-self-7.24.1.tgz", + "integrity": "sha512-kDJgnPujTmAZ/9q2CN4m2/lRsUUPDvsG3+tSHWUJIzMGTt5U/b/fwWd3RO3n+5mjLrsBrVa5eKFRVSQbi3dF1w==", + "dev": true, + "dependencies": { + "@babel/helper-plugin-utils": "^7.24.0" + }, + "engines": { + "node": ">=6.9.0" + }, + "peerDependencies": { + "@babel/core": "^7.0.0-0" + } + }, + "node_modules/@babel/plugin-transform-react-jsx-source": { + "version": "7.24.1", + "resolved": "https://registry.npmjs.org/@babel/plugin-transform-react-jsx-source/-/plugin-transform-react-jsx-source-7.24.1.tgz", + "integrity": "sha512-1v202n7aUq4uXAieRTKcwPzNyphlCuqHHDcdSNc+vdhoTEZcFMh+L5yZuCmGaIO7bs1nJUNfHB89TZyoL48xNA==", + "dev": true, + "dependencies": { + "@babel/helper-plugin-utils": "^7.24.0" + }, + "engines": { + "node": ">=6.9.0" + }, + "peerDependencies": { + "@babel/core": "^7.0.0-0" + } + }, + "node_modules/@babel/template": { + "version": "7.24.0", + "resolved": "https://registry.npmjs.org/@babel/template/-/template-7.24.0.tgz", + "integrity": "sha512-Bkf2q8lMB0AFpX0NFEqSbx1OkTHf0f+0j82mkw+ZpzBnkk7e9Ql0891vlfgi+kHwOk8tQjiQHpqh4LaSa0fKEA==", + "dev": true, + "dependencies": { + "@babel/code-frame": "^7.23.5", + "@babel/parser": "^7.24.0", + "@babel/types": "^7.24.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/traverse": { + "version": "7.24.1", + "resolved": "https://registry.npmjs.org/@babel/traverse/-/traverse-7.24.1.tgz", + "integrity": "sha512-xuU6o9m68KeqZbQuDt2TcKSxUw/mrsvavlEqQ1leZ/B+C9tk6E4sRWy97WaXgvq5E+nU3cXMxv3WKOCanVMCmQ==", + "dev": true, + "dependencies": { + "@babel/code-frame": "^7.24.1", + "@babel/generator": "^7.24.1", + "@babel/helper-environment-visitor": "^7.22.20", + "@babel/helper-function-name": "^7.23.0", + "@babel/helper-hoist-variables": "^7.22.5", + "@babel/helper-split-export-declaration": "^7.22.6", + "@babel/parser": "^7.24.1", + "@babel/types": "^7.24.0", + "debug": "^4.3.1", + "globals": "^11.1.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@babel/types": { + "version": "7.24.0", + "resolved": "https://registry.npmjs.org/@babel/types/-/types-7.24.0.tgz", + "integrity": "sha512-+j7a5c253RfKh8iABBhywc8NSfP5LURe7Uh4qpsh6jc+aLJguvmIUBdjSdEMQv2bENrCR5MfRdjGo7vzS/ob7w==", + "dev": true, + "dependencies": { + "@babel/helper-string-parser": "^7.23.4", + "@babel/helper-validator-identifier": "^7.22.20", + "to-fast-properties": "^2.0.0" + }, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/@esbuild/aix-ppc64": { + "version": "0.20.2", + "resolved": "https://registry.npmjs.org/@esbuild/aix-ppc64/-/aix-ppc64-0.20.2.tgz", + "integrity": "sha512-D+EBOJHXdNZcLJRBkhENNG8Wji2kgc9AZ9KiPr1JuZjsNtyHzrsfLRrY0tk2H2aoFu6RANO1y1iPPUCDYWkb5g==", + "cpu": [ + "ppc64" + ], + "dev": true, + "optional": true, + "os": [ + "aix" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/android-arm": { + "version": "0.20.2", + "resolved": "https://registry.npmjs.org/@esbuild/android-arm/-/android-arm-0.20.2.tgz", + "integrity": "sha512-t98Ra6pw2VaDhqNWO2Oph2LXbz/EJcnLmKLGBJwEwXX/JAN83Fym1rU8l0JUWK6HkIbWONCSSatf4sf2NBRx/w==", + "cpu": [ + "arm" + ], + "dev": true, + "optional": true, + "os": [ + "android" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/android-arm64": { + "version": "0.20.2", + "resolved": "https://registry.npmjs.org/@esbuild/android-arm64/-/android-arm64-0.20.2.tgz", + "integrity": "sha512-mRzjLacRtl/tWU0SvD8lUEwb61yP9cqQo6noDZP/O8VkwafSYwZ4yWy24kan8jE/IMERpYncRt2dw438LP3Xmg==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "android" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/android-x64": { + "version": "0.20.2", + "resolved": "https://registry.npmjs.org/@esbuild/android-x64/-/android-x64-0.20.2.tgz", + "integrity": "sha512-btzExgV+/lMGDDa194CcUQm53ncxzeBrWJcncOBxuC6ndBkKxnHdFJn86mCIgTELsooUmwUm9FkhSp5HYu00Rg==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "android" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/darwin-arm64": { + "version": "0.20.2", + "resolved": "https://registry.npmjs.org/@esbuild/darwin-arm64/-/darwin-arm64-0.20.2.tgz", + "integrity": "sha512-4J6IRT+10J3aJH3l1yzEg9y3wkTDgDk7TSDFX+wKFiWjqWp/iCfLIYzGyasx9l0SAFPT1HwSCR+0w/h1ES/MjA==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/darwin-x64": { + "version": "0.20.2", + "resolved": "https://registry.npmjs.org/@esbuild/darwin-x64/-/darwin-x64-0.20.2.tgz", + "integrity": "sha512-tBcXp9KNphnNH0dfhv8KYkZhjc+H3XBkF5DKtswJblV7KlT9EI2+jeA8DgBjp908WEuYll6pF+UStUCfEpdysA==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/freebsd-arm64": { + "version": "0.20.2", + "resolved": "https://registry.npmjs.org/@esbuild/freebsd-arm64/-/freebsd-arm64-0.20.2.tgz", + "integrity": "sha512-d3qI41G4SuLiCGCFGUrKsSeTXyWG6yem1KcGZVS+3FYlYhtNoNgYrWcvkOoaqMhwXSMrZRl69ArHsGJ9mYdbbw==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "freebsd" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/freebsd-x64": { + "version": "0.20.2", + "resolved": "https://registry.npmjs.org/@esbuild/freebsd-x64/-/freebsd-x64-0.20.2.tgz", + "integrity": "sha512-d+DipyvHRuqEeM5zDivKV1KuXn9WeRX6vqSqIDgwIfPQtwMP4jaDsQsDncjTDDsExT4lR/91OLjRo8bmC1e+Cw==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "freebsd" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-arm": { + "version": "0.20.2", + "resolved": "https://registry.npmjs.org/@esbuild/linux-arm/-/linux-arm-0.20.2.tgz", + "integrity": "sha512-VhLPeR8HTMPccbuWWcEUD1Az68TqaTYyj6nfE4QByZIQEQVWBB8vup8PpR7y1QHL3CpcF6xd5WVBU/+SBEvGTg==", + "cpu": [ + "arm" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-arm64": { + "version": "0.20.2", + "resolved": "https://registry.npmjs.org/@esbuild/linux-arm64/-/linux-arm64-0.20.2.tgz", + "integrity": "sha512-9pb6rBjGvTFNira2FLIWqDk/uaf42sSyLE8j1rnUpuzsODBq7FvpwHYZxQ/It/8b+QOS1RYfqgGFNLRI+qlq2A==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-ia32": { + "version": "0.20.2", + "resolved": "https://registry.npmjs.org/@esbuild/linux-ia32/-/linux-ia32-0.20.2.tgz", + "integrity": "sha512-o10utieEkNPFDZFQm9CoP7Tvb33UutoJqg3qKf1PWVeeJhJw0Q347PxMvBgVVFgouYLGIhFYG0UGdBumROyiig==", + "cpu": [ + "ia32" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-loong64": { + "version": "0.20.2", + "resolved": "https://registry.npmjs.org/@esbuild/linux-loong64/-/linux-loong64-0.20.2.tgz", + "integrity": "sha512-PR7sp6R/UC4CFVomVINKJ80pMFlfDfMQMYynX7t1tNTeivQ6XdX5r2XovMmha/VjR1YN/HgHWsVcTRIMkymrgQ==", + "cpu": [ + "loong64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-mips64el": { + "version": "0.20.2", + "resolved": "https://registry.npmjs.org/@esbuild/linux-mips64el/-/linux-mips64el-0.20.2.tgz", + "integrity": "sha512-4BlTqeutE/KnOiTG5Y6Sb/Hw6hsBOZapOVF6njAESHInhlQAghVVZL1ZpIctBOoTFbQyGW+LsVYZ8lSSB3wkjA==", + "cpu": [ + "mips64el" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-ppc64": { + "version": "0.20.2", + "resolved": "https://registry.npmjs.org/@esbuild/linux-ppc64/-/linux-ppc64-0.20.2.tgz", + "integrity": "sha512-rD3KsaDprDcfajSKdn25ooz5J5/fWBylaaXkuotBDGnMnDP1Uv5DLAN/45qfnf3JDYyJv/ytGHQaziHUdyzaAg==", + "cpu": [ + "ppc64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-riscv64": { + "version": "0.20.2", + "resolved": "https://registry.npmjs.org/@esbuild/linux-riscv64/-/linux-riscv64-0.20.2.tgz", + "integrity": "sha512-snwmBKacKmwTMmhLlz/3aH1Q9T8v45bKYGE3j26TsaOVtjIag4wLfWSiZykXzXuE1kbCE+zJRmwp+ZbIHinnVg==", + "cpu": [ + "riscv64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-s390x": { + "version": "0.20.2", + "resolved": "https://registry.npmjs.org/@esbuild/linux-s390x/-/linux-s390x-0.20.2.tgz", + "integrity": "sha512-wcWISOobRWNm3cezm5HOZcYz1sKoHLd8VL1dl309DiixxVFoFe/o8HnwuIwn6sXre88Nwj+VwZUvJf4AFxkyrQ==", + "cpu": [ + "s390x" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-x64": { + "version": "0.20.2", + "resolved": "https://registry.npmjs.org/@esbuild/linux-x64/-/linux-x64-0.20.2.tgz", + "integrity": "sha512-1MdwI6OOTsfQfek8sLwgyjOXAu+wKhLEoaOLTjbijk6E2WONYpH9ZU2mNtR+lZ2B4uwr+usqGuVfFT9tMtGvGw==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/netbsd-x64": { + "version": "0.20.2", + "resolved": "https://registry.npmjs.org/@esbuild/netbsd-x64/-/netbsd-x64-0.20.2.tgz", + "integrity": "sha512-K8/DhBxcVQkzYc43yJXDSyjlFeHQJBiowJ0uVL6Tor3jGQfSGHNNJcWxNbOI8v5k82prYqzPuwkzHt3J1T1iZQ==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "netbsd" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/openbsd-x64": { + "version": "0.20.2", + "resolved": "https://registry.npmjs.org/@esbuild/openbsd-x64/-/openbsd-x64-0.20.2.tgz", + "integrity": "sha512-eMpKlV0SThJmmJgiVyN9jTPJ2VBPquf6Kt/nAoo6DgHAoN57K15ZghiHaMvqjCye/uU4X5u3YSMgVBI1h3vKrQ==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "openbsd" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/sunos-x64": { + "version": "0.20.2", + "resolved": "https://registry.npmjs.org/@esbuild/sunos-x64/-/sunos-x64-0.20.2.tgz", + "integrity": "sha512-2UyFtRC6cXLyejf/YEld4Hajo7UHILetzE1vsRcGL3earZEW77JxrFjH4Ez2qaTiEfMgAXxfAZCm1fvM/G/o8w==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "sunos" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/win32-arm64": { + "version": "0.20.2", + "resolved": "https://registry.npmjs.org/@esbuild/win32-arm64/-/win32-arm64-0.20.2.tgz", + "integrity": "sha512-GRibxoawM9ZCnDxnP3usoUDO9vUkpAxIIZ6GQI+IlVmr5kP3zUq+l17xELTHMWTWzjxa2guPNyrpq1GWmPvcGQ==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/win32-ia32": { + "version": "0.20.2", + "resolved": "https://registry.npmjs.org/@esbuild/win32-ia32/-/win32-ia32-0.20.2.tgz", + "integrity": "sha512-HfLOfn9YWmkSKRQqovpnITazdtquEW8/SoHW7pWpuEeguaZI4QnCRW6b+oZTztdBnZOS2hqJ6im/D5cPzBTTlQ==", + "cpu": [ + "ia32" + ], + "dev": true, + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/win32-x64": { + "version": "0.20.2", + "resolved": "https://registry.npmjs.org/@esbuild/win32-x64/-/win32-x64-0.20.2.tgz", + "integrity": "sha512-N49X4lJX27+l9jbLKSqZ6bKNjzQvHaT8IIFUy+YIqmXQdjYCToGWwOItDrfby14c78aDd5NHQl29xingXfCdLQ==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@eslint-community/eslint-utils": { + "version": "4.4.0", + "resolved": "https://registry.npmjs.org/@eslint-community/eslint-utils/-/eslint-utils-4.4.0.tgz", + "integrity": "sha512-1/sA4dwrzBAyeUoQ6oxahHKmrZvsnLCg4RfxW3ZFGGmQkSNQPFNLV9CUEFQP1x9EYXHTo5p6xdhZM1Ne9p/AfA==", + "dev": true, + "dependencies": { + "eslint-visitor-keys": "^3.3.0" + }, + "engines": { + "node": "^12.22.0 || ^14.17.0 || >=16.0.0" + }, + "peerDependencies": { + "eslint": "^6.0.0 || ^7.0.0 || >=8.0.0" + } + }, + "node_modules/@eslint-community/regexpp": { + "version": "4.10.0", + "resolved": "https://registry.npmjs.org/@eslint-community/regexpp/-/regexpp-4.10.0.tgz", + "integrity": "sha512-Cu96Sd2By9mCNTx2iyKOmq10v22jUVQv0lQnlGNy16oE9589yE+QADPbrMGCkA51cKZSg3Pu/aTJVTGfL/qjUA==", + "dev": true, + "engines": { + "node": "^12.0.0 || ^14.0.0 || >=16.0.0" + } + }, + "node_modules/@eslint/eslintrc": { + "version": "2.1.4", + "resolved": "https://registry.npmjs.org/@eslint/eslintrc/-/eslintrc-2.1.4.tgz", + "integrity": "sha512-269Z39MS6wVJtsoUl10L60WdkhJVdPG24Q4eZTH3nnF6lpvSShEK3wQjDX9JRWAUPvPh7COouPpU9IrqaZFvtQ==", + "dev": true, + "dependencies": { + "ajv": "^6.12.4", + "debug": "^4.3.2", + "espree": "^9.6.0", + "globals": "^13.19.0", + "ignore": "^5.2.0", + "import-fresh": "^3.2.1", + "js-yaml": "^4.1.0", + "minimatch": "^3.1.2", + "strip-json-comments": "^3.1.1" + }, + "engines": { + "node": "^12.22.0 || ^14.17.0 || >=16.0.0" + }, + "funding": { + "url": "https://opencollective.com/eslint" + } + }, + "node_modules/@eslint/eslintrc/node_modules/globals": { + "version": "13.24.0", + "resolved": "https://registry.npmjs.org/globals/-/globals-13.24.0.tgz", + "integrity": "sha512-AhO5QUcj8llrbG09iWhPU2B204J1xnPeL8kQmVorSsy+Sjj1sk8gIyh6cUocGmH4L0UuhAJy+hJMRA4mgA4mFQ==", + "dev": true, + "dependencies": { + "type-fest": "^0.20.2" + }, + "engines": { + "node": ">=8" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/@eslint/js": { + "version": "8.57.0", + "resolved": "https://registry.npmjs.org/@eslint/js/-/js-8.57.0.tgz", + "integrity": "sha512-Ys+3g2TaW7gADOJzPt83SJtCDhMjndcDMFVQ/Tj9iA1BfJzFKD9mAUXT3OenpuPHbI6P/myECxRJrofUsDx/5g==", + "dev": true, + "engines": { + "node": "^12.22.0 || ^14.17.0 || >=16.0.0" + } + }, + "node_modules/@humanwhocodes/config-array": { + "version": "0.11.14", + "resolved": "https://registry.npmjs.org/@humanwhocodes/config-array/-/config-array-0.11.14.tgz", + "integrity": "sha512-3T8LkOmg45BV5FICb15QQMsyUSWrQ8AygVfC7ZG32zOalnqrilm018ZVCw0eapXux8FtA33q8PSRSstjee3jSg==", + "dev": true, + "dependencies": { + "@humanwhocodes/object-schema": "^2.0.2", + "debug": "^4.3.1", + "minimatch": "^3.0.5" + }, + "engines": { + "node": ">=10.10.0" + } + }, + "node_modules/@humanwhocodes/module-importer": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/@humanwhocodes/module-importer/-/module-importer-1.0.1.tgz", + "integrity": "sha512-bxveV4V8v5Yb4ncFTT3rPSgZBOpCkjfK0y4oVVVJwIuDVBRMDXrPyXRL988i5ap9m9bnyEEjWfm5WkBmtffLfA==", + "dev": true, + "engines": { + "node": ">=12.22" + }, + "funding": { + "type": "github", + "url": "https://github.com/sponsors/nzakas" + } + }, + "node_modules/@humanwhocodes/object-schema": { + "version": "2.0.3", + "resolved": "https://registry.npmjs.org/@humanwhocodes/object-schema/-/object-schema-2.0.3.tgz", + "integrity": "sha512-93zYdMES/c1D69yZiKDBj0V24vqNzB/koF26KPaagAfd3P/4gUlh3Dys5ogAK+Exi9QyzlD8x/08Zt7wIKcDcA==", + "dev": true + }, + "node_modules/@isaacs/cliui": { + "version": "8.0.2", + "resolved": "https://registry.npmjs.org/@isaacs/cliui/-/cliui-8.0.2.tgz", + "integrity": "sha512-O8jcjabXaleOG9DQ0+ARXWZBTfnP4WNAqzuiJK7ll44AmxGKv/J2M4TPjxjY3znBCfvBXFzucm1twdyFybFqEA==", + "dev": true, + "dependencies": { + "string-width": "^5.1.2", + "string-width-cjs": "npm:string-width@^4.2.0", + "strip-ansi": "^7.0.1", + "strip-ansi-cjs": "npm:strip-ansi@^6.0.1", + "wrap-ansi": "^8.1.0", + "wrap-ansi-cjs": "npm:wrap-ansi@^7.0.0" + }, + "engines": { + "node": ">=12" + } + }, + "node_modules/@isaacs/cliui/node_modules/ansi-regex": { + "version": "6.0.1", + "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-6.0.1.tgz", + "integrity": "sha512-n5M855fKb2SsfMIiFFoVrABHJC8QtHwVx+mHWP3QcEqBHYienj5dHSgjbxtC0WEZXYt4wcD6zrQElDPhFuZgfA==", + "dev": true, + "engines": { + "node": ">=12" + }, + "funding": { + "url": "https://github.com/chalk/ansi-regex?sponsor=1" + } + }, + "node_modules/@isaacs/cliui/node_modules/strip-ansi": { + "version": "7.1.0", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-7.1.0.tgz", + "integrity": "sha512-iq6eVVI64nQQTRYq2KtEg2d2uU7LElhTJwsH4YzIHZshxlgZms/wIc4VoDQTlG/IvVIrBKG06CrZnp0qv7hkcQ==", + "dev": true, + "dependencies": { + "ansi-regex": "^6.0.1" + }, + "engines": { + "node": ">=12" + }, + "funding": { + "url": "https://github.com/chalk/strip-ansi?sponsor=1" + } + }, + "node_modules/@jridgewell/gen-mapping": { + "version": "0.3.5", + "resolved": "https://registry.npmjs.org/@jridgewell/gen-mapping/-/gen-mapping-0.3.5.tgz", + "integrity": "sha512-IzL8ZoEDIBRWEzlCcRhOaCupYyN5gdIK+Q6fbFdPDg6HqX6jpkItn7DFIpW9LQzXG6Df9sA7+OKnq0qlz/GaQg==", + "dev": true, + "dependencies": { + "@jridgewell/set-array": "^1.2.1", + "@jridgewell/sourcemap-codec": "^1.4.10", + "@jridgewell/trace-mapping": "^0.3.24" + }, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/@jridgewell/resolve-uri": { + "version": "3.1.2", + "resolved": "https://registry.npmjs.org/@jridgewell/resolve-uri/-/resolve-uri-3.1.2.tgz", + "integrity": "sha512-bRISgCIjP20/tbWSPWMEi54QVPRZExkuD9lJL+UIxUKtwVJA8wW1Trb1jMs1RFXo1CBTNZ/5hpC9QvmKWdopKw==", + "dev": true, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/@jridgewell/set-array": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/@jridgewell/set-array/-/set-array-1.2.1.tgz", + "integrity": "sha512-R8gLRTZeyp03ymzP/6Lil/28tGeGEzhx1q2k703KGWRAI1VdvPIXdG70VJc2pAMw3NA6JKL5hhFu1sJX0Mnn/A==", + "dev": true, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/@jridgewell/sourcemap-codec": { + "version": "1.4.15", + "resolved": "https://registry.npmjs.org/@jridgewell/sourcemap-codec/-/sourcemap-codec-1.4.15.tgz", + "integrity": "sha512-eF2rxCRulEKXHTRiDrDy6erMYWqNw4LPdQ8UQA4huuxaQsVeRPFl2oM8oDGxMFhJUWZf9McpLtJasDDZb/Bpeg==", + "dev": true + }, + "node_modules/@jridgewell/trace-mapping": { + "version": "0.3.25", + "resolved": "https://registry.npmjs.org/@jridgewell/trace-mapping/-/trace-mapping-0.3.25.tgz", + "integrity": "sha512-vNk6aEwybGtawWmy/PzwnGDOjCkLWSD2wqvjGGAgOAwCGWySYXfYoxt00IJkTF+8Lb57DwOb3Aa0o9CApepiYQ==", + "dev": true, + "dependencies": { + "@jridgewell/resolve-uri": "^3.1.0", + "@jridgewell/sourcemap-codec": "^1.4.14" + } + }, + "node_modules/@nodelib/fs.scandir": { + "version": "2.1.5", + "resolved": "https://registry.npmjs.org/@nodelib/fs.scandir/-/fs.scandir-2.1.5.tgz", + "integrity": "sha512-vq24Bq3ym5HEQm2NKCr3yXDwjc7vTsEThRDnkp2DK9p1uqLR+DHurm/NOTo0KG7HYHU7eppKZj3MyqYuMBf62g==", + "dev": true, + "dependencies": { + "@nodelib/fs.stat": "2.0.5", + "run-parallel": "^1.1.9" + }, + "engines": { + "node": ">= 8" + } + }, + "node_modules/@nodelib/fs.stat": { + "version": "2.0.5", + "resolved": "https://registry.npmjs.org/@nodelib/fs.stat/-/fs.stat-2.0.5.tgz", + "integrity": "sha512-RkhPPp2zrqDAQA/2jNhnztcPAlv64XdhIp7a7454A5ovI7Bukxgt7MX7udwAu3zg1DcpPU0rz3VV1SeaqvY4+A==", + "dev": true, + "engines": { + "node": ">= 8" + } + }, + "node_modules/@nodelib/fs.walk": { + "version": "1.2.8", + "resolved": "https://registry.npmjs.org/@nodelib/fs.walk/-/fs.walk-1.2.8.tgz", + "integrity": "sha512-oGB+UxlgWcgQkgwo8GcEGwemoTFt3FIO9ababBmaGwXIoBKZ+GTy0pP185beGg7Llih/NSHSV2XAs1lnznocSg==", + "dev": true, + "dependencies": { + "@nodelib/fs.scandir": "2.1.5", + "fastq": "^1.6.0" + }, + "engines": { + "node": ">= 8" + } + }, + "node_modules/@pkgjs/parseargs": { + "version": "0.11.0", + "resolved": "https://registry.npmjs.org/@pkgjs/parseargs/-/parseargs-0.11.0.tgz", + "integrity": "sha512-+1VkjdD0QBLPodGrJUeqarH8VAIvQODIbwh9XpP5Syisf7YoQgsJKPNFoqqLQlu+VQ/tVSshMR6loPMn8U+dPg==", + "dev": true, + "optional": true, + "engines": { + "node": ">=14" + } + }, + "node_modules/@remix-run/router": { + "version": "1.15.3", + "resolved": "https://registry.npmjs.org/@remix-run/router/-/router-1.15.3.tgz", + "integrity": "sha512-Oy8rmScVrVxWZVOpEF57ovlnhpZ8CCPlnIIumVcV9nFdiSIrus99+Lw78ekXyGvVDlIsFJbSfmSovJUhCWYV3w==", + "engines": { + "node": ">=14.0.0" + } + }, + "node_modules/@rollup/rollup-android-arm-eabi": { + "version": "4.14.3", + "resolved": "https://registry.npmjs.org/@rollup/rollup-android-arm-eabi/-/rollup-android-arm-eabi-4.14.3.tgz", + "integrity": "sha512-X9alQ3XM6I9IlSlmC8ddAvMSyG1WuHk5oUnXGw+yUBs3BFoTizmG1La/Gr8fVJvDWAq+zlYTZ9DBgrlKRVY06g==", + "cpu": [ + "arm" + ], + "dev": true, + "optional": true, + "os": [ + "android" + ] + }, + "node_modules/@rollup/rollup-android-arm64": { + "version": "4.14.3", + "resolved": "https://registry.npmjs.org/@rollup/rollup-android-arm64/-/rollup-android-arm64-4.14.3.tgz", + "integrity": "sha512-eQK5JIi+POhFpzk+LnjKIy4Ks+pwJ+NXmPxOCSvOKSNRPONzKuUvWE+P9JxGZVxrtzm6BAYMaL50FFuPe0oWMQ==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "android" + ] + }, + "node_modules/@rollup/rollup-darwin-arm64": { + "version": "4.14.3", + "resolved": "https://registry.npmjs.org/@rollup/rollup-darwin-arm64/-/rollup-darwin-arm64-4.14.3.tgz", + "integrity": "sha512-Od4vE6f6CTT53yM1jgcLqNfItTsLt5zE46fdPaEmeFHvPs5SjZYlLpHrSiHEKR1+HdRfxuzXHjDOIxQyC3ptBA==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "darwin" + ] + }, + "node_modules/@rollup/rollup-darwin-x64": { + "version": "4.14.3", + "resolved": "https://registry.npmjs.org/@rollup/rollup-darwin-x64/-/rollup-darwin-x64-4.14.3.tgz", + "integrity": "sha512-0IMAO21axJeNIrvS9lSe/PGthc8ZUS+zC53O0VhF5gMxfmcKAP4ESkKOCwEi6u2asUrt4mQv2rjY8QseIEb1aw==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "darwin" + ] + }, + "node_modules/@rollup/rollup-linux-arm-gnueabihf": { + "version": "4.14.3", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-arm-gnueabihf/-/rollup-linux-arm-gnueabihf-4.14.3.tgz", + "integrity": "sha512-ge2DC7tHRHa3caVEoSbPRJpq7azhG+xYsd6u2MEnJ6XzPSzQsTKyXvh6iWjXRf7Rt9ykIUWHtl0Uz3T6yXPpKw==", + "cpu": [ + "arm" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-arm-musleabihf": { + "version": "4.14.3", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-arm-musleabihf/-/rollup-linux-arm-musleabihf-4.14.3.tgz", + "integrity": "sha512-ljcuiDI4V3ySuc7eSk4lQ9wU8J8r8KrOUvB2U+TtK0TiW6OFDmJ+DdIjjwZHIw9CNxzbmXY39wwpzYuFDwNXuw==", + "cpu": [ + "arm" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-arm64-gnu": { + "version": "4.14.3", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-arm64-gnu/-/rollup-linux-arm64-gnu-4.14.3.tgz", + "integrity": "sha512-Eci2us9VTHm1eSyn5/eEpaC7eP/mp5n46gTRB3Aar3BgSvDQGJZuicyq6TsH4HngNBgVqC5sDYxOzTExSU+NjA==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-arm64-musl": { + "version": "4.14.3", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-arm64-musl/-/rollup-linux-arm64-musl-4.14.3.tgz", + "integrity": "sha512-UrBoMLCq4E92/LCqlh+blpqMz5h1tJttPIniwUgOFJyjWI1qrtrDhhpHPuFxULlUmjFHfloWdixtDhSxJt5iKw==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-powerpc64le-gnu": { + "version": "4.14.3", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-powerpc64le-gnu/-/rollup-linux-powerpc64le-gnu-4.14.3.tgz", + "integrity": "sha512-5aRjvsS8q1nWN8AoRfrq5+9IflC3P1leMoy4r2WjXyFqf3qcqsxRCfxtZIV58tCxd+Yv7WELPcO9mY9aeQyAmw==", + "cpu": [ + "ppc64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-riscv64-gnu": { + "version": "4.14.3", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-riscv64-gnu/-/rollup-linux-riscv64-gnu-4.14.3.tgz", + "integrity": "sha512-sk/Qh1j2/RJSX7FhEpJn8n0ndxy/uf0kI/9Zc4b1ELhqULVdTfN6HL31CDaTChiBAOgLcsJ1sgVZjWv8XNEsAQ==", + "cpu": [ + "riscv64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-s390x-gnu": { + "version": "4.14.3", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-s390x-gnu/-/rollup-linux-s390x-gnu-4.14.3.tgz", + "integrity": "sha512-jOO/PEaDitOmY9TgkxF/TQIjXySQe5KVYB57H/8LRP/ux0ZoO8cSHCX17asMSv3ruwslXW/TLBcxyaUzGRHcqg==", + "cpu": [ + "s390x" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-x64-gnu": { + "version": "4.14.3", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-x64-gnu/-/rollup-linux-x64-gnu-4.14.3.tgz", + "integrity": "sha512-8ybV4Xjy59xLMyWo3GCfEGqtKV5M5gCSrZlxkPGvEPCGDLNla7v48S662HSGwRd6/2cSneMQWiv+QzcttLrrOA==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-linux-x64-musl": { + "version": "4.14.3", + "resolved": "https://registry.npmjs.org/@rollup/rollup-linux-x64-musl/-/rollup-linux-x64-musl-4.14.3.tgz", + "integrity": "sha512-s+xf1I46trOY10OqAtZ5Rm6lzHre/UiLA1J2uOhCFXWkbZrJRkYBPO6FhvGfHmdtQ3Bx793MNa7LvoWFAm93bg==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "linux" + ] + }, + "node_modules/@rollup/rollup-win32-arm64-msvc": { + "version": "4.14.3", + "resolved": "https://registry.npmjs.org/@rollup/rollup-win32-arm64-msvc/-/rollup-win32-arm64-msvc-4.14.3.tgz", + "integrity": "sha512-+4h2WrGOYsOumDQ5S2sYNyhVfrue+9tc9XcLWLh+Kw3UOxAvrfOrSMFon60KspcDdytkNDh7K2Vs6eMaYImAZg==", + "cpu": [ + "arm64" + ], + "dev": true, + "optional": true, + "os": [ + "win32" + ] + }, + "node_modules/@rollup/rollup-win32-ia32-msvc": { + "version": "4.14.3", + "resolved": "https://registry.npmjs.org/@rollup/rollup-win32-ia32-msvc/-/rollup-win32-ia32-msvc-4.14.3.tgz", + "integrity": "sha512-T1l7y/bCeL/kUwh9OD4PQT4aM7Bq43vX05htPJJ46RTI4r5KNt6qJRzAfNfM+OYMNEVBWQzR2Gyk+FXLZfogGw==", + "cpu": [ + "ia32" + ], + "dev": true, + "optional": true, + "os": [ + "win32" + ] + }, + "node_modules/@rollup/rollup-win32-x64-msvc": { + "version": "4.14.3", + "resolved": "https://registry.npmjs.org/@rollup/rollup-win32-x64-msvc/-/rollup-win32-x64-msvc-4.14.3.tgz", + "integrity": "sha512-/BypzV0H1y1HzgYpxqRaXGBRqfodgoBBCcsrujT6QRcakDQdfU+Lq9PENPh5jB4I44YWq+0C2eHsHya+nZY1sA==", + "cpu": [ + "x64" + ], + "dev": true, + "optional": true, + "os": [ + "win32" + ] + }, + "node_modules/@types/babel__core": { + "version": "7.20.5", + "resolved": "https://registry.npmjs.org/@types/babel__core/-/babel__core-7.20.5.tgz", + "integrity": "sha512-qoQprZvz5wQFJwMDqeseRXWv3rqMvhgpbXFfVyWhbx9X47POIA6i/+dXefEmZKoAgOaTdaIgNSMqMIU61yRyzA==", + "dev": true, + "dependencies": { + "@babel/parser": "^7.20.7", + "@babel/types": "^7.20.7", + "@types/babel__generator": "*", + "@types/babel__template": "*", + "@types/babel__traverse": "*" + } + }, + "node_modules/@types/babel__generator": { + "version": "7.6.8", + "resolved": "https://registry.npmjs.org/@types/babel__generator/-/babel__generator-7.6.8.tgz", + "integrity": "sha512-ASsj+tpEDsEiFr1arWrlN6V3mdfjRMZt6LtK/Vp/kreFLnr5QH5+DhvD5nINYZXzwJvXeGq+05iUXcAzVrqWtw==", + "dev": true, + "dependencies": { + "@babel/types": "^7.0.0" + } + }, + "node_modules/@types/babel__template": { + "version": "7.4.4", + "resolved": "https://registry.npmjs.org/@types/babel__template/-/babel__template-7.4.4.tgz", + "integrity": "sha512-h/NUaSyG5EyxBIp8YRxo4RMe2/qQgvyowRwVMzhYhBCONbW8PUsg4lkFMrhgZhUe5z3L3MiLDuvyJ/CaPa2A8A==", + "dev": true, + "dependencies": { + "@babel/parser": "^7.1.0", + "@babel/types": "^7.0.0" + } + }, + "node_modules/@types/babel__traverse": { + "version": "7.20.5", + "resolved": "https://registry.npmjs.org/@types/babel__traverse/-/babel__traverse-7.20.5.tgz", + "integrity": "sha512-WXCyOcRtH37HAUkpXhUduaxdm82b4GSlyTqajXviN4EfiuPgNYR109xMCKvpl6zPIpua0DGlMEDCq+g8EdoheQ==", + "dev": true, + "dependencies": { + "@babel/types": "^7.20.7" + } + }, + "node_modules/@types/estree": { + "version": "1.0.5", + "resolved": "https://registry.npmjs.org/@types/estree/-/estree-1.0.5.tgz", + "integrity": "sha512-/kYRxGDLWzHOB7q+wtSUQlFrtcdUccpfy+X+9iMBpHK8QLLhx2wIPYuS5DYtR9Wa/YlZAbIovy7qVdB1Aq6Lyw==", + "dev": true + }, + "node_modules/@types/prop-types": { + "version": "15.7.12", + "resolved": "https://registry.npmjs.org/@types/prop-types/-/prop-types-15.7.12.tgz", + "integrity": "sha512-5zvhXYtRNRluoE/jAp4GVsSduVUzNWKkOZrCDBWYtE7biZywwdC2AcEzg+cSMLFRfVgeAFqpfNabiPjxFddV1Q==", + "dev": true + }, + "node_modules/@types/react": { + "version": "18.2.79", + "resolved": "https://registry.npmjs.org/@types/react/-/react-18.2.79.tgz", + "integrity": "sha512-RwGAGXPl9kSXwdNTafkOEuFrTBD5SA2B3iEB96xi8+xu5ddUa/cpvyVCSNn+asgLCTHkb5ZxN8gbuibYJi4s1w==", + "dev": true, + "dependencies": { + "@types/prop-types": "*", + "csstype": "^3.0.2" + } + }, + "node_modules/@types/react-dom": { + "version": "18.2.25", + "resolved": "https://registry.npmjs.org/@types/react-dom/-/react-dom-18.2.25.tgz", + "integrity": "sha512-o/V48vf4MQh7juIKZU2QGDfli6p1+OOi5oXx36Hffpc9adsHeXjVp8rHuPkjd8VT8sOJ2Zp05HR7CdpGTIUFUA==", + "dev": true, + "dependencies": { + "@types/react": "*" + } + }, + "node_modules/@ungap/structured-clone": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/@ungap/structured-clone/-/structured-clone-1.2.0.tgz", + "integrity": "sha512-zuVdFrMJiuCDQUMCzQaD6KL28MjnqqN8XnAqiEq9PNm/hCPTSGfrXCOfwj1ow4LFb/tNymJPwsNbVePc1xFqrQ==", + "dev": true + }, + "node_modules/@vitejs/plugin-react": { + "version": "4.2.1", + "resolved": "https://registry.npmjs.org/@vitejs/plugin-react/-/plugin-react-4.2.1.tgz", + "integrity": "sha512-oojO9IDc4nCUUi8qIR11KoQm0XFFLIwsRBwHRR4d/88IWghn1y6ckz/bJ8GHDCsYEJee8mDzqtJxh15/cisJNQ==", + "dev": true, + "dependencies": { + "@babel/core": "^7.23.5", + "@babel/plugin-transform-react-jsx-self": "^7.23.3", + "@babel/plugin-transform-react-jsx-source": "^7.23.3", + "@types/babel__core": "^7.20.5", + "react-refresh": "^0.14.0" + }, + "engines": { + "node": "^14.18.0 || >=16.0.0" + }, + "peerDependencies": { + "vite": "^4.2.0 || ^5.0.0" + } + }, + "node_modules/acorn": { + "version": "8.11.3", + "resolved": "https://registry.npmjs.org/acorn/-/acorn-8.11.3.tgz", + "integrity": "sha512-Y9rRfJG5jcKOE0CLisYbojUjIrIEE7AGMzA/Sm4BslANhbS+cDMpgBdcPT91oJ7OuJ9hYJBx59RjbhxVnrF8Xg==", + "dev": true, + "bin": { + "acorn": "bin/acorn" + }, + "engines": { + "node": ">=0.4.0" + } + }, + "node_modules/acorn-jsx": { + "version": "5.3.2", + "resolved": "https://registry.npmjs.org/acorn-jsx/-/acorn-jsx-5.3.2.tgz", + "integrity": "sha512-rq9s+JNhf0IChjtDXxllJ7g41oZk5SlXtp0LHwyA5cejwn7vKmKp4pPri6YEePv2PU65sAsegbXtIinmDFDXgQ==", + "dev": true, + "peerDependencies": { + "acorn": "^6.0.0 || ^7.0.0 || ^8.0.0" + } + }, + "node_modules/ajv": { + "version": "6.12.6", + "resolved": "https://registry.npmjs.org/ajv/-/ajv-6.12.6.tgz", + "integrity": "sha512-j3fVLgvTo527anyYyJOGTYJbG+vnnQYvE0m5mmkc1TK+nxAppkCLMIL0aZ4dblVCNoGShhm+kzE4ZUykBoMg4g==", + "dev": true, + "dependencies": { + "fast-deep-equal": "^3.1.1", + "fast-json-stable-stringify": "^2.0.0", + "json-schema-traverse": "^0.4.1", + "uri-js": "^4.2.2" + }, + "funding": { + "type": "github", + "url": "https://github.com/sponsors/epoberezkin" + } + }, + "node_modules/ansi-regex": { + "version": "5.0.1", + "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-5.0.1.tgz", + "integrity": "sha512-quJQXlTSUGL2LH9SUXo8VwsY4soanhgo6LNSm84E1LBcE8s3O0wpdiRzyR9z/ZZJMlMWv37qOOb9pdJlMUEKFQ==", + "dev": true, + "engines": { + "node": ">=8" + } + }, + "node_modules/ansi-styles": { + "version": "3.2.1", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-3.2.1.tgz", + "integrity": "sha512-VT0ZI6kZRdTh8YyJw3SMbYm/u+NqfsAxEpWO0Pf9sq8/e94WxxOpPKx9FR1FlyCtOVDNOQ+8ntlqFxiRc+r5qA==", + "dev": true, + "dependencies": { + "color-convert": "^1.9.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/any-promise": { + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/any-promise/-/any-promise-1.3.0.tgz", + "integrity": "sha512-7UvmKalWRt1wgjL1RrGxoSJW/0QZFIegpeGvZG9kjp8vrRu55XTHbwnqq2GpXm9uLbcuhxm3IqX9OB4MZR1b2A==", + "dev": true + }, + "node_modules/anymatch": { + "version": "3.1.3", + "resolved": "https://registry.npmjs.org/anymatch/-/anymatch-3.1.3.tgz", + "integrity": "sha512-KMReFUr0B4t+D+OBkjR3KYqvocp2XaSzO55UcB6mgQMd3KbcE+mWTyvVV7D/zsdEbNnV6acZUutkiHQXvTr1Rw==", + "dev": true, + "dependencies": { + "normalize-path": "^3.0.0", + "picomatch": "^2.0.4" + }, + "engines": { + "node": ">= 8" + } + }, + "node_modules/arg": { + "version": "5.0.2", + "resolved": "https://registry.npmjs.org/arg/-/arg-5.0.2.tgz", + "integrity": "sha512-PYjyFOLKQ9y57JvQ6QLo8dAgNqswh8M1RMJYdQduT6xbWSgK36P/Z/v+p888pM69jMMfS8Xd8F6I1kQ/I9HUGg==", + "dev": true + }, + "node_modules/argparse": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/argparse/-/argparse-2.0.1.tgz", + "integrity": "sha512-8+9WqebbFzpX9OR+Wa6O29asIogeRMzcGtAINdpMHHyAg10f05aSFVBbcEqGf/PXw1EjAZ+q2/bEBg3DvurK3Q==", + "dev": true + }, + "node_modules/array-buffer-byte-length": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/array-buffer-byte-length/-/array-buffer-byte-length-1.0.1.tgz", + "integrity": "sha512-ahC5W1xgou+KTXix4sAO8Ki12Q+jf4i0+tmk3sC+zgcynshkHxzpXdImBehiUYKKKDwvfFiJl1tZt6ewscS1Mg==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.5", + "is-array-buffer": "^3.0.4" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/array-includes": { + "version": "3.1.8", + "resolved": "https://registry.npmjs.org/array-includes/-/array-includes-3.1.8.tgz", + "integrity": "sha512-itaWrbYbqpGXkGhZPGUulwnhVf5Hpy1xiCFsGqyIGglbBxmG5vSjxQen3/WGOjPpNEv1RtBLKxbmVXm8HpJStQ==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.7", + "define-properties": "^1.2.1", + "es-abstract": "^1.23.2", + "es-object-atoms": "^1.0.0", + "get-intrinsic": "^1.2.4", + "is-string": "^1.0.7" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/array.prototype.findlast": { + "version": "1.2.5", + "resolved": "https://registry.npmjs.org/array.prototype.findlast/-/array.prototype.findlast-1.2.5.tgz", + "integrity": "sha512-CVvd6FHg1Z3POpBLxO6E6zr+rSKEQ9L6rZHAaY7lLfhKsWYUBBOuMs0e9o24oopj6H+geRCX0YJ+TJLBK2eHyQ==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.7", + "define-properties": "^1.2.1", + "es-abstract": "^1.23.2", + "es-errors": "^1.3.0", + "es-object-atoms": "^1.0.0", + "es-shim-unscopables": "^1.0.2" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/array.prototype.flat": { + "version": "1.3.2", + "resolved": "https://registry.npmjs.org/array.prototype.flat/-/array.prototype.flat-1.3.2.tgz", + "integrity": "sha512-djYB+Zx2vLewY8RWlNCUdHjDXs2XOgm602S9E7P/UpHgfeHL00cRiIF+IN/G/aUJ7kGPb6yO/ErDI5V2s8iycA==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.2", + "define-properties": "^1.2.0", + "es-abstract": "^1.22.1", + "es-shim-unscopables": "^1.0.0" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/array.prototype.flatmap": { + "version": "1.3.2", + "resolved": "https://registry.npmjs.org/array.prototype.flatmap/-/array.prototype.flatmap-1.3.2.tgz", + "integrity": "sha512-Ewyx0c9PmpcsByhSW4r+9zDU7sGjFc86qf/kKtuSCRdhfbk0SNLLkaT5qvcHnRGgc5NP/ly/y+qkXkqONX54CQ==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.2", + "define-properties": "^1.2.0", + "es-abstract": "^1.22.1", + "es-shim-unscopables": "^1.0.0" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/array.prototype.toreversed": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/array.prototype.toreversed/-/array.prototype.toreversed-1.1.2.tgz", + "integrity": "sha512-wwDCoT4Ck4Cz7sLtgUmzR5UV3YF5mFHUlbChCzZBQZ+0m2cl/DH3tKgvphv1nKgFsJ48oCSg6p91q2Vm0I/ZMA==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.2", + "define-properties": "^1.2.0", + "es-abstract": "^1.22.1", + "es-shim-unscopables": "^1.0.0" + } + }, + "node_modules/array.prototype.tosorted": { + "version": "1.1.3", + "resolved": "https://registry.npmjs.org/array.prototype.tosorted/-/array.prototype.tosorted-1.1.3.tgz", + "integrity": "sha512-/DdH4TiTmOKzyQbp/eadcCVexiCb36xJg7HshYOYJnNZFDj33GEv0P7GxsynpShhq4OLYJzbGcBDkLsDt7MnNg==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.5", + "define-properties": "^1.2.1", + "es-abstract": "^1.22.3", + "es-errors": "^1.1.0", + "es-shim-unscopables": "^1.0.2" + } + }, + "node_modules/arraybuffer.prototype.slice": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/arraybuffer.prototype.slice/-/arraybuffer.prototype.slice-1.0.3.tgz", + "integrity": "sha512-bMxMKAjg13EBSVscxTaYA4mRc5t1UAXa2kXiGTNfZ079HIWXEkKmkgFrh/nJqamaLSrXO5H4WFFkPEaLJWbs3A==", + "dev": true, + "dependencies": { + "array-buffer-byte-length": "^1.0.1", + "call-bind": "^1.0.5", + "define-properties": "^1.2.1", + "es-abstract": "^1.22.3", + "es-errors": "^1.2.1", + "get-intrinsic": "^1.2.3", + "is-array-buffer": "^3.0.4", + "is-shared-array-buffer": "^1.0.2" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/autoprefixer": { + "version": "10.4.19", + "resolved": "https://registry.npmjs.org/autoprefixer/-/autoprefixer-10.4.19.tgz", + "integrity": "sha512-BaENR2+zBZ8xXhM4pUaKUxlVdxZ0EZhjvbopwnXmxRUfqDmwSpC2lAi/QXvx7NRdPCo1WKEcEF6mV64si1z4Ew==", + "dev": true, + "funding": [ + { + "type": "opencollective", + "url": "https://opencollective.com/postcss/" + }, + { + "type": "tidelift", + "url": "https://tidelift.com/funding/github/npm/autoprefixer" + }, + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ], + "dependencies": { + "browserslist": "^4.23.0", + "caniuse-lite": "^1.0.30001599", + "fraction.js": "^4.3.7", + "normalize-range": "^0.1.2", + "picocolors": "^1.0.0", + "postcss-value-parser": "^4.2.0" + }, + "bin": { + "autoprefixer": "bin/autoprefixer" + }, + "engines": { + "node": "^10 || ^12 || >=14" + }, + "peerDependencies": { + "postcss": "^8.1.0" + } + }, + "node_modules/available-typed-arrays": { + "version": "1.0.7", + "resolved": "https://registry.npmjs.org/available-typed-arrays/-/available-typed-arrays-1.0.7.tgz", + "integrity": "sha512-wvUjBtSGN7+7SjNpq/9M2Tg350UZD3q62IFZLbRAR1bSMlCo1ZaeW+BJ+D090e4hIIZLBcTDWe4Mh4jvUDajzQ==", + "dev": true, + "dependencies": { + "possible-typed-array-names": "^1.0.0" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/balanced-match": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/balanced-match/-/balanced-match-1.0.2.tgz", + "integrity": "sha512-3oSeUO0TMV67hN1AmbXsK4yaqU7tjiHlbxRDZOpH0KW9+CeX4bRAaX0Anxt0tx2MrpRpWwQaPwIlISEJhYU5Pw==", + "dev": true + }, + "node_modules/binary-extensions": { + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/binary-extensions/-/binary-extensions-2.3.0.tgz", + "integrity": "sha512-Ceh+7ox5qe7LJuLHoY0feh3pHuUDHAcRUeyL2VYghZwfpkNIy/+8Ocg0a3UuSoYzavmylwuLWQOf3hl0jjMMIw==", + "dev": true, + "engines": { + "node": ">=8" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/brace-expansion": { + "version": "1.1.11", + "resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.11.tgz", + "integrity": "sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==", + "dev": true, + "dependencies": { + "balanced-match": "^1.0.0", + "concat-map": "0.0.1" + } + }, + "node_modules/braces": { + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/braces/-/braces-3.0.2.tgz", + "integrity": "sha512-b8um+L1RzM3WDSzvhm6gIz1yfTbBt6YTlcEKAvsmqCZZFw46z626lVj9j1yEPW33H5H+lBQpZMP1k8l+78Ha0A==", + "dev": true, + "dependencies": { + "fill-range": "^7.0.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/browserslist": { + "version": "4.23.0", + "resolved": "https://registry.npmjs.org/browserslist/-/browserslist-4.23.0.tgz", + "integrity": "sha512-QW8HiM1shhT2GuzkvklfjcKDiWFXHOeFCIA/huJPwHsslwcydgk7X+z2zXpEijP98UCY7HbubZt5J2Zgvf0CaQ==", + "dev": true, + "funding": [ + { + "type": "opencollective", + "url": "https://opencollective.com/browserslist" + }, + { + "type": "tidelift", + "url": "https://tidelift.com/funding/github/npm/browserslist" + }, + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ], + "dependencies": { + "caniuse-lite": "^1.0.30001587", + "electron-to-chromium": "^1.4.668", + "node-releases": "^2.0.14", + "update-browserslist-db": "^1.0.13" + }, + "bin": { + "browserslist": "cli.js" + }, + "engines": { + "node": "^6 || ^7 || ^8 || ^9 || ^10 || ^11 || ^12 || >=13.7" + } + }, + "node_modules/call-bind": { + "version": "1.0.7", + "resolved": "https://registry.npmjs.org/call-bind/-/call-bind-1.0.7.tgz", + "integrity": "sha512-GHTSNSYICQ7scH7sZ+M2rFopRoLh8t2bLSW6BbgrtLsahOIB5iyAVJf9GjWK3cYTDaMj4XdBpM1cA6pIS0Kv2w==", + "dev": true, + "dependencies": { + "es-define-property": "^1.0.0", + "es-errors": "^1.3.0", + "function-bind": "^1.1.2", + "get-intrinsic": "^1.2.4", + "set-function-length": "^1.2.1" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/callsites": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/callsites/-/callsites-3.1.0.tgz", + "integrity": "sha512-P8BjAsXvZS+VIDUI11hHCQEv74YT67YUi5JJFNWIqL235sBmjX4+qx9Muvls5ivyNENctx46xQLQ3aTuE7ssaQ==", + "dev": true, + "engines": { + "node": ">=6" + } + }, + "node_modules/camelcase-css": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/camelcase-css/-/camelcase-css-2.0.1.tgz", + "integrity": "sha512-QOSvevhslijgYwRx6Rv7zKdMF8lbRmx+uQGx2+vDc+KI/eBnsy9kit5aj23AgGu3pa4t9AgwbnXWqS+iOY+2aA==", + "engines": { + "node": ">= 6" + } + }, + "node_modules/caniuse-lite": { + "version": "1.0.30001611", + "resolved": "https://registry.npmjs.org/caniuse-lite/-/caniuse-lite-1.0.30001611.tgz", + "integrity": "sha512-19NuN1/3PjA3QI8Eki55N8my4LzfkMCRLgCVfrl/slbSAchQfV0+GwjPrK3rq37As4UCLlM/DHajbKkAqbv92Q==", + "dev": true, + "funding": [ + { + "type": "opencollective", + "url": "https://opencollective.com/browserslist" + }, + { + "type": "tidelift", + "url": "https://tidelift.com/funding/github/npm/caniuse-lite" + }, + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ] + }, + "node_modules/chalk": { + "version": "2.4.2", + "resolved": "https://registry.npmjs.org/chalk/-/chalk-2.4.2.tgz", + "integrity": "sha512-Mti+f9lpJNcwF4tWV8/OrTTtF1gZi+f8FqlyAdouralcFWFQWF2+NgCHShjkCb+IFBLq9buZwE1xckQU4peSuQ==", + "dev": true, + "dependencies": { + "ansi-styles": "^3.2.1", + "escape-string-regexp": "^1.0.5", + "supports-color": "^5.3.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/chokidar": { + "version": "3.6.0", + "resolved": "https://registry.npmjs.org/chokidar/-/chokidar-3.6.0.tgz", + "integrity": "sha512-7VT13fmjotKpGipCW9JEQAusEPE+Ei8nl6/g4FBAmIm0GOOLMua9NDDo/DWp0ZAxCr3cPq5ZpBqmPAQgDda2Pw==", + "dev": true, + "dependencies": { + "anymatch": "~3.1.2", + "braces": "~3.0.2", + "glob-parent": "~5.1.2", + "is-binary-path": "~2.1.0", + "is-glob": "~4.0.1", + "normalize-path": "~3.0.0", + "readdirp": "~3.6.0" + }, + "engines": { + "node": ">= 8.10.0" + }, + "funding": { + "url": "https://paulmillr.com/funding/" + }, + "optionalDependencies": { + "fsevents": "~2.3.2" + } + }, + "node_modules/chokidar/node_modules/glob-parent": { + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-5.1.2.tgz", + "integrity": "sha512-AOIgSQCepiJYwP3ARnGx+5VnTu2HBYdzbGP45eLw1vr3zB3vZLeyed1sC9hnbcOc9/SrMyM5RPQrkGz4aS9Zow==", + "dev": true, + "dependencies": { + "is-glob": "^4.0.1" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/color-convert": { + "version": "1.9.3", + "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-1.9.3.tgz", + "integrity": "sha512-QfAUtd+vFdAtFQcC8CCyYt1fYWxSqAiK2cSD6zDB8N3cpsEBAvRxp9zOGg6G/SHHJYAT88/az/IuDGALsNVbGg==", + "dev": true, + "dependencies": { + "color-name": "1.1.3" + } + }, + "node_modules/color-name": { + "version": "1.1.3", + "resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.3.tgz", + "integrity": "sha512-72fSenhMw2HZMTVHeCA9KCmpEIbzWiQsjN+BHcBbS9vr1mtt+vJjPdksIBNUmKAW8TFUDPJK5SUU3QhE9NEXDw==", + "dev": true + }, + "node_modules/commander": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/commander/-/commander-4.1.1.tgz", + "integrity": "sha512-NOKm8xhkzAjzFx8B2v5OAHT+u5pRQc2UCa2Vq9jYL/31o2wi9mxBA7LIFs3sV5VSC49z6pEhfbMULvShKj26WA==", + "dev": true, + "engines": { + "node": ">= 6" + } + }, + "node_modules/concat-map": { + "version": "0.0.1", + "resolved": "https://registry.npmjs.org/concat-map/-/concat-map-0.0.1.tgz", + "integrity": "sha512-/Srv4dswyQNBfohGpz9o6Yb3Gz3SrUDqBH5rTuhGR7ahtlbYKnVxw2bCFMRljaA7EXHaXZ8wsHdodFvbkhKmqg==", + "dev": true + }, + "node_modules/convert-source-map": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/convert-source-map/-/convert-source-map-2.0.0.tgz", + "integrity": "sha512-Kvp459HrV2FEJ1CAsi1Ku+MY3kasH19TFykTz2xWmMeq6bk2NU3XXvfJ+Q61m0xktWwt+1HSYf3JZsTms3aRJg==", + "dev": true + }, + "node_modules/cross-spawn": { + "version": "7.0.3", + "resolved": "https://registry.npmjs.org/cross-spawn/-/cross-spawn-7.0.3.tgz", + "integrity": "sha512-iRDPJKUPVEND7dHPO8rkbOnPpyDygcDFtWjpeWNCgy8WP2rXcxXL8TskReQl6OrB2G7+UJrags1q15Fudc7G6w==", + "dev": true, + "dependencies": { + "path-key": "^3.1.0", + "shebang-command": "^2.0.0", + "which": "^2.0.1" + }, + "engines": { + "node": ">= 8" + } + }, + "node_modules/css-selector-tokenizer": { + "version": "0.8.0", + "resolved": "https://registry.npmjs.org/css-selector-tokenizer/-/css-selector-tokenizer-0.8.0.tgz", + "integrity": "sha512-Jd6Ig3/pe62/qe5SBPTN8h8LeUg/pT4lLgtavPf7updwwHpvFzxvOQBHYj2LZDMjUnBzgvIUSjRcf6oT5HzHFg==", + "dependencies": { + "cssesc": "^3.0.0", + "fastparse": "^1.1.2" + } + }, + "node_modules/cssesc": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/cssesc/-/cssesc-3.0.0.tgz", + "integrity": "sha512-/Tb/JcjK111nNScGob5MNtsntNM1aCNUDipB/TkwZFhyDrrE47SOx/18wF2bbjgc3ZzCSKW1T5nt5EbFoAz/Vg==", + "bin": { + "cssesc": "bin/cssesc" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/csstype": { + "version": "3.1.3", + "resolved": "https://registry.npmjs.org/csstype/-/csstype-3.1.3.tgz", + "integrity": "sha512-M1uQkMl8rQK/szD0LNhtqxIPLpimGm8sOBwU7lLnCpSbTyY3yeU1Vc7l4KT5zT4s/yOxHH5O7tIuuLOCnLADRw==", + "dev": true + }, + "node_modules/culori": { + "version": "3.3.0", + "resolved": "https://registry.npmjs.org/culori/-/culori-3.3.0.tgz", + "integrity": "sha512-pHJg+jbuFsCjz9iclQBqyL3B2HLCBF71BwVNujUYEvCeQMvV97R59MNK3R2+jgJ3a1fcZgI9B3vYgz8lzr/BFQ==", + "engines": { + "node": "^12.20.0 || ^14.13.1 || >=16.0.0" + } + }, + "node_modules/daisyui": { + "version": "4.10.2", + "resolved": "https://registry.npmjs.org/daisyui/-/daisyui-4.10.2.tgz", + "integrity": "sha512-eCWS1W/JPyxW9IvlgW5m0R6rp9ZhRsBTW37rvEUthckkjsV04u8XipV519OoccSA46ixhSJa3q7XLI1WUFtRCA==", + "dependencies": { + "css-selector-tokenizer": "^0.8", + "culori": "^3", + "picocolors": "^1", + "postcss-js": "^4" + }, + "engines": { + "node": ">=16.9.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/daisyui" + } + }, + "node_modules/data-view-buffer": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/data-view-buffer/-/data-view-buffer-1.0.1.tgz", + "integrity": "sha512-0lht7OugA5x3iJLOWFhWK/5ehONdprk0ISXqVFn/NFrDu+cuc8iADFrGQz5BnRK7LLU3JmkbXSxaqX+/mXYtUA==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.6", + "es-errors": "^1.3.0", + "is-data-view": "^1.0.1" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/data-view-byte-length": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/data-view-byte-length/-/data-view-byte-length-1.0.1.tgz", + "integrity": "sha512-4J7wRJD3ABAzr8wP+OcIcqq2dlUKp4DVflx++hs5h5ZKydWMI6/D/fAot+yh6g2tHh8fLFTvNOaVN357NvSrOQ==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.7", + "es-errors": "^1.3.0", + "is-data-view": "^1.0.1" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/data-view-byte-offset": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/data-view-byte-offset/-/data-view-byte-offset-1.0.0.tgz", + "integrity": "sha512-t/Ygsytq+R995EJ5PZlD4Cu56sWa8InXySaViRzw9apusqsOO2bQP+SbYzAhR0pFKoB+43lYy8rWban9JSuXnA==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.6", + "es-errors": "^1.3.0", + "is-data-view": "^1.0.1" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/debug": { + "version": "4.3.4", + "resolved": "https://registry.npmjs.org/debug/-/debug-4.3.4.tgz", + "integrity": "sha512-PRWFHuSU3eDtQJPvnNY7Jcket1j0t5OuOsFzPPzsekD52Zl8qUfFIPEiswXqIvHWGVHOgX+7G/vCNNhehwxfkQ==", + "dev": true, + "dependencies": { + "ms": "2.1.2" + }, + "engines": { + "node": ">=6.0" + }, + "peerDependenciesMeta": { + "supports-color": { + "optional": true + } + } + }, + "node_modules/deep-is": { + "version": "0.1.4", + "resolved": "https://registry.npmjs.org/deep-is/-/deep-is-0.1.4.tgz", + "integrity": "sha512-oIPzksmTg4/MriiaYGO+okXDT7ztn/w3Eptv/+gSIdMdKsJo0u4CfYNFJPy+4SKMuCqGw2wxnA+URMg3t8a/bQ==", + "dev": true + }, + "node_modules/define-data-property": { + "version": "1.1.4", + "resolved": "https://registry.npmjs.org/define-data-property/-/define-data-property-1.1.4.tgz", + "integrity": "sha512-rBMvIzlpA8v6E+SJZoo++HAYqsLrkg7MSfIinMPFhmkorw7X+dOXVJQs+QT69zGkzMyfDnIMN2Wid1+NbL3T+A==", + "dev": true, + "dependencies": { + "es-define-property": "^1.0.0", + "es-errors": "^1.3.0", + "gopd": "^1.0.1" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/define-properties": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/define-properties/-/define-properties-1.2.1.tgz", + "integrity": "sha512-8QmQKqEASLd5nx0U1B1okLElbUuuttJ/AnYmRXbbbGDWh6uS208EjD4Xqq/I9wK7u0v6O08XhTWnt5XtEbR6Dg==", + "dev": true, + "dependencies": { + "define-data-property": "^1.0.1", + "has-property-descriptors": "^1.0.0", + "object-keys": "^1.1.1" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/didyoumean": { + "version": "1.2.2", + "resolved": "https://registry.npmjs.org/didyoumean/-/didyoumean-1.2.2.tgz", + "integrity": "sha512-gxtyfqMg7GKyhQmb056K7M3xszy/myH8w+B4RT+QXBQsvAOdc3XymqDDPHx1BgPgsdAA5SIifona89YtRATDzw==", + "dev": true + }, + "node_modules/dlv": { + "version": "1.1.3", + "resolved": "https://registry.npmjs.org/dlv/-/dlv-1.1.3.tgz", + "integrity": "sha512-+HlytyjlPKnIG8XuRG8WvmBP8xs8P71y+SKKS6ZXWoEgLuePxtDoUEiH7WkdePWrQ5JBpE6aoVqfZfJUQkjXwA==", + "dev": true + }, + "node_modules/doctrine": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/doctrine/-/doctrine-3.0.0.tgz", + "integrity": "sha512-yS+Q5i3hBf7GBkd4KG8a7eBNNWNGLTaEwwYWUijIYM7zrlYDM0BFXHjjPWlWZ1Rg7UaddZeIDmi9jF3HmqiQ2w==", + "dev": true, + "dependencies": { + "esutils": "^2.0.2" + }, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/eastasianwidth": { + "version": "0.2.0", + "resolved": "https://registry.npmjs.org/eastasianwidth/-/eastasianwidth-0.2.0.tgz", + "integrity": "sha512-I88TYZWc9XiYHRQ4/3c5rjjfgkjhLyW2luGIheGERbNQ6OY7yTybanSpDXZa8y7VUP9YmDcYa+eyq4ca7iLqWA==", + "dev": true + }, + "node_modules/electron-to-chromium": { + "version": "1.4.740", + "resolved": "https://registry.npmjs.org/electron-to-chromium/-/electron-to-chromium-1.4.740.tgz", + "integrity": "sha512-Yvg5i+iyv7Xm18BRdVPVm8lc7kgxM3r6iwqCH2zB7QZy1kZRNmd0Zqm0zcD9XoFREE5/5rwIuIAOT+/mzGcnZg==", + "dev": true + }, + "node_modules/emoji-regex": { + "version": "9.2.2", + "resolved": "https://registry.npmjs.org/emoji-regex/-/emoji-regex-9.2.2.tgz", + "integrity": "sha512-L18DaJsXSUk2+42pv8mLs5jJT2hqFkFE4j21wOmgbUqsZ2hL72NsUU785g9RXgo3s0ZNgVl42TiHp3ZtOv/Vyg==", + "dev": true + }, + "node_modules/es-abstract": { + "version": "1.23.3", + "resolved": "https://registry.npmjs.org/es-abstract/-/es-abstract-1.23.3.tgz", + "integrity": "sha512-e+HfNH61Bj1X9/jLc5v1owaLYuHdeHHSQlkhCBiTK8rBvKaULl/beGMxwrMXjpYrv4pz22BlY570vVePA2ho4A==", + "dev": true, + "dependencies": { + "array-buffer-byte-length": "^1.0.1", + "arraybuffer.prototype.slice": "^1.0.3", + "available-typed-arrays": "^1.0.7", + "call-bind": "^1.0.7", + "data-view-buffer": "^1.0.1", + "data-view-byte-length": "^1.0.1", + "data-view-byte-offset": "^1.0.0", + "es-define-property": "^1.0.0", + "es-errors": "^1.3.0", + "es-object-atoms": "^1.0.0", + "es-set-tostringtag": "^2.0.3", + "es-to-primitive": "^1.2.1", + "function.prototype.name": "^1.1.6", + "get-intrinsic": "^1.2.4", + "get-symbol-description": "^1.0.2", + "globalthis": "^1.0.3", + "gopd": "^1.0.1", + "has-property-descriptors": "^1.0.2", + "has-proto": "^1.0.3", + "has-symbols": "^1.0.3", + "hasown": "^2.0.2", + "internal-slot": "^1.0.7", + "is-array-buffer": "^3.0.4", + "is-callable": "^1.2.7", + "is-data-view": "^1.0.1", + "is-negative-zero": "^2.0.3", + "is-regex": "^1.1.4", + "is-shared-array-buffer": "^1.0.3", + "is-string": "^1.0.7", + "is-typed-array": "^1.1.13", + "is-weakref": "^1.0.2", + "object-inspect": "^1.13.1", + "object-keys": "^1.1.1", + "object.assign": "^4.1.5", + "regexp.prototype.flags": "^1.5.2", + "safe-array-concat": "^1.1.2", + "safe-regex-test": "^1.0.3", + "string.prototype.trim": "^1.2.9", + "string.prototype.trimend": "^1.0.8", + "string.prototype.trimstart": "^1.0.8", + "typed-array-buffer": "^1.0.2", + "typed-array-byte-length": "^1.0.1", + "typed-array-byte-offset": "^1.0.2", + "typed-array-length": "^1.0.6", + "unbox-primitive": "^1.0.2", + "which-typed-array": "^1.1.15" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/es-define-property": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/es-define-property/-/es-define-property-1.0.0.tgz", + "integrity": "sha512-jxayLKShrEqqzJ0eumQbVhTYQM27CfT1T35+gCgDFoL82JLsXqTJ76zv6A0YLOgEnLUMvLzsDsGIrl8NFpT2gQ==", + "dev": true, + "dependencies": { + "get-intrinsic": "^1.2.4" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/es-errors": { + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/es-errors/-/es-errors-1.3.0.tgz", + "integrity": "sha512-Zf5H2Kxt2xjTvbJvP2ZWLEICxA6j+hAmMzIlypy4xcBg1vKVnx89Wy0GbS+kf5cwCVFFzdCFh2XSCFNULS6csw==", + "dev": true, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/es-iterator-helpers": { + "version": "1.0.18", + "resolved": "https://registry.npmjs.org/es-iterator-helpers/-/es-iterator-helpers-1.0.18.tgz", + "integrity": "sha512-scxAJaewsahbqTYrGKJihhViaM6DDZDDoucfvzNbK0pOren1g/daDQ3IAhzn+1G14rBG7w+i5N+qul60++zlKA==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.7", + "define-properties": "^1.2.1", + "es-abstract": "^1.23.0", + "es-errors": "^1.3.0", + "es-set-tostringtag": "^2.0.3", + "function-bind": "^1.1.2", + "get-intrinsic": "^1.2.4", + "globalthis": "^1.0.3", + "has-property-descriptors": "^1.0.2", + "has-proto": "^1.0.3", + "has-symbols": "^1.0.3", + "internal-slot": "^1.0.7", + "iterator.prototype": "^1.1.2", + "safe-array-concat": "^1.1.2" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/es-object-atoms": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/es-object-atoms/-/es-object-atoms-1.0.0.tgz", + "integrity": "sha512-MZ4iQ6JwHOBQjahnjwaC1ZtIBH+2ohjamzAO3oaHcXYup7qxjF2fixyH+Q71voWHeOkI2q/TnJao/KfXYIZWbw==", + "dev": true, + "dependencies": { + "es-errors": "^1.3.0" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/es-set-tostringtag": { + "version": "2.0.3", + "resolved": "https://registry.npmjs.org/es-set-tostringtag/-/es-set-tostringtag-2.0.3.tgz", + "integrity": "sha512-3T8uNMC3OQTHkFUsFq8r/BwAXLHvU/9O9mE0fBc/MY5iq/8H7ncvO947LmYA6ldWw9Uh8Yhf25zu6n7nML5QWQ==", + "dev": true, + "dependencies": { + "get-intrinsic": "^1.2.4", + "has-tostringtag": "^1.0.2", + "hasown": "^2.0.1" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/es-shim-unscopables": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/es-shim-unscopables/-/es-shim-unscopables-1.0.2.tgz", + "integrity": "sha512-J3yBRXCzDu4ULnQwxyToo/OjdMx6akgVC7K6few0a7F/0wLtmKKN7I73AH5T2836UuXRqN7Qg+IIUw/+YJksRw==", + "dev": true, + "dependencies": { + "hasown": "^2.0.0" + } + }, + "node_modules/es-to-primitive": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/es-to-primitive/-/es-to-primitive-1.2.1.tgz", + "integrity": "sha512-QCOllgZJtaUo9miYBcLChTUaHNjJF3PYs1VidD7AwiEj1kYxKeQTctLAezAOH5ZKRH0g2IgPn6KwB4IT8iRpvA==", + "dev": true, + "dependencies": { + "is-callable": "^1.1.4", + "is-date-object": "^1.0.1", + "is-symbol": "^1.0.2" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/esbuild": { + "version": "0.20.2", + "resolved": "https://registry.npmjs.org/esbuild/-/esbuild-0.20.2.tgz", + "integrity": "sha512-WdOOppmUNU+IbZ0PaDiTst80zjnrOkyJNHoKupIcVyU8Lvla3Ugx94VzkQ32Ijqd7UhHJy75gNWDMUekcrSJ6g==", + "dev": true, + "hasInstallScript": true, + "bin": { + "esbuild": "bin/esbuild" + }, + "engines": { + "node": ">=12" + }, + "optionalDependencies": { + "@esbuild/aix-ppc64": "0.20.2", + "@esbuild/android-arm": "0.20.2", + "@esbuild/android-arm64": "0.20.2", + "@esbuild/android-x64": "0.20.2", + "@esbuild/darwin-arm64": "0.20.2", + "@esbuild/darwin-x64": "0.20.2", + "@esbuild/freebsd-arm64": "0.20.2", + "@esbuild/freebsd-x64": "0.20.2", + "@esbuild/linux-arm": "0.20.2", + "@esbuild/linux-arm64": "0.20.2", + "@esbuild/linux-ia32": "0.20.2", + "@esbuild/linux-loong64": "0.20.2", + "@esbuild/linux-mips64el": "0.20.2", + "@esbuild/linux-ppc64": "0.20.2", + "@esbuild/linux-riscv64": "0.20.2", + "@esbuild/linux-s390x": "0.20.2", + "@esbuild/linux-x64": "0.20.2", + "@esbuild/netbsd-x64": "0.20.2", + "@esbuild/openbsd-x64": "0.20.2", + "@esbuild/sunos-x64": "0.20.2", + "@esbuild/win32-arm64": "0.20.2", + "@esbuild/win32-ia32": "0.20.2", + "@esbuild/win32-x64": "0.20.2" + } + }, + "node_modules/escalade": { + "version": "3.1.2", + "resolved": "https://registry.npmjs.org/escalade/-/escalade-3.1.2.tgz", + "integrity": "sha512-ErCHMCae19vR8vQGe50xIsVomy19rg6gFu3+r3jkEO46suLMWBksvVyoGgQV+jOfl84ZSOSlmv6Gxa89PmTGmA==", + "dev": true, + "engines": { + "node": ">=6" + } + }, + "node_modules/escape-string-regexp": { + "version": "1.0.5", + "resolved": "https://registry.npmjs.org/escape-string-regexp/-/escape-string-regexp-1.0.5.tgz", + "integrity": "sha512-vbRorB5FUQWvla16U8R/qgaFIya2qGzwDrNmCZuYKrbdSUMG6I1ZCGQRefkRVhuOkIGVne7BQ35DSfo1qvJqFg==", + "dev": true, + "engines": { + "node": ">=0.8.0" + } + }, + "node_modules/eslint": { + "version": "8.57.0", + "resolved": "https://registry.npmjs.org/eslint/-/eslint-8.57.0.tgz", + "integrity": "sha512-dZ6+mexnaTIbSBZWgou51U6OmzIhYM2VcNdtiTtI7qPNZm35Akpr0f6vtw3w1Kmn5PYo+tZVfh13WrhpS6oLqQ==", + "dev": true, + "dependencies": { + "@eslint-community/eslint-utils": "^4.2.0", + "@eslint-community/regexpp": "^4.6.1", + "@eslint/eslintrc": "^2.1.4", + "@eslint/js": "8.57.0", + "@humanwhocodes/config-array": "^0.11.14", + "@humanwhocodes/module-importer": "^1.0.1", + "@nodelib/fs.walk": "^1.2.8", + "@ungap/structured-clone": "^1.2.0", + "ajv": "^6.12.4", + "chalk": "^4.0.0", + "cross-spawn": "^7.0.2", + "debug": "^4.3.2", + "doctrine": "^3.0.0", + "escape-string-regexp": "^4.0.0", + "eslint-scope": "^7.2.2", + "eslint-visitor-keys": "^3.4.3", + "espree": "^9.6.1", + "esquery": "^1.4.2", + "esutils": "^2.0.2", + "fast-deep-equal": "^3.1.3", + "file-entry-cache": "^6.0.1", + "find-up": "^5.0.0", + "glob-parent": "^6.0.2", + "globals": "^13.19.0", + "graphemer": "^1.4.0", + "ignore": "^5.2.0", + "imurmurhash": "^0.1.4", + "is-glob": "^4.0.0", + "is-path-inside": "^3.0.3", + "js-yaml": "^4.1.0", + "json-stable-stringify-without-jsonify": "^1.0.1", + "levn": "^0.4.1", + "lodash.merge": "^4.6.2", + "minimatch": "^3.1.2", + "natural-compare": "^1.4.0", + "optionator": "^0.9.3", + "strip-ansi": "^6.0.1", + "text-table": "^0.2.0" + }, + "bin": { + "eslint": "bin/eslint.js" + }, + "engines": { + "node": "^12.22.0 || ^14.17.0 || >=16.0.0" + }, + "funding": { + "url": "https://opencollective.com/eslint" + } + }, + "node_modules/eslint-plugin-react": { + "version": "7.34.1", + "resolved": "https://registry.npmjs.org/eslint-plugin-react/-/eslint-plugin-react-7.34.1.tgz", + "integrity": "sha512-N97CxlouPT1AHt8Jn0mhhN2RrADlUAsk1/atcT2KyA/l9Q/E6ll7OIGwNumFmWfZ9skV3XXccYS19h80rHtgkw==", + "dev": true, + "dependencies": { + "array-includes": "^3.1.7", + "array.prototype.findlast": "^1.2.4", + "array.prototype.flatmap": "^1.3.2", + "array.prototype.toreversed": "^1.1.2", + "array.prototype.tosorted": "^1.1.3", + "doctrine": "^2.1.0", + "es-iterator-helpers": "^1.0.17", + "estraverse": "^5.3.0", + "jsx-ast-utils": "^2.4.1 || ^3.0.0", + "minimatch": "^3.1.2", + "object.entries": "^1.1.7", + "object.fromentries": "^2.0.7", + "object.hasown": "^1.1.3", + "object.values": "^1.1.7", + "prop-types": "^15.8.1", + "resolve": "^2.0.0-next.5", + "semver": "^6.3.1", + "string.prototype.matchall": "^4.0.10" + }, + "engines": { + "node": ">=4" + }, + "peerDependencies": { + "eslint": "^3 || ^4 || ^5 || ^6 || ^7 || ^8" + } + }, + "node_modules/eslint-plugin-react-hooks": { + "version": "4.6.0", + "resolved": "https://registry.npmjs.org/eslint-plugin-react-hooks/-/eslint-plugin-react-hooks-4.6.0.tgz", + "integrity": "sha512-oFc7Itz9Qxh2x4gNHStv3BqJq54ExXmfC+a1NjAta66IAN87Wu0R/QArgIS9qKzX3dXKPI9H5crl9QchNMY9+g==", + "dev": true, + "engines": { + "node": ">=10" + }, + "peerDependencies": { + "eslint": "^3.0.0 || ^4.0.0 || ^5.0.0 || ^6.0.0 || ^7.0.0 || ^8.0.0-0" + } + }, + "node_modules/eslint-plugin-react-refresh": { + "version": "0.4.6", + "resolved": "https://registry.npmjs.org/eslint-plugin-react-refresh/-/eslint-plugin-react-refresh-0.4.6.tgz", + "integrity": "sha512-NjGXdm7zgcKRkKMua34qVO9doI7VOxZ6ancSvBELJSSoX97jyndXcSoa8XBh69JoB31dNz3EEzlMcizZl7LaMA==", + "dev": true, + "peerDependencies": { + "eslint": ">=7" + } + }, + "node_modules/eslint-plugin-react/node_modules/doctrine": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/doctrine/-/doctrine-2.1.0.tgz", + "integrity": "sha512-35mSku4ZXK0vfCuHEDAwt55dg2jNajHZ1odvF+8SSr82EsZY4QmXfuWso8oEd8zRhVObSN18aM0CjSdoBX7zIw==", + "dev": true, + "dependencies": { + "esutils": "^2.0.2" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/eslint-scope": { + "version": "7.2.2", + "resolved": "https://registry.npmjs.org/eslint-scope/-/eslint-scope-7.2.2.tgz", + "integrity": "sha512-dOt21O7lTMhDM+X9mB4GX+DZrZtCUJPL/wlcTqxyrx5IvO0IYtILdtrQGQp+8n5S0gwSVmOf9NQrjMOgfQZlIg==", + "dev": true, + "dependencies": { + "esrecurse": "^4.3.0", + "estraverse": "^5.2.0" + }, + "engines": { + "node": "^12.22.0 || ^14.17.0 || >=16.0.0" + }, + "funding": { + "url": "https://opencollective.com/eslint" + } + }, + "node_modules/eslint-visitor-keys": { + "version": "3.4.3", + "resolved": "https://registry.npmjs.org/eslint-visitor-keys/-/eslint-visitor-keys-3.4.3.tgz", + "integrity": "sha512-wpc+LXeiyiisxPlEkUzU6svyS1frIO3Mgxj1fdy7Pm8Ygzguax2N3Fa/D/ag1WqbOprdI+uY6wMUl8/a2G+iag==", + "dev": true, + "engines": { + "node": "^12.22.0 || ^14.17.0 || >=16.0.0" + }, + "funding": { + "url": "https://opencollective.com/eslint" + } + }, + "node_modules/eslint/node_modules/ansi-styles": { + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", + "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==", + "dev": true, + "dependencies": { + "color-convert": "^2.0.1" + }, + "engines": { + "node": ">=8" + }, + "funding": { + "url": "https://github.com/chalk/ansi-styles?sponsor=1" + } + }, + "node_modules/eslint/node_modules/chalk": { + "version": "4.1.2", + "resolved": "https://registry.npmjs.org/chalk/-/chalk-4.1.2.tgz", + "integrity": "sha512-oKnbhFyRIXpUuez8iBMmyEa4nbj4IOQyuhc/wy9kY7/WVPcwIO9VA668Pu8RkO7+0G76SLROeyw9CpQ061i4mA==", + "dev": true, + "dependencies": { + "ansi-styles": "^4.1.0", + "supports-color": "^7.1.0" + }, + "engines": { + "node": ">=10" + }, + "funding": { + "url": "https://github.com/chalk/chalk?sponsor=1" + } + }, + "node_modules/eslint/node_modules/color-convert": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-2.0.1.tgz", + "integrity": "sha512-RRECPsj7iu/xb5oKYcsFHSppFNnsj/52OVTRKb4zP5onXwVF3zVmmToNcOfGC+CRDpfK/U584fMg38ZHCaElKQ==", + "dev": true, + "dependencies": { + "color-name": "~1.1.4" + }, + "engines": { + "node": ">=7.0.0" + } + }, + "node_modules/eslint/node_modules/color-name": { + "version": "1.1.4", + "resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.4.tgz", + "integrity": "sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==", + "dev": true + }, + "node_modules/eslint/node_modules/escape-string-regexp": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/escape-string-regexp/-/escape-string-regexp-4.0.0.tgz", + "integrity": "sha512-TtpcNJ3XAzx3Gq8sWRzJaVajRs0uVxA2YAkdb1jm2YkPz4G6egUFAyA3n5vtEIZefPk5Wa4UXbKuS5fKkJWdgA==", + "dev": true, + "engines": { + "node": ">=10" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/eslint/node_modules/globals": { + "version": "13.24.0", + "resolved": "https://registry.npmjs.org/globals/-/globals-13.24.0.tgz", + "integrity": "sha512-AhO5QUcj8llrbG09iWhPU2B204J1xnPeL8kQmVorSsy+Sjj1sk8gIyh6cUocGmH4L0UuhAJy+hJMRA4mgA4mFQ==", + "dev": true, + "dependencies": { + "type-fest": "^0.20.2" + }, + "engines": { + "node": ">=8" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/eslint/node_modules/has-flag": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz", + "integrity": "sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ==", + "dev": true, + "engines": { + "node": ">=8" + } + }, + "node_modules/eslint/node_modules/supports-color": { + "version": "7.2.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", + "integrity": "sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw==", + "dev": true, + "dependencies": { + "has-flag": "^4.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/espree": { + "version": "9.6.1", + "resolved": "https://registry.npmjs.org/espree/-/espree-9.6.1.tgz", + "integrity": "sha512-oruZaFkjorTpF32kDSI5/75ViwGeZginGGy2NoOSg3Q9bnwlnmDm4HLnkl0RE3n+njDXR037aY1+x58Z/zFdwQ==", + "dev": true, + "dependencies": { + "acorn": "^8.9.0", + "acorn-jsx": "^5.3.2", + "eslint-visitor-keys": "^3.4.1" + }, + "engines": { + "node": "^12.22.0 || ^14.17.0 || >=16.0.0" + }, + "funding": { + "url": "https://opencollective.com/eslint" + } + }, + "node_modules/esquery": { + "version": "1.5.0", + "resolved": "https://registry.npmjs.org/esquery/-/esquery-1.5.0.tgz", + "integrity": "sha512-YQLXUplAwJgCydQ78IMJywZCceoqk1oH01OERdSAJc/7U2AylwjhSCLDEtqwg811idIS/9fIU5GjG73IgjKMVg==", + "dev": true, + "dependencies": { + "estraverse": "^5.1.0" + }, + "engines": { + "node": ">=0.10" + } + }, + "node_modules/esrecurse": { + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/esrecurse/-/esrecurse-4.3.0.tgz", + "integrity": "sha512-KmfKL3b6G+RXvP8N1vr3Tq1kL/oCFgn2NYXEtqP8/L3pKapUA4G8cFVaoF3SU323CD4XypR/ffioHmkti6/Tag==", + "dev": true, + "dependencies": { + "estraverse": "^5.2.0" + }, + "engines": { + "node": ">=4.0" + } + }, + "node_modules/estraverse": { + "version": "5.3.0", + "resolved": "https://registry.npmjs.org/estraverse/-/estraverse-5.3.0.tgz", + "integrity": "sha512-MMdARuVEQziNTeJD8DgMqmhwR11BRQ/cBP+pLtYdSTnf3MIO8fFeiINEbX36ZdNlfU/7A9f3gUw49B3oQsvwBA==", + "dev": true, + "engines": { + "node": ">=4.0" + } + }, + "node_modules/esutils": { + "version": "2.0.3", + "resolved": "https://registry.npmjs.org/esutils/-/esutils-2.0.3.tgz", + "integrity": "sha512-kVscqXk4OCp68SZ0dkgEKVi6/8ij300KBWTJq32P/dYeWTSwK41WyTxalN1eRmA5Z9UU/LX9D7FWSmV9SAYx6g==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/fast-deep-equal": { + "version": "3.1.3", + "resolved": "https://registry.npmjs.org/fast-deep-equal/-/fast-deep-equal-3.1.3.tgz", + "integrity": "sha512-f3qQ9oQy9j2AhBe/H9VC91wLmKBCCU/gDOnKNAYG5hswO7BLKj09Hc5HYNz9cGI++xlpDCIgDaitVs03ATR84Q==", + "dev": true + }, + "node_modules/fast-glob": { + "version": "3.3.2", + "resolved": "https://registry.npmjs.org/fast-glob/-/fast-glob-3.3.2.tgz", + "integrity": "sha512-oX2ruAFQwf/Orj8m737Y5adxDQO0LAB7/S5MnxCdTNDd4p6BsyIVsv9JQsATbTSq8KHRpLwIHbVlUNatxd+1Ow==", + "dev": true, + "dependencies": { + "@nodelib/fs.stat": "^2.0.2", + "@nodelib/fs.walk": "^1.2.3", + "glob-parent": "^5.1.2", + "merge2": "^1.3.0", + "micromatch": "^4.0.4" + }, + "engines": { + "node": ">=8.6.0" + } + }, + "node_modules/fast-glob/node_modules/glob-parent": { + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-5.1.2.tgz", + "integrity": "sha512-AOIgSQCepiJYwP3ARnGx+5VnTu2HBYdzbGP45eLw1vr3zB3vZLeyed1sC9hnbcOc9/SrMyM5RPQrkGz4aS9Zow==", + "dev": true, + "dependencies": { + "is-glob": "^4.0.1" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/fast-json-stable-stringify": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/fast-json-stable-stringify/-/fast-json-stable-stringify-2.1.0.tgz", + "integrity": "sha512-lhd/wF+Lk98HZoTCtlVraHtfh5XYijIjalXck7saUtuanSDyLMxnHhSXEDJqHxD7msR8D0uCmqlkwjCV8xvwHw==", + "dev": true + }, + "node_modules/fast-levenshtein": { + "version": "2.0.6", + "resolved": "https://registry.npmjs.org/fast-levenshtein/-/fast-levenshtein-2.0.6.tgz", + "integrity": "sha512-DCXu6Ifhqcks7TZKY3Hxp3y6qphY5SJZmrWMDrKcERSOXWQdMhU9Ig/PYrzyw/ul9jOIyh0N4M0tbC5hodg8dw==", + "dev": true + }, + "node_modules/fastparse": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/fastparse/-/fastparse-1.1.2.tgz", + "integrity": "sha512-483XLLxTVIwWK3QTrMGRqUfUpoOs/0hbQrl2oz4J0pAcm3A3bu84wxTFqGqkJzewCLdME38xJLJAxBABfQT8sQ==" + }, + "node_modules/fastq": { + "version": "1.17.1", + "resolved": "https://registry.npmjs.org/fastq/-/fastq-1.17.1.tgz", + "integrity": "sha512-sRVD3lWVIXWg6By68ZN7vho9a1pQcN/WBFaAAsDDFzlJjvoGx0P8z7V1t72grFJfJhu3YPZBuu25f7Kaw2jN1w==", + "dev": true, + "dependencies": { + "reusify": "^1.0.4" + } + }, + "node_modules/file-entry-cache": { + "version": "6.0.1", + "resolved": "https://registry.npmjs.org/file-entry-cache/-/file-entry-cache-6.0.1.tgz", + "integrity": "sha512-7Gps/XWymbLk2QLYK4NzpMOrYjMhdIxXuIvy2QBsLE6ljuodKvdkWs/cpyJJ3CVIVpH0Oi1Hvg1ovbMzLdFBBg==", + "dev": true, + "dependencies": { + "flat-cache": "^3.0.4" + }, + "engines": { + "node": "^10.12.0 || >=12.0.0" + } + }, + "node_modules/fill-range": { + "version": "7.0.1", + "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-7.0.1.tgz", + "integrity": "sha512-qOo9F+dMUmC2Lcb4BbVvnKJxTPjCm+RRpe4gDuGrzkL7mEVl/djYSu2OdQ2Pa302N4oqkSg9ir6jaLWJ2USVpQ==", + "dev": true, + "dependencies": { + "to-regex-range": "^5.0.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/find-up": { + "version": "5.0.0", + "resolved": "https://registry.npmjs.org/find-up/-/find-up-5.0.0.tgz", + "integrity": "sha512-78/PXT1wlLLDgTzDs7sjq9hzz0vXD+zn+7wypEe4fXQxCmdmqfGsEPQxmiCSQI3ajFV91bVSsvNtrJRiW6nGng==", + "dev": true, + "dependencies": { + "locate-path": "^6.0.0", + "path-exists": "^4.0.0" + }, + "engines": { + "node": ">=10" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/flat-cache": { + "version": "3.2.0", + "resolved": "https://registry.npmjs.org/flat-cache/-/flat-cache-3.2.0.tgz", + "integrity": "sha512-CYcENa+FtcUKLmhhqyctpclsq7QF38pKjZHsGNiSQF5r4FtoKDWabFDl3hzaEQMvT1LHEysw5twgLvpYYb4vbw==", + "dev": true, + "dependencies": { + "flatted": "^3.2.9", + "keyv": "^4.5.3", + "rimraf": "^3.0.2" + }, + "engines": { + "node": "^10.12.0 || >=12.0.0" + } + }, + "node_modules/flatted": { + "version": "3.3.1", + "resolved": "https://registry.npmjs.org/flatted/-/flatted-3.3.1.tgz", + "integrity": "sha512-X8cqMLLie7KsNUDSdzeN8FYK9rEt4Dt67OsG/DNGnYTSDBG4uFAJFBnUeiV+zCVAvwFy56IjM9sH51jVaEhNxw==", + "dev": true + }, + "node_modules/for-each": { + "version": "0.3.3", + "resolved": "https://registry.npmjs.org/for-each/-/for-each-0.3.3.tgz", + "integrity": "sha512-jqYfLp7mo9vIyQf8ykW2v7A+2N4QjeCeI5+Dz9XraiO1ign81wjiH7Fb9vSOWvQfNtmSa4H2RoQTrrXivdUZmw==", + "dev": true, + "dependencies": { + "is-callable": "^1.1.3" + } + }, + "node_modules/foreground-child": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/foreground-child/-/foreground-child-3.1.1.tgz", + "integrity": "sha512-TMKDUnIte6bfb5nWv7V/caI169OHgvwjb7V4WkeUvbQQdjr5rWKqHFiKWb/fcOwB+CzBT+qbWjvj+DVwRskpIg==", + "dev": true, + "dependencies": { + "cross-spawn": "^7.0.0", + "signal-exit": "^4.0.1" + }, + "engines": { + "node": ">=14" + }, + "funding": { + "url": "https://github.com/sponsors/isaacs" + } + }, + "node_modules/fraction.js": { + "version": "4.3.7", + "resolved": "https://registry.npmjs.org/fraction.js/-/fraction.js-4.3.7.tgz", + "integrity": "sha512-ZsDfxO51wGAXREY55a7la9LScWpwv9RxIrYABrlvOFBlH/ShPnrtsXeuUIfXKKOVicNxQ+o8JTbJvjS4M89yew==", + "dev": true, + "engines": { + "node": "*" + }, + "funding": { + "type": "patreon", + "url": "https://github.com/sponsors/rawify" + } + }, + "node_modules/fs.realpath": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/fs.realpath/-/fs.realpath-1.0.0.tgz", + "integrity": "sha512-OO0pH2lK6a0hZnAdau5ItzHPI6pUlvI7jMVnxUQRtw4owF2wk8lOSabtGDCTP4Ggrg2MbGnWO9X8K1t4+fGMDw==", + "dev": true + }, + "node_modules/fsevents": { + "version": "2.3.3", + "resolved": "https://registry.npmjs.org/fsevents/-/fsevents-2.3.3.tgz", + "integrity": "sha512-5xoDfX+fL7faATnagmWPpbFtwh/R77WmMMqqHGS65C3vvB0YHrgF+B1YmZ3441tMj5n63k0212XNoJwzlhffQw==", + "dev": true, + "hasInstallScript": true, + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": "^8.16.0 || ^10.6.0 || >=11.0.0" + } + }, + "node_modules/function-bind": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/function-bind/-/function-bind-1.1.2.tgz", + "integrity": "sha512-7XHNxH7qX9xG5mIwxkhumTox/MIRNcOgDrxWsMt2pAr23WHp6MrRlN7FBSFpCpr+oVO0F744iUgR82nJMfG2SA==", + "dev": true, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/function.prototype.name": { + "version": "1.1.6", + "resolved": "https://registry.npmjs.org/function.prototype.name/-/function.prototype.name-1.1.6.tgz", + "integrity": "sha512-Z5kx79swU5P27WEayXM1tBi5Ze/lbIyiNgU3qyXUOf9b2rgXYyF9Dy9Cx+IQv/Lc8WCG6L82zwUPpSS9hGehIg==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.2", + "define-properties": "^1.2.0", + "es-abstract": "^1.22.1", + "functions-have-names": "^1.2.3" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/functions-have-names": { + "version": "1.2.3", + "resolved": "https://registry.npmjs.org/functions-have-names/-/functions-have-names-1.2.3.tgz", + "integrity": "sha512-xckBUXyTIqT97tq2x2AMb+g163b5JFysYk0x4qxNFwbfQkmNZoiRHb6sPzI9/QV33WeuvVYBUIiD4NzNIyqaRQ==", + "dev": true, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/gensync": { + "version": "1.0.0-beta.2", + "resolved": "https://registry.npmjs.org/gensync/-/gensync-1.0.0-beta.2.tgz", + "integrity": "sha512-3hN7NaskYvMDLQY55gnW3NQ+mesEAepTqlg+VEbj7zzqEMBVNhzcGYYeqFo/TlYz6eQiFcp1HcsCZO+nGgS8zg==", + "dev": true, + "engines": { + "node": ">=6.9.0" + } + }, + "node_modules/get-intrinsic": { + "version": "1.2.4", + "resolved": "https://registry.npmjs.org/get-intrinsic/-/get-intrinsic-1.2.4.tgz", + "integrity": "sha512-5uYhsJH8VJBTv7oslg4BznJYhDoRI6waYCxMmCdnTrcCrHA/fCFKoTFz2JKKE0HdDFUF7/oQuhzumXJK7paBRQ==", + "dev": true, + "dependencies": { + "es-errors": "^1.3.0", + "function-bind": "^1.1.2", + "has-proto": "^1.0.1", + "has-symbols": "^1.0.3", + "hasown": "^2.0.0" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/get-symbol-description": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/get-symbol-description/-/get-symbol-description-1.0.2.tgz", + "integrity": "sha512-g0QYk1dZBxGwk+Ngc+ltRH2IBp2f7zBkBMBJZCDerh6EhlhSR6+9irMCuT/09zD6qkarHUSn529sK/yL4S27mg==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.5", + "es-errors": "^1.3.0", + "get-intrinsic": "^1.2.4" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/glob": { + "version": "7.2.3", + "resolved": "https://registry.npmjs.org/glob/-/glob-7.2.3.tgz", + "integrity": "sha512-nFR0zLpU2YCaRxwoCJvL6UvCH2JFyFVIvwTLsIf21AuHlMskA1hhTdk+LlYJtOlYt9v6dvszD2BGRqBL+iQK9Q==", + "dev": true, + "dependencies": { + "fs.realpath": "^1.0.0", + "inflight": "^1.0.4", + "inherits": "2", + "minimatch": "^3.1.1", + "once": "^1.3.0", + "path-is-absolute": "^1.0.0" + }, + "engines": { + "node": "*" + }, + "funding": { + "url": "https://github.com/sponsors/isaacs" + } + }, + "node_modules/glob-parent": { + "version": "6.0.2", + "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-6.0.2.tgz", + "integrity": "sha512-XxwI8EOhVQgWp6iDL+3b0r86f4d6AX6zSU55HfB4ydCEuXLXc5FcYeOu+nnGftS4TEju/11rt4KJPTMgbfmv4A==", + "dev": true, + "dependencies": { + "is-glob": "^4.0.3" + }, + "engines": { + "node": ">=10.13.0" + } + }, + "node_modules/globals": { + "version": "11.12.0", + "resolved": "https://registry.npmjs.org/globals/-/globals-11.12.0.tgz", + "integrity": "sha512-WOBp/EEGUiIsJSp7wcv/y6MO+lV9UoncWqxuFfm8eBwzWNgyfBd6Gz+IeKQ9jCmyhoH99g15M3T+QaVHFjizVA==", + "dev": true, + "engines": { + "node": ">=4" + } + }, + "node_modules/globalthis": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/globalthis/-/globalthis-1.0.3.tgz", + "integrity": "sha512-sFdI5LyBiNTHjRd7cGPWapiHWMOXKyuBNX/cWJ3NfzrZQVa8GI/8cofCl74AOVqq9W5kNmguTIzJ/1s2gyI9wA==", + "dev": true, + "dependencies": { + "define-properties": "^1.1.3" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/gopd": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/gopd/-/gopd-1.0.1.tgz", + "integrity": "sha512-d65bNlIadxvpb/A2abVdlqKqV563juRnZ1Wtk6s1sIR8uNsXR70xqIzVqxVf1eTqDunwT2MkczEeaezCKTZhwA==", + "dev": true, + "dependencies": { + "get-intrinsic": "^1.1.3" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/graphemer": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/graphemer/-/graphemer-1.4.0.tgz", + "integrity": "sha512-EtKwoO6kxCL9WO5xipiHTZlSzBm7WLT627TqC/uVRd0HKmq8NXyebnNYxDoBi7wt8eTWrUrKXCOVaFq9x1kgag==", + "dev": true + }, + "node_modules/has-bigints": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/has-bigints/-/has-bigints-1.0.2.tgz", + "integrity": "sha512-tSvCKtBr9lkF0Ex0aQiP9N+OpV4zi2r/Nee5VkRDbaqv35RLYMzbwQfFSZZH0kR+Rd6302UJZ2p/bJCEoR3VoQ==", + "dev": true, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/has-flag": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/has-flag/-/has-flag-3.0.0.tgz", + "integrity": "sha512-sKJf1+ceQBr4SMkvQnBDNDtf4TXpVhVGateu0t918bl30FnbE2m4vNLX+VWe/dpjlb+HugGYzW7uQXH98HPEYw==", + "dev": true, + "engines": { + "node": ">=4" + } + }, + "node_modules/has-property-descriptors": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/has-property-descriptors/-/has-property-descriptors-1.0.2.tgz", + "integrity": "sha512-55JNKuIW+vq4Ke1BjOTjM2YctQIvCT7GFzHwmfZPGo5wnrgkid0YQtnAleFSqumZm4az3n2BS+erby5ipJdgrg==", + "dev": true, + "dependencies": { + "es-define-property": "^1.0.0" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/has-proto": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/has-proto/-/has-proto-1.0.3.tgz", + "integrity": "sha512-SJ1amZAJUiZS+PhsVLf5tGydlaVB8EdFpaSO4gmiUKUOxk8qzn5AIy4ZeJUmh22znIdk/uMAUT2pl3FxzVUH+Q==", + "dev": true, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/has-symbols": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/has-symbols/-/has-symbols-1.0.3.tgz", + "integrity": "sha512-l3LCuF6MgDNwTDKkdYGEihYjt5pRPbEg46rtlmnSPlUbgmB8LOIrKJbYYFBSbnPaJexMKtiPO8hmeRjRz2Td+A==", + "dev": true, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/has-tostringtag": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/has-tostringtag/-/has-tostringtag-1.0.2.tgz", + "integrity": "sha512-NqADB8VjPFLM2V0VvHUewwwsw0ZWBaIdgo+ieHtK3hasLz4qeCRjYcqfB6AQrBggRKppKF8L52/VqdVsO47Dlw==", + "dev": true, + "dependencies": { + "has-symbols": "^1.0.3" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/hasown": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/hasown/-/hasown-2.0.2.tgz", + "integrity": "sha512-0hJU9SCPvmMzIBdZFqNPXWa6dqh7WdH0cII9y+CyS8rG3nL48Bclra9HmKhVVUHyPWNH5Y7xDwAB7bfgSjkUMQ==", + "dev": true, + "dependencies": { + "function-bind": "^1.1.2" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/ignore": { + "version": "5.3.1", + "resolved": "https://registry.npmjs.org/ignore/-/ignore-5.3.1.tgz", + "integrity": "sha512-5Fytz/IraMjqpwfd34ke28PTVMjZjJG2MPn5t7OE4eUCUNf8BAa7b5WUS9/Qvr6mwOQS7Mk6vdsMno5he+T8Xw==", + "dev": true, + "engines": { + "node": ">= 4" + } + }, + "node_modules/import-fresh": { + "version": "3.3.0", + "resolved": "https://registry.npmjs.org/import-fresh/-/import-fresh-3.3.0.tgz", + "integrity": "sha512-veYYhQa+D1QBKznvhUHxb8faxlrwUnxseDAbAp457E0wLNio2bOSKnjYDhMj+YiAq61xrMGhQk9iXVk5FzgQMw==", + "dev": true, + "dependencies": { + "parent-module": "^1.0.0", + "resolve-from": "^4.0.0" + }, + "engines": { + "node": ">=6" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/imurmurhash": { + "version": "0.1.4", + "resolved": "https://registry.npmjs.org/imurmurhash/-/imurmurhash-0.1.4.tgz", + "integrity": "sha512-JmXMZ6wuvDmLiHEml9ykzqO6lwFbof0GG4IkcGaENdCRDDmMVnny7s5HsIgHCbaq0w2MyPhDqkhTUgS2LU2PHA==", + "dev": true, + "engines": { + "node": ">=0.8.19" + } + }, + "node_modules/inflight": { + "version": "1.0.6", + "resolved": "https://registry.npmjs.org/inflight/-/inflight-1.0.6.tgz", + "integrity": "sha512-k92I/b08q4wvFscXCLvqfsHCrjrF7yiXsQuIVvVE7N82W3+aqpzuUdBbfhWcy/FZR3/4IgflMgKLOsvPDrGCJA==", + "dev": true, + "dependencies": { + "once": "^1.3.0", + "wrappy": "1" + } + }, + "node_modules/inherits": { + "version": "2.0.4", + "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.4.tgz", + "integrity": "sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ==", + "dev": true + }, + "node_modules/internal-slot": { + "version": "1.0.7", + "resolved": "https://registry.npmjs.org/internal-slot/-/internal-slot-1.0.7.tgz", + "integrity": "sha512-NGnrKwXzSms2qUUih/ILZ5JBqNTSa1+ZmP6flaIp6KmSElgE9qdndzS3cqjrDovwFdmwsGsLdeFgB6suw+1e9g==", + "dev": true, + "dependencies": { + "es-errors": "^1.3.0", + "hasown": "^2.0.0", + "side-channel": "^1.0.4" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/is-array-buffer": { + "version": "3.0.4", + "resolved": "https://registry.npmjs.org/is-array-buffer/-/is-array-buffer-3.0.4.tgz", + "integrity": "sha512-wcjaerHw0ydZwfhiKbXJWLDY8A7yV7KhjQOpb83hGgGfId/aQa4TOvwyzn2PuswW2gPCYEL/nEAiSVpdOj1lXw==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.2", + "get-intrinsic": "^1.2.1" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-async-function": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/is-async-function/-/is-async-function-2.0.0.tgz", + "integrity": "sha512-Y1JXKrfykRJGdlDwdKlLpLyMIiWqWvuSd17TvZk68PLAOGOoF4Xyav1z0Xhoi+gCYjZVeC5SI+hYFOfvXmGRCA==", + "dev": true, + "dependencies": { + "has-tostringtag": "^1.0.0" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-bigint": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/is-bigint/-/is-bigint-1.0.4.tgz", + "integrity": "sha512-zB9CruMamjym81i2JZ3UMn54PKGsQzsJeo6xvN3HJJ4CAsQNB6iRutp2To77OfCNuoxspsIhzaPoO1zyCEhFOg==", + "dev": true, + "dependencies": { + "has-bigints": "^1.0.1" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-binary-path": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/is-binary-path/-/is-binary-path-2.1.0.tgz", + "integrity": "sha512-ZMERYes6pDydyuGidse7OsHxtbI7WVeUEozgR/g7rd0xUimYNlvZRE/K2MgZTjWy725IfelLeVcEM97mmtRGXw==", + "dev": true, + "dependencies": { + "binary-extensions": "^2.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/is-boolean-object": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/is-boolean-object/-/is-boolean-object-1.1.2.tgz", + "integrity": "sha512-gDYaKHJmnj4aWxyj6YHyXVpdQawtVLHU5cb+eztPGczf6cjuTdwve5ZIEfgXqH4e57An1D1AKf8CZ3kYrQRqYA==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.2", + "has-tostringtag": "^1.0.0" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-callable": { + "version": "1.2.7", + "resolved": "https://registry.npmjs.org/is-callable/-/is-callable-1.2.7.tgz", + "integrity": "sha512-1BC0BVFhS/p0qtw6enp8e+8OD0UrK0oFLztSjNzhcKA3WDuJxxAPXzPuPtKkjEY9UUoEWlX/8fgKeu2S8i9JTA==", + "dev": true, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-core-module": { + "version": "2.13.1", + "resolved": "https://registry.npmjs.org/is-core-module/-/is-core-module-2.13.1.tgz", + "integrity": "sha512-hHrIjvZsftOsvKSn2TRYl63zvxsgE0K+0mYMoH6gD4omR5IWB2KynivBQczo3+wF1cCkjzvptnI9Q0sPU66ilw==", + "dev": true, + "dependencies": { + "hasown": "^2.0.0" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-data-view": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/is-data-view/-/is-data-view-1.0.1.tgz", + "integrity": "sha512-AHkaJrsUVW6wq6JS8y3JnM/GJF/9cf+k20+iDzlSaJrinEo5+7vRiteOSwBhHRiAyQATN1AmY4hwzxJKPmYf+w==", + "dev": true, + "dependencies": { + "is-typed-array": "^1.1.13" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-date-object": { + "version": "1.0.5", + "resolved": "https://registry.npmjs.org/is-date-object/-/is-date-object-1.0.5.tgz", + "integrity": "sha512-9YQaSxsAiSwcvS33MBk3wTCVnWK+HhF8VZR2jRxehM16QcVOdHqPn4VPHmRK4lSr38n9JriurInLcP90xsYNfQ==", + "dev": true, + "dependencies": { + "has-tostringtag": "^1.0.0" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-extglob": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/is-extglob/-/is-extglob-2.1.1.tgz", + "integrity": "sha512-SbKbANkN603Vi4jEZv49LeVJMn4yGwsbzZworEoyEiutsN3nJYdbO36zfhGJ6QEDpOZIFkDtnq5JRxmvl3jsoQ==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-finalizationregistry": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/is-finalizationregistry/-/is-finalizationregistry-1.0.2.tgz", + "integrity": "sha512-0by5vtUJs8iFQb5TYUHHPudOR+qXYIMKtiUzvLIZITZUjknFmziyBJuLhVRc+Ds0dREFlskDNJKYIdIzu/9pfw==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.2" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-fullwidth-code-point": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/is-fullwidth-code-point/-/is-fullwidth-code-point-3.0.0.tgz", + "integrity": "sha512-zymm5+u+sCsSWyD9qNaejV3DFvhCKclKdizYaJUuHA83RLjb7nSuGnddCHGv0hk+KY7BMAlsWeK4Ueg6EV6XQg==", + "dev": true, + "engines": { + "node": ">=8" + } + }, + "node_modules/is-generator-function": { + "version": "1.0.10", + "resolved": "https://registry.npmjs.org/is-generator-function/-/is-generator-function-1.0.10.tgz", + "integrity": "sha512-jsEjy9l3yiXEQ+PsXdmBwEPcOxaXWLspKdplFUVI9vq1iZgIekeC0L167qeu86czQaxed3q/Uzuw0swL0irL8A==", + "dev": true, + "dependencies": { + "has-tostringtag": "^1.0.0" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-glob": { + "version": "4.0.3", + "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-4.0.3.tgz", + "integrity": "sha512-xelSayHH36ZgE7ZWhli7pW34hNbNl8Ojv5KVmkJD4hBdD3th8Tfk9vYasLM+mXWOZhFkgZfxhLSnrwRr4elSSg==", + "dev": true, + "dependencies": { + "is-extglob": "^2.1.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-map": { + "version": "2.0.3", + "resolved": "https://registry.npmjs.org/is-map/-/is-map-2.0.3.tgz", + "integrity": "sha512-1Qed0/Hr2m+YqxnM09CjA2d/i6YZNfF6R2oRAOj36eUdS6qIV/huPJNSEpKbupewFs+ZsJlxsjjPbc0/afW6Lw==", + "dev": true, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-negative-zero": { + "version": "2.0.3", + "resolved": "https://registry.npmjs.org/is-negative-zero/-/is-negative-zero-2.0.3.tgz", + "integrity": "sha512-5KoIu2Ngpyek75jXodFvnafB6DJgr3u8uuK0LEZJjrU19DrMD3EVERaR8sjz8CCGgpZvxPl9SuE1GMVPFHx1mw==", + "dev": true, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-number": { + "version": "7.0.0", + "resolved": "https://registry.npmjs.org/is-number/-/is-number-7.0.0.tgz", + "integrity": "sha512-41Cifkg6e8TylSpdtTpeLVMqvSBEVzTttHvERD741+pnZ8ANv0004MRL43QKPDlK9cGvNp6NZWZUBlbGXYxxng==", + "dev": true, + "engines": { + "node": ">=0.12.0" + } + }, + "node_modules/is-number-object": { + "version": "1.0.7", + "resolved": "https://registry.npmjs.org/is-number-object/-/is-number-object-1.0.7.tgz", + "integrity": "sha512-k1U0IRzLMo7ZlYIfzRu23Oh6MiIFasgpb9X76eqfFZAqwH44UI4KTBvBYIZ1dSL9ZzChTB9ShHfLkR4pdW5krQ==", + "dev": true, + "dependencies": { + "has-tostringtag": "^1.0.0" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-path-inside": { + "version": "3.0.3", + "resolved": "https://registry.npmjs.org/is-path-inside/-/is-path-inside-3.0.3.tgz", + "integrity": "sha512-Fd4gABb+ycGAmKou8eMftCupSir5lRxqf4aD/vd0cD2qc4HL07OjCeuHMr8Ro4CoMaeCKDB0/ECBOVWjTwUvPQ==", + "dev": true, + "engines": { + "node": ">=8" + } + }, + "node_modules/is-regex": { + "version": "1.1.4", + "resolved": "https://registry.npmjs.org/is-regex/-/is-regex-1.1.4.tgz", + "integrity": "sha512-kvRdxDsxZjhzUX07ZnLydzS1TU/TJlTUHHY4YLL87e37oUA49DfkLqgy+VjFocowy29cKvcSiu+kIv728jTTVg==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.2", + "has-tostringtag": "^1.0.0" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-set": { + "version": "2.0.3", + "resolved": "https://registry.npmjs.org/is-set/-/is-set-2.0.3.tgz", + "integrity": "sha512-iPAjerrse27/ygGLxw+EBR9agv9Y6uLeYVJMu+QNCoouJ1/1ri0mGrcWpfCqFZuzzx3WjtwxG098X+n4OuRkPg==", + "dev": true, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-shared-array-buffer": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/is-shared-array-buffer/-/is-shared-array-buffer-1.0.3.tgz", + "integrity": "sha512-nA2hv5XIhLR3uVzDDfCIknerhx8XUKnstuOERPNNIinXG7v9u+ohXF67vxm4TPTEPU6lm61ZkwP3c9PCB97rhg==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.7" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-string": { + "version": "1.0.7", + "resolved": "https://registry.npmjs.org/is-string/-/is-string-1.0.7.tgz", + "integrity": "sha512-tE2UXzivje6ofPW7l23cjDOMa09gb7xlAqG6jG5ej6uPV32TlWP3NKPigtaGeHNu9fohccRYvIiZMfOOnOYUtg==", + "dev": true, + "dependencies": { + "has-tostringtag": "^1.0.0" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-symbol": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/is-symbol/-/is-symbol-1.0.4.tgz", + "integrity": "sha512-C/CPBqKWnvdcxqIARxyOh4v1UUEOCHpgDa0WYgpKDFMszcrPcffg5uhwSgPCLD2WWxmq6isisz87tzT01tuGhg==", + "dev": true, + "dependencies": { + "has-symbols": "^1.0.2" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-typed-array": { + "version": "1.1.13", + "resolved": "https://registry.npmjs.org/is-typed-array/-/is-typed-array-1.1.13.tgz", + "integrity": "sha512-uZ25/bUAlUY5fR4OKT4rZQEBrzQWYV9ZJYGGsUmEJ6thodVJ1HX64ePQ6Z0qPWP+m+Uq6e9UugrE38jeYsDSMw==", + "dev": true, + "dependencies": { + "which-typed-array": "^1.1.14" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-weakmap": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/is-weakmap/-/is-weakmap-2.0.2.tgz", + "integrity": "sha512-K5pXYOm9wqY1RgjpL3YTkF39tni1XajUIkawTLUo9EZEVUFga5gSQJF8nNS7ZwJQ02y+1YCNYcMh+HIf1ZqE+w==", + "dev": true, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-weakref": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/is-weakref/-/is-weakref-1.0.2.tgz", + "integrity": "sha512-qctsuLZmIQ0+vSSMfoVvyFe2+GSEvnmZ2ezTup1SBse9+twCCeial6EEi3Nc2KFcf6+qz2FBPnjXsk8xhKSaPQ==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.2" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-weakset": { + "version": "2.0.3", + "resolved": "https://registry.npmjs.org/is-weakset/-/is-weakset-2.0.3.tgz", + "integrity": "sha512-LvIm3/KWzS9oRFHugab7d+M/GcBXuXX5xZkzPmN+NxihdQlZUQ4dWuSV1xR/sq6upL1TJEDrfBgRepHFdBtSNQ==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.7", + "get-intrinsic": "^1.2.4" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/isarray": { + "version": "2.0.5", + "resolved": "https://registry.npmjs.org/isarray/-/isarray-2.0.5.tgz", + "integrity": "sha512-xHjhDr3cNBK0BzdUJSPXZntQUx/mwMS5Rw4A7lPJ90XGAO6ISP/ePDNuo0vhqOZU+UD5JoodwCAAoZQd3FeAKw==", + "dev": true + }, + "node_modules/isexe": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/isexe/-/isexe-2.0.0.tgz", + "integrity": "sha512-RHxMLp9lnKHGHRng9QFhRCMbYAcVpn69smSGcq3f36xjgVVWThj4qqLbTLlq7Ssj8B+fIQ1EuCEGI2lKsyQeIw==", + "dev": true + }, + "node_modules/iterator.prototype": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/iterator.prototype/-/iterator.prototype-1.1.2.tgz", + "integrity": "sha512-DR33HMMr8EzwuRL8Y9D3u2BMj8+RqSE850jfGu59kS7tbmPLzGkZmVSfyCFSDxuZiEY6Rzt3T2NA/qU+NwVj1w==", + "dev": true, + "dependencies": { + "define-properties": "^1.2.1", + "get-intrinsic": "^1.2.1", + "has-symbols": "^1.0.3", + "reflect.getprototypeof": "^1.0.4", + "set-function-name": "^2.0.1" + } + }, + "node_modules/jackspeak": { + "version": "2.3.6", + "resolved": "https://registry.npmjs.org/jackspeak/-/jackspeak-2.3.6.tgz", + "integrity": "sha512-N3yCS/NegsOBokc8GAdM8UcmfsKiSS8cipheD/nivzr700H+nsMOxJjQnvwOcRYVuFkdH0wGUvW2WbXGmrZGbQ==", + "dev": true, + "dependencies": { + "@isaacs/cliui": "^8.0.2" + }, + "engines": { + "node": ">=14" + }, + "funding": { + "url": "https://github.com/sponsors/isaacs" + }, + "optionalDependencies": { + "@pkgjs/parseargs": "^0.11.0" + } + }, + "node_modules/jiti": { + "version": "1.21.0", + "resolved": "https://registry.npmjs.org/jiti/-/jiti-1.21.0.tgz", + "integrity": "sha512-gFqAIbuKyyso/3G2qhiO2OM6shY6EPP/R0+mkDbyspxKazh8BXDC5FiFsUjlczgdNz/vfra0da2y+aHrusLG/Q==", + "dev": true, + "bin": { + "jiti": "bin/jiti.js" + } + }, + "node_modules/js-tokens": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/js-tokens/-/js-tokens-4.0.0.tgz", + "integrity": "sha512-RdJUflcE3cUzKiMqQgsCu06FPu9UdIJO0beYbPhHN4k6apgJtifcoCtT9bcxOpYBtpD2kCM6Sbzg4CausW/PKQ==" + }, + "node_modules/js-yaml": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/js-yaml/-/js-yaml-4.1.0.tgz", + "integrity": "sha512-wpxZs9NoxZaJESJGIZTyDEaYpl0FKSA+FB9aJiyemKhMwkxQg63h4T1KJgUGHpTqPDNRcmmYLugrRjJlBtWvRA==", + "dev": true, + "dependencies": { + "argparse": "^2.0.1" + }, + "bin": { + "js-yaml": "bin/js-yaml.js" + } + }, + "node_modules/jsesc": { + "version": "2.5.2", + "resolved": "https://registry.npmjs.org/jsesc/-/jsesc-2.5.2.tgz", + "integrity": "sha512-OYu7XEzjkCQ3C5Ps3QIZsQfNpqoJyZZA99wd9aWd05NCtC5pWOkShK2mkL6HXQR6/Cy2lbNdPlZBpuQHXE63gA==", + "dev": true, + "bin": { + "jsesc": "bin/jsesc" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/json-buffer": { + "version": "3.0.1", + "resolved": "https://registry.npmjs.org/json-buffer/-/json-buffer-3.0.1.tgz", + "integrity": "sha512-4bV5BfR2mqfQTJm+V5tPPdf+ZpuhiIvTuAB5g8kcrXOZpTT/QwwVRWBywX1ozr6lEuPdbHxwaJlm9G6mI2sfSQ==", + "dev": true + }, + "node_modules/json-schema-traverse": { + "version": "0.4.1", + "resolved": "https://registry.npmjs.org/json-schema-traverse/-/json-schema-traverse-0.4.1.tgz", + "integrity": "sha512-xbbCH5dCYU5T8LcEhhuh7HJ88HXuW3qsI3Y0zOZFKfZEHcpWiHU/Jxzk629Brsab/mMiHQti9wMP+845RPe3Vg==", + "dev": true + }, + "node_modules/json-stable-stringify-without-jsonify": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/json-stable-stringify-without-jsonify/-/json-stable-stringify-without-jsonify-1.0.1.tgz", + "integrity": "sha512-Bdboy+l7tA3OGW6FjyFHWkP5LuByj1Tk33Ljyq0axyzdk9//JSi2u3fP1QSmd1KNwq6VOKYGlAu87CisVir6Pw==", + "dev": true + }, + "node_modules/json5": { + "version": "2.2.3", + "resolved": "https://registry.npmjs.org/json5/-/json5-2.2.3.tgz", + "integrity": "sha512-XmOWe7eyHYH14cLdVPoyg+GOH3rYX++KpzrylJwSW98t3Nk+U8XOl8FWKOgwtzdb8lXGf6zYwDUzeHMWfxasyg==", + "dev": true, + "bin": { + "json5": "lib/cli.js" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/jsx-ast-utils": { + "version": "3.3.5", + "resolved": "https://registry.npmjs.org/jsx-ast-utils/-/jsx-ast-utils-3.3.5.tgz", + "integrity": "sha512-ZZow9HBI5O6EPgSJLUb8n2NKgmVWTwCvHGwFuJlMjvLFqlGG6pjirPhtdsseaLZjSibD8eegzmYpUZwoIlj2cQ==", + "dev": true, + "dependencies": { + "array-includes": "^3.1.6", + "array.prototype.flat": "^1.3.1", + "object.assign": "^4.1.4", + "object.values": "^1.1.6" + }, + "engines": { + "node": ">=4.0" + } + }, + "node_modules/keyv": { + "version": "4.5.4", + "resolved": "https://registry.npmjs.org/keyv/-/keyv-4.5.4.tgz", + "integrity": "sha512-oxVHkHR/EJf2CNXnWxRLW6mg7JyCCUcG0DtEGmL2ctUo1PNTin1PUil+r/+4r5MpVgC/fn1kjsx7mjSujKqIpw==", + "dev": true, + "dependencies": { + "json-buffer": "3.0.1" + } + }, + "node_modules/levn": { + "version": "0.4.1", + "resolved": "https://registry.npmjs.org/levn/-/levn-0.4.1.tgz", + "integrity": "sha512-+bT2uH4E5LGE7h/n3evcS/sQlJXCpIp6ym8OWJ5eV6+67Dsql/LaaT7qJBAt2rzfoa/5QBGBhxDix1dMt2kQKQ==", + "dev": true, + "dependencies": { + "prelude-ls": "^1.2.1", + "type-check": "~0.4.0" + }, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/lilconfig": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/lilconfig/-/lilconfig-2.1.0.tgz", + "integrity": "sha512-utWOt/GHzuUxnLKxB6dk81RoOeoNeHgbrXiuGk4yyF5qlRz+iIVWu56E2fqGHFrXz0QNUhLB/8nKqvRH66JKGQ==", + "dev": true, + "engines": { + "node": ">=10" + } + }, + "node_modules/lines-and-columns": { + "version": "1.2.4", + "resolved": "https://registry.npmjs.org/lines-and-columns/-/lines-and-columns-1.2.4.tgz", + "integrity": "sha512-7ylylesZQ/PV29jhEDl3Ufjo6ZX7gCqJr5F7PKrqc93v7fzSymt1BpwEU8nAUXs8qzzvqhbjhK5QZg6Mt/HkBg==", + "dev": true + }, + "node_modules/locate-path": { + "version": "6.0.0", + "resolved": "https://registry.npmjs.org/locate-path/-/locate-path-6.0.0.tgz", + "integrity": "sha512-iPZK6eYjbxRu3uB4/WZ3EsEIMJFMqAoopl3R+zuq0UjcAm/MO6KCweDgPfP3elTztoKP3KtnVHxTn2NHBSDVUw==", + "dev": true, + "dependencies": { + "p-locate": "^5.0.0" + }, + "engines": { + "node": ">=10" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/lodash.merge": { + "version": "4.6.2", + "resolved": "https://registry.npmjs.org/lodash.merge/-/lodash.merge-4.6.2.tgz", + "integrity": "sha512-0KpjqXRVvrYyCsX1swR/XTK0va6VQkQM6MNo7PqW77ByjAhoARA8EfrP1N4+KlKj8YS0ZUCtRT/YUuhyYDujIQ==", + "dev": true + }, + "node_modules/loose-envify": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/loose-envify/-/loose-envify-1.4.0.tgz", + "integrity": "sha512-lyuxPGr/Wfhrlem2CL/UcnUc1zcqKAImBDzukY7Y5F/yQiNdko6+fRLevlw1HgMySw7f611UIY408EtxRSoK3Q==", + "dependencies": { + "js-tokens": "^3.0.0 || ^4.0.0" + }, + "bin": { + "loose-envify": "cli.js" + } + }, + "node_modules/lru-cache": { + "version": "5.1.1", + "resolved": "https://registry.npmjs.org/lru-cache/-/lru-cache-5.1.1.tgz", + "integrity": "sha512-KpNARQA3Iwv+jTA0utUVVbrh+Jlrr1Fv0e56GGzAFOXN7dk/FviaDW8LHmK52DlcH4WP2n6gI8vN1aesBFgo9w==", + "dev": true, + "dependencies": { + "yallist": "^3.0.2" + } + }, + "node_modules/merge2": { + "version": "1.4.1", + "resolved": "https://registry.npmjs.org/merge2/-/merge2-1.4.1.tgz", + "integrity": "sha512-8q7VEgMJW4J8tcfVPy8g09NcQwZdbwFEqhe/WZkoIzjn/3TGDwtOCYtXGxA3O8tPzpczCCDgv+P2P5y00ZJOOg==", + "dev": true, + "engines": { + "node": ">= 8" + } + }, + "node_modules/micromatch": { + "version": "4.0.5", + "resolved": "https://registry.npmjs.org/micromatch/-/micromatch-4.0.5.tgz", + "integrity": "sha512-DMy+ERcEW2q8Z2Po+WNXuw3c5YaUSFjAO5GsJqfEl7UjvtIuFKO6ZrKvcItdy98dwFI2N1tg3zNIdKaQT+aNdA==", + "dev": true, + "dependencies": { + "braces": "^3.0.2", + "picomatch": "^2.3.1" + }, + "engines": { + "node": ">=8.6" + } + }, + "node_modules/minimatch": { + "version": "3.1.2", + "resolved": "https://registry.npmjs.org/minimatch/-/minimatch-3.1.2.tgz", + "integrity": "sha512-J7p63hRiAjw1NDEww1W7i37+ByIrOWO5XQQAzZ3VOcL0PNybwpfmV/N05zFAzwQ9USyEcX6t3UO+K5aqBQOIHw==", + "dev": true, + "dependencies": { + "brace-expansion": "^1.1.7" + }, + "engines": { + "node": "*" + } + }, + "node_modules/minipass": { + "version": "7.0.4", + "resolved": "https://registry.npmjs.org/minipass/-/minipass-7.0.4.tgz", + "integrity": "sha512-jYofLM5Dam9279rdkWzqHozUo4ybjdZmCsDHePy5V/PbBcVMiSZR97gmAy45aqi8CK1lG2ECd356FU86avfwUQ==", + "dev": true, + "engines": { + "node": ">=16 || 14 >=14.17" + } + }, + "node_modules/ms": { + "version": "2.1.2", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.2.tgz", + "integrity": "sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==", + "dev": true + }, + "node_modules/mz": { + "version": "2.7.0", + "resolved": "https://registry.npmjs.org/mz/-/mz-2.7.0.tgz", + "integrity": "sha512-z81GNO7nnYMEhrGh9LeymoE4+Yr0Wn5McHIZMK5cfQCl+NDX08sCZgUc9/6MHni9IWuFLm1Z3HTCXu2z9fN62Q==", + "dev": true, + "dependencies": { + "any-promise": "^1.0.0", + "object-assign": "^4.0.1", + "thenify-all": "^1.0.0" + } + }, + "node_modules/nanoid": { + "version": "3.3.7", + "resolved": "https://registry.npmjs.org/nanoid/-/nanoid-3.3.7.tgz", + "integrity": "sha512-eSRppjcPIatRIMC1U6UngP8XFcz8MQWGQdt1MTBQ7NaAmvXDfvNxbvWV3x2y6CdEUciCSsDHDQZbhYaB8QEo2g==", + "funding": [ + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ], + "bin": { + "nanoid": "bin/nanoid.cjs" + }, + "engines": { + "node": "^10 || ^12 || ^13.7 || ^14 || >=15.0.1" + } + }, + "node_modules/natural-compare": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/natural-compare/-/natural-compare-1.4.0.tgz", + "integrity": "sha512-OWND8ei3VtNC9h7V60qff3SVobHr996CTwgxubgyQYEpg290h9J0buyECNNJexkFm5sOajh5G116RYA1c8ZMSw==", + "dev": true + }, + "node_modules/node-releases": { + "version": "2.0.14", + "resolved": "https://registry.npmjs.org/node-releases/-/node-releases-2.0.14.tgz", + "integrity": "sha512-y10wOWt8yZpqXmOgRo77WaHEmhYQYGNA6y421PKsKYWEK8aW+cqAphborZDhqfyKrbZEN92CN1X2KbafY2s7Yw==", + "dev": true + }, + "node_modules/normalize-path": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/normalize-path/-/normalize-path-3.0.0.tgz", + "integrity": "sha512-6eZs5Ls3WtCisHWp9S2GUy8dqkpGi4BVSz3GaqiE6ezub0512ESztXUwUB6C6IKbQkY2Pnb/mD4WYojCRwcwLA==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/normalize-range": { + "version": "0.1.2", + "resolved": "https://registry.npmjs.org/normalize-range/-/normalize-range-0.1.2.tgz", + "integrity": "sha512-bdok/XvKII3nUpklnV6P2hxtMNrCboOjAcyBuQnWEhO665FwrSNRxU+AqpsyvO6LgGYPspN+lu5CLtw4jPRKNA==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/object-assign": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/object-assign/-/object-assign-4.1.1.tgz", + "integrity": "sha512-rJgTQnkUnH1sFw8yT6VSU3zD3sWmu6sZhIseY8VX+GRu3P6F7Fu+JNDoXfklElbLJSnc3FUQHVe4cU5hj+BcUg==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/object-hash": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/object-hash/-/object-hash-3.0.0.tgz", + "integrity": "sha512-RSn9F68PjH9HqtltsSnqYC1XXoWe9Bju5+213R98cNGttag9q9yAOTzdbsqvIa7aNm5WffBZFpWYr2aWrklWAw==", + "dev": true, + "engines": { + "node": ">= 6" + } + }, + "node_modules/object-inspect": { + "version": "1.13.1", + "resolved": "https://registry.npmjs.org/object-inspect/-/object-inspect-1.13.1.tgz", + "integrity": "sha512-5qoj1RUiKOMsCCNLV1CBiPYE10sziTsnmNxkAI/rZhiD63CF7IqdFGC/XzjWjpSgLf0LxXX3bDFIh0E18f6UhQ==", + "dev": true, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/object-keys": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/object-keys/-/object-keys-1.1.1.tgz", + "integrity": "sha512-NuAESUOUMrlIXOfHKzD6bpPu3tYt3xvjNdRIQ+FeT0lNb4K8WR70CaDxhuNguS2XG+GjkyMwOzsN5ZktImfhLA==", + "dev": true, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/object.assign": { + "version": "4.1.5", + "resolved": "https://registry.npmjs.org/object.assign/-/object.assign-4.1.5.tgz", + "integrity": "sha512-byy+U7gp+FVwmyzKPYhW2h5l3crpmGsxl7X2s8y43IgxvG4g3QZ6CffDtsNQy1WsmZpQbO+ybo0AlW7TY6DcBQ==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.5", + "define-properties": "^1.2.1", + "has-symbols": "^1.0.3", + "object-keys": "^1.1.1" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/object.entries": { + "version": "1.1.8", + "resolved": "https://registry.npmjs.org/object.entries/-/object.entries-1.1.8.tgz", + "integrity": "sha512-cmopxi8VwRIAw/fkijJohSfpef5PdN0pMQJN6VC/ZKvn0LIknWD8KtgY6KlQdEc4tIjcQ3HxSMmnvtzIscdaYQ==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.7", + "define-properties": "^1.2.1", + "es-object-atoms": "^1.0.0" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/object.fromentries": { + "version": "2.0.8", + "resolved": "https://registry.npmjs.org/object.fromentries/-/object.fromentries-2.0.8.tgz", + "integrity": "sha512-k6E21FzySsSK5a21KRADBd/NGneRegFO5pLHfdQLpRDETUNJueLXs3WCzyQ3tFRDYgbq3KHGXfTbi2bs8WQ6rQ==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.7", + "define-properties": "^1.2.1", + "es-abstract": "^1.23.2", + "es-object-atoms": "^1.0.0" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/object.hasown": { + "version": "1.1.4", + "resolved": "https://registry.npmjs.org/object.hasown/-/object.hasown-1.1.4.tgz", + "integrity": "sha512-FZ9LZt9/RHzGySlBARE3VF+gE26TxR38SdmqOqliuTnl9wrKulaQs+4dee1V+Io8VfxqzAfHu6YuRgUy8OHoTg==", + "dev": true, + "dependencies": { + "define-properties": "^1.2.1", + "es-abstract": "^1.23.2", + "es-object-atoms": "^1.0.0" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/object.values": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/object.values/-/object.values-1.2.0.tgz", + "integrity": "sha512-yBYjY9QX2hnRmZHAjG/f13MzmBzxzYgQhFrke06TTyKY5zSTEqkOeukBzIdVA3j3ulu8Qa3MbVFShV7T2RmGtQ==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.7", + "define-properties": "^1.2.1", + "es-object-atoms": "^1.0.0" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/once": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/once/-/once-1.4.0.tgz", + "integrity": "sha512-lNaJgI+2Q5URQBkccEKHTQOPaXdUxnZZElQTZY0MFUAuaEqe1E+Nyvgdz/aIyNi6Z9MzO5dv1H8n58/GELp3+w==", + "dev": true, + "dependencies": { + "wrappy": "1" + } + }, + "node_modules/optionator": { + "version": "0.9.3", + "resolved": "https://registry.npmjs.org/optionator/-/optionator-0.9.3.tgz", + "integrity": "sha512-JjCoypp+jKn1ttEFExxhetCKeJt9zhAgAve5FXHixTvFDW/5aEktX9bufBKLRRMdU7bNtpLfcGu94B3cdEJgjg==", + "dev": true, + "dependencies": { + "@aashutoshrathi/word-wrap": "^1.2.3", + "deep-is": "^0.1.3", + "fast-levenshtein": "^2.0.6", + "levn": "^0.4.1", + "prelude-ls": "^1.2.1", + "type-check": "^0.4.0" + }, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/p-limit": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/p-limit/-/p-limit-3.1.0.tgz", + "integrity": "sha512-TYOanM3wGwNGsZN2cVTYPArw454xnXj5qmWF1bEoAc4+cU/ol7GVh7odevjp1FNHduHc3KZMcFduxU5Xc6uJRQ==", + "dev": true, + "dependencies": { + "yocto-queue": "^0.1.0" + }, + "engines": { + "node": ">=10" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/p-locate": { + "version": "5.0.0", + "resolved": "https://registry.npmjs.org/p-locate/-/p-locate-5.0.0.tgz", + "integrity": "sha512-LaNjtRWUBY++zB5nE/NwcaoMylSPk+S+ZHNB1TzdbMJMny6dynpAGt7X/tl/QYq3TIeE6nxHppbo2LGymrG5Pw==", + "dev": true, + "dependencies": { + "p-limit": "^3.0.2" + }, + "engines": { + "node": ">=10" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/parent-module": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/parent-module/-/parent-module-1.0.1.tgz", + "integrity": "sha512-GQ2EWRpQV8/o+Aw8YqtfZZPfNRWZYkbidE9k5rpl/hC3vtHHBfGm2Ifi6qWV+coDGkrUKZAxE3Lot5kcsRlh+g==", + "dev": true, + "dependencies": { + "callsites": "^3.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/path-exists": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/path-exists/-/path-exists-4.0.0.tgz", + "integrity": "sha512-ak9Qy5Q7jYb2Wwcey5Fpvg2KoAc/ZIhLSLOSBmRmygPsGwkVVt0fZa0qrtMz+m6tJTAHfZQ8FnmB4MG4LWy7/w==", + "dev": true, + "engines": { + "node": ">=8" + } + }, + "node_modules/path-is-absolute": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/path-is-absolute/-/path-is-absolute-1.0.1.tgz", + "integrity": "sha512-AVbw3UJ2e9bq64vSaS9Am0fje1Pa8pbGqTTsmXfaIiMpnr5DlDhfJOuLj9Sf95ZPVDAUerDfEk88MPmPe7UCQg==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/path-key": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/path-key/-/path-key-3.1.1.tgz", + "integrity": "sha512-ojmeN0qd+y0jszEtoY48r0Peq5dwMEkIlCOu6Q5f41lfkswXuKtYrhgoTpLnyIcHm24Uhqx+5Tqm2InSwLhE6Q==", + "dev": true, + "engines": { + "node": ">=8" + } + }, + "node_modules/path-parse": { + "version": "1.0.7", + "resolved": "https://registry.npmjs.org/path-parse/-/path-parse-1.0.7.tgz", + "integrity": "sha512-LDJzPVEEEPR+y48z93A0Ed0yXb8pAByGWo/k5YYdYgpY2/2EsOsksJrq7lOHxryrVOn1ejG6oAp8ahvOIQD8sw==", + "dev": true + }, + "node_modules/path-scurry": { + "version": "1.10.2", + "resolved": "https://registry.npmjs.org/path-scurry/-/path-scurry-1.10.2.tgz", + "integrity": "sha512-7xTavNy5RQXnsjANvVvMkEjvloOinkAjv/Z6Ildz9v2RinZ4SBKTWFOVRbaF8p0vpHnyjV/UwNDdKuUv6M5qcA==", + "dev": true, + "dependencies": { + "lru-cache": "^10.2.0", + "minipass": "^5.0.0 || ^6.0.2 || ^7.0.0" + }, + "engines": { + "node": ">=16 || 14 >=14.17" + }, + "funding": { + "url": "https://github.com/sponsors/isaacs" + } + }, + "node_modules/path-scurry/node_modules/lru-cache": { + "version": "10.2.0", + "resolved": "https://registry.npmjs.org/lru-cache/-/lru-cache-10.2.0.tgz", + "integrity": "sha512-2bIM8x+VAf6JT4bKAljS1qUWgMsqZRPGJS6FSahIMPVvctcNhyVp7AJu7quxOW9jwkryBReKZY5tY5JYv2n/7Q==", + "dev": true, + "engines": { + "node": "14 || >=16.14" + } + }, + "node_modules/picocolors": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/picocolors/-/picocolors-1.0.0.tgz", + "integrity": "sha512-1fygroTLlHu66zi26VoTDv8yRgm0Fccecssto+MhsZ0D/DGW2sm8E8AjW7NU5VVTRt5GxbeZ5qBuJr+HyLYkjQ==" + }, + "node_modules/picomatch": { + "version": "2.3.1", + "resolved": "https://registry.npmjs.org/picomatch/-/picomatch-2.3.1.tgz", + "integrity": "sha512-JU3teHTNjmE2VCGFzuY8EXzCDVwEqB2a8fsIvwaStHhAWJEeVd1o1QD80CU6+ZdEXXSLbSsuLwJjkCBWqRQUVA==", + "dev": true, + "engines": { + "node": ">=8.6" + }, + "funding": { + "url": "https://github.com/sponsors/jonschlinkert" + } + }, + "node_modules/pify": { + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/pify/-/pify-2.3.0.tgz", + "integrity": "sha512-udgsAY+fTnvv7kI7aaxbqwWNb0AHiB0qBO89PZKPkoTmGOgdbrHDKD+0B2X4uTfJ/FT1R09r9gTsjUjNJotuog==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/pirates": { + "version": "4.0.6", + "resolved": "https://registry.npmjs.org/pirates/-/pirates-4.0.6.tgz", + "integrity": "sha512-saLsH7WeYYPiD25LDuLRRY/i+6HaPYr6G1OUlN39otzkSTxKnubR9RTxS3/Kk50s1g2JTgFwWQDQyplC5/SHZg==", + "dev": true, + "engines": { + "node": ">= 6" + } + }, + "node_modules/possible-typed-array-names": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/possible-typed-array-names/-/possible-typed-array-names-1.0.0.tgz", + "integrity": "sha512-d7Uw+eZoloe0EHDIYoe+bQ5WXnGMOpmiZFTuMWCwpjzzkL2nTjcKiAk4hh8TjnGye2TwWOk3UXucZ+3rbmBa8Q==", + "dev": true, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/postcss": { + "version": "8.4.38", + "resolved": "https://registry.npmjs.org/postcss/-/postcss-8.4.38.tgz", + "integrity": "sha512-Wglpdk03BSfXkHoQa3b/oulrotAkwrlLDRSOb9D0bN86FdRyE9lppSp33aHNPgBa0JKCoB+drFLZkQoRRYae5A==", + "funding": [ + { + "type": "opencollective", + "url": "https://opencollective.com/postcss/" + }, + { + "type": "tidelift", + "url": "https://tidelift.com/funding/github/npm/postcss" + }, + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ], + "dependencies": { + "nanoid": "^3.3.7", + "picocolors": "^1.0.0", + "source-map-js": "^1.2.0" + }, + "engines": { + "node": "^10 || ^12 || >=14" + } + }, + "node_modules/postcss-import": { + "version": "15.1.0", + "resolved": "https://registry.npmjs.org/postcss-import/-/postcss-import-15.1.0.tgz", + "integrity": "sha512-hpr+J05B2FVYUAXHeK1YyI267J/dDDhMU6B6civm8hSY1jYJnBXxzKDKDswzJmtLHryrjhnDjqqp/49t8FALew==", + "dev": true, + "dependencies": { + "postcss-value-parser": "^4.0.0", + "read-cache": "^1.0.0", + "resolve": "^1.1.7" + }, + "engines": { + "node": ">=14.0.0" + }, + "peerDependencies": { + "postcss": "^8.0.0" + } + }, + "node_modules/postcss-import/node_modules/resolve": { + "version": "1.22.8", + "resolved": "https://registry.npmjs.org/resolve/-/resolve-1.22.8.tgz", + "integrity": "sha512-oKWePCxqpd6FlLvGV1VU0x7bkPmmCNolxzjMf4NczoDnQcIWrAF+cPtZn5i6n+RfD2d9i0tzpKnG6Yk168yIyw==", + "dev": true, + "dependencies": { + "is-core-module": "^2.13.0", + "path-parse": "^1.0.7", + "supports-preserve-symlinks-flag": "^1.0.0" + }, + "bin": { + "resolve": "bin/resolve" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/postcss-js": { + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/postcss-js/-/postcss-js-4.0.1.tgz", + "integrity": "sha512-dDLF8pEO191hJMtlHFPRa8xsizHaM82MLfNkUHdUtVEV3tgTp5oj+8qbEqYM57SLfc74KSbw//4SeJma2LRVIw==", + "dependencies": { + "camelcase-css": "^2.0.1" + }, + "engines": { + "node": "^12 || ^14 || >= 16" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/postcss/" + }, + "peerDependencies": { + "postcss": "^8.4.21" + } + }, + "node_modules/postcss-load-config": { + "version": "4.0.2", + "resolved": "https://registry.npmjs.org/postcss-load-config/-/postcss-load-config-4.0.2.tgz", + "integrity": "sha512-bSVhyJGL00wMVoPUzAVAnbEoWyqRxkjv64tUl427SKnPrENtq6hJwUojroMz2VB+Q1edmi4IfrAPpami5VVgMQ==", + "dev": true, + "funding": [ + { + "type": "opencollective", + "url": "https://opencollective.com/postcss/" + }, + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ], + "dependencies": { + "lilconfig": "^3.0.0", + "yaml": "^2.3.4" + }, + "engines": { + "node": ">= 14" + }, + "peerDependencies": { + "postcss": ">=8.0.9", + "ts-node": ">=9.0.0" + }, + "peerDependenciesMeta": { + "postcss": { + "optional": true + }, + "ts-node": { + "optional": true + } + } + }, + "node_modules/postcss-load-config/node_modules/lilconfig": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/lilconfig/-/lilconfig-3.1.1.tgz", + "integrity": "sha512-O18pf7nyvHTckunPWCV1XUNXU1piu01y2b7ATJ0ppkUkk8ocqVWBrYjJBCwHDjD/ZWcfyrA0P4gKhzWGi5EINQ==", + "dev": true, + "engines": { + "node": ">=14" + }, + "funding": { + "url": "https://github.com/sponsors/antonk52" + } + }, + "node_modules/postcss-nested": { + "version": "6.0.1", + "resolved": "https://registry.npmjs.org/postcss-nested/-/postcss-nested-6.0.1.tgz", + "integrity": "sha512-mEp4xPMi5bSWiMbsgoPfcP74lsWLHkQbZc3sY+jWYd65CUwXrUaTp0fmNpa01ZcETKlIgUdFN/MpS2xZtqL9dQ==", + "dev": true, + "dependencies": { + "postcss-selector-parser": "^6.0.11" + }, + "engines": { + "node": ">=12.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/postcss/" + }, + "peerDependencies": { + "postcss": "^8.2.14" + } + }, + "node_modules/postcss-selector-parser": { + "version": "6.0.16", + "resolved": "https://registry.npmjs.org/postcss-selector-parser/-/postcss-selector-parser-6.0.16.tgz", + "integrity": "sha512-A0RVJrX+IUkVZbW3ClroRWurercFhieevHB38sr2+l9eUClMqome3LmEmnhlNy+5Mr2EYN6B2Kaw9wYdd+VHiw==", + "dev": true, + "dependencies": { + "cssesc": "^3.0.0", + "util-deprecate": "^1.0.2" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/postcss-value-parser": { + "version": "4.2.0", + "resolved": "https://registry.npmjs.org/postcss-value-parser/-/postcss-value-parser-4.2.0.tgz", + "integrity": "sha512-1NNCs6uurfkVbeXG4S8JFT9t19m45ICnif8zWLd5oPSZ50QnwMfK+H3jv408d4jw/7Bttv5axS5IiHoLaVNHeQ==", + "dev": true + }, + "node_modules/prelude-ls": { + "version": "1.2.1", + "resolved": "https://registry.npmjs.org/prelude-ls/-/prelude-ls-1.2.1.tgz", + "integrity": "sha512-vkcDPrRZo1QZLbn5RLGPpg/WmIQ65qoWWhcGKf/b5eplkkarX0m9z8ppCat4mlOqUsWpyNuYgO3VRyrYHSzX5g==", + "dev": true, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/prop-types": { + "version": "15.8.1", + "resolved": "https://registry.npmjs.org/prop-types/-/prop-types-15.8.1.tgz", + "integrity": "sha512-oj87CgZICdulUohogVAR7AjlC0327U4el4L6eAvOqCeudMDVU0NThNaV+b9Df4dXgSP1gXMTnPdhfe/2qDH5cg==", + "dev": true, + "dependencies": { + "loose-envify": "^1.4.0", + "object-assign": "^4.1.1", + "react-is": "^16.13.1" + } + }, + "node_modules/punycode": { + "version": "2.3.1", + "resolved": "https://registry.npmjs.org/punycode/-/punycode-2.3.1.tgz", + "integrity": "sha512-vYt7UD1U9Wg6138shLtLOvdAu+8DsC/ilFtEVHcH+wydcSpNE20AfSOduf6MkRFahL5FY7X1oU7nKVZFtfq8Fg==", + "dev": true, + "engines": { + "node": ">=6" + } + }, + "node_modules/queue-microtask": { + "version": "1.2.3", + "resolved": "https://registry.npmjs.org/queue-microtask/-/queue-microtask-1.2.3.tgz", + "integrity": "sha512-NuaNSa6flKT5JaSYQzJok04JzTL1CA6aGhv5rfLW3PgqA+M2ChpZQnAC8h8i4ZFkBS8X5RqkDBHA7r4hej3K9A==", + "dev": true, + "funding": [ + { + "type": "github", + "url": "https://github.com/sponsors/feross" + }, + { + "type": "patreon", + "url": "https://www.patreon.com/feross" + }, + { + "type": "consulting", + "url": "https://feross.org/support" + } + ] + }, + "node_modules/react": { + "version": "18.2.0", + "resolved": "https://registry.npmjs.org/react/-/react-18.2.0.tgz", + "integrity": "sha512-/3IjMdb2L9QbBdWiW5e3P2/npwMBaU9mHCSCUzNln0ZCYbcfTsGbTJrU/kGemdH2IWmB2ioZ+zkxtmq6g09fGQ==", + "dependencies": { + "loose-envify": "^1.1.0" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/react-dom": { + "version": "18.2.0", + "resolved": "https://registry.npmjs.org/react-dom/-/react-dom-18.2.0.tgz", + "integrity": "sha512-6IMTriUmvsjHUjNtEDudZfuDQUoWXVxKHhlEGSk81n4YFS+r/Kl99wXiwlVXtPBtJenozv2P+hxDsw9eA7Xo6g==", + "dependencies": { + "loose-envify": "^1.1.0", + "scheduler": "^0.23.0" + }, + "peerDependencies": { + "react": "^18.2.0" + } + }, + "node_modules/react-is": { + "version": "16.13.1", + "resolved": "https://registry.npmjs.org/react-is/-/react-is-16.13.1.tgz", + "integrity": "sha512-24e6ynE2H+OKt4kqsOvNd8kBpV65zoxbA4BVsEOB3ARVWQki/DHzaUoC5KuON/BiccDaCCTZBuOcfZs70kR8bQ==", + "dev": true + }, + "node_modules/react-refresh": { + "version": "0.14.0", + "resolved": "https://registry.npmjs.org/react-refresh/-/react-refresh-0.14.0.tgz", + "integrity": "sha512-wViHqhAd8OHeLS/IRMJjTSDHF3U9eWi62F/MledQGPdJGDhodXJ9PBLNGr6WWL7qlH12Mt3TyTpbS+hGXMjCzQ==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/react-router": { + "version": "6.22.3", + "resolved": "https://registry.npmjs.org/react-router/-/react-router-6.22.3.tgz", + "integrity": "sha512-dr2eb3Mj5zK2YISHK++foM9w4eBnO23eKnZEDs7c880P6oKbrjz/Svg9+nxqtHQK+oMW4OtjZca0RqPglXxguQ==", + "dependencies": { + "@remix-run/router": "1.15.3" + }, + "engines": { + "node": ">=14.0.0" + }, + "peerDependencies": { + "react": ">=16.8" + } + }, + "node_modules/react-router-dom": { + "version": "6.22.3", + "resolved": "https://registry.npmjs.org/react-router-dom/-/react-router-dom-6.22.3.tgz", + "integrity": "sha512-7ZILI7HjcE+p31oQvwbokjk6OA/bnFxrhJ19n82Ex9Ph8fNAq+Hm/7KchpMGlTgWhUxRHMMCut+vEtNpWpowKw==", + "dependencies": { + "@remix-run/router": "1.15.3", + "react-router": "6.22.3" + }, + "engines": { + "node": ">=14.0.0" + }, + "peerDependencies": { + "react": ">=16.8", + "react-dom": ">=16.8" + } + }, + "node_modules/read-cache": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/read-cache/-/read-cache-1.0.0.tgz", + "integrity": "sha512-Owdv/Ft7IjOgm/i0xvNDZ1LrRANRfew4b2prF3OWMQLxLfu3bS8FVhCsrSCMK4lR56Y9ya+AThoTpDCTxCmpRA==", + "dev": true, + "dependencies": { + "pify": "^2.3.0" + } + }, + "node_modules/readdirp": { + "version": "3.6.0", + "resolved": "https://registry.npmjs.org/readdirp/-/readdirp-3.6.0.tgz", + "integrity": "sha512-hOS089on8RduqdbhvQ5Z37A0ESjsqz6qnRcffsMU3495FuTdqSm+7bhJ29JvIOsBDEEnan5DPu9t3To9VRlMzA==", + "dev": true, + "dependencies": { + "picomatch": "^2.2.1" + }, + "engines": { + "node": ">=8.10.0" + } + }, + "node_modules/reflect.getprototypeof": { + "version": "1.0.6", + "resolved": "https://registry.npmjs.org/reflect.getprototypeof/-/reflect.getprototypeof-1.0.6.tgz", + "integrity": "sha512-fmfw4XgoDke3kdI6h4xcUz1dG8uaiv5q9gcEwLS4Pnth2kxT+GZ7YehS1JTMGBQmtV7Y4GFGbs2re2NqhdozUg==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.7", + "define-properties": "^1.2.1", + "es-abstract": "^1.23.1", + "es-errors": "^1.3.0", + "get-intrinsic": "^1.2.4", + "globalthis": "^1.0.3", + "which-builtin-type": "^1.1.3" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/regexp.prototype.flags": { + "version": "1.5.2", + "resolved": "https://registry.npmjs.org/regexp.prototype.flags/-/regexp.prototype.flags-1.5.2.tgz", + "integrity": "sha512-NcDiDkTLuPR+++OCKB0nWafEmhg/Da8aUPLPMQbK+bxKKCm1/S5he+AqYa4PlMCVBalb4/yxIRub6qkEx5yJbw==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.6", + "define-properties": "^1.2.1", + "es-errors": "^1.3.0", + "set-function-name": "^2.0.1" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/resolve": { + "version": "2.0.0-next.5", + "resolved": "https://registry.npmjs.org/resolve/-/resolve-2.0.0-next.5.tgz", + "integrity": "sha512-U7WjGVG9sH8tvjW5SmGbQuui75FiyjAX72HX15DwBBwF9dNiQZRQAg9nnPhYy+TUnE0+VcrttuvNI8oSxZcocA==", + "dev": true, + "dependencies": { + "is-core-module": "^2.13.0", + "path-parse": "^1.0.7", + "supports-preserve-symlinks-flag": "^1.0.0" + }, + "bin": { + "resolve": "bin/resolve" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/resolve-from": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/resolve-from/-/resolve-from-4.0.0.tgz", + "integrity": "sha512-pb/MYmXstAkysRFx8piNI1tGFNQIFA3vkE3Gq4EuA1dF6gHp/+vgZqsCGJapvy8N3Q+4o7FwvquPJcnZ7RYy4g==", + "dev": true, + "engines": { + "node": ">=4" + } + }, + "node_modules/reusify": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/reusify/-/reusify-1.0.4.tgz", + "integrity": "sha512-U9nH88a3fc/ekCF1l0/UP1IosiuIjyTh7hBvXVMHYgVcfGvt897Xguj2UOLDeI5BG2m7/uwyaLVT6fbtCwTyzw==", + "dev": true, + "engines": { + "iojs": ">=1.0.0", + "node": ">=0.10.0" + } + }, + "node_modules/rimraf": { + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-3.0.2.tgz", + "integrity": "sha512-JZkJMZkAGFFPP2YqXZXPbMlMBgsxzE8ILs4lMIX/2o0L9UBw9O/Y3o6wFw/i9YLapcUJWwqbi3kdxIPdC62TIA==", + "dev": true, + "dependencies": { + "glob": "^7.1.3" + }, + "bin": { + "rimraf": "bin.js" + }, + "funding": { + "url": "https://github.com/sponsors/isaacs" + } + }, + "node_modules/rollup": { + "version": "4.14.3", + "resolved": "https://registry.npmjs.org/rollup/-/rollup-4.14.3.tgz", + "integrity": "sha512-ag5tTQKYsj1bhrFC9+OEWqb5O6VYgtQDO9hPDBMmIbePwhfSr+ExlcU741t8Dhw5DkPCQf6noz0jb36D6W9/hw==", + "dev": true, + "dependencies": { + "@types/estree": "1.0.5" + }, + "bin": { + "rollup": "dist/bin/rollup" + }, + "engines": { + "node": ">=18.0.0", + "npm": ">=8.0.0" + }, + "optionalDependencies": { + "@rollup/rollup-android-arm-eabi": "4.14.3", + "@rollup/rollup-android-arm64": "4.14.3", + "@rollup/rollup-darwin-arm64": "4.14.3", + "@rollup/rollup-darwin-x64": "4.14.3", + "@rollup/rollup-linux-arm-gnueabihf": "4.14.3", + "@rollup/rollup-linux-arm-musleabihf": "4.14.3", + "@rollup/rollup-linux-arm64-gnu": "4.14.3", + "@rollup/rollup-linux-arm64-musl": "4.14.3", + "@rollup/rollup-linux-powerpc64le-gnu": "4.14.3", + "@rollup/rollup-linux-riscv64-gnu": "4.14.3", + "@rollup/rollup-linux-s390x-gnu": "4.14.3", + "@rollup/rollup-linux-x64-gnu": "4.14.3", + "@rollup/rollup-linux-x64-musl": "4.14.3", + "@rollup/rollup-win32-arm64-msvc": "4.14.3", + "@rollup/rollup-win32-ia32-msvc": "4.14.3", + "@rollup/rollup-win32-x64-msvc": "4.14.3", + "fsevents": "~2.3.2" + } + }, + "node_modules/run-parallel": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/run-parallel/-/run-parallel-1.2.0.tgz", + "integrity": "sha512-5l4VyZR86LZ/lDxZTR6jqL8AFE2S0IFLMP26AbjsLVADxHdhB/c0GUsH+y39UfCi3dzz8OlQuPmnaJOMoDHQBA==", + "dev": true, + "funding": [ + { + "type": "github", + "url": "https://github.com/sponsors/feross" + }, + { + "type": "patreon", + "url": "https://www.patreon.com/feross" + }, + { + "type": "consulting", + "url": "https://feross.org/support" + } + ], + "dependencies": { + "queue-microtask": "^1.2.2" + } + }, + "node_modules/safe-array-concat": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/safe-array-concat/-/safe-array-concat-1.1.2.tgz", + "integrity": "sha512-vj6RsCsWBCf19jIeHEfkRMw8DPiBb+DMXklQ/1SGDHOMlHdPUkZXFQ2YdplS23zESTijAcurb1aSgJA3AgMu1Q==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.7", + "get-intrinsic": "^1.2.4", + "has-symbols": "^1.0.3", + "isarray": "^2.0.5" + }, + "engines": { + "node": ">=0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/safe-regex-test": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/safe-regex-test/-/safe-regex-test-1.0.3.tgz", + "integrity": "sha512-CdASjNJPvRa7roO6Ra/gLYBTzYzzPyyBXxIMdGW3USQLyjWEls2RgW5UBTXaQVp+OrpeCK3bLem8smtmheoRuw==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.6", + "es-errors": "^1.3.0", + "is-regex": "^1.1.4" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/scheduler": { + "version": "0.23.0", + "resolved": "https://registry.npmjs.org/scheduler/-/scheduler-0.23.0.tgz", + "integrity": "sha512-CtuThmgHNg7zIZWAXi3AsyIzA3n4xx7aNyjwC2VJldO2LMVDhFK+63xGqq6CsJH4rTAt6/M+N4GhZiDYPx9eUw==", + "dependencies": { + "loose-envify": "^1.1.0" + } + }, + "node_modules/semver": { + "version": "6.3.1", + "resolved": "https://registry.npmjs.org/semver/-/semver-6.3.1.tgz", + "integrity": "sha512-BR7VvDCVHO+q2xBEWskxS6DJE1qRnb7DxzUrogb71CWoSficBxYsiAGd+Kl0mmq/MprG9yArRkyrQxTO6XjMzA==", + "dev": true, + "bin": { + "semver": "bin/semver.js" + } + }, + "node_modules/set-function-length": { + "version": "1.2.2", + "resolved": "https://registry.npmjs.org/set-function-length/-/set-function-length-1.2.2.tgz", + "integrity": "sha512-pgRc4hJ4/sNjWCSS9AmnS40x3bNMDTknHgL5UaMBTMyJnU90EgWh1Rz+MC9eFu4BuN/UwZjKQuY/1v3rM7HMfg==", + "dev": true, + "dependencies": { + "define-data-property": "^1.1.4", + "es-errors": "^1.3.0", + "function-bind": "^1.1.2", + "get-intrinsic": "^1.2.4", + "gopd": "^1.0.1", + "has-property-descriptors": "^1.0.2" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/set-function-name": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/set-function-name/-/set-function-name-2.0.2.tgz", + "integrity": "sha512-7PGFlmtwsEADb0WYyvCMa1t+yke6daIG4Wirafur5kcf+MhUnPms1UeR0CKQdTZD81yESwMHbtn+TR+dMviakQ==", + "dev": true, + "dependencies": { + "define-data-property": "^1.1.4", + "es-errors": "^1.3.0", + "functions-have-names": "^1.2.3", + "has-property-descriptors": "^1.0.2" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/shebang-command": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/shebang-command/-/shebang-command-2.0.0.tgz", + "integrity": "sha512-kHxr2zZpYtdmrN1qDjrrX/Z1rR1kG8Dx+gkpK1G4eXmvXswmcE1hTWBWYUzlraYw1/yZp6YuDY77YtvbN0dmDA==", + "dev": true, + "dependencies": { + "shebang-regex": "^3.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/shebang-regex": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/shebang-regex/-/shebang-regex-3.0.0.tgz", + "integrity": "sha512-7++dFhtcx3353uBaq8DDR4NuxBetBzC7ZQOhmTQInHEd6bSrXdiEyzCvG07Z44UYdLShWUyXt5M/yhz8ekcb1A==", + "dev": true, + "engines": { + "node": ">=8" + } + }, + "node_modules/side-channel": { + "version": "1.0.6", + "resolved": "https://registry.npmjs.org/side-channel/-/side-channel-1.0.6.tgz", + "integrity": "sha512-fDW/EZ6Q9RiO8eFG8Hj+7u/oW+XrPTIChwCOM2+th2A6OblDtYYIpve9m+KvI9Z4C9qSEXlaGR6bTEYHReuglA==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.7", + "es-errors": "^1.3.0", + "get-intrinsic": "^1.2.4", + "object-inspect": "^1.13.1" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/signal-exit": { + "version": "4.1.0", + "resolved": "https://registry.npmjs.org/signal-exit/-/signal-exit-4.1.0.tgz", + "integrity": "sha512-bzyZ1e88w9O1iNJbKnOlvYTrWPDl46O1bG0D3XInv+9tkPrxrN8jUUTiFlDkkmKWgn1M6CfIA13SuGqOa9Korw==", + "dev": true, + "engines": { + "node": ">=14" + }, + "funding": { + "url": "https://github.com/sponsors/isaacs" + } + }, + "node_modules/source-map-js": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/source-map-js/-/source-map-js-1.2.0.tgz", + "integrity": "sha512-itJW8lvSA0TXEphiRoawsCksnlf8SyvmFzIhltqAHluXd88pkCd+cXJVHTDwdCr0IzwptSm035IHQktUu1QUMg==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/string-width": { + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/string-width/-/string-width-5.1.2.tgz", + "integrity": "sha512-HnLOCR3vjcY8beoNLtcjZ5/nxn2afmME6lhrDrebokqMap+XbeW8n9TXpPDOqdGK5qcI3oT0GKTW6wC7EMiVqA==", + "dev": true, + "dependencies": { + "eastasianwidth": "^0.2.0", + "emoji-regex": "^9.2.2", + "strip-ansi": "^7.0.1" + }, + "engines": { + "node": ">=12" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/string-width-cjs": { + "name": "string-width", + "version": "4.2.3", + "resolved": "https://registry.npmjs.org/string-width/-/string-width-4.2.3.tgz", + "integrity": "sha512-wKyQRQpjJ0sIp62ErSZdGsjMJWsap5oRNihHhu6G7JVO/9jIB6UyevL+tXuOqrng8j/cxKTWyWUwvSTriiZz/g==", + "dev": true, + "dependencies": { + "emoji-regex": "^8.0.0", + "is-fullwidth-code-point": "^3.0.0", + "strip-ansi": "^6.0.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/string-width-cjs/node_modules/emoji-regex": { + "version": "8.0.0", + "resolved": "https://registry.npmjs.org/emoji-regex/-/emoji-regex-8.0.0.tgz", + "integrity": "sha512-MSjYzcWNOA0ewAHpz0MxpYFvwg6yjy1NG3xteoqz644VCo/RPgnr1/GGt+ic3iJTzQ8Eu3TdM14SawnVUmGE6A==", + "dev": true + }, + "node_modules/string-width/node_modules/ansi-regex": { + "version": "6.0.1", + "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-6.0.1.tgz", + "integrity": "sha512-n5M855fKb2SsfMIiFFoVrABHJC8QtHwVx+mHWP3QcEqBHYienj5dHSgjbxtC0WEZXYt4wcD6zrQElDPhFuZgfA==", + "dev": true, + "engines": { + "node": ">=12" + }, + "funding": { + "url": "https://github.com/chalk/ansi-regex?sponsor=1" + } + }, + "node_modules/string-width/node_modules/strip-ansi": { + "version": "7.1.0", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-7.1.0.tgz", + "integrity": "sha512-iq6eVVI64nQQTRYq2KtEg2d2uU7LElhTJwsH4YzIHZshxlgZms/wIc4VoDQTlG/IvVIrBKG06CrZnp0qv7hkcQ==", + "dev": true, + "dependencies": { + "ansi-regex": "^6.0.1" + }, + "engines": { + "node": ">=12" + }, + "funding": { + "url": "https://github.com/chalk/strip-ansi?sponsor=1" + } + }, + "node_modules/string.prototype.matchall": { + "version": "4.0.11", + "resolved": "https://registry.npmjs.org/string.prototype.matchall/-/string.prototype.matchall-4.0.11.tgz", + "integrity": "sha512-NUdh0aDavY2og7IbBPenWqR9exH+E26Sv8e0/eTe1tltDGZL+GtBkDAnnyBtmekfK6/Dq3MkcGtzXFEd1LQrtg==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.7", + "define-properties": "^1.2.1", + "es-abstract": "^1.23.2", + "es-errors": "^1.3.0", + "es-object-atoms": "^1.0.0", + "get-intrinsic": "^1.2.4", + "gopd": "^1.0.1", + "has-symbols": "^1.0.3", + "internal-slot": "^1.0.7", + "regexp.prototype.flags": "^1.5.2", + "set-function-name": "^2.0.2", + "side-channel": "^1.0.6" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/string.prototype.trim": { + "version": "1.2.9", + "resolved": "https://registry.npmjs.org/string.prototype.trim/-/string.prototype.trim-1.2.9.tgz", + "integrity": "sha512-klHuCNxiMZ8MlsOihJhJEBJAiMVqU3Z2nEXWfWnIqjN0gEFS9J9+IxKozWWtQGcgoa1WUZzLjKPTr4ZHNFTFxw==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.7", + "define-properties": "^1.2.1", + "es-abstract": "^1.23.0", + "es-object-atoms": "^1.0.0" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/string.prototype.trimend": { + "version": "1.0.8", + "resolved": "https://registry.npmjs.org/string.prototype.trimend/-/string.prototype.trimend-1.0.8.tgz", + "integrity": "sha512-p73uL5VCHCO2BZZ6krwwQE3kCzM7NKmis8S//xEC6fQonchbum4eP6kR4DLEjQFO3Wnj3Fuo8NM0kOSjVdHjZQ==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.7", + "define-properties": "^1.2.1", + "es-object-atoms": "^1.0.0" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/string.prototype.trimstart": { + "version": "1.0.8", + "resolved": "https://registry.npmjs.org/string.prototype.trimstart/-/string.prototype.trimstart-1.0.8.tgz", + "integrity": "sha512-UXSH262CSZY1tfu3G3Secr6uGLCFVPMhIqHjlgCUtCCcgihYc/xKs9djMTMUOb2j1mVSeU8EU6NWc/iQKU6Gfg==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.7", + "define-properties": "^1.2.1", + "es-object-atoms": "^1.0.0" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/strip-ansi": { + "version": "6.0.1", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-6.0.1.tgz", + "integrity": "sha512-Y38VPSHcqkFrCpFnQ9vuSXmquuv5oXOKpGeT6aGrr3o3Gc9AlVa6JBfUSOCnbxGGZF+/0ooI7KrPuUSztUdU5A==", + "dev": true, + "dependencies": { + "ansi-regex": "^5.0.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/strip-ansi-cjs": { + "name": "strip-ansi", + "version": "6.0.1", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-6.0.1.tgz", + "integrity": "sha512-Y38VPSHcqkFrCpFnQ9vuSXmquuv5oXOKpGeT6aGrr3o3Gc9AlVa6JBfUSOCnbxGGZF+/0ooI7KrPuUSztUdU5A==", + "dev": true, + "dependencies": { + "ansi-regex": "^5.0.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/strip-json-comments": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/strip-json-comments/-/strip-json-comments-3.1.1.tgz", + "integrity": "sha512-6fPc+R4ihwqP6N/aIv2f1gMH8lOVtWQHoqC4yK6oSDVVocumAsfCqjkXnqiYMhmMwS/mEHLp7Vehlt3ql6lEig==", + "dev": true, + "engines": { + "node": ">=8" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/sucrase": { + "version": "3.35.0", + "resolved": "https://registry.npmjs.org/sucrase/-/sucrase-3.35.0.tgz", + "integrity": "sha512-8EbVDiu9iN/nESwxeSxDKe0dunta1GOlHufmSSXxMD2z2/tMZpDMpvXQGsc+ajGo8y2uYUmixaSRUc/QPoQ0GA==", + "dev": true, + "dependencies": { + "@jridgewell/gen-mapping": "^0.3.2", + "commander": "^4.0.0", + "glob": "^10.3.10", + "lines-and-columns": "^1.1.6", + "mz": "^2.7.0", + "pirates": "^4.0.1", + "ts-interface-checker": "^0.1.9" + }, + "bin": { + "sucrase": "bin/sucrase", + "sucrase-node": "bin/sucrase-node" + }, + "engines": { + "node": ">=16 || 14 >=14.17" + } + }, + "node_modules/sucrase/node_modules/brace-expansion": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-2.0.1.tgz", + "integrity": "sha512-XnAIvQ8eM+kC6aULx6wuQiwVsnzsi9d3WxzV3FpWTGA19F621kwdbsAcFKXgKUHZWsy+mY6iL1sHTxWEFCytDA==", + "dev": true, + "dependencies": { + "balanced-match": "^1.0.0" + } + }, + "node_modules/sucrase/node_modules/glob": { + "version": "10.3.12", + "resolved": "https://registry.npmjs.org/glob/-/glob-10.3.12.tgz", + "integrity": "sha512-TCNv8vJ+xz4QiqTpfOJA7HvYv+tNIRHKfUWw/q+v2jdgN4ebz+KY9tGx5J4rHP0o84mNP+ApH66HRX8us3Khqg==", + "dev": true, + "dependencies": { + "foreground-child": "^3.1.0", + "jackspeak": "^2.3.6", + "minimatch": "^9.0.1", + "minipass": "^7.0.4", + "path-scurry": "^1.10.2" + }, + "bin": { + "glob": "dist/esm/bin.mjs" + }, + "engines": { + "node": ">=16 || 14 >=14.17" + }, + "funding": { + "url": "https://github.com/sponsors/isaacs" + } + }, + "node_modules/sucrase/node_modules/minimatch": { + "version": "9.0.4", + "resolved": "https://registry.npmjs.org/minimatch/-/minimatch-9.0.4.tgz", + "integrity": "sha512-KqWh+VchfxcMNRAJjj2tnsSJdNbHsVgnkBhTNrW7AjVo6OvLtxw8zfT9oLw1JSohlFzJ8jCoTgaoXvJ+kHt6fw==", + "dev": true, + "dependencies": { + "brace-expansion": "^2.0.1" + }, + "engines": { + "node": ">=16 || 14 >=14.17" + }, + "funding": { + "url": "https://github.com/sponsors/isaacs" + } + }, + "node_modules/supports-color": { + "version": "5.5.0", + "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-5.5.0.tgz", + "integrity": "sha512-QjVjwdXIt408MIiAqCX4oUKsgU2EqAGzs2Ppkm4aQYbjm+ZEWEcW4SfFNTr4uMNZma0ey4f5lgLrkB0aX0QMow==", + "dev": true, + "dependencies": { + "has-flag": "^3.0.0" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/supports-preserve-symlinks-flag": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/supports-preserve-symlinks-flag/-/supports-preserve-symlinks-flag-1.0.0.tgz", + "integrity": "sha512-ot0WnXS9fgdkgIcePe6RHNk1WA8+muPa6cSjeR3V8K27q9BB1rTE3R1p7Hv0z1ZyAc8s6Vvv8DIyWf681MAt0w==", + "dev": true, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/tailwindcss": { + "version": "3.4.3", + "resolved": "https://registry.npmjs.org/tailwindcss/-/tailwindcss-3.4.3.tgz", + "integrity": "sha512-U7sxQk/n397Bmx4JHbJx/iSOOv5G+II3f1kpLpY2QeUv5DcPdcTsYLlusZfq1NthHS1c1cZoyFmmkex1rzke0A==", + "dev": true, + "dependencies": { + "@alloc/quick-lru": "^5.2.0", + "arg": "^5.0.2", + "chokidar": "^3.5.3", + "didyoumean": "^1.2.2", + "dlv": "^1.1.3", + "fast-glob": "^3.3.0", + "glob-parent": "^6.0.2", + "is-glob": "^4.0.3", + "jiti": "^1.21.0", + "lilconfig": "^2.1.0", + "micromatch": "^4.0.5", + "normalize-path": "^3.0.0", + "object-hash": "^3.0.0", + "picocolors": "^1.0.0", + "postcss": "^8.4.23", + "postcss-import": "^15.1.0", + "postcss-js": "^4.0.1", + "postcss-load-config": "^4.0.1", + "postcss-nested": "^6.0.1", + "postcss-selector-parser": "^6.0.11", + "resolve": "^1.22.2", + "sucrase": "^3.32.0" + }, + "bin": { + "tailwind": "lib/cli.js", + "tailwindcss": "lib/cli.js" + }, + "engines": { + "node": ">=14.0.0" + } + }, + "node_modules/tailwindcss/node_modules/resolve": { + "version": "1.22.8", + "resolved": "https://registry.npmjs.org/resolve/-/resolve-1.22.8.tgz", + "integrity": "sha512-oKWePCxqpd6FlLvGV1VU0x7bkPmmCNolxzjMf4NczoDnQcIWrAF+cPtZn5i6n+RfD2d9i0tzpKnG6Yk168yIyw==", + "dev": true, + "dependencies": { + "is-core-module": "^2.13.0", + "path-parse": "^1.0.7", + "supports-preserve-symlinks-flag": "^1.0.0" + }, + "bin": { + "resolve": "bin/resolve" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/text-table": { + "version": "0.2.0", + "resolved": "https://registry.npmjs.org/text-table/-/text-table-0.2.0.tgz", + "integrity": "sha512-N+8UisAXDGk8PFXP4HAzVR9nbfmVJ3zYLAWiTIoqC5v5isinhr+r5uaO8+7r3BMfuNIufIsA7RdpVgacC2cSpw==", + "dev": true + }, + "node_modules/thenify": { + "version": "3.3.1", + "resolved": "https://registry.npmjs.org/thenify/-/thenify-3.3.1.tgz", + "integrity": "sha512-RVZSIV5IG10Hk3enotrhvz0T9em6cyHBLkH/YAZuKqd8hRkKhSfCGIcP2KUY0EPxndzANBmNllzWPwak+bheSw==", + "dev": true, + "dependencies": { + "any-promise": "^1.0.0" + } + }, + "node_modules/thenify-all": { + "version": "1.6.0", + "resolved": "https://registry.npmjs.org/thenify-all/-/thenify-all-1.6.0.tgz", + "integrity": "sha512-RNxQH/qI8/t3thXJDwcstUO4zeqo64+Uy/+sNVRBx4Xn2OX+OZ9oP+iJnNFqplFra2ZUVeKCSa2oVWi3T4uVmA==", + "dev": true, + "dependencies": { + "thenify": ">= 3.1.0 < 4" + }, + "engines": { + "node": ">=0.8" + } + }, + "node_modules/to-fast-properties": { + "version": "2.0.0", + "resolved": "https://registry.npmjs.org/to-fast-properties/-/to-fast-properties-2.0.0.tgz", + "integrity": "sha512-/OaKK0xYrs3DmxRYqL/yDc+FxFUVYhDlXMhRmv3z915w2HF1tnN1omB354j8VUGO/hbRzyD6Y3sA7v7GS/ceog==", + "dev": true, + "engines": { + "node": ">=4" + } + }, + "node_modules/to-regex-range": { + "version": "5.0.1", + "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-5.0.1.tgz", + "integrity": "sha512-65P7iz6X5yEr1cwcgvQxbbIw7Uk3gOy5dIdtZ4rDveLqhrdJP+Li/Hx6tyK0NEb+2GCyneCMJiGqrADCSNk8sQ==", + "dev": true, + "dependencies": { + "is-number": "^7.0.0" + }, + "engines": { + "node": ">=8.0" + } + }, + "node_modules/ts-interface-checker": { + "version": "0.1.13", + "resolved": "https://registry.npmjs.org/ts-interface-checker/-/ts-interface-checker-0.1.13.tgz", + "integrity": "sha512-Y/arvbn+rrz3JCKl9C4kVNfTfSm2/mEp5FSz5EsZSANGPSlQrpRI5M4PKF+mJnE52jOO90PnPSc3Ur3bTQw0gA==", + "dev": true + }, + "node_modules/type-check": { + "version": "0.4.0", + "resolved": "https://registry.npmjs.org/type-check/-/type-check-0.4.0.tgz", + "integrity": "sha512-XleUoc9uwGXqjWwXaUTZAmzMcFZ5858QA2vvx1Ur5xIcixXIP+8LnFDgRplU30us6teqdlskFfu+ae4K79Ooew==", + "dev": true, + "dependencies": { + "prelude-ls": "^1.2.1" + }, + "engines": { + "node": ">= 0.8.0" + } + }, + "node_modules/type-fest": { + "version": "0.20.2", + "resolved": "https://registry.npmjs.org/type-fest/-/type-fest-0.20.2.tgz", + "integrity": "sha512-Ne+eE4r0/iWnpAxD852z3A+N0Bt5RN//NjJwRd2VFHEmrywxf5vsZlh4R6lixl6B+wz/8d+maTSAkN1FIkI3LQ==", + "dev": true, + "engines": { + "node": ">=10" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/typed-array-buffer": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/typed-array-buffer/-/typed-array-buffer-1.0.2.tgz", + "integrity": "sha512-gEymJYKZtKXzzBzM4jqa9w6Q1Jjm7x2d+sh19AdsD4wqnMPDYyvwpsIc2Q/835kHuo3BEQ7CjelGhfTsoBb2MQ==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.7", + "es-errors": "^1.3.0", + "is-typed-array": "^1.1.13" + }, + "engines": { + "node": ">= 0.4" + } + }, + "node_modules/typed-array-byte-length": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/typed-array-byte-length/-/typed-array-byte-length-1.0.1.tgz", + "integrity": "sha512-3iMJ9q0ao7WE9tWcaYKIptkNBuOIcZCCT0d4MRvuuH88fEoEH62IuQe0OtraD3ebQEoTRk8XCBoknUNc1Y67pw==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.7", + "for-each": "^0.3.3", + "gopd": "^1.0.1", + "has-proto": "^1.0.3", + "is-typed-array": "^1.1.13" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/typed-array-byte-offset": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/typed-array-byte-offset/-/typed-array-byte-offset-1.0.2.tgz", + "integrity": "sha512-Ous0vodHa56FviZucS2E63zkgtgrACj7omjwd/8lTEMEPFFyjfixMZ1ZXenpgCFBBt4EC1J2XsyVS2gkG0eTFA==", + "dev": true, + "dependencies": { + "available-typed-arrays": "^1.0.7", + "call-bind": "^1.0.7", + "for-each": "^0.3.3", + "gopd": "^1.0.1", + "has-proto": "^1.0.3", + "is-typed-array": "^1.1.13" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/typed-array-length": { + "version": "1.0.6", + "resolved": "https://registry.npmjs.org/typed-array-length/-/typed-array-length-1.0.6.tgz", + "integrity": "sha512-/OxDN6OtAk5KBpGb28T+HZc2M+ADtvRxXrKKbUwtsLgdoxgX13hyy7ek6bFRl5+aBs2yZzB0c4CnQfAtVypW/g==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.7", + "for-each": "^0.3.3", + "gopd": "^1.0.1", + "has-proto": "^1.0.3", + "is-typed-array": "^1.1.13", + "possible-typed-array-names": "^1.0.0" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/unbox-primitive": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/unbox-primitive/-/unbox-primitive-1.0.2.tgz", + "integrity": "sha512-61pPlCD9h51VoreyJ0BReideM3MDKMKnh6+V9L08331ipq6Q8OFXZYiqP6n/tbHx4s5I9uRhcye6BrbkizkBDw==", + "dev": true, + "dependencies": { + "call-bind": "^1.0.2", + "has-bigints": "^1.0.2", + "has-symbols": "^1.0.3", + "which-boxed-primitive": "^1.0.2" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/update-browserslist-db": { + "version": "1.0.13", + "resolved": "https://registry.npmjs.org/update-browserslist-db/-/update-browserslist-db-1.0.13.tgz", + "integrity": "sha512-xebP81SNcPuNpPP3uzeW1NYXxI3rxyJzF3pD6sH4jE7o/IX+WtSpwnVU+qIsDPyk0d3hmFQ7mjqc6AtV604hbg==", + "dev": true, + "funding": [ + { + "type": "opencollective", + "url": "https://opencollective.com/browserslist" + }, + { + "type": "tidelift", + "url": "https://tidelift.com/funding/github/npm/browserslist" + }, + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ], + "dependencies": { + "escalade": "^3.1.1", + "picocolors": "^1.0.0" + }, + "bin": { + "update-browserslist-db": "cli.js" + }, + "peerDependencies": { + "browserslist": ">= 4.21.0" + } + }, + "node_modules/uri-js": { + "version": "4.4.1", + "resolved": "https://registry.npmjs.org/uri-js/-/uri-js-4.4.1.tgz", + "integrity": "sha512-7rKUyy33Q1yc98pQ1DAmLtwX109F7TIfWlW1Ydo8Wl1ii1SeHieeh0HHfPeL2fMXK6z0s8ecKs9frCuLJvndBg==", + "dev": true, + "dependencies": { + "punycode": "^2.1.0" + } + }, + "node_modules/util-deprecate": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/util-deprecate/-/util-deprecate-1.0.2.tgz", + "integrity": "sha512-EPD5q1uXyFxJpCrLnCc1nHnq3gOa6DZBocAIiI2TaSCA7VCJ1UJDMagCzIkXNsUYfD1daK//LTEQ8xiIbrHtcw==", + "dev": true + }, + "node_modules/vite": { + "version": "5.2.9", + "resolved": "https://registry.npmjs.org/vite/-/vite-5.2.9.tgz", + "integrity": "sha512-uOQWfuZBlc6Y3W/DTuQ1Sr+oIXWvqljLvS881SVmAj00d5RdgShLcuXWxseWPd4HXwiYBFW/vXHfKFeqj9uQnw==", + "dev": true, + "dependencies": { + "esbuild": "^0.20.1", + "postcss": "^8.4.38", + "rollup": "^4.13.0" + }, + "bin": { + "vite": "bin/vite.js" + }, + "engines": { + "node": "^18.0.0 || >=20.0.0" + }, + "funding": { + "url": "https://github.com/vitejs/vite?sponsor=1" + }, + "optionalDependencies": { + "fsevents": "~2.3.3" + }, + "peerDependencies": { + "@types/node": "^18.0.0 || >=20.0.0", + "less": "*", + "lightningcss": "^1.21.0", + "sass": "*", + "stylus": "*", + "sugarss": "*", + "terser": "^5.4.0" + }, + "peerDependenciesMeta": { + "@types/node": { + "optional": true + }, + "less": { + "optional": true + }, + "lightningcss": { + "optional": true + }, + "sass": { + "optional": true + }, + "stylus": { + "optional": true + }, + "sugarss": { + "optional": true + }, + "terser": { + "optional": true + } + } + }, + "node_modules/which": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/which/-/which-2.0.2.tgz", + "integrity": "sha512-BLI3Tl1TW3Pvl70l3yq3Y64i+awpwXqsGBYWkkqMtnbXgrMD+yj7rhW0kuEDxzJaYXGjEW5ogapKNMEKNMjibA==", + "dev": true, + "dependencies": { + "isexe": "^2.0.0" + }, + "bin": { + "node-which": "bin/node-which" + }, + "engines": { + "node": ">= 8" + } + }, + "node_modules/which-boxed-primitive": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/which-boxed-primitive/-/which-boxed-primitive-1.0.2.tgz", + "integrity": "sha512-bwZdv0AKLpplFY2KZRX6TvyuN7ojjr7lwkg6ml0roIy9YeuSr7JS372qlNW18UQYzgYK9ziGcerWqZOmEn9VNg==", + "dev": true, + "dependencies": { + "is-bigint": "^1.0.1", + "is-boolean-object": "^1.1.0", + "is-number-object": "^1.0.4", + "is-string": "^1.0.5", + "is-symbol": "^1.0.3" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/which-builtin-type": { + "version": "1.1.3", + "resolved": "https://registry.npmjs.org/which-builtin-type/-/which-builtin-type-1.1.3.tgz", + "integrity": "sha512-YmjsSMDBYsM1CaFiayOVT06+KJeXf0o5M/CAd4o1lTadFAtacTUM49zoYxr/oroopFDfhvN6iEcBxUyc3gvKmw==", + "dev": true, + "dependencies": { + "function.prototype.name": "^1.1.5", + "has-tostringtag": "^1.0.0", + "is-async-function": "^2.0.0", + "is-date-object": "^1.0.5", + "is-finalizationregistry": "^1.0.2", + "is-generator-function": "^1.0.10", + "is-regex": "^1.1.4", + "is-weakref": "^1.0.2", + "isarray": "^2.0.5", + "which-boxed-primitive": "^1.0.2", + "which-collection": "^1.0.1", + "which-typed-array": "^1.1.9" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/which-collection": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/which-collection/-/which-collection-1.0.2.tgz", + "integrity": "sha512-K4jVyjnBdgvc86Y6BkaLZEN933SwYOuBFkdmBu9ZfkcAbdVbpITnDmjvZ/aQjRXQrv5EPkTnD1s39GiiqbngCw==", + "dev": true, + "dependencies": { + "is-map": "^2.0.3", + "is-set": "^2.0.3", + "is-weakmap": "^2.0.2", + "is-weakset": "^2.0.3" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/which-typed-array": { + "version": "1.1.15", + "resolved": "https://registry.npmjs.org/which-typed-array/-/which-typed-array-1.1.15.tgz", + "integrity": "sha512-oV0jmFtUky6CXfkqehVvBP/LSWJ2sy4vWMioiENyJLePrBO/yKyV9OyJySfAKosh+RYkIl5zJCNZ8/4JncrpdA==", + "dev": true, + "dependencies": { + "available-typed-arrays": "^1.0.7", + "call-bind": "^1.0.7", + "for-each": "^0.3.3", + "gopd": "^1.0.1", + "has-tostringtag": "^1.0.2" + }, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/wrap-ansi": { + "version": "8.1.0", + "resolved": "https://registry.npmjs.org/wrap-ansi/-/wrap-ansi-8.1.0.tgz", + "integrity": "sha512-si7QWI6zUMq56bESFvagtmzMdGOtoxfR+Sez11Mobfc7tm+VkUckk9bW2UeffTGVUbOksxmSw0AA2gs8g71NCQ==", + "dev": true, + "dependencies": { + "ansi-styles": "^6.1.0", + "string-width": "^5.0.1", + "strip-ansi": "^7.0.1" + }, + "engines": { + "node": ">=12" + }, + "funding": { + "url": "https://github.com/chalk/wrap-ansi?sponsor=1" + } + }, + "node_modules/wrap-ansi-cjs": { + "name": "wrap-ansi", + "version": "7.0.0", + "resolved": "https://registry.npmjs.org/wrap-ansi/-/wrap-ansi-7.0.0.tgz", + "integrity": "sha512-YVGIj2kamLSTxw6NsZjoBxfSwsn0ycdesmc4p+Q21c5zPuZ1pl+NfxVdxPtdHvmNVOQ6XSYG4AUtyt/Fi7D16Q==", + "dev": true, + "dependencies": { + "ansi-styles": "^4.0.0", + "string-width": "^4.1.0", + "strip-ansi": "^6.0.0" + }, + "engines": { + "node": ">=10" + }, + "funding": { + "url": "https://github.com/chalk/wrap-ansi?sponsor=1" + } + }, + "node_modules/wrap-ansi-cjs/node_modules/ansi-styles": { + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz", + "integrity": "sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg==", + "dev": true, + "dependencies": { + "color-convert": "^2.0.1" + }, + "engines": { + "node": ">=8" + }, + "funding": { + "url": "https://github.com/chalk/ansi-styles?sponsor=1" + } + }, + "node_modules/wrap-ansi-cjs/node_modules/color-convert": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/color-convert/-/color-convert-2.0.1.tgz", + "integrity": "sha512-RRECPsj7iu/xb5oKYcsFHSppFNnsj/52OVTRKb4zP5onXwVF3zVmmToNcOfGC+CRDpfK/U584fMg38ZHCaElKQ==", + "dev": true, + "dependencies": { + "color-name": "~1.1.4" + }, + "engines": { + "node": ">=7.0.0" + } + }, + "node_modules/wrap-ansi-cjs/node_modules/color-name": { + "version": "1.1.4", + "resolved": "https://registry.npmjs.org/color-name/-/color-name-1.1.4.tgz", + "integrity": "sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA==", + "dev": true + }, + "node_modules/wrap-ansi-cjs/node_modules/emoji-regex": { + "version": "8.0.0", + "resolved": "https://registry.npmjs.org/emoji-regex/-/emoji-regex-8.0.0.tgz", + "integrity": "sha512-MSjYzcWNOA0ewAHpz0MxpYFvwg6yjy1NG3xteoqz644VCo/RPgnr1/GGt+ic3iJTzQ8Eu3TdM14SawnVUmGE6A==", + "dev": true + }, + "node_modules/wrap-ansi-cjs/node_modules/string-width": { + "version": "4.2.3", + "resolved": "https://registry.npmjs.org/string-width/-/string-width-4.2.3.tgz", + "integrity": "sha512-wKyQRQpjJ0sIp62ErSZdGsjMJWsap5oRNihHhu6G7JVO/9jIB6UyevL+tXuOqrng8j/cxKTWyWUwvSTriiZz/g==", + "dev": true, + "dependencies": { + "emoji-regex": "^8.0.0", + "is-fullwidth-code-point": "^3.0.0", + "strip-ansi": "^6.0.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/wrap-ansi/node_modules/ansi-regex": { + "version": "6.0.1", + "resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-6.0.1.tgz", + "integrity": "sha512-n5M855fKb2SsfMIiFFoVrABHJC8QtHwVx+mHWP3QcEqBHYienj5dHSgjbxtC0WEZXYt4wcD6zrQElDPhFuZgfA==", + "dev": true, + "engines": { + "node": ">=12" + }, + "funding": { + "url": "https://github.com/chalk/ansi-regex?sponsor=1" + } + }, + "node_modules/wrap-ansi/node_modules/ansi-styles": { + "version": "6.2.1", + "resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-6.2.1.tgz", + "integrity": "sha512-bN798gFfQX+viw3R7yrGWRqnrN2oRkEkUjjl4JNn4E8GxxbjtG3FbrEIIY3l8/hrwUwIeCZvi4QuOTP4MErVug==", + "dev": true, + "engines": { + "node": ">=12" + }, + "funding": { + "url": "https://github.com/chalk/ansi-styles?sponsor=1" + } + }, + "node_modules/wrap-ansi/node_modules/strip-ansi": { + "version": "7.1.0", + "resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-7.1.0.tgz", + "integrity": "sha512-iq6eVVI64nQQTRYq2KtEg2d2uU7LElhTJwsH4YzIHZshxlgZms/wIc4VoDQTlG/IvVIrBKG06CrZnp0qv7hkcQ==", + "dev": true, + "dependencies": { + "ansi-regex": "^6.0.1" + }, + "engines": { + "node": ">=12" + }, + "funding": { + "url": "https://github.com/chalk/strip-ansi?sponsor=1" + } + }, + "node_modules/wrappy": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/wrappy/-/wrappy-1.0.2.tgz", + "integrity": "sha512-l4Sp/DRseor9wL6EvV2+TuQn63dMkPjZ/sp9XkghTEbV9KlPS1xUsZ3u7/IQO4wxtcFB4bgpQPRcR3QCvezPcQ==", + "dev": true + }, + "node_modules/yallist": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/yallist/-/yallist-3.1.1.tgz", + "integrity": "sha512-a4UGQaWPH59mOXUYnAG2ewncQS4i4F43Tv3JoAM+s2VDAmS9NsK8GpDMLrCHPksFT7h3K6TOoUNn2pb7RoXx4g==", + "dev": true + }, + "node_modules/yaml": { + "version": "2.4.1", + "resolved": "https://registry.npmjs.org/yaml/-/yaml-2.4.1.tgz", + "integrity": "sha512-pIXzoImaqmfOrL7teGUBt/T7ZDnyeGBWyXQBvOVhLkWLN37GXv8NMLK406UY6dS51JfcQHsmcW5cJ441bHg6Lg==", + "dev": true, + "bin": { + "yaml": "bin.mjs" + }, + "engines": { + "node": ">= 14" + } + }, + "node_modules/yocto-queue": { + "version": "0.1.0", + "resolved": "https://registry.npmjs.org/yocto-queue/-/yocto-queue-0.1.0.tgz", + "integrity": "sha512-rVksvsnNCdJ/ohGc6xgPwyN8eheCxsiLM8mxuE/t/mOVqJewPuO1miLpTHQiRgTKCLexL4MeAFVagts7HmNZ2Q==", + "dev": true, + "engines": { + "node": ">=10" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + } + } +} diff --git a/25_03_11/frontend_vizsgafeladat/frontend/package.json b/25_03_11/frontend_vizsgafeladat/frontend/package.json new file mode 100644 index 00000000..e31a1106 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/frontend/package.json @@ -0,0 +1,31 @@ +{ + "name": "frontend", + "private": true, + "version": "0.0.0", + "type": "module", + "scripts": { + "dev": "vite", + "build": "vite build", + "lint": "eslint . --ext js,jsx --report-unused-disable-directives --max-warnings 0", + "preview": "vite preview" + }, + "dependencies": { + "daisyui": "^4.10.2", + "react": "^18.2.0", + "react-dom": "^18.2.0", + "react-router-dom": "^6.22.3" + }, + "devDependencies": { + "@types/react": "^18.2.66", + "@types/react-dom": "^18.2.22", + "@vitejs/plugin-react": "^4.2.1", + "autoprefixer": "^10.4.19", + "eslint": "^8.57.0", + "eslint-plugin-react": "^7.34.1", + "eslint-plugin-react-hooks": "^4.6.0", + "eslint-plugin-react-refresh": "^0.4.6", + "postcss": "^8.4.38", + "tailwindcss": "^3.4.3", + "vite": "^5.2.0" + } +} diff --git a/25_03_11/frontend_vizsgafeladat/frontend/postcss.config.js b/25_03_11/frontend_vizsgafeladat/frontend/postcss.config.js new file mode 100644 index 00000000..2e7af2b7 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/frontend/postcss.config.js @@ -0,0 +1,6 @@ +export default { + plugins: { + tailwindcss: {}, + autoprefixer: {}, + }, +} diff --git a/25_03_11/frontend_vizsgafeladat/frontend/public/vite.svg b/25_03_11/frontend_vizsgafeladat/frontend/public/vite.svg new file mode 100644 index 00000000..e7b8dfb1 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/frontend/public/vite.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/25_03_11/frontend_vizsgafeladat/frontend/src/App.css b/25_03_11/frontend_vizsgafeladat/frontend/src/App.css new file mode 100644 index 00000000..b9d355df --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/frontend/src/App.css @@ -0,0 +1,42 @@ +#root { + max-width: 1280px; + margin: 0 auto; + padding: 2rem; + text-align: center; +} + +.logo { + height: 6em; + padding: 1.5em; + will-change: filter; + transition: filter 300ms; +} +.logo:hover { + filter: drop-shadow(0 0 2em #646cffaa); +} +.logo.react:hover { + filter: drop-shadow(0 0 2em #61dafbaa); +} + +@keyframes logo-spin { + from { + transform: rotate(0deg); + } + to { + transform: rotate(360deg); + } +} + +@media (prefers-reduced-motion: no-preference) { + a:nth-of-type(2) .logo { + animation: logo-spin infinite 20s linear; + } +} + +.card { + padding: 2em; +} + +.read-the-docs { + color: #888; +} diff --git a/25_03_11/frontend_vizsgafeladat/frontend/src/App.jsx b/25_03_11/frontend_vizsgafeladat/frontend/src/App.jsx new file mode 100644 index 00000000..b15377c3 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/frontend/src/App.jsx @@ -0,0 +1,30 @@ +import Header from "./components/Header" +import Main from "./components/Main"; +import Menu from "./components/Menu"; +import Termekek from "./components/Termekek"; +import UjTermek from "./components/UjTermek"; + +import {BrowserRouter, Route, Routes} from "react-router-dom"; + +const headerText = "Webshop"; + +function App() { + + + return ( + <> + +
+ + + } /> + } /> + } /> + } /> + + + + ) +} + +export default App diff --git a/25_03_11/frontend_vizsgafeladat/frontend/src/assets/Business_SVG.svg b/25_03_11/frontend_vizsgafeladat/frontend/src/assets/Business_SVG.svg new file mode 100644 index 00000000..b4a7ac0c --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/frontend/src/assets/Business_SVG.svg @@ -0,0 +1 @@ +Business_SVG \ No newline at end of file diff --git a/25_03_11/frontend_vizsgafeladat/frontend/src/assets/react.svg b/25_03_11/frontend_vizsgafeladat/frontend/src/assets/react.svg new file mode 100644 index 00000000..6c87de9b --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/frontend/src/assets/react.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/25_03_11/frontend_vizsgafeladat/frontend/src/components/Header.jsx b/25_03_11/frontend_vizsgafeladat/frontend/src/components/Header.jsx new file mode 100644 index 00000000..f25097c5 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/frontend/src/components/Header.jsx @@ -0,0 +1,5 @@ +export default function Header({szoveg}) { + return ( +

{szoveg}

+ ) +} \ No newline at end of file diff --git a/25_03_11/frontend_vizsgafeladat/frontend/src/components/Main.jsx b/25_03_11/frontend_vizsgafeladat/frontend/src/components/Main.jsx new file mode 100644 index 00000000..99a3fab7 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/frontend/src/components/Main.jsx @@ -0,0 +1,44 @@ +import KEP from "./../assets/Business_SVG.svg"; + +export default function Main() { + return ( +
+
+
+ +
+
+
+
+

+ text +

text +

+

+

+ text +

+
+ +
+
+
+ Kép +
+
+
+ ) +} \ No newline at end of file diff --git a/25_03_11/frontend_vizsgafeladat/frontend/src/components/Menu.jsx b/25_03_11/frontend_vizsgafeladat/frontend/src/components/Menu.jsx new file mode 100644 index 00000000..e9758a0c --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/frontend/src/components/Menu.jsx @@ -0,0 +1,32 @@ +import { Link } from "react-router-dom" + +export default function Menu() { + return ( + + ) +} \ No newline at end of file diff --git a/25_03_11/frontend_vizsgafeladat/frontend/src/components/Termek.jsx b/25_03_11/frontend_vizsgafeladat/frontend/src/components/Termek.jsx new file mode 100644 index 00000000..94486340 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/frontend/src/components/Termek.jsx @@ -0,0 +1,29 @@ +export default function Termek(params) { + const { id, megnevezes, ar } = params.element; + return ( +
+
+
+ +
+
+
+ {megnevezes} +
+

+ {id} +

+

+ {ar} +

+

+ text +

+
+ +
+
+ ) +} \ No newline at end of file diff --git a/25_03_11/frontend_vizsgafeladat/frontend/src/components/Termekek.jsx b/25_03_11/frontend_vizsgafeladat/frontend/src/components/Termekek.jsx new file mode 100644 index 00000000..61bab56f --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/frontend/src/components/Termekek.jsx @@ -0,0 +1,40 @@ +import { useEffect, useState } from "react"; +import Termek from "./Termek"; + +const url = "http://localhost:8000/termekek"; + +export default function Termekek(){ + const [termekek, setTermekek] = useState([]); + + + + useEffect( () => { + async function getData(){ + try { + const resp = await fetch(url); + const data = await resp.json(); + setTermekek(data); + } catch (err){ + console.log("Error", err); + } + }; + + getData(); + + }, []); + + if(termekek.length === 0){ + return ( + <> + Adatok betoltése + + ) + } else { + console.log("termekek: ", termekek); + termekek.map((element) => { + return ( + + ) + }); + } +} \ No newline at end of file diff --git a/25_03_11/frontend_vizsgafeladat/frontend/src/components/UjTermek.jsx b/25_03_11/frontend_vizsgafeladat/frontend/src/components/UjTermek.jsx new file mode 100644 index 00000000..faa96929 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/frontend/src/components/UjTermek.jsx @@ -0,0 +1,7 @@ +export default function UjTermek(){ + return ( + <> + új termék felvétele + + ) +} \ No newline at end of file diff --git a/25_03_11/frontend_vizsgafeladat/frontend/src/index.css b/25_03_11/frontend_vizsgafeladat/frontend/src/index.css new file mode 100644 index 00000000..bd6213e1 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/frontend/src/index.css @@ -0,0 +1,3 @@ +@tailwind base; +@tailwind components; +@tailwind utilities; \ No newline at end of file diff --git a/25_03_11/frontend_vizsgafeladat/frontend/src/main.jsx b/25_03_11/frontend_vizsgafeladat/frontend/src/main.jsx new file mode 100644 index 00000000..46c74f0e --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/frontend/src/main.jsx @@ -0,0 +1,11 @@ +import React from 'react' +import ReactDOM from 'react-dom/client' +import App from './App.jsx' +import './index.css' + +ReactDOM.createRoot(document.getElementById('root')).render( + <> + + + , +) diff --git a/25_03_11/frontend_vizsgafeladat/frontend/src/sablonok/form_sablon.html b/25_03_11/frontend_vizsgafeladat/frontend/src/sablonok/form_sablon.html new file mode 100644 index 00000000..aac2931d --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/frontend/src/sablonok/form_sablon.html @@ -0,0 +1,43 @@ +
+
+ Workflow +

+ Text +

+ +
+ +
+
+
+
+ +
+ +
+
+ + +
+ +
+ + +
+
+ +
+ + + +
+ +
+ +
+
+
\ No newline at end of file diff --git a/25_03_11/frontend_vizsgafeladat/frontend/src/sablonok/header.html b/25_03_11/frontend_vizsgafeladat/frontend/src/sablonok/header.html new file mode 100644 index 00000000..3920a595 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/frontend/src/sablonok/header.html @@ -0,0 +1 @@ +

Header

\ No newline at end of file diff --git a/25_03_11/frontend_vizsgafeladat/frontend/src/sablonok/main.html b/25_03_11/frontend_vizsgafeladat/frontend/src/sablonok/main.html new file mode 100644 index 00000000..aaefbb9c --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/frontend/src/sablonok/main.html @@ -0,0 +1,38 @@ +
+
+
+ +
+
+
+
+

+ text +

text +

+

+

+ text +

+
+ +
+
+
+ +
+
+
\ No newline at end of file diff --git a/25_03_11/frontend_vizsgafeladat/frontend/src/sablonok/menu.html b/25_03_11/frontend_vizsgafeladat/frontend/src/sablonok/menu.html new file mode 100644 index 00000000..e0b75679 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/frontend/src/sablonok/menu.html @@ -0,0 +1,23 @@ + \ No newline at end of file diff --git a/25_03_11/frontend_vizsgafeladat/frontend/src/sablonok/termek.html b/25_03_11/frontend_vizsgafeladat/frontend/src/sablonok/termek.html new file mode 100644 index 00000000..fd376bf8 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/frontend/src/sablonok/termek.html @@ -0,0 +1,24 @@ +
+
+
+ +
+
+
+ text +
+

+ text +

+

+ text +

+

+ text +

+
+ +
+
\ No newline at end of file diff --git a/25_03_11/frontend_vizsgafeladat/frontend/tailwind.config.js b/25_03_11/frontend_vizsgafeladat/frontend/tailwind.config.js new file mode 100644 index 00000000..fecc15f7 --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/frontend/tailwind.config.js @@ -0,0 +1,12 @@ +/** @type {import('tailwindcss').Config} */ +export default { + content: [ + "./index.html", + "./src/**/*.{js,ts,jsx,tsx}", + ], + theme: { + extend: {}, + }, + plugins: [require('daisyui')], +} + diff --git a/25_03_11/frontend_vizsgafeladat/frontend/vite.config.js b/25_03_11/frontend_vizsgafeladat/frontend/vite.config.js new file mode 100644 index 00000000..5a33944a --- /dev/null +++ b/25_03_11/frontend_vizsgafeladat/frontend/vite.config.js @@ -0,0 +1,7 @@ +import { defineConfig } from 'vite' +import react from '@vitejs/plugin-react' + +// https://vitejs.dev/config/ +export default defineConfig({ + plugins: [react()], +}) diff --git a/25_03_11/frontend_vizsgafeladat/frontend_feladat.pdf b/25_03_11/frontend_vizsgafeladat/frontend_feladat.pdf new file mode 100644 index 00000000..567a82be Binary files /dev/null and b/25_03_11/frontend_vizsgafeladat/frontend_feladat.pdf differ diff --git a/25_03_11/frontend_vizsgafeladat/mintak/adattablak.png b/25_03_11/frontend_vizsgafeladat/mintak/adattablak.png new file mode 100644 index 00000000..f12c51b5 Binary files /dev/null and b/25_03_11/frontend_vizsgafeladat/mintak/adattablak.png differ diff --git a/25_03_11/frontend_vizsgafeladat/mintak/fooldal_minta.png b/25_03_11/frontend_vizsgafeladat/mintak/fooldal_minta.png new file mode 100644 index 00000000..95438832 Binary files /dev/null and b/25_03_11/frontend_vizsgafeladat/mintak/fooldal_minta.png differ diff --git a/25_03_11/frontend_vizsgafeladat/mintak/termekek_minta.png b/25_03_11/frontend_vizsgafeladat/mintak/termekek_minta.png new file mode 100644 index 00000000..85e19439 Binary files /dev/null and b/25_03_11/frontend_vizsgafeladat/mintak/termekek_minta.png differ diff --git a/25_03_11/frontend_vizsgafeladat/mintak/ujtermek_minta.png b/25_03_11/frontend_vizsgafeladat/mintak/ujtermek_minta.png new file mode 100644 index 00000000..fffc231c Binary files /dev/null and b/25_03_11/frontend_vizsgafeladat/mintak/ujtermek_minta.png differ